![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| First Aid Kit Receipt.jpeg | 2025-05-19 11:06 | 119K | |
| Blue and Yellow Recycling Bins.jpg | 2025-05-19 11:06 | 152K | |
| Roof support structure - Scaffolding:Ridgepole:Screws - Recycling Center.jpg | 2025-05-19 11:06 | 2.6M | |
| Recycling Bin Labels 2.jpeg | 2025-05-19 11:06 | 124K | |
| Scale 50kg for recycling center.jpg | 2025-05-19 11:06 | 207K | |
| Anti-corrosives and welding for roof.jpg | 2025-05-19 11:06 | 2.5M | |
| Gray Recycling Bins.jpg | 2025-05-19 11:06 | 137K | |
| Recycling Bin Labels 1.jpg | 2025-05-19 11:06 | 2.3M | |
| Local Govt Donated Roofing (see %22Zinc OND #28%22).pdf | 2025-05-19 11:06 | 61K | |
| Grating for Recycling Center:Protect recycling from rodents and frogs.jpg | 2025-05-19 11:06 | 137K | |
| Roof Support 2 - more scaffolding.jpg | 2025-05-19 11:06 | 2.2M | |
| Specialized Labor for New Roof:Recycling Center.jpg | 2025-05-19 11:06 | 2.7M | |
