![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | budget_files/ | 2025-05-16 14:25 | - | |
![[DIR]](/icons/folder.gif) | receipts/ | 2025-08-05 03:40 | - | |
![[DIR]](/icons/folder.gif) | survey/ | 2025-07-23 22:07 | - | |
![[VID]](/icons/movie.gif) | 1308_IMG_1381.mp4 | 2025-05-19 11:05 | 0 | |
![[IMG]](/icons/image2.gif) | 7103_Rise Family Event.JPG | 2025-05-19 11:04 | 0 | |
![[IMG]](/icons/image2.gif) | 3025_image.png | 2025-05-19 11:03 | 915 | |
![[IMG]](/icons/image2.gif) | 6273_image.png | 2025-05-19 11:04 | 1.0K | |
![[IMG]](/icons/image2.gif) | 6665_image.png | 2025-05-19 11:05 | 4.3K | |
![[IMG]](/icons/image2.gif) | 2255_image.png | 2025-05-19 11:04 | 4.6K | |
![[VID]](/icons/movie.gif) | 2342_IMG_0348.MOV | 2025-05-19 11:03 | 7.8K | |
![[VID]](/icons/movie.gif) | 2342_IMG_0354.MOV | 2025-05-19 11:05 | 8.4K | |
![[ ]](/icons/unknown.gif) | 1277_Facilitators creed.docx | 2025-05-19 11:05 | 11K | |
![[ ]](/icons/unknown.gif) | 859_Charla - Energia Renovable.doc | 2025-05-19 11:04 | 12K | |
![[IMG]](/icons/image2.gif) | 3657_Salesman asks, Is the boss at home. Mafalda replies. In this family, we are a cooperative.jpg | 2025-05-19 11:05 | 12K | |
![[ ]](/icons/unknown.gif) | 859_Contrato de Acuerdo - Ahorros.docx | 2025-05-19 11:03 | 12K | |
![[ ]](/icons/unknown.gif) | 1333_Solarpanel_tests_english_MONICA.docx | 2025-05-19 11:04 | 12K | |
![[ ]](/icons/unknown.gif) | 5401_KAYEMBE project accounts.docx | 2025-05-19 11:06 | 12K | |
![[ ]](/icons/unknown.gif) | 1333_Solarpanel_tests_english_ELVA.docx | 2025-05-19 11:04 | 12K | |
![[ ]](/icons/unknown.gif) | 2850_Soft skills plan_Blacksoap training.docx | 2025-05-19 11:05 | 12K | |
![[ ]](/icons/unknown.gif) | 1333_Solarpanel_tests_english_YARITZEL.docx | 2025-05-19 11:05 | 12K | |
![[ ]](/icons/unknown.gif) | 859_Charla - Agua.doc | 2025-05-19 11:05 | 13K | |
![[ ]](/icons/unknown.gif) | 6204_KADILAP Invitation Letter.docx | 2025-05-19 11:05 | 13K | |
![[ ]](/icons/unknown.gif) | 2837_Teens Can Code 2019 google drive links.docx | 2025-05-19 11:04 | 13K | |
![[ ]](/icons/unknown.gif) | 859_Estudio de Uso de Panel Solar.docx | 2025-05-19 11:05 | 13K | |
![[ ]](/icons/unknown.gif) | 2235_4_Charity Agu Reference Letter.docx | 2025-05-19 11:03 | 13K | |
![[ ]](/icons/unknown.gif) | 3156_Classroom Library Reading Log- Upper Primary.docx | 2025-05-19 11:03 | 13K | |
![[ ]](/icons/unknown.gif) | 2589_Summary of MSOs.docx | 2025-05-19 11:05 | 13K | |
![[ ]](/icons/layout.gif) | 6104_Malidade water pro.pdf | 2025-05-19 11:03 | 13K | |
![[ ]](/icons/unknown.gif) | 7000_Reunión Ordinaria 7-7-2024.docx | 2025-05-19 11:03 | 14K | |
![[IMG]](/icons/image2.gif) | 6713_Chibanja Primary 2.jpg | 2025-05-19 11:05 | 15K | |
![[IMG]](/icons/image2.gif) | 2507_women pionner summit 6.jpg | 2025-05-19 11:05 | 15K | |
![[ ]](/icons/unknown.gif) | 7000_FINCA ORGÁNICA SAN ANTONIO 2024 BUDGET.docx | 2025-05-19 11:06 | 15K | |
![[IMG]](/icons/image2.gif) | 3293_image.png | 2025-05-19 11:04 | 15K | |
![[ ]](/icons/unknown.gif) | 7000_Ecuador Boyd Itinerary-2 (1).docx | 2025-05-19 11:05 | 15K | |
![[IMG]](/icons/image2.gif) | 6713_Chibanja Primary 1.jpg | 2025-05-19 11:05 | 15K | |
![[ ]](/icons/unknown.gif) | 3262_Mercury project video transcription.docx | 2025-05-19 11:05 | 15K | |
![[ ]](/icons/unknown.gif) | 3971_Testimonio final Maria Alejandra.docx | 2025-05-19 11:05 | 15K | |
![[IMG]](/icons/image2.gif) | 3657_Mom, what would you like to be, if you lived...if you were living.jpg | 2025-05-19 11:05 | 16K | |
![[ ]](/icons/unknown.gif) | 2933_Tiwatukule Youth Center Daily Activities.docx | 2025-05-19 11:06 | 16K | |
![[IMG]](/icons/image2.gif) | 4549_WC_EMAILPICTOGRAM.png | 2025-05-19 11:07 | 16K | |
![[IMG]](/icons/image2.gif) | 5814_image.png | 2025-05-19 11:06 | 17K | |
![[IMG]](/icons/image2.gif) | 3657_Mafalda yells...without equality between men and women there is not democracy. Stop violence, discrimination, and inequality.jpg | 2025-05-19 11:05 | 18K | |
![[IMG]](/icons/image2.gif) | 3657_Of course, the bad thing is that women instead of playing a role [papel], have been a rag [trapo] in the history of humanity.jpg | 2025-05-19 11:03 | 18K | |
![[ ]](/icons/layout.gif) | 851_Visualising WC Projects - Phase 1.pdf | 2025-05-19 11:03 | 18K | |
![[IMG]](/icons/image2.gif) | 851_Screen Shot 2017-03-31 at 5.58.26 PM.png | 2025-05-19 11:04 | 18K | |
![[IMG]](/icons/image2.gif) | 4623_image.png | 2025-05-19 11:05 | 18K | |
![[ ]](/icons/unknown.gif) | 3156_Classroom Library Reading Log- Lower Primary.docx | 2025-05-19 11:03 | 18K | |
![[IMG]](/icons/image2.gif) | 2533_IMG_8704.jpg | 2025-05-19 11:04 | 19K | |
![[ ]](/icons/unknown.gif) | 7000_Ecuador Nick&Amanda Itinerary (1).docx | 2025-05-19 11:03 | 19K | |
![[ ]](/icons/unknown.gif) | 820_Pre Camp WP Questionnaire.docx | 2025-05-19 11:03 | 19K | |
![[ ]](/icons/unknown.gif) | 2989_Field Reviews – Community led co-creation process - project rethinking.docx | 2025-05-19 11:03 | 19K | |
![[ ]](/icons/unknown.gif) | 820_Pre Camp Girls Questionnaire.docx | 2025-05-19 11:03 | 19K | |
![[ ]](/icons/unknown.gif) | 7000_Indicators to measure improvement in projects 2024 funding.docx | 2025-05-19 11:04 | 20K | |
![[ ]](/icons/unknown.gif) | 3156_Primary Teacher Training- Classroom Libraries.docx | 2025-05-19 11:04 | 20K | |
![[IMG]](/icons/image2.gif) | 3262_image.png | 2025-05-19 11:04 | 20K | |
![[ ]](/icons/unknown.gif) | 1094_MEMORANDUM OF AGREEMENT.docx | 2025-05-19 11:05 | 20K | |
![[IMG]](/icons/image2.gif) | 3620_image.png | 2025-05-19 11:03 | 20K | |
![[ ]](/icons/unknown.gif) | 820_Post Camp Girls Questionnaire.docx | 2025-05-19 11:05 | 22K | |
![[ ]](/icons/unknown.gif) | 6204_KADILAP TRAINING SCHEDULE.docx | 2025-05-19 11:06 | 22K | |
![[ ]](/icons/unknown.gif) | 820_Post Camp WP Questionnaire.docx | 2025-05-19 11:05 | 22K | |
![[ ]](/icons/unknown.gif) | 1094_Charfauros-Offline Budget World Connect.xlsx | 2025-05-19 11:03 | 22K | |
![[IMG]](/icons/image2.gif) | 3785_IMG-20230512-WA0008.jpg | 2025-05-19 11:03 | 22K | |
![[IMG]](/icons/image2.gif) | 2281_Emergent leader #2.jpg | 2025-05-19 11:05 | 23K | |
![[IMG]](/icons/image2.gif) | 6104_FB_IMG_1688978946679.jpg | 2025-05-19 11:04 | 23K | |
![[ ]](/icons/unknown.gif) | 1445_Mobile-CLC-Workshop-Proposal (2).docx | 2025-05-19 11:05 | 23K | |
![[ ]](/icons/unknown.gif) | 2399_Plan de Negocio.docx | 2025-05-19 11:03 | 23K | |
![[IMG]](/icons/image2.gif) | 4549_image.png | 2025-05-19 11:03 | 23K | |
![[IMG]](/icons/image2.gif) | 5660_image.png | 2025-05-19 11:07 | 24K | |
![[ ]](/icons/unknown.gif) | 6204_EndLine Assesment for KADILAP.docx | 2025-05-19 11:03 | 25K | |
![[ ]](/icons/layout.gif) | 7000_Devolucion Mesas.pdf | 2025-05-19 11:07 | 25K | |
![[IMG]](/icons/image2.gif) | 1674_image.png | 2025-05-19 11:06 | 25K | |
![[ ]](/icons/unknown.gif) | 6204_Baseline Assesment for KADILAP.docx | 2025-05-19 11:03 | 26K | |
![[ ]](/icons/layout.gif) | 7000_Factura mesas y carpas.pdf | 2025-05-19 11:05 | 26K | |
![[IMG]](/icons/image2.gif) | 4698_IMG-20200725-WA0089.jpg | 2025-05-19 11:04 | 27K | |
![[IMG]](/icons/image2.gif) | 2993_IMG-20190802-WA0062.jpg | 2025-05-19 11:07 | 27K | |
![[ ]](/icons/unknown.gif) | 2124_Pesajes proyecto ambiental - Salitre.docx | 2025-05-19 11:05 | 27K | |
![[IMG]](/icons/image2.gif) | 3049_IMG-20200123-WA0002.jpg | 2025-05-19 11:04 | 28K | |
![[ ]](/icons/layout.gif) | 7000_Factura Mashpi 17-08-2024.pdf | 2025-05-19 11:07 | 29K | |
![[ ]](/icons/layout.gif) | 3774_incubation%20period(2)(2).pdf | 2025-05-19 11:03 | 29K | |
![[IMG]](/icons/image2.gif) | 5576_image.png | 2025-05-19 11:05 | 30K | |
![[IMG]](/icons/image2.gif) | 6713_Rose Honde.jpg | 2025-05-19 11:04 | 30K | |
![[IMG]](/icons/image2.gif) | 2507_women at SG 1.jpg | 2025-05-19 11:05 | 30K | |
![[IMG]](/icons/image2.gif) | 3657_Why is important the empowernment of women for development ...working material sent by whatsapp.png | 2025-05-19 11:05 | 31K | |
![[ ]](/icons/unknown.gif) | 2850_Process of making black soap_Durian.doc | 2025-05-19 11:03 | 31K | |
![[ ]](/icons/compressed.gif) | Final Report_22-058 (ChimphoyoBanda, Eunice) - Budget Files.zip | 2025-05-19 11:05 | 32K | |
![[IMG]](/icons/image2.gif) | 4688_IMG-20200726-WA0100.jpg | 2025-05-19 11:03 | 32K | |
![[IMG]](/icons/image2.gif) | 2382_Barbara Mejias.jpg | 2025-05-19 11:05 | 32K | |
![[ ]](/icons/layout.gif) | 3131_01-Grant Application (, ).pdf | 2025-05-19 11:04 | 33K | |
![[ ]](/icons/unknown.gif) | 851_2017 - World Connect - Offline Grant Application.docx | 2025-05-19 11:05 | 33K | |
![[ ]](/icons/unknown.gif) | 2589_Summary Report BD Retraining.docx | 2025-05-19 11:04 | 33K | |
![[IMG]](/icons/image2.gif) | 3731_IMG-20200214-WA0042.jpg | 2025-05-19 11:03 | 33K | |
![[ ]](/icons/unknown.gif) | 1418_Teacher's Guide.docx | 2025-05-19 11:05 | 33K | |
![[IMG]](/icons/image2.gif) | 1248_5.jpg | 2025-05-19 11:04 | 33K | |
![[IMG]](/icons/image2.gif) | 3657_Doctor Suero's Testimony. Los Robalos, Samana.png | 2025-05-19 11:05 | 33K | |
![[IMG]](/icons/image2.gif) | 2270_image.png | 2025-05-19 11:04 | 34K | |
![[IMG]](/icons/image2.gif) | 2507_SG emerging leader Sherlyne.jpg | 2025-05-19 11:05 | 34K | |
![[IMG]](/icons/image2.gif) | 2389_1522172823611.jpg | 2025-05-19 11:05 | 34K | |
![[IMG]](/icons/image2.gif) | 4514_a22fc812-40ed-4589-b0ec-d0ddd0c0ef87.JPG | 2025-05-19 11:05 | 34K | |
![[IMG]](/icons/image2.gif) | 2628_image.png | 2025-05-19 11:05 | 34K | |
![[IMG]](/icons/image2.gif) | 4688_IMG-20200726-WA0099.jpg | 2025-05-19 11:07 | 34K | |
![[IMG]](/icons/image2.gif) | 2389_1523642382332.jpg | 2025-05-19 11:03 | 34K | |
![[IMG]](/icons/image2.gif) | 7017_image.png | 2025-06-06 17:50 | 34K | |
![[IMG]](/icons/image2.gif) | 3657_Part II. Guillermina's Testimony..png | 2025-05-19 11:03 | 35K | |
![[IMG]](/icons/image2.gif) | 2382_Barbara Mejias2.jpg | 2025-05-19 11:05 | 35K | |
![[IMG]](/icons/image2.gif) | 4514_07e0bf46-8599-4621-97b8-0d8b784dd780.JPG | 2025-05-19 11:05 | 35K | |
![[IMG]](/icons/image2.gif) | 1692_ASXI7807.jpg | 2025-05-19 11:04 | 35K | |
![[IMG]](/icons/image2.gif) | 3025_New folding tables.jpg | 2025-05-19 11:04 | 36K | |
![[IMG]](/icons/image2.gif) | 3640_IMG-20221102-WA0010.jpg | 2025-05-19 11:03 | 36K | |
![[ ]](/icons/unknown.gif) | 2589_Some Results of Bancal Bay Community Interviews.docx | 2025-05-19 11:03 | 36K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231025-WA0295.jpg | 2025-05-19 11:03 | 37K | |
![[IMG]](/icons/image2.gif) | 2389_1523647463879.jpg | 2025-05-19 11:06 | 37K | |
![[IMG]](/icons/image2.gif) | 3379_eglen cohort 3 Employed at Huruma J.Hotel.jpg | 2025-05-19 11:03 | 38K | |
![[IMG]](/icons/image2.gif) | 2507_Woman at SG 11.jpg | 2025-05-19 11:06 | 38K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0405.jpg | 2025-05-19 11:05 | 38K | |
![[ ]](/icons/unknown.gif) | 1060_Links to Videos.docx | 2025-05-19 11:04 | 38K | |
![[IMG]](/icons/image2.gif) | 4698_IMG-20200725-WA0088.jpg | 2025-05-19 11:03 | 39K | |
![[IMG]](/icons/image2.gif) | 3025_f69700c3-66f8-44ef-b6a5-0f249465489f.jpg | 2025-05-19 11:03 | 39K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0414.jpg | 2025-05-19 11:05 | 39K | |
![[ ]](/icons/layout.gif) | 7102_Spanish Version_ CNS _ Kitchen Equipment List for Eating Well.pdf | 2025-05-19 11:05 | 39K | |
![[IMG]](/icons/image2.gif) | 3025_Students on new folding tables.jpg | 2025-05-19 11:05 | 39K | |
![[IMG]](/icons/image2.gif) | 2507_women pitching at SG.jpg | 2025-05-19 11:06 | 39K | |
![[IMG]](/icons/image2.gif) | 4514_2f7b2dd4-cbef-445c-99e9-02d8847fd400.JPG | 2025-05-19 11:06 | 40K | |
![[IMG]](/icons/image2.gif) | 4421_IMG-20221212-WA0024.jpg | 2025-05-19 11:06 | 40K | |
![[IMG]](/icons/image2.gif) | 6713_Hand over 7.jpg | 2025-05-19 11:05 | 40K | |
![[IMG]](/icons/image2.gif) | 4666_mpamba incinerator 2.jpg | 2025-05-19 11:05 | 40K | |
![[IMG]](/icons/image2.gif) | 2956_IMG-20190724-WA0006.jpg | 2025-05-19 11:03 | 40K | |
![[IMG]](/icons/image2.gif) | 5792_IMG-20221204-WA0018.jpg | 2025-05-19 11:03 | 41K | |
![[ ]](/icons/layout.gif) | 1658_Testimonies en espanol.pdf | 2025-05-19 11:05 | 41K | |
![[IMG]](/icons/image2.gif) | 2389_1523647468853.jpg | 2025-05-19 11:07 | 41K | |
![[IMG]](/icons/image2.gif) | 6273_Maniragena pig after 6 months.jpg | 2025-05-19 11:05 | 41K | |
![[IMG]](/icons/image2.gif) | 4545_IMG-20190102-WA0022.jpg | 2025-05-19 11:04 | 41K | |
![[IMG]](/icons/image2.gif) | 2507_Woman at SG 9.jpg | 2025-05-19 11:03 | 41K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0135.jpg | 2025-05-19 11:04 | 41K | |
![[IMG]](/icons/image2.gif) | 3165_44562077_2691932437698819_4414142888888238080_n.jpg | 2025-05-19 11:05 | 42K | |
![[IMG]](/icons/image2.gif) | 5792_IMG-20221204-WA0021.jpg | 2025-05-19 11:03 | 43K | |
![[IMG]](/icons/image2.gif) | 3340_IMG-20190715-WA0024.jpg | 2025-05-19 11:04 | 43K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231022-WA0003.jpg | 2025-05-19 11:03 | 43K | |
![[IMG]](/icons/image2.gif) | 3113_IMG-20190426-WA0096.jpg | 2025-05-19 11:04 | 43K | |
![[IMG]](/icons/image2.gif) | 6155_a completed house.jpg | 2025-05-19 11:07 | 43K | |
![[IMG]](/icons/image2.gif) | 6154_IMG-20230520-WA0046.jpg | 2025-05-19 11:05 | 43K | |
![[IMG]](/icons/image2.gif) | 2048_IMG_0886.JPG | 2025-05-19 11:04 | 43K | |
![[IMG]](/icons/image2.gif) | 3640_IMG-20221102-WA0013.jpg | 2025-05-19 11:03 | 43K | |
![[IMG]](/icons/image2.gif) | 5775_10.jpg | 2025-05-19 11:03 | 44K | |
![[IMG]](/icons/image2.gif) | 1248_4.jpg | 2025-05-19 11:06 | 44K | |
![[IMG]](/icons/image2.gif) | 3165_52880596_170007273982355_912904292426317824_n.jpg | 2025-05-19 11:05 | 44K | |
![[IMG]](/icons/image2.gif) | 2311_Women.jpg | 2025-05-19 11:07 | 44K | |
![[IMG]](/icons/image2.gif) | 6113_IMG-20241211-WA0031.jpg | 2025-05-19 11:05 | 44K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-9.jpg | 2025-05-19 11:04 | 44K | |
![[IMG]](/icons/image2.gif) | 7002_abana.jpg | 2025-05-19 11:03 | 44K | |
![[IMG]](/icons/image2.gif) | 3165_53315499_170007483982334_4907928741969133568_n.jpg | 2025-05-19 11:03 | 45K | |
![[IMG]](/icons/image2.gif) | 2836_IMG-20181024-WA0015.jpg | 2025-05-19 11:04 | 45K | |
![[IMG]](/icons/image2.gif) | 6113_IMG-20241211-WA0023.jpg | 2025-05-19 11:04 | 46K | |
![[IMG]](/icons/image2.gif) | 2507_woman pitching at SG 4.jpg | 2025-05-19 11:03 | 46K | |
![[IMG]](/icons/image2.gif) | 3025_ff7074c5-8311-40c5-8662-0cebfe17767b.jpg | 2025-05-19 11:03 | 46K | |
![[IMG]](/icons/image2.gif) | 5775_7.jpg | 2025-05-19 11:03 | 47K | |
![[ ]](/icons/unknown.gif) | 1421_amanda k 1a.PDF | 2025-05-19 11:05 | 47K | |
![[IMG]](/icons/image2.gif) | 3772_Brandson Langson.jpg | 2025-05-19 11:03 | 47K | |
![[IMG]](/icons/image2.gif) | 745_Healing garden progress.jpg | 2025-05-19 11:06 | 47K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231019-WA0315.jpg | 2025-05-19 11:03 | 47K | |
![[IMG]](/icons/image2.gif) | 7002_ishuri.jpg | 2025-05-19 11:04 | 47K | |
![[IMG]](/icons/image2.gif) | 1448_15493306_911528477777_1388425141643460539_o.jpg | 2025-05-19 11:03 | 47K | |
![[IMG]](/icons/image2.gif) | 3113_IMG-20190815-WA0016.jpg | 2025-05-19 11:05 | 47K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231022-WA0006.jpg | 2025-05-19 11:06 | 47K | |
![[IMG]](/icons/image2.gif) | 6713_Hand over 10.jpg | 2025-05-19 11:03 | 47K | |
![[ ]](/icons/unknown.gif) | 1421_amanda k2.PDF | 2025-05-19 11:05 | 47K | |
![[IMG]](/icons/image2.gif) | 2976_IMG-20190726-WA0011.jpg | 2025-05-19 11:03 | 47K | |
![[IMG]](/icons/image2.gif) | 3025_2 new folding tables for the RRC.jpg | 2025-05-19 11:04 | 47K | |
![[IMG]](/icons/image2.gif) | 2389_1523117534161.jpg | 2025-05-19 11:05 | 48K | |
![[IMG]](/icons/image2.gif) | 4778_girls and young women receiving healthy mimi-kits.jpg | 2025-05-19 11:05 | 48K | |
![[IMG]](/icons/image2.gif) | 2507_Woman at SG 4.jpg | 2025-05-19 11:05 | 48K | |
![[IMG]](/icons/image2.gif) | 5443_FB_IMG_1701118788400.jpg | 2025-05-19 11:06 | 48K | |
![[IMG]](/icons/image2.gif) | 767_18485634_829298992680_2698904919265533862_n.jpg | 2025-05-19 11:05 | 48K | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting literacy project self portraits.jpg | 2025-05-19 11:05 | 48K | |
![[IMG]](/icons/image2.gif) | 3113_IMG-20190815-WA0015.jpg | 2025-05-19 11:04 | 48K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0134.jpg | 2025-05-19 11:06 | 48K | |
![[IMG]](/icons/image2.gif) | 3941_Bead work done.jpg | 2025-05-19 11:06 | 48K | |
![[IMG]](/icons/image2.gif) | 2507_Woman at SG 6.jpg | 2025-05-19 11:03 | 48K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231111-WA0155.jpg | 2025-05-19 11:05 | 48K | |
![[IMG]](/icons/image2.gif) | 5443_FB_IMG_1701118816328.jpg | 2025-05-19 11:03 | 48K | |
![[IMG]](/icons/image2.gif) | 6113_IMG-20241211-WA0032.jpg | 2025-05-19 11:07 | 48K | |
![[IMG]](/icons/image2.gif) | 4688_IMG-20200726-WA0098.jpg | 2025-05-19 11:06 | 48K | |
![[IMG]](/icons/image2.gif) | 3730_a8968e81-e069-4376-b32e-bada75ff78ad.jpg | 2025-05-19 11:05 | 49K | |
![[IMG]](/icons/image2.gif) | 3640_IMG-20221102-WA0021.jpg | 2025-05-19 11:03 | 49K | |
![[IMG]](/icons/image2.gif) | 3772_Martha Bello a beneficiary at Pwemphwe community.jpg | 2025-05-19 11:05 | 49K | |
![[IMG]](/icons/image2.gif) | 4688_IMG-20200726-WA0101.jpg | 2025-05-19 11:04 | 49K | |
![[IMG]](/icons/image2.gif) | 6713_Hand over 6.jpg | 2025-05-19 11:06 | 49K | |
![[IMG]](/icons/image2.gif) | 6713_Hand over 8.jpg | 2025-05-19 11:04 | 49K | |
![[IMG]](/icons/image2.gif) | 4698_IMG-20200725-WA0083.jpg | 2025-05-19 11:05 | 49K | |
![[IMG]](/icons/image2.gif) | 6713_Hand over 11.jpg | 2025-05-19 11:07 | 49K | |
![[IMG]](/icons/image2.gif) | 5848_IMG-20221230-WA0038.jpg | 2025-05-19 11:06 | 50K | |
![[IMG]](/icons/image2.gif) | 5848_IMG-20221230-WA0036.jpg | 2025-05-19 11:04 | 50K | |
![[IMG]](/icons/image2.gif) | 6155_a completed house2.jpg | 2025-05-19 11:04 | 50K | |
![[IMG]](/icons/image2.gif) | 4666_mpamba incinerator 1.jpg | 2025-05-19 11:03 | 50K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0550.jpg | 2025-05-19 11:05 | 50K | |
![[IMG]](/icons/image2.gif) | 2810_Appreciation.jpg | 2025-05-19 11:04 | 50K | |
![[IMG]](/icons/image2.gif) | 3730_149c9d76-988d-4b5a-8080-2de1c73945f8.jpg | 2025-05-19 11:04 | 51K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0531.jpg | 2025-05-19 11:05 | 51K | |
![[IMG]](/icons/image2.gif) | 2854_IMG-20181005-WA0024.jpg | 2025-05-19 11:05 | 51K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231025-WA0299.jpg | 2025-05-19 11:05 | 51K | |
![[IMG]](/icons/image2.gif) | 3379_happy moment graduation.jpg | 2025-05-19 11:07 | 51K | |
![[IMG]](/icons/image2.gif) | 5443_IMG-20231120-WA0017 (1).jpg | 2025-05-19 11:03 | 51K | |
![[IMG]](/icons/image2.gif) | 5443_IMG-20231120-WA0017.jpg | 2025-05-19 11:04 | 51K | |
![[IMG]](/icons/image2.gif) | 3165_53145594_170007377315678_8424301076605304832_n.jpg | 2025-05-19 11:06 | 51K | |
![[IMG]](/icons/image2.gif) | 6155_a completed house111.jpg | 2025-05-19 11:05 | 51K | |
![[IMG]](/icons/image2.gif) | 3379_classroom learning.jpg | 2025-05-19 11:07 | 51K | |
![[IMG]](/icons/image2.gif) | 3025_Students on thee new folding tables.jpg | 2025-05-19 11:05 | 51K | |
![[IMG]](/icons/image2.gif) | 3379_baking class.jpg | 2025-05-19 11:03 | 51K | |
![[IMG]](/icons/image2.gif) | 2507_SG emerging leader.jpg | 2025-05-19 11:05 | 51K | |
![[IMG]](/icons/image2.gif) | 5443_FB_IMG_1701118804717.jpg | 2025-05-19 11:04 | 52K | |
![[IMG]](/icons/image2.gif) | 4358_Inside the shelter.jpg | 2025-05-19 11:04 | 52K | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (14).jpg | 2025-05-19 11:05 | 52K | |
![[ ]](/icons/compressed.gif) | Final Report_19-260 (Bwalya, Davies) - Budget Files.zip | 2025-05-19 11:03 | 52K | |
![[IMG]](/icons/image2.gif) | 5792_IMG-20221204-WA0035.jpg | 2025-05-19 11:07 | 52K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0402.jpg | 2025-05-19 11:03 | 52K | |
![[IMG]](/icons/image2.gif) | 6273_Valerie pig after 6 months.jpg | 2025-05-19 11:06 | 52K | |
![[IMG]](/icons/image2.gif) | 5775_4.jpg | 2025-05-19 11:05 | 53K | |
![[IMG]](/icons/image2.gif) | 2810_first baby and the midwife.jpg | 2025-05-19 11:03 | 53K | |
![[IMG]](/icons/image2.gif) | 3379_educational exchange 1.jpg | 2025-05-19 11:03 | 53K | |
![[IMG]](/icons/image2.gif) | 3640_IMG-20221104-WA0020.jpg | 2025-05-19 11:04 | 53K | |
![[IMG]](/icons/image2.gif) | 4358_The beds.jpg | 2025-05-19 11:07 | 53K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0126.jpg | 2025-05-19 11:04 | 53K | |
![[IMG]](/icons/image2.gif) | 6273_Musabyeyezu pig after 6 months.jpg | 2025-05-19 11:03 | 53K | |
![[IMG]](/icons/image2.gif) | 3772_Bizweck Lameck-Project Leader.jpg | 2025-05-19 11:03 | 53K | |
![[IMG]](/icons/image2.gif) | 2507_women at SG.jpg | 2025-05-19 11:05 | 53K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-15.jpg | 2025-05-19 11:04 | 53K | |
![[IMG]](/icons/image2.gif) | 5443_IMG-20231120-WA0016.jpg | 2025-05-19 11:05 | 53K | |
![[IMG]](/icons/image2.gif) | 6113_IMG-20241211-WA0029.jpg | 2025-05-19 11:03 | 53K | |
![[IMG]](/icons/image2.gif) | 1692_DUBL4859.jpg | 2025-05-19 11:05 | 53K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0412.jpg | 2025-05-19 11:04 | 54K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0133.jpg | 2025-05-19 11:05 | 54K | |
![[IMG]](/icons/image2.gif) | 6713_Hand over 5.jpg | 2025-05-19 11:07 | 54K | |
![[IMG]](/icons/image2.gif) | 745_healing garden work.jpg | 2025-05-19 11:04 | 54K | |
![[IMG]](/icons/image2.gif) | 3515_CONNECT PICS 2.jpg | 2025-05-19 11:06 | 55K | |
![[IMG]](/icons/image2.gif) | 6113_IMG-20241211-WA0030.jpg | 2025-05-19 11:04 | 55K | |
![[IMG]](/icons/image2.gif) | 2507_Woman at SG 5.jpg | 2025-05-19 11:05 | 55K | |
![[IMG]](/icons/image2.gif) | 2531_35518488_1845358768875549_4554447749482807296_o.jpg | 2025-05-19 11:03 | 55K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-8.jpg | 2025-05-19 11:03 | 55K | |
![[IMG]](/icons/image2.gif) | 2507_women pitching at SG 1.jpg | 2025-05-19 11:04 | 55K | |
![[ ]](/icons/unknown.gif) | 7000_English Application 2023 World Connect.docx | 2025-05-19 11:04 | 55K | |
![[IMG]](/icons/image2.gif) | 7097_Brujas Sponsorship Deck 2024.JPG | 2025-05-19 11:05 | 55K | |
![[IMG]](/icons/image2.gif) | 5848_IMG-20221206-WA0001.jpg | 2025-05-19 11:05 | 56K | |
![[IMG]](/icons/image2.gif) | 3640_IMG-20221102-WA0008.jpg | 2025-05-19 11:05 | 56K | |
![[IMG]](/icons/image2.gif) | 6113_IMG-20241211-WA0033.jpg | 2025-05-19 11:04 | 56K | |
![[IMG]](/icons/image2.gif) | 822_portal1.jpg | 2025-05-19 11:05 | 56K | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (4).jpg | 2025-05-19 11:06 | 56K | |
![[IMG]](/icons/image2.gif) | 2926_Workshop for teachers and volunteer mothers led by FamilyLab.jpg | 2025-05-19 11:05 | 56K | |
![[IMG]](/icons/image2.gif) | 2976_IMG-20190726-WA0015.jpg | 2025-05-19 11:05 | 56K | |
![[ ]](/icons/compressed.gif) | Final Report_19-016 (Niyonshuti, Belle Ange) - Budget Files.zip | 2025-05-19 11:03 | 56K | |
![[IMG]](/icons/image2.gif) | 3340_IMG-20190715-WA0022.jpg | 2025-05-19 11:05 | 56K | |
![[IMG]](/icons/image2.gif) | 5443_FB_IMG_1701118824600.jpg | 2025-05-19 11:03 | 56K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0130.jpg | 2025-05-19 11:03 | 56K | |
![[IMG]](/icons/image2.gif) | 615_Mosquito Elimination Campaign_Men.jpg | 2025-05-19 11:03 | 56K | |
![[IMG]](/icons/image2.gif) | 6113_IMG-20241211-WA0028.jpg | 2025-05-19 11:04 | 56K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0409.jpg | 2025-05-19 11:04 | 56K | |
![[IMG]](/icons/image2.gif) | 3025_3ca50fd1-ffa1-4b4a-bfc7-5543b64e3b40.jpg | 2025-05-19 11:03 | 57K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-26.jpg | 2025-05-19 11:06 | 57K | |
![[ ]](/icons/layout.gif) | 7102_Culinary Curriculum Development Worksheet.pdf | 2025-05-19 11:05 | 57K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0408.jpg | 2025-05-19 11:05 | 57K | |
![[IMG]](/icons/image2.gif) | 2507_Ten top entrepreneur of 2018.jpg | 2025-05-19 11:04 | 57K | |
![[IMG]](/icons/image2.gif) | 7002_class.jpg | 2025-05-19 11:07 | 57K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-6.jpg | 2025-05-19 11:05 | 57K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-22.jpg | 2025-05-19 11:03 | 57K | |
![[IMG]](/icons/image2.gif) | 2991_FB_IMG_1549002755846.jpg | 2025-05-19 11:04 | 57K | |
![[IMG]](/icons/image2.gif) | 2991_FB_IMG_1553254423895.jpg | 2025-05-19 11:04 | 58K | |
![[IMG]](/icons/image2.gif) | 6113_IMG-20241211-WA0025.jpg | 2025-05-19 11:04 | 58K | |
![[IMG]](/icons/image2.gif) | 5775_2.jpg | 2025-05-19 11:03 | 58K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0372.jpg | 2025-05-19 11:07 | 58K | |
![[IMG]](/icons/image2.gif) | 3774_Girls and parents to be sponsored by profits from chicken and eggs sale.jpg | 2025-05-19 11:05 | 58K | |
![[IMG]](/icons/image2.gif) | 2152_IMG-20170618-WA0001.jpg | 2025-05-19 11:04 | 58K | |
![[IMG]](/icons/image2.gif) | 6551_old roofing taken off.jpg | 2025-05-19 11:05 | 58K | |
![[IMG]](/icons/image2.gif) | 822_portal2.jpg | 2025-05-19 11:04 | 58K | |
![[IMG]](/icons/image2.gif) | 3340_IMG-20190715-WA0023.jpg | 2025-05-19 11:03 | 58K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-24.jpg | 2025-05-19 11:05 | 58K | |
![[IMG]](/icons/image2.gif) | 3657_It is important women have voice and vote in every sphere....png | 2025-05-19 11:03 | 58K | |
![[IMG]](/icons/image2.gif) | 2048_IMG_0889.JPG | 2025-05-19 11:04 | 58K | |
![[IMG]](/icons/image2.gif) | 3672_IMG-20200620-WA0003.jpg | 2025-05-19 11:07 | 59K | |
![[IMG]](/icons/image2.gif) | 2311_Brikects.JPG | 2025-05-19 11:04 | 59K | |
![[IMG]](/icons/image2.gif) | 3165_64867253_202567494059666_6179961114307067904_n.jpg | 2025-05-19 11:03 | 59K | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (3).jpg | 2025-05-19 11:05 | 59K | |
![[IMG]](/icons/image2.gif) | 2841_49656228_2247682755504588_5549757715401670656_n.jpg | 2025-05-19 11:04 | 59K | |
![[IMG]](/icons/image2.gif) | 2507_Woman at SG 12.jpg | 2025-05-19 11:03 | 59K | |
![[IMG]](/icons/image2.gif) | 5648_GuardUp 16.jpg | 2025-05-19 11:06 | 59K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0418.jpg | 2025-05-19 11:03 | 59K | |
![[IMG]](/icons/image2.gif) | 2533_55c8e330-d081-4e18-b732-00fd0a5f6db6.jpg | 2025-05-19 11:03 | 59K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240428-WA0015.jpg | 2025-05-19 11:05 | 59K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0346.jpg | 2025-05-19 11:05 | 59K | |
![[IMG]](/icons/image2.gif) | 6113_IMG-20241211-WA0026.jpg | 2025-05-19 11:04 | 59K | |
![[IMG]](/icons/image2.gif) | 1248_3.jpg | 2025-05-19 11:03 | 59K | |
![[IMG]](/icons/image2.gif) | 3672_IMG-20200620-WA0002.jpg | 2025-05-19 11:03 | 59K | |
![[IMG]](/icons/image2.gif) | 2507_women workshop 3.jpg | 2025-05-19 11:05 | 59K | |
![[IMG]](/icons/image2.gif) | 4778_receivign food packs.jpg | 2025-05-19 11:03 | 59K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231019-WA0321.jpg | 2025-05-19 11:03 | 59K | |
![[IMG]](/icons/image2.gif) | 7017_22.jpg | 2025-06-06 17:54 | 60K | |
![[IMG]](/icons/image2.gif) | 3730_8d5a9ba1-b88e-42da-b9a6-f4ead953fca1.jpg | 2025-05-19 11:04 | 60K | |
![[IMG]](/icons/image2.gif) | 5792_IMG-20221204-WA0037.jpg | 2025-05-19 11:03 | 60K | |
![[IMG]](/icons/image2.gif) | 2836_IMG-20181024-WA0006.jpg | 2025-05-19 11:03 | 60K | |
![[IMG]](/icons/image2.gif) | 3340_IMG-20190416-WA0048.jpg | 2025-05-19 11:03 | 60K | |
![[IMG]](/icons/image2.gif) | 3730_6485ce2e-a38f-478f-9c1c-53d8dfee2869.jpg | 2025-05-19 11:05 | 60K | |
![[IMG]](/icons/image2.gif) | 2956_IMG-20191110-WA0027.jpg | 2025-05-19 11:05 | 60K | |
![[IMG]](/icons/image2.gif) | 2976_IMG-20190726-WA0007.jpg | 2025-05-19 11:03 | 60K | |
![[IMG]](/icons/image2.gif) | 3165_62402542_202567367393012_7643144308983332864_n.jpg | 2025-05-19 11:03 | 61K | |
![[IMG]](/icons/image2.gif) | 3672_IMG-20200620-WA0005.jpg | 2025-05-19 11:07 | 61K | |
![[IMG]](/icons/image2.gif) | 3730_31effd25-5761-40ae-a817-63925de61b42.jpg | 2025-05-19 11:03 | 61K | |
![[IMG]](/icons/image2.gif) | 6113_IMG-20241211-WA0024.jpg | 2025-05-19 11:05 | 61K | |
![[IMG]](/icons/image2.gif) | 2926_PreK Students preparing indigenous dish MAITO.jpg | 2025-05-19 11:04 | 61K | |
![[IMG]](/icons/image2.gif) | 2235_WORLD_CONNECT_logo_RGB.png | 2025-05-19 11:03 | 61K | |
![[IMG]](/icons/image2.gif) | 3730_19fe4325-e8a8-40ed-bfa1-aa8594bd1a18.jpg | 2025-05-19 11:05 | 61K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-23.jpg | 2025-05-19 11:06 | 61K | |
![[IMG]](/icons/image2.gif) | 5775_3.jpg | 2025-05-19 11:04 | 61K | |
![[IMG]](/icons/image2.gif) | 6113_IMG-20241211-WA0027.jpg | 2025-05-19 11:04 | 61K | |
![[IMG]](/icons/image2.gif) | 3165_64975966_202567410726341_2268001980808953856_n.jpg | 2025-05-19 11:03 | 61K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0407.jpg | 2025-05-19 11:05 | 61K | |
![[IMG]](/icons/image2.gif) | 6797_IMG-20240821-WA0028.jpg | 2025-05-19 11:03 | 61K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-19.jpg | 2025-05-19 11:03 | 61K | |
![[IMG]](/icons/image2.gif) | 3640_IMG-20221104-WA0019.jpg | 2025-05-19 11:06 | 61K | |
![[IMG]](/icons/image2.gif) | 6713_Hand over 4.jpg | 2025-05-19 11:05 | 61K | |
![[IMG]](/icons/image2.gif) | 4778_girls receiving the healthy mimi-kits.jpg | 2025-05-19 11:04 | 61K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0417.jpg | 2025-05-19 11:06 | 62K | |
![[IMG]](/icons/image2.gif) | 3156_IMG-20180918-WA0003.jpg | 2025-05-19 11:05 | 62K | |
![[IMG]](/icons/image2.gif) | 2507_SG Director speaking at Yale.jpg | 2025-05-19 11:04 | 62K | |
![[IMG]](/icons/image2.gif) | 4421_IMG-20221212-WA0022.jpg | 2025-05-19 11:05 | 62K | |
![[IMG]](/icons/image2.gif) | 3785_IMG-20230310-WA0006.jpg | 2025-05-19 11:05 | 62K | |
![[IMG]](/icons/image2.gif) | 1421_18222049_10210333205581534_5399952521636795948_n.jpg | 2025-05-19 11:03 | 62K | |
![[IMG]](/icons/image2.gif) | 3263_Kids Festival.jpg | 2025-05-19 11:05 | 62K | |
![[IMG]](/icons/image2.gif) | 2397_Next Gen Female CEO 18.JPG | 2025-05-19 11:03 | 62K | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting literacy project student self portraits 2.jpg | 2025-05-19 11:05 | 62K | |
![[IMG]](/icons/image2.gif) | 760_14799912_1175634615828073_1205377975_o.jpg | 2025-05-19 11:04 | 62K | |
![[IMG]](/icons/image2.gif) | 2956_IMG-20190724-WA0004.jpg | 2025-05-19 11:07 | 62K | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (1).jpg | 2025-05-19 11:05 | 62K | |
![[IMG]](/icons/image2.gif) | 2281_Established Field Partiner.jpg | 2025-05-19 11:05 | 62K | |
![[ ]](/icons/unknown.gif) | 1445_HCA Grant Completion Letter.docx | 2025-05-19 11:04 | 62K | |
![[IMG]](/icons/image2.gif) | 2993_IMG-20190820-WA0016.jpg | 2025-05-19 11:07 | 62K | |
![[IMG]](/icons/image2.gif) | 3335_A list of names during one of distributions of chickens.jpg | 2025-05-19 11:05 | 62K | |
![[IMG]](/icons/image2.gif) | 3335_IMG-20190518-WA0014.jpg | 2025-05-19 11:03 | 62K | |
![[IMG]](/icons/image2.gif) | 5226_IMG-20211126-WA0039.jpg | 2025-05-19 11:04 | 63K | |
![[IMG]](/icons/image2.gif) | 3165_62265086_200599190923163_6106270835696205824_n.jpg | 2025-05-19 11:06 | 63K | |
![[IMG]](/icons/image2.gif) | 5792_IMG-20221204-WA0028.jpg | 2025-05-19 11:06 | 63K | |
![[IMG]](/icons/image2.gif) | 6551_IMG-20240811-WA0034.jpg | 2025-05-19 11:05 | 63K | |
![[IMG]](/icons/image2.gif) | 6141_IMG-20221022-WA0020.jpg | 2025-05-19 11:04 | 63K | |
![[IMG]](/icons/image2.gif) | 760_14808732_1175635792494622_1506339904_o.jpg | 2025-05-19 11:04 | 63K | |
![[IMG]](/icons/image2.gif) | 3165_44667511_2691932441032152_3439799535969239040_n.jpg | 2025-05-19 11:06 | 63K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-14.jpg | 2025-05-19 11:07 | 63K | |
![[IMG]](/icons/image2.gif) | 6551_IMG-20240811-WA0039.jpg | 2025-05-19 11:03 | 63K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231022-WA0015.jpg | 2025-05-19 11:04 | 63K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231022-WA0020.jpg | 2025-05-19 11:05 | 64K | |
![[IMG]](/icons/image2.gif) | 6531_IMG-20230324-WA0025.jpg | 2025-05-19 11:03 | 64K | |
![[IMG]](/icons/image2.gif) | 6713_Final block 4.jpg | 2025-05-19 11:03 | 64K | |
![[IMG]](/icons/image2.gif) | 2281_Buckets for washing hands.jpg | 2025-05-19 11:05 | 64K | |
![[IMG]](/icons/image2.gif) | 2993_IMG-20181213-WA0121 - Copy.jpg | 2025-05-19 11:05 | 64K | |
![[ ]](/icons/compressed.gif) | Final Report_23-028 (Malunga, Joshua) - Files.zip | 2025-05-19 11:04 | 64K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0136.jpg | 2025-05-19 11:04 | 64K | |
![[IMG]](/icons/image2.gif) | 760_14424167_1150309071693961_82172975_o.jpg | 2025-05-19 11:05 | 64K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0392.jpg | 2025-05-19 11:04 | 64K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0381.jpg | 2025-05-19 11:05 | 64K | |
![[IMG]](/icons/image2.gif) | 2810_Baby Weighing scale.jpg | 2025-05-19 11:04 | 65K | |
![[ ]](/icons/unknown.gif) | 1445_Mobile Center Orientation Letter to Brgys_131442385427422309.docx | 2025-05-19 11:04 | 65K | |
![[IMG]](/icons/image2.gif) | 3379_graduation ceremony.jpg | 2025-05-19 11:04 | 65K | |
![[IMG]](/icons/image2.gif) | 6154_IMG-20230520-WA0041.jpg | 2025-05-19 11:07 | 65K | |
![[IMG]](/icons/image2.gif) | 3165_64752247_202289084087507_3267025929502720000_n.jpg | 2025-05-19 11:04 | 65K | |
![[IMG]](/icons/image2.gif) | 2794_Photo with Dr. Ryu (host professor) with the Established Field Partner during the trainig tour in University of Seoul South Korea.jpg | 2025-05-19 11:07 | 65K | |
![[IMG]](/icons/image2.gif) | 6267_IMG-20241018-WA0025.jpg | 2025-05-19 11:05 | 65K | |
![[IMG]](/icons/image2.gif) | 615_Health Promotion.jpg | 2025-05-19 11:03 | 65K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231025-WA0629.jpg | 2025-05-19 11:03 | 65K | |
![[IMG]](/icons/image2.gif) | 4698_IMG-20200725-WA0086.jpg | 2025-05-19 11:05 | 65K | |
![[IMG]](/icons/image2.gif) | 1042_garden project.jpg | 2025-05-19 11:06 | 65K | |
![[IMG]](/icons/image2.gif) | 3785_IMG-20230310-WA0007.jpg | 2025-05-19 11:04 | 65K | |
![[IMG]](/icons/image2.gif) | 4688_IMG-20200726-WA0097.jpg | 2025-05-19 11:05 | 65K | |
![[IMG]](/icons/image2.gif) | 3340_IMG-20190129-WA0031.jpg | 2025-05-19 11:03 | 65K | |
![[IMG]](/icons/image2.gif) | 615_Microenterprise.jpg | 2025-05-19 11:05 | 65K | |
![[IMG]](/icons/image2.gif) | 2507_Woman at SG 3.jpg | 2025-05-19 11:04 | 65K | |
![[IMG]](/icons/image2.gif) | 4421_IMG-20221212-WA0020.jpg | 2025-05-19 11:03 | 65K | |
![[IMG]](/icons/image2.gif) | 615_HIV Education Campaign.jpg | 2025-05-19 11:05 | 66K | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (2).jpg | 2025-05-19 11:05 | 66K | |
![[IMG]](/icons/image2.gif) | 2507_Woman at SG 7.jpg | 2025-05-19 11:05 | 66K | |
![[ ]](/icons/compressed.gif) | Final Report_20-032 (Kasambala, Kondwani) - Budget Files.zip | 2025-05-19 11:03 | 66K | |
![[IMG]](/icons/image2.gif) | 6155_Building stage.jpg | 2025-05-19 11:07 | 66K | |
![[IMG]](/icons/image2.gif) | 2836_IMG-20181024-WA0008.jpg | 2025-05-19 11:05 | 66K | |
![[IMG]](/icons/image2.gif) | 3657_Doctor Abreu and Doctor Sierra surprised RPCV.jpg | 2025-05-19 11:06 | 66K | |
![[IMG]](/icons/image2.gif) | 2531_35515714_1845358815542211_5317679617123811328_o.jpg | 2025-05-19 11:05 | 66K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231020-WA0040.jpg | 2025-05-19 11:05 | 66K | |
![[IMG]](/icons/image2.gif) | 2841_50805301_2256865237919673_6750010425330368512_n.jpg | 2025-05-19 11:07 | 66K | |
![[IMG]](/icons/image2.gif) | 5034_SALOMEY.jpg | 2025-05-19 11:05 | 66K | |
![[IMG]](/icons/image2.gif) | 5792_IMG-20221204-WA0038.jpg | 2025-05-19 11:05 | 66K | |
![[IMG]](/icons/image2.gif) | 3672_IMG-20200620-WA0000.jpg | 2025-05-19 11:05 | 66K | |
![[IMG]](/icons/image2.gif) | 1668_Picture 1.jpg | 2025-05-19 11:03 | 67K | |
![[IMG]](/icons/image2.gif) | 615_Youth_Sanitation 2.jpg | 2025-05-19 11:03 | 67K | |
![[IMG]](/icons/image2.gif) | 2507_SG chapter in Jeremie.jpg | 2025-05-19 11:04 | 67K | |
![[IMG]](/icons/image2.gif) | 4698_IMG-20200725-WA0085.jpg | 2025-05-19 11:05 | 67K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231025-WA0304.jpg | 2025-05-19 11:04 | 67K | |
![[IMG]](/icons/image2.gif) | 4705_IMG-20200520-WA0008 (1).jpg | 2025-05-19 11:05 | 67K | |
![[IMG]](/icons/image2.gif) | 3730_095a18d8-7e31-4414-8ccc-58f50509f3f6.jpg | 2025-05-19 11:04 | 67K | |
![[IMG]](/icons/image2.gif) | 4705_IMG-20200520-WA0009 (1).jpg | 2025-05-19 11:05 | 67K | |
![[IMG]](/icons/image2.gif) | 6551_IMG-20240811-WA0040.jpg | 2025-05-19 11:04 | 67K | |
![[IMG]](/icons/image2.gif) | 2507_Women from Villa Rosa .jpg | 2025-05-19 11:05 | 67K | |
![[IMG]](/icons/image2.gif) | 2507_Woman at SG 10.jpg | 2025-05-19 11:05 | 67K | |
![[IMG]](/icons/image2.gif) | 615_Women's group 1.jpg | 2025-05-19 11:06 | 67K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-29.jpg | 2025-05-19 11:03 | 67K | |
![[IMG]](/icons/image2.gif) | 5848_1696879874894.jpg | 2025-05-19 11:05 | 67K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0404.jpg | 2025-05-19 11:04 | 67K | |
![[IMG]](/icons/image2.gif) | 3113_IMG-20190815-WA0019.jpg | 2025-05-19 11:07 | 67K | |
![[ ]](/icons/compressed.gif) | Witsaja Preserving and Strengthening the Sapara Identity-final_report-files.zip | 2025-05-19 11:03 | 67K | |
![[IMG]](/icons/image2.gif) | 3165_64445921_202566994059716_1148521628439674880_n.jpg | 2025-05-19 11:03 | 67K | |
![[ ]](/icons/layout.gif) | 3971_Karla James testimonial.pdf | 2025-05-19 11:05 | 68K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0382.jpg | 2025-05-19 11:03 | 68K | |
![[IMG]](/icons/image2.gif) | 3657_Last wkshp Gender and Health & certificate surprise to RPCV.jpg | 2025-05-19 11:05 | 68K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0219.jpg | 2025-05-19 11:03 | 68K | |
![[IMG]](/icons/image2.gif) | 5848_IMG-20221230-WA0037.jpg | 2025-05-19 11:06 | 68K | |
![[IMG]](/icons/image2.gif) | 1413_Dolly action shot.jpg | 2025-05-19 11:05 | 68K | |
![[IMG]](/icons/image2.gif) | 4787_106363160_2824798854315392_8103769972800269632_n.jpg | 2025-05-19 11:05 | 68K | |
![[IMG]](/icons/image2.gif) | 2539_DR Participant. iACT 2018JPG.JPG | 2025-05-19 11:05 | 68K | |
![[IMG]](/icons/image2.gif) | 3730_8e2a32f6-fe18-493f-93e9-d61ce676c132.jpg | 2025-05-19 11:04 | 68K | |
![[IMG]](/icons/image2.gif) | 3730_image.png | 2025-05-19 11:06 | 68K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231025-WA0308.jpg | 2025-05-19 11:04 | 68K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-7.jpg | 2025-05-19 11:04 | 68K | |
![[IMG]](/icons/image2.gif) | 760_14803225_1175635465827988_1326990494_o.jpg | 2025-05-19 11:06 | 69K | |
![[IMG]](/icons/image2.gif) | 6551_WhatsApp Image 2024-07-23 at 11.31.29_7a030fff.jpg | 2025-05-19 11:05 | 69K | |
![[IMG]](/icons/image2.gif) | 5848_IMG-20221109-WA0022.jpg | 2025-05-19 11:04 | 69K | |
![[IMG]](/icons/image2.gif) | 615_Microenterprise 2.jpg | 2025-05-19 11:04 | 69K | |
![[IMG]](/icons/image2.gif) | 3340_IMG-20190309-WA0011.jpg | 2025-05-19 11:04 | 69K | |
![[IMG]](/icons/image2.gif) | 3730_f82c37c4-24fb-4ab0-a015-e4c8fe3da5b4.jpg | 2025-05-19 11:04 | 69K | |
![[IMG]](/icons/image2.gif) | 5848_1696879874951.jpg | 2025-05-19 11:06 | 69K | |
![[IMG]](/icons/image2.gif) | 2394_26992152_1825499900796309_2469590340902730454_n.jpg | 2025-05-19 11:03 | 69K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0366.jpg | 2025-05-19 11:05 | 69K | |
![[IMG]](/icons/image2.gif) | 3785_IMG-20230310-WA0021.jpg | 2025-05-19 11:05 | 69K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0368.jpg | 2025-05-19 11:07 | 69K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0357.jpg | 2025-05-19 11:05 | 69K | |
![[IMG]](/icons/image2.gif) | 1311_15036433_1163424597028457_7290288727706415991_n[1].jpg | 2025-05-19 11:05 | 70K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231025-WA0320.jpg | 2025-05-19 11:04 | 70K | |
![[IMG]](/icons/image2.gif) | 1674_18198768_756394704527648_6681069759089758102_n.jpg | 2025-05-19 11:04 | 70K | |
![[IMG]](/icons/image2.gif) | 6692_Shop Sales.jpg | 2025-05-19 11:04 | 70K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0386.jpg | 2025-05-19 11:05 | 70K | |
![[IMG]](/icons/image2.gif) | 2976_IMG-20190726-WA0012.jpg | 2025-05-19 11:05 | 70K | |
![[IMG]](/icons/image2.gif) | 6524_265995666910_status_61ae6a6d103e437485983d485e084070.jpg | 2025-05-19 11:06 | 70K | |
![[IMG]](/icons/image2.gif) | 6551_windows replaced.jpg | 2025-05-19 11:07 | 70K | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3953.JPG | 2025-05-19 11:04 | 70K | |
![[IMG]](/icons/image2.gif) | 1311_15037181_1163425000361750_8861420798632510418_n[1].jpg | 2025-05-19 11:04 | 70K | |
![[IMG]](/icons/image2.gif) | 3730_b2988ad6-c35b-41d9-9c9f-f355040f228d.jpg | 2025-05-19 11:06 | 70K | |
![[IMG]](/icons/image2.gif) | 2507_women pionner summit 4.jpg | 2025-05-19 11:04 | 70K | |
![[IMG]](/icons/image2.gif) | 6515_IMG-20230502-WA0027.jpg | 2025-05-19 11:07 | 70K | |
![[IMG]](/icons/image2.gif) | 6531_IMG-20230324-WA0043.jpg | 2025-05-19 11:04 | 70K | |
![[IMG]](/icons/image2.gif) | 3774_community youth group members pose after training.jpg | 2025-05-19 11:06 | 70K | |
![[IMG]](/icons/image2.gif) | 5660_IMG-20221014-WA0042.jpg | 2025-05-19 11:05 | 70K | |
![[IMG]](/icons/image2.gif) | 7010_image.png | 2025-05-19 11:04 | 70K | |
![[IMG]](/icons/image2.gif) | 6520_image.png | 2025-05-19 11:04 | 70K | |
![[IMG]](/icons/image2.gif) | 2507_women workshop SG.jpg | 2025-05-19 11:04 | 71K | |
![[IMG]](/icons/image2.gif) | 2976_IMG-20190726-WA0008.jpg | 2025-05-19 11:03 | 71K | |
![[IMG]](/icons/image2.gif) | 2841_IMG-20190521-WA0002.jpg | 2025-05-19 11:04 | 71K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0397.jpg | 2025-05-19 11:04 | 71K | |
![[IMG]](/icons/image2.gif) | 6551_roof works.jpg | 2025-05-19 11:05 | 71K | |
![[IMG]](/icons/image2.gif) | 4778_food packs 2.jpg | 2025-05-19 11:05 | 71K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0416.jpg | 2025-05-19 11:03 | 71K | |
![[IMG]](/icons/image2.gif) | 3785_IMG-20230310-WA0011.jpg | 2025-05-19 11:05 | 71K | |
![[IMG]](/icons/image2.gif) | 7226_b25lY21zOmU4ZTA2MDEyLTY0NWYtNGUzZi04Zjc4LWZmMzk2NDdlMGIwZjozYmQ5OGMxYi00MDY1LTQzNzItYmJhMS0wNDNlYzU5NGQzMjM=.jpg | 2025-05-19 11:04 | 71K | |
![[IMG]](/icons/image2.gif) | 3657_Part 1. Guillermina's testimony.png | 2025-05-19 11:05 | 72K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0411.jpg | 2025-05-19 11:03 | 72K | |
![[IMG]](/icons/image2.gif) | 6303_IMG-20240412-WA0023.jpg | 2025-05-19 11:05 | 72K | |
![[IMG]](/icons/image2.gif) | 3165_62339952_200599167589832_555167176328216576_n.jpg | 2025-05-19 11:03 | 72K | |
![[IMG]](/icons/image2.gif) | 6141_IMG-20221022-WA0029.jpg | 2025-05-19 11:03 | 72K | |
![[IMG]](/icons/image2.gif) | 5792_IMG-20221204-WA0019.jpg | 2025-05-19 11:04 | 72K | |
![[IMG]](/icons/image2.gif) | 3340_IMG-20181006-WA0067.jpg | 2025-05-19 11:03 | 72K | |
![[IMG]](/icons/image2.gif) | 2507_women pionner summit 7.jpg | 2025-05-19 11:04 | 72K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0353.jpg | 2025-05-19 11:04 | 72K | |
![[IMG]](/icons/image2.gif) | 1094_Counterpart Filger.jpg | 2025-05-19 11:05 | 72K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0122.jpg | 2025-05-19 11:05 | 72K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0594.jpg | 2025-05-19 11:05 | 73K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0354.jpg | 2025-05-19 11:03 | 73K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-4.jpg | 2025-05-19 11:03 | 73K | |
![[IMG]](/icons/image2.gif) | 5576_IMG-20230621-WA0016.jpg | 2025-05-19 11:04 | 73K | |
![[IMG]](/icons/image2.gif) | 760_14446399_1150308461694022_353297164_o.jpg | 2025-05-19 11:03 | 73K | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting literacy project story apron.jpg | 2025-05-19 11:05 | 73K | |
![[IMG]](/icons/image2.gif) | 2810_Louis Anye.jpg | 2025-05-19 11:05 | 73K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0370.jpg | 2025-05-19 11:05 | 73K | |
![[IMG]](/icons/image2.gif) | 3941_Fascinator facilitator training a participant.jpg | 2025-05-19 11:03 | 73K | |
![[IMG]](/icons/image2.gif) | 1674_18275144_756393847861067_8841093049588360464_n.jpg | 2025-05-19 11:04 | 73K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0380.jpg | 2025-05-19 11:04 | 73K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-5.jpg | 2025-05-19 11:04 | 73K | |
![[IMG]](/icons/image2.gif) | 7000_carpa verde.JPG | 2025-05-19 11:04 | 73K | |
![[IMG]](/icons/image2.gif) | 2810_baby's bed.jpg | 2025-05-19 11:05 | 73K | |
![[IMG]](/icons/image2.gif) | 2841_50595968_2252344758371721_5437162609411358720_n.jpg | 2025-05-19 11:07 | 74K | |
![[IMG]](/icons/image2.gif) | 4705_IMG-20200520-WA0027 (1).jpg | 2025-05-19 11:04 | 74K | |
![[IMG]](/icons/image2.gif) | 6515_IMG-20230502-WA0013.jpg | 2025-05-19 11:07 | 74K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0351.jpg | 2025-05-19 11:03 | 74K | |
![[IMG]](/icons/image2.gif) | 1674_18274754_756394584527660_2024448523906234457_n.jpg | 2025-05-19 11:04 | 74K | |
![[IMG]](/icons/image2.gif) | 3165_44493039_120956842220732_4743025040302276608_n (1).jpg | 2025-05-19 11:07 | 74K | |
![[IMG]](/icons/image2.gif) | 822_portal3.jpg | 2025-05-19 11:03 | 74K | |
![[IMG]](/icons/image2.gif) | 2836_IMG-20181024-WA0013.jpg | 2025-05-19 11:04 | 74K | |
![[IMG]](/icons/image2.gif) | 3025_1286f833-fba2-4cbd-bc36-3d87594b3451.jpg | 2025-05-19 11:05 | 74K | |
![[IMG]](/icons/image2.gif) | 2533_IMG_7394.jpg | 2025-05-19 11:03 | 75K | |
![[IMG]](/icons/image2.gif) | 1094_Beneficiary 1 Testimonial.jpg | 2025-05-19 11:05 | 75K | |
![[IMG]](/icons/image2.gif) | 2976_IMG-20190726-WA0019.jpg | 2025-05-19 11:03 | 75K | |
![[IMG]](/icons/image2.gif) | 2836_IMG-20181024-WA0012.jpg | 2025-05-19 11:03 | 75K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231025-WA0305.jpg | 2025-05-19 11:05 | 75K | |
![[IMG]](/icons/image2.gif) | 4421_IMG-20221212-WA0023.jpg | 2025-05-19 11:04 | 75K | |
![[IMG]](/icons/image2.gif) | 2376_23905588_10155980817177082_1392930667519174405_n.jpg | 2025-05-19 11:03 | 75K | |
![[IMG]](/icons/image2.gif) | 760_12647756_996776937047176_175210858_n.jpg | 2025-05-19 11:05 | 75K | |
![[IMG]](/icons/image2.gif) | 5226_IMG-20211127-WA0069.jpg | 2025-05-19 11:04 | 75K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0384.jpg | 2025-05-19 11:05 | 75K | |
![[IMG]](/icons/image2.gif) | 3113_IMG-20190815-WA0018.jpg | 2025-05-19 11:03 | 75K | |
![[IMG]](/icons/image2.gif) | 6551_IMG-20240811-WA0031.jpg | 2025-05-19 11:05 | 75K | |
![[IMG]](/icons/image2.gif) | 3340_IMG-20190309-WA0002.jpg | 2025-05-19 11:05 | 75K | |
![[IMG]](/icons/image2.gif) | 4666_mpamba incinerator 3.jpg | 2025-05-19 11:03 | 75K | |
![[IMG]](/icons/image2.gif) | 3165_44595059_2691932514365478_1308106373887688704_n.jpg | 2025-05-19 11:05 | 75K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0605.jpg | 2025-05-19 11:05 | 75K | |
![[IMG]](/icons/image2.gif) | 6515_IMG-20230502-WA0011.jpg | 2025-05-19 11:04 | 76K | |
![[IMG]](/icons/image2.gif) | 3165_64918821_202567530726329_7612847390634016768_n.jpg | 2025-05-19 11:03 | 76K | |
![[IMG]](/icons/image2.gif) | 6551_IMG-20240811-WA0033.jpg | 2025-05-19 11:04 | 76K | |
![[IMG]](/icons/image2.gif) | 6515_IMG-20230502-WA0007.jpg | 2025-05-19 11:05 | 76K | |
![[IMG]](/icons/image2.gif) | 3340_IMG-20190129-WA0021.jpg | 2025-05-19 11:05 | 76K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0352.jpg | 2025-05-19 11:05 | 76K | |
![[IMG]](/icons/image2.gif) | 2810_First Baby to be delivered at our maternity.jpg | 2025-05-19 11:06 | 76K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0389.jpg | 2025-05-19 11:07 | 76K | |
![[ ]](/icons/layout.gif) | 6104_Malidade community water project.pdf | 2025-05-19 11:04 | 76K | |
![[IMG]](/icons/image2.gif) | 4720_IMG-20200725-WA0041.jpg | 2025-05-19 11:05 | 76K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0637.jpg | 2025-05-19 11:03 | 76K | |
![[IMG]](/icons/image2.gif) | 6141_IMG-20221017-WA0037.jpg | 2025-05-19 11:03 | 76K | |
![[IMG]](/icons/image2.gif) | 1248_2.jpg | 2025-05-19 11:04 | 76K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231025-WA0642.jpg | 2025-05-19 11:05 | 76K | |
![[IMG]](/icons/image2.gif) | 4778_communities receiving food packs.jpg | 2025-05-19 11:05 | 77K | |
![[IMG]](/icons/image2.gif) | 760_12660450_996776793713857_1838347679_n.jpg | 2025-05-19 11:04 | 77K | |
![[IMG]](/icons/image2.gif) | 2531_35528728_1845359522208807_7925200948819918848_o.jpg | 2025-05-19 11:03 | 77K | |
![[IMG]](/icons/image2.gif) | 6141_IMG-20221017-WA0012.jpg | 2025-05-19 11:04 | 77K | |
![[IMG]](/icons/image2.gif) | 822_launch.jpg | 2025-05-19 11:03 | 77K | |
![[IMG]](/icons/image2.gif) | 760_14799919_1175634565828078_1507208434_o.jpg | 2025-05-19 11:05 | 78K | |
![[IMG]](/icons/image2.gif) | 7097_Copy of Brujas Sponsorship Deck PICS 2.JPG | 2025-05-19 11:06 | 78K | |
![[IMG]](/icons/image2.gif) | 2691_IMG-20180614-WA0011.jpg | 2025-05-19 11:05 | 78K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-1.jpg | 2025-05-19 11:05 | 78K | |
![[IMG]](/icons/image2.gif) | 5226_IMG-20211110-WA0008.jpg | 2025-05-19 11:03 | 78K | |
![[IMG]](/icons/image2.gif) | 5848_IMG-20221109-WA0020.jpg | 2025-05-19 11:03 | 78K | |
![[IMG]](/icons/image2.gif) | 6141_IMG-20221017-WA0049.jpg | 2025-05-19 11:03 | 78K | |
![[IMG]](/icons/image2.gif) | 6155_House setting stage.jpg | 2025-05-19 11:03 | 78K | |
![[IMG]](/icons/image2.gif) | 760_14787059_1175635385827996_1867026213_o.jpg | 2025-05-19 11:04 | 78K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0403.jpg | 2025-05-19 11:05 | 78K | |
![[IMG]](/icons/image2.gif) | 4778_parents receiving support.jpg | 2025-05-19 11:05 | 79K | |
![[IMG]](/icons/image2.gif) | 2539_Saouda with Machine. iACT 2018..JPG | 2025-05-19 11:04 | 79K | |
![[IMG]](/icons/image2.gif) | 2976_IMG-20190726-WA0020.jpg | 2025-05-19 11:03 | 79K | |
![[IMG]](/icons/image2.gif) | 2658_29684267_316046478923721_583516374692822240_n.jpg | 2025-05-19 11:05 | 79K | |
![[IMG]](/icons/image2.gif) | 3165_62556732_200599550923127_5341626297476972544_n.jpg | 2025-05-19 11:06 | 79K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0376.jpg | 2025-05-19 11:03 | 79K | |
![[IMG]](/icons/image2.gif) | 2652_goat multiplied.jpg | 2025-05-19 11:05 | 79K | |
![[IMG]](/icons/image2.gif) | 6141_IMG-20221017-WA0053.jpg | 2025-05-19 11:05 | 79K | |
![[IMG]](/icons/image2.gif) | 5707_IMG-20221216-WA0029.jpg | 2025-05-19 11:07 | 79K | |
![[IMG]](/icons/image2.gif) | 2993_IMG-20190820-WA0011.jpg | 2025-05-19 11:04 | 79K | |
![[IMG]](/icons/image2.gif) | 3515_WILNED MKANDAWIRE BENEFICIARY.jpg | 2025-05-19 11:04 | 79K | |
![[IMG]](/icons/image2.gif) | 6627_IMG-20231204-WA0016.jpg | 2025-05-19 11:04 | 79K | |
![[IMG]](/icons/image2.gif) | 2993_IMG-20190820-WA0008.jpg | 2025-05-19 11:03 | 79K | |
![[IMG]](/icons/image2.gif) | 3640_IMG-20221104-WA0021.jpg | 2025-05-19 11:03 | 79K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0375.jpg | 2025-05-19 11:03 | 80K | |
![[IMG]](/icons/image2.gif) | 4623_IMG-20200612-WA0033.jpg | 2025-05-19 11:03 | 80K | |
![[IMG]](/icons/image2.gif) | 5775_WhatsApp Image 2023-10-02 at 12.46.51.jpg | 2025-05-19 11:03 | 80K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0424.jpg | 2025-05-19 11:05 | 80K | |
![[IMG]](/icons/image2.gif) | 2311_Demonstrating the role focus.jpg | 2025-05-19 11:04 | 80K | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (5).jpg | 2025-05-19 11:04 | 80K | |
![[IMG]](/icons/image2.gif) | 2841_50502186_2256859761253554_2516880470730342400_n.jpg | 2025-05-19 11:04 | 80K | |
![[IMG]](/icons/image2.gif) | 3165_65215503_202567030726379_5869778009254264832_n.jpg | 2025-05-19 11:03 | 80K | |
![[IMG]](/icons/image2.gif) | 5585_World Connect Visits Ngwenya (2).jpg | 2025-05-19 11:05 | 80K | |
![[IMG]](/icons/image2.gif) | 3640_IMG-20221104-WA0022.jpg | 2025-05-19 11:07 | 80K | |
![[IMG]](/icons/image2.gif) | 2841_50467891_2256859841253546_401378459181383680_n.jpg | 2025-05-19 11:05 | 80K | |
![[IMG]](/icons/image2.gif) | 5792_IMG-20220526-WA0000.jpg | 2025-05-19 11:05 | 81K | |
![[IMG]](/icons/image2.gif) | 3335_Briefing PTA_SMC and Chiefs on the project.jpg | 2025-05-19 11:03 | 81K | |
![[IMG]](/icons/image2.gif) | 6551_IMG-20240811-WA0035.jpg | 2025-05-19 11:05 | 81K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0406.jpg | 2025-05-19 11:03 | 81K | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (6).jpg | 2025-05-19 11:03 | 81K | |
![[IMG]](/icons/image2.gif) | 3263_Painted Entrance.jpg | 2025-05-19 11:03 | 81K | |
![[IMG]](/icons/image2.gif) | 615_HIV Memorial Activity.jpg | 2025-05-19 11:05 | 81K | |
![[IMG]](/icons/image2.gif) | 3730_9ff4e503-3ed3-454f-b028-070cc1b9058a.jpg | 2025-05-19 11:03 | 81K | |
![[IMG]](/icons/image2.gif) | 2976_IMG-20190726-WA0010.jpg | 2025-05-19 11:05 | 81K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0385.jpg | 2025-05-19 11:05 | 81K | |
![[IMG]](/icons/image2.gif) | 5603_IMG-20230421-WA0016.jpg | 2025-05-19 11:03 | 81K | |
![[IMG]](/icons/image2.gif) | 3594_IMG-20200125-WA0047.jpg | 2025-05-19 11:05 | 81K | |
![[IMG]](/icons/image2.gif) | 3672_IMG-20200620-WA0001.jpg | 2025-05-19 11:05 | 81K | |
![[IMG]](/icons/image2.gif) | 3263_Mural.jpg | 2025-05-19 11:04 | 81K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-27.jpg | 2025-05-19 11:05 | 82K | |
![[IMG]](/icons/image2.gif) | 6627_IMG-20231204-WA0027.jpg | 2025-05-19 11:04 | 82K | |
![[IMG]](/icons/image2.gif) | 6239_IMG_20230810_121346_289.jpg | 2025-05-19 11:04 | 82K | |
![[IMG]](/icons/image2.gif) | 4778_food packs- distribution centre at dandora.jpg | 2025-05-19 11:04 | 82K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-2.jpg | 2025-05-19 11:05 | 82K | |
![[IMG]](/icons/image2.gif) | 3049_IMG-20191219-WA0019.jpg | 2025-05-19 11:07 | 82K | |
![[IMG]](/icons/image2.gif) | 2658_29683456_316029192258783_5470455197013673326_n.jpg | 2025-05-19 11:04 | 82K | |
![[IMG]](/icons/image2.gif) | 2810_Post Natal Ward.jpg | 2025-05-19 11:06 | 82K | |
![[IMG]](/icons/image2.gif) | 3515_GLORY MUNTHALI BENEFICIARY.jpg | 2025-05-19 11:05 | 82K | |
![[IMG]](/icons/image2.gif) | 6627_IMG-20231204-WA0036.jpg | 2025-05-19 11:04 | 82K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231025-WA0625.jpg | 2025-05-19 11:04 | 82K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0369.jpg | 2025-05-19 11:03 | 82K | |
![[IMG]](/icons/image2.gif) | 2539_Peanut Oil Machine. iACT 2018.JPG | 2025-05-19 11:04 | 82K | |
![[IMG]](/icons/image2.gif) | 5707_IMG-20221213-WA0039.jpg | 2025-05-19 11:05 | 82K | |
![[IMG]](/icons/image2.gif) | 2152_IMG-20170616-WA0004.jpg | 2025-05-19 11:05 | 83K | |
![[IMG]](/icons/image2.gif) | 3785_IMG-20230310-WA0020.jpg | 2025-05-19 11:03 | 83K | |
![[IMG]](/icons/image2.gif) | 5585_World Connect Visits Ngwenya.jpg | 2025-05-19 11:04 | 83K | |
![[IMG]](/icons/image2.gif) | 3515_CONNECT PICS 5.jpg | 2025-05-19 11:04 | 83K | |
![[IMG]](/icons/image2.gif) | 2993_IMG-20190820-WA0072.jpg | 2025-05-19 11:05 | 83K | |
![[IMG]](/icons/image2.gif) | 6155_Bricks and sand mobilization.jpg | 2025-05-19 11:05 | 83K | |
![[IMG]](/icons/image2.gif) | 2976_IMG-20190726-WA0009.jpg | 2025-05-19 11:05 | 83K | |
![[IMG]](/icons/image2.gif) | 7017_16.jpg | 2025-06-06 17:54 | 83K | |
![[IMG]](/icons/image2.gif) | 760_14393791_1150309175027284_1204998842_o.jpg | 2025-05-19 11:04 | 83K | |
![[IMG]](/icons/image2.gif) | 6627_IMG-20231204-WA0017.jpg | 2025-05-19 11:05 | 83K | |
![[IMG]](/icons/image2.gif) | 2976_IMG-20190726-WA0016.jpg | 2025-05-19 11:05 | 83K | |
![[IMG]](/icons/image2.gif) | 5603_IMG-20230411-WA0029.jpg | 2025-05-19 11:03 | 83K | |
![[IMG]](/icons/image2.gif) | 4720_IMG-20200725-WA0044.jpg | 2025-05-19 11:04 | 83K | |
![[IMG]](/icons/image2.gif) | 6627_IMG-20231204-WA0035.jpg | 2025-05-19 11:05 | 84K | |
![[IMG]](/icons/image2.gif) | 6303_IMG-20240412-WA0026 (1).jpg | 2025-05-19 11:05 | 84K | |
![[IMG]](/icons/image2.gif) | 6303_IMG-20240412-WA0026.jpg | 2025-05-19 11:05 | 84K | |
![[IMG]](/icons/image2.gif) | 3709_Running tap water.jpg | 2025-05-19 11:05 | 84K | |
![[IMG]](/icons/image2.gif) | 6155_a completed hous.jpg | 2025-05-19 11:05 | 84K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0629.jpg | 2025-05-19 11:05 | 84K | |
![[IMG]](/icons/image2.gif) | 3730_1f8d3d92-e91c-4f3d-8e8e-a8ce7266d2cd.jpg | 2025-05-19 11:05 | 84K | |
![[IMG]](/icons/image2.gif) | 3730_72b05f22-72be-4ff1-9c65-89b18559cd5b.jpg | 2025-05-19 11:06 | 84K | |
![[IMG]](/icons/image2.gif) | 2976_IMG-20190726-WA0018.jpg | 2025-05-19 11:03 | 84K | |
![[IMG]](/icons/image2.gif) | 3025_Stationery for the RRC.jpg | 2025-05-19 11:04 | 84K | |
![[IMG]](/icons/image2.gif) | 2976_IMG-20190726-WA0017.jpg | 2025-05-19 11:03 | 84K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0268.jpg | 2025-05-19 11:03 | 84K | |
![[IMG]](/icons/image2.gif) | 1013_IMG_3336.JPG | 2025-05-19 11:04 | 84K | |
![[ ]](/icons/compressed.gif) | Final Report_17-089 (Wolf, Rachel) - Files.zip | 2025-05-19 11:03 | 84K | |
![[IMG]](/icons/image2.gif) | 1413_Delivering cow milk w dolly picture 2.jpg | 2025-05-19 11:03 | 84K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0533.jpg | 2025-05-19 11:05 | 85K | |
![[IMG]](/icons/image2.gif) | 6104_IMG-20230703-WA0015.jpg | 2025-05-19 11:05 | 85K | |
![[IMG]](/icons/image2.gif) | 2384_CAMME Classroom 2.jpg | 2025-05-19 11:05 | 85K | |
![[IMG]](/icons/image2.gif) | 2384_ef61f9b4-91f3-4d69-943f-5781308255ff.jpg | 2025-05-19 11:06 | 85K | |
![[IMG]](/icons/image2.gif) | 6627_IMG-20231204-WA0018.jpg | 2025-05-19 11:05 | 85K | |
![[IMG]](/icons/image2.gif) | 2507_SG grind 13th edition.jpg | 2025-05-19 11:05 | 85K | |
![[IMG]](/icons/image2.gif) | 2976_IMG-20190726-WA0021.jpg | 2025-05-19 11:03 | 85K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0415.jpg | 2025-05-19 11:03 | 85K | |
![[IMG]](/icons/image2.gif) | 615_Sanitation_Womens Group.jpg | 2025-05-19 11:07 | 85K | |
![[IMG]](/icons/image2.gif) | 3941_Makeup Progress 2.jpg | 2025-05-19 11:05 | 85K | |
![[IMG]](/icons/image2.gif) | 7017_17.jpg | 2025-06-06 17:54 | 85K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0285.jpg | 2025-05-19 11:03 | 85K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0568.jpg | 2025-05-19 11:05 | 85K | |
![[IMG]](/icons/image2.gif) | 2610_image.png | 2025-05-19 11:03 | 85K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0377.jpg | 2025-05-19 11:04 | 85K | |
![[IMG]](/icons/image2.gif) | 7000_MT3.jpg | 2025-05-19 11:03 | 86K | |
![[IMG]](/icons/image2.gif) | 1248_45.jpg | 2025-05-19 11:04 | 86K | |
![[IMG]](/icons/image2.gif) | 3730_a6c7eb93-9fc3-4bac-891c-3f28d3098fcc.jpg | 2025-05-19 11:04 | 86K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0391.jpg | 2025-05-19 11:06 | 86K | |
![[IMG]](/icons/image2.gif) | 2652_kivumu Goat.jpg | 2025-05-19 11:05 | 86K | |
![[IMG]](/icons/image2.gif) | 5571_IMG-20230721-WA0053 (1).jpg | 2025-05-19 11:05 | 86K | |
![[IMG]](/icons/image2.gif) | 5571_IMG-20230721-WA0053 (2).jpg | 2025-05-19 11:05 | 86K | |
![[IMG]](/icons/image2.gif) | 5571_IMG-20230721-WA0053.jpg | 2025-05-19 11:07 | 86K | |
![[IMG]](/icons/image2.gif) | 4720_IMG-20200725-WA0042.jpg | 2025-05-19 11:05 | 87K | |
![[IMG]](/icons/image2.gif) | 6551_IMG-20240811-WA0058.jpg | 2025-05-19 11:05 | 87K | |
![[IMG]](/icons/image2.gif) | 3340_IMG-20190309-WA0004.jpg | 2025-05-19 11:05 | 87K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-20.jpg | 2025-05-19 11:05 | 87K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231025-WA0322.jpg | 2025-05-19 11:03 | 87K | |
![[IMG]](/icons/image2.gif) | 1379_Maria Pintado2.jpg | 2025-05-19 11:03 | 87K | |
![[IMG]](/icons/image2.gif) | 5707_IMG-20221216-WA0020.jpg | 2025-05-19 11:06 | 87K | |
![[IMG]](/icons/image2.gif) | 7017_Picture1.jpg | 2025-06-06 17:54 | 87K | |
![[IMG]](/icons/image2.gif) | 5775_5.jpg | 2025-05-19 11:05 | 87K | |
![[IMG]](/icons/image2.gif) | 2507_women busy at SG.jpg | 2025-05-19 11:05 | 88K | |
![[IMG]](/icons/image2.gif) | 2836_IMG-20181019-WA0009.jpg | 2025-05-19 11:04 | 88K | |
![[IMG]](/icons/image2.gif) | 5815_IMG-20220217-WA0021.jpg | 2025-05-19 11:03 | 88K | |
![[IMG]](/icons/image2.gif) | 2533_d34a98ea-1ad3-4910-b7ea-f4cb28ada137.jpg | 2025-05-19 11:06 | 88K | |
![[IMG]](/icons/image2.gif) | 2810_Delivery bed.jpg | 2025-05-19 11:04 | 88K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231111-WA0154.jpg | 2025-05-19 11:03 | 88K | |
![[IMG]](/icons/image2.gif) | 760_14439005_1150308181694050_1143930156_o.jpg | 2025-05-19 11:03 | 88K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0652.jpg | 2025-05-19 11:07 | 88K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0379.jpg | 2025-05-19 11:03 | 88K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0442.jpg | 2025-05-19 11:03 | 89K | |
![[IMG]](/icons/image2.gif) | 3263_Tourist Lunch.jpg | 2025-05-19 11:03 | 89K | |
![[IMG]](/icons/image2.gif) | 5848_IMG-20221109-WA0019.jpg | 2025-05-19 11:04 | 89K | |
![[IMG]](/icons/image2.gif) | 3113_IMG-20190815-WA0017.jpg | 2025-05-19 11:04 | 89K | |
![[IMG]](/icons/image2.gif) | 3730_8c0653b6-0480-46d2-8f60-4f03d1c55e60.jpg | 2025-05-19 11:03 | 89K | |
![[IMG]](/icons/image2.gif) | 4778_Girls heatlhy mimi-kits.jpg | 2025-05-19 11:03 | 89K | |
![[IMG]](/icons/image2.gif) | 3774_a peace corp at one of the trainings.jpg | 2025-05-19 11:04 | 89K | |
![[IMG]](/icons/image2.gif) | 2507_SG business women.jpg | 2025-05-19 11:05 | 89K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0630.jpg | 2025-05-19 11:05 | 89K | |
![[IMG]](/icons/image2.gif) | 3730_bb067d51-8951-4e95-a48c-99f6af53f86a.jpg | 2025-05-19 11:03 | 89K | |
![[IMG]](/icons/image2.gif) | 3263_TypicalDishes.jpg | 2025-05-19 11:06 | 89K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0393.jpg | 2025-05-19 11:05 | 89K | |
![[IMG]](/icons/image2.gif) | 6633_WhatsApp Image 2024-06-08 at 15.09.58_50a284f0.jpg | 2025-05-19 11:03 | 89K | |
![[IMG]](/icons/image2.gif) | 6531_IMG-20230324-WA0050.jpg | 2025-05-19 11:07 | 89K | |
![[IMG]](/icons/image2.gif) | 2976_IMG-20190726-WA0013.jpg | 2025-05-19 11:03 | 89K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0390.jpg | 2025-05-19 11:05 | 89K | |
![[IMG]](/icons/image2.gif) | 3730_0ff178fd-4574-49c2-b387-d7b53fb5356b.jpg | 2025-05-19 11:04 | 89K | |
![[IMG]](/icons/image2.gif) | 5792_IMG-20221204-WA0034.jpg | 2025-05-19 11:06 | 90K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0225.jpg | 2025-05-19 11:04 | 90K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-18.jpg | 2025-05-19 11:03 | 90K | |
![[IMG]](/icons/image2.gif) | 6303_IMG-20240412-WA0019.jpg | 2025-05-19 11:04 | 90K | |
![[IMG]](/icons/image2.gif) | 3263_Playground4.jpg | 2025-05-19 11:04 | 90K | |
![[IMG]](/icons/image2.gif) | 3657_Teacher putting on condom. Gender and Health. HIV.Teen pregnancy. Maternal Mortality.png | 2025-05-19 11:07 | 90K | |
![[IMG]](/icons/image2.gif) | 6797_IMG-20240821-WA0020.jpg | 2025-05-19 11:06 | 90K | |
![[IMG]](/icons/image2.gif) | 3340_IMG-20190903-WA0008.jpg | 2025-05-19 11:04 | 90K | |
![[IMG]](/icons/image2.gif) | 3730_1fc527f6-071d-425b-a6c9-536374c59a39.jpg | 2025-05-19 11:05 | 90K | |
![[IMG]](/icons/image2.gif) | 4778_food packs for families.jpg | 2025-05-19 11:05 | 90K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0131.jpg | 2025-05-19 11:05 | 90K | |
![[IMG]](/icons/image2.gif) | 4421_IMG-20221212-WA0009.jpg | 2025-05-19 11:05 | 90K | |
![[IMG]](/icons/image2.gif) | 6515_IMG-20230502-WA0022.jpg | 2025-05-19 11:06 | 90K | |
![[IMG]](/icons/image2.gif) | 2507_women workshop hts18 1.jpg | 2025-05-19 11:07 | 90K | |
![[IMG]](/icons/image2.gif) | 2926_Community Parents in a workshop learning about the materials in the new preK.jpg | 2025-05-19 11:06 | 90K | |
![[IMG]](/icons/image2.gif) | 2810_Patient reception.jpg | 2025-05-19 11:05 | 90K | |
![[IMG]](/icons/image2.gif) | 2477_37682477_870774183133746_6236510771145080832_o.jpg | 2025-05-19 11:04 | 90K | |
![[IMG]](/icons/image2.gif) | 7017_8.jpg | 2025-06-06 17:54 | 91K | |
![[IMG]](/icons/image2.gif) | 5775_9.jpg | 2025-05-19 11:05 | 91K | |
![[IMG]](/icons/image2.gif) | 6515_IMG-20230502-WA0051.jpg | 2025-05-19 11:04 | 91K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0396.jpg | 2025-05-19 11:05 | 91K | |
![[IMG]](/icons/image2.gif) | 1674_18301027_756393357861116_7937369203186823423_n.jpg | 2025-05-19 11:05 | 91K | |
![[IMG]](/icons/image2.gif) | 2507_women workshop 1.jpg | 2025-05-19 11:03 | 91K | |
![[IMG]](/icons/image2.gif) | 2152_IMG-20170616-WA0006.jpg | 2025-05-19 11:04 | 91K | |
![[IMG]](/icons/image2.gif) | 3620_IMG-20190403-WA0034.jpg | 2025-05-19 11:05 | 91K | |
![[IMG]](/icons/image2.gif) | 2507_women pioneer summit 1.jpg | 2025-05-19 11:04 | 91K | |
![[IMG]](/icons/image2.gif) | 767_17579928_791800507636726_1226391945_n.jpg | 2025-05-19 11:04 | 91K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231218-WA0038.jpg | 2025-05-19 11:03 | 92K | |
![[IMG]](/icons/image2.gif) | 5815_FdGZN7SXEAE5m0Z.jpg | 2025-05-19 11:05 | 92K | |
![[IMG]](/icons/image2.gif) | 6531_IMG-20230324-WA0048.jpg | 2025-05-19 11:04 | 92K | |
![[IMG]](/icons/image2.gif) | 4421_IMG-20221212-WA0010.jpg | 2025-05-19 11:07 | 92K | |
![[IMG]](/icons/image2.gif) | 2477_40449679_1916517195080834_4111589183351422976_o.jpg | 2025-05-19 11:07 | 92K | |
![[IMG]](/icons/image2.gif) | 3594_IMG-20200125-WA0053.jpg | 2025-05-19 11:05 | 92K | |
![[IMG]](/icons/image2.gif) | 2841_51436220_2267538843518979_1671871098628603904_n.jpg | 2025-05-19 11:05 | 92K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0651.jpg | 2025-05-19 11:06 | 92K | |
![[IMG]](/icons/image2.gif) | 6239_IMG_20230825_151909_175.jpg | 2025-05-19 11:04 | 92K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231124-WA0478.jpg | 2025-05-19 11:05 | 93K | |
![[ ]](/icons/layout.gif) | 5659_FASHION ILLUSTRATION CURRICULUM.pdf | 2025-05-19 11:05 | 93K | |
![[IMG]](/icons/image2.gif) | 6713_Final block 3.jpg | 2025-05-19 11:03 | 93K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0575.jpg | 2025-05-19 11:03 | 93K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-21.jpg | 2025-05-19 11:04 | 93K | |
![[IMG]](/icons/image2.gif) | 4720_IMG-20200725-WA0040.jpg | 2025-05-19 11:05 | 93K | |
![[IMG]](/icons/image2.gif) | 2836_IMG-20181019-WA0010.jpg | 2025-05-19 11:03 | 93K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0410.jpg | 2025-05-19 11:05 | 93K | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya (5).jpg | 2025-05-19 11:05 | 93K | |
![[IMG]](/icons/image2.gif) | 2507_Woman at SG 8.jpg | 2025-05-19 11:03 | 93K | |
![[IMG]](/icons/image2.gif) | 2956_50927192_2123453024385993_5104342080361070592_n.jpg | 2025-05-19 11:04 | 93K | |
![[IMG]](/icons/image2.gif) | 6267_IMG-20241018-WA0026.jpg | 2025-05-19 11:05 | 93K | |
![[IMG]](/icons/image2.gif) | 5226_IMG-20211127-WA0062.jpg | 2025-05-19 11:04 | 93K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0649.jpg | 2025-05-19 11:04 | 93K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0506.jpg | 2025-05-19 11:07 | 94K | |
![[IMG]](/icons/image2.gif) | 3941_Makeup Progress.jpg | 2025-05-19 11:04 | 94K | |
![[IMG]](/icons/image2.gif) | 6633_WhatsApp Image 2024-06-08 at 15.10.02_514df61e.jpg | 2025-05-19 11:04 | 94K | |
![[IMG]](/icons/image2.gif) | 2926_Community Members working on Construction and Infrastructure.jpg | 2025-05-19 11:05 | 94K | |
![[IMG]](/icons/image2.gif) | 6515_IMG-20230502-WA0058.jpg | 2025-05-19 11:05 | 94K | |
![[IMG]](/icons/image2.gif) | 4720_IMG-20200725-WA0039.jpg | 2025-05-19 11:03 | 94K | |
![[IMG]](/icons/image2.gif) | 3730_d33074c5-6842-4191-b372-29b3c076ab04.jpg | 2025-05-19 11:04 | 94K | |
![[IMG]](/icons/image2.gif) | 614_11070246_2756004510434_7560861363317892407_n.jpg | 2025-05-19 11:05 | 94K | |
![[IMG]](/icons/image2.gif) | 6515_IMG-20230502-WA0023.jpg | 2025-05-19 11:05 | 94K | |
![[IMG]](/icons/image2.gif) | 6239_IMG_20230825_151807_673.jpg | 2025-05-19 11:05 | 95K | |
![[IMG]](/icons/image2.gif) | 3340_IMG-20190129-WA0030.jpg | 2025-05-19 11:05 | 95K | |
![[IMG]](/icons/image2.gif) | 6104_IMG-20230703-WA0221.jpg | 2025-05-19 11:07 | 95K | |
![[IMG]](/icons/image2.gif) | 6296_IMG-20230126-WA0046.jpg | 2025-05-19 11:07 | 95K | |
![[IMG]](/icons/image2.gif) | 6633_WhatsApp Image 2024-06-08 at 15.09.54_9f1fa6e8.jpg | 2025-05-19 11:05 | 95K | |
![[IMG]](/icons/image2.gif) | 1413_Air Compressor picture.jpg | 2025-05-19 11:04 | 96K | |
![[IMG]](/icons/image2.gif) | 2281_Participant #1-Binwell Mgona.jpg | 2025-05-19 11:03 | 96K | |
![[IMG]](/icons/image2.gif) | 3774_Chief Justin grants land for the project.jpg | 2025-05-19 11:03 | 96K | |
![[IMG]](/icons/image2.gif) | 6155_Foundation digging stage.jpg | 2025-05-19 11:03 | 96K | |
![[IMG]](/icons/image2.gif) | 6551_IMG-20240811-WA0030.jpg | 2025-05-19 11:05 | 96K | |
![[IMG]](/icons/image2.gif) | 2658_29597942_316030428925326_6141996017787318616_n.jpg | 2025-05-19 11:05 | 96K | |
![[IMG]](/icons/image2.gif) | 2991_FB_IMG_1549002716039.jpg | 2025-05-19 11:03 | 96K | |
![[IMG]](/icons/image2.gif) | 3049_IMG-20190221-WA0010.jpg | 2025-05-19 11:03 | 96K | |
![[IMG]](/icons/image2.gif) | 1242_IMG-20161113-WA0000.jpg | 2025-05-19 11:03 | 96K | |
![[ ]](/icons/unknown.gif) | 2124_Evaluación colegio.docx | 2025-05-19 11:03 | 97K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-28.jpg | 2025-05-19 11:05 | 97K | |
![[IMG]](/icons/image2.gif) | 2507_women workshop 2.jpg | 2025-05-19 11:05 | 98K | |
![[IMG]](/icons/image2.gif) | 6525_IMG-20230601-WA0011.jpg | 2025-05-19 11:03 | 98K | |
![[ ]](/icons/unknown.gif) | 821_Recetas de cocina.docx | 2025-05-19 11:05 | 98K | |
![[IMG]](/icons/image2.gif) | 6551_IMG-20240811-WA0028.jpg | 2025-05-19 11:07 | 98K | |
![[IMG]](/icons/image2.gif) | 2810_Delivery Kit and Surgical kit.jpg | 2025-05-19 11:03 | 98K | |
![[IMG]](/icons/image2.gif) | 4421_IMG-20221212-WA0012.jpg | 2025-05-19 11:04 | 98K | |
![[IMG]](/icons/image2.gif) | 2152_IMG-20170616-WA0005.jpg | 2025-05-19 11:03 | 98K | |
![[IMG]](/icons/image2.gif) | 6155_Final phase stage.jpg | 2025-05-19 11:03 | 98K | |
![[ ]](/icons/compressed.gif) | Final Report_20-013 (Malunga, Joshua) - Files.zip | 2025-05-19 11:03 | 98K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0413.jpg | 2025-05-19 11:05 | 98K | |
![[IMG]](/icons/image2.gif) | 5443_FB_IMG_1701118702567.jpg | 2025-05-19 11:03 | 98K | |
![[IMG]](/icons/image2.gif) | 6713_Final block 5.jpg | 2025-05-19 11:05 | 98K | |
![[IMG]](/icons/image2.gif) | 6713_Hand over 1.jpg | 2025-05-19 11:04 | 98K | |
![[IMG]](/icons/image2.gif) | 2281_Participant #2-Doreen Moses.jpg | 2025-05-19 11:04 | 98K | |
![[IMG]](/icons/image2.gif) | 4421_IMG-20221212-WA0008.jpg | 2025-05-19 11:05 | 98K | |
![[IMG]](/icons/image2.gif) | 6303_IMG-20240412-WA0027.jpg | 2025-05-19 11:04 | 98K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-25.jpg | 2025-05-19 11:04 | 99K | |
![[IMG]](/icons/image2.gif) | 6303_IMG-20240412-WA0035.jpg | 2025-05-19 11:05 | 99K | |
![[IMG]](/icons/image2.gif) | 4421_IMG-20221212-WA0007.jpg | 2025-05-19 11:03 | 99K | |
![[IMG]](/icons/image2.gif) | 2658_29597913_316030118925357_5284068847506701901_n.jpg | 2025-05-19 11:03 | 99K | |
![[IMG]](/icons/image2.gif) | 7017_18.jpg | 2025-06-06 17:54 | 99K | |
![[IMG]](/icons/image2.gif) | 2976_IMG-20190726-WA0005.jpg | 2025-05-19 11:07 | 99K | |
![[IMG]](/icons/image2.gif) | 6692_Branding.jpg | 2025-05-19 11:04 | 99K | |
![[IMG]](/icons/image2.gif) | 3730_194322b2-7358-4509-9596-c0dbbc920151.jpg | 2025-05-19 11:06 | 99K | |
![[IMG]](/icons/image2.gif) | 3730_2e34a406-4796-49f0-bf12-7b78637e09df.jpg | 2025-05-19 11:04 | 99K | |
![[IMG]](/icons/image2.gif) | 6531_cyclo.jpg | 2025-05-19 11:05 | 99K | |
![[IMG]](/icons/image2.gif) | 2507_women pionner summit.jpg | 2025-05-19 11:03 | 100K | |
![[IMG]](/icons/image2.gif) | 760_14407926_1150309318360603_2082858452_o.jpg | 2025-05-19 11:04 | 100K | |
![[IMG]](/icons/image2.gif) | 3281_IMG-20190226-WA0016.jpg | 2025-05-19 11:03 | 100K | |
![[IMG]](/icons/image2.gif) | 6633_WhatsApp Image 2024-06-08 at 15.10.11_14633bb1.jpg | 2025-05-19 11:05 | 100K | |
![[IMG]](/icons/image2.gif) | 1335_28170111_2028253437235493_1246632657_o.jpg | 2025-05-19 11:05 | 100K | |
![[IMG]](/icons/image2.gif) | 2281_Participant #3-Pilirani Endifala.jpg | 2025-05-19 11:04 | 100K | |
![[IMG]](/icons/image2.gif) | 6797_IMG-20240821-WA0019.jpg | 2025-05-19 11:06 | 100K | |
![[IMG]](/icons/image2.gif) | 6633_WhatsApp Image 2024-06-08 at 15.10.17_89b536eb.jpg | 2025-05-19 11:06 | 100K | |
![[IMG]](/icons/image2.gif) | 5848_IMG-20221112-WA0067.jpg | 2025-05-19 11:04 | 100K | |
![[IMG]](/icons/image2.gif) | 4439_IMG-20200422-WA0025.jpg | 2025-05-19 11:05 | 100K | |
![[IMG]](/icons/image2.gif) | 2507_SG 12th edition.jpg | 2025-05-19 11:03 | 100K | |
![[IMG]](/icons/image2.gif) | 6897_HLFTGC2.jpg | 2025-05-19 11:03 | 100K | |
![[IMG]](/icons/image2.gif) | 1242_IMG-20161113-WA0001.jpg | 2025-05-19 11:05 | 100K | |
![[IMG]](/icons/image2.gif) | 2976_district consultative meeting.jpg | 2025-05-19 11:04 | 101K | |
![[IMG]](/icons/image2.gif) | 822_IMG_6301.JPG | 2025-05-19 11:05 | 101K | |
![[IMG]](/icons/image2.gif) | 3730_73c10658-80e2-45c8-ae70-99bcaae3ca3a.jpg | 2025-05-19 11:03 | 101K | |
![[IMG]](/icons/image2.gif) | 2658_19731819_316029602258742_7147094798433278942_n.jpg | 2025-05-19 11:05 | 101K | |
![[IMG]](/icons/image2.gif) | 822_IMG_6519.JPG | 2025-05-19 11:06 | 101K | |
![[ ]](/icons/unknown.gif) | 2956_Mushroom trianing india.docx | 2025-05-19 11:04 | 101K | |
![[IMG]](/icons/image2.gif) | 4514_2d5f98fe-a36b-45fa-9939-c538540462a5.JPG | 2025-05-19 11:03 | 101K | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya (2).jpg | 2025-05-19 11:05 | 101K | |
![[IMG]](/icons/image2.gif) | 1248_34.jpg | 2025-05-19 11:05 | 101K | |
![[ ]](/icons/layout.gif) | 5284_Final Report - University of Malawi_120656.pdf | 2025-05-19 11:03 | 101K | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3951.JPG | 2025-05-19 11:03 | 101K | |
![[IMG]](/icons/image2.gif) | 5226_IMG-20211127-WA0054.jpg | 2025-05-19 11:05 | 101K | |
![[IMG]](/icons/image2.gif) | 3941_Bead work done 1.jpg | 2025-05-19 11:05 | 102K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0121.jpg | 2025-05-19 11:07 | 102K | |
![[ ]](/icons/layout.gif) | 5284_kuloilerr..pdf | 2025-05-19 11:03 | 102K | |
![[IMG]](/icons/image2.gif) | 3785_IMG-20230512-WA0044.jpg | 2025-05-19 11:03 | 102K | |
![[IMG]](/icons/image2.gif) | 3730_46c1e5dc-4e12-4fee-b883-4e385c2b3792.jpg | 2025-05-19 11:04 | 102K | |
![[IMG]](/icons/image2.gif) | 615_Youth Raising Awareness.jpg | 2025-05-19 11:03 | 102K | |
![[IMG]](/icons/image2.gif) | 4514_a6765ab8-8eba-4745-8a0c-0a16277322c3.JPG | 2025-05-19 11:05 | 102K | |
![[IMG]](/icons/image2.gif) | 2285_IMG-20180130-WA0017.jpg | 2025-05-19 11:04 | 102K | |
![[IMG]](/icons/image2.gif) | 2285_IMG-20180212-WA0004.jpg | 2025-05-19 11:04 | 102K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0356.jpg | 2025-05-19 11:04 | 102K | |
![[IMG]](/icons/image2.gif) | 3730_53a88e9e-db43-4c48-8663-4090781bce7e.jpg | 2025-05-19 11:07 | 102K | |
![[IMG]](/icons/image2.gif) | 2048_IMG_0892.JPG | 2025-05-19 11:07 | 103K | |
![[IMG]](/icons/image2.gif) | 6713_Hand over 3.jpg | 2025-05-19 11:05 | 103K | |
![[IMG]](/icons/image2.gif) | 3730_aa55cd49-1c66-4c2d-8d59-781ad52af266.jpg | 2025-05-19 11:04 | 103K | |
![[IMG]](/icons/image2.gif) | 3049_IMG-20200122-WA0017.jpg | 2025-05-19 11:05 | 103K | |
![[IMG]](/icons/image2.gif) | 760_14803266_1175636452494556_541686504_o.jpg | 2025-05-19 11:07 | 103K | |
![[IMG]](/icons/image2.gif) | 3941_Full Makeup Glam by Partipant 1.jpg | 2025-05-19 11:04 | 103K | |
![[IMG]](/icons/image2.gif) | 5792_IMG-20221204-WA0039.jpg | 2025-05-19 11:05 | 103K | |
![[IMG]](/icons/image2.gif) | 3730_53a055f9-9957-4dcd-9a75-7495339359cb.jpg | 2025-05-19 11:04 | 103K | |
![[IMG]](/icons/image2.gif) | 2658_29597527_316029445592091_5330249069791315587_n.jpg | 2025-05-19 11:06 | 103K | |
![[IMG]](/icons/image2.gif) | 3281_IMG-20190226-WA0018.jpg | 2025-05-19 11:06 | 103K | |
![[IMG]](/icons/image2.gif) | 6155_Foundation stage.jpg | 2025-05-19 11:05 | 103K | |
![[IMG]](/icons/image2.gif) | 3263_Lunch Specials.jpg | 2025-05-19 11:04 | 103K | |
![[IMG]](/icons/image2.gif) | 3941_Participant adorned in bead and headpiece work by them.jpg | 2025-05-19 11:04 | 103K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0446.jpg | 2025-05-19 11:03 | 103K | |
![[IMG]](/icons/image2.gif) | 3941_Makeup Progress 1.jpg | 2025-05-19 11:05 | 103K | |
![[IMG]](/icons/image2.gif) | 4778_HXFU6964[1].JPG | 2025-05-19 11:04 | 104K | |
![[IMG]](/icons/image2.gif) | 615_Youth Condom Distribution Campaign.jpg | 2025-05-19 11:05 | 104K | |
![[IMG]](/icons/image2.gif) | 6618_IMG-20241011-WA0006.jpg | 2025-05-19 11:04 | 104K | |
![[IMG]](/icons/image2.gif) | 3731_IMG-20200214-WA0016.jpg | 2025-05-19 11:04 | 104K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0615.jpg | 2025-05-19 11:03 | 104K | |
![[IMG]](/icons/image2.gif) | 5792_IMG-20221204-WA0008.jpg | 2025-05-19 11:06 | 104K | |
![[IMG]](/icons/image2.gif) | 6627_IMG-20231204-WA0028.jpg | 2025-05-19 11:07 | 104K | |
![[IMG]](/icons/image2.gif) | 2507_Woman at SG 13.jpg | 2025-05-19 11:03 | 104K | |
![[IMG]](/icons/image2.gif) | 5697_DSC00789.JPG | 2025-05-19 11:05 | 104K | |
![[ ]](/icons/layout.gif) | 6618_ANALYSIS RESULTS.pdf | 2025-05-19 11:05 | 104K | |
![[ ]](/icons/layout.gif) | 2128_IMAGE.pdf | 2025-05-19 11:05 | 104K | |
![[IMG]](/icons/image2.gif) | 4514_f8ed5b15-8760-448b-85ae-a87f9e40333a.JPG | 2025-05-19 11:05 | 105K | |
![[IMG]](/icons/image2.gif) | 1674_18813264_770293589804426_3252031342472211989_n.jpg | 2025-05-19 11:03 | 105K | |
![[IMG]](/icons/image2.gif) | 1012_IMG_8119.jpg | 2025-05-19 11:03 | 105K | |
![[IMG]](/icons/image2.gif) | 3730_a8c2ce45-d8db-41eb-a182-6a5a1f1483af.jpg | 2025-05-19 11:03 | 105K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0545.jpg | 2025-05-19 11:07 | 105K | |
![[IMG]](/icons/image2.gif) | 4778_footsteps staff - doing packaging of the food packs.jpg | 2025-05-19 11:05 | 105K | |
![[IMG]](/icons/image2.gif) | 760_14446339_1150309291693939_72789995_o.jpg | 2025-05-19 11:03 | 105K | |
![[ ]](/icons/unknown.gif) | 3245_OWI.Reg.Forms.Waste.Collection.2019.doc | 2025-05-19 11:06 | 105K | |
![[IMG]](/icons/image2.gif) | 4421_IMG-20221212-WA0005.jpg | 2025-05-19 11:06 | 105K | |
![[ ]](/icons/layout.gif) | 1445_Final Grant Receipts Cover Sheet_131442386483544164.pdf | 2025-05-19 11:05 | 105K | |
![[IMG]](/icons/image2.gif) | 1413_Dolly minga picture 2.jpg | 2025-05-19 11:05 | 105K | |
![[IMG]](/icons/image2.gif) | 6633_WhatsApp Image 2024-06-08 at 15.10.01_929dd6b6.jpg | 2025-05-19 11:04 | 105K | |
![[IMG]](/icons/image2.gif) | 2658_29683541_316029515592084_6997627415588184216_n.jpg | 2025-05-19 11:04 | 105K | |
![[IMG]](/icons/image2.gif) | 2531_IMG-20181024-WA0050.jpg | 2025-05-19 11:05 | 105K | |
![[IMG]](/icons/image2.gif) | 760_14808772_1175636615827873_1771520548_o.jpg | 2025-05-19 11:07 | 106K | |
![[IMG]](/icons/image2.gif) | 2658_29598087_316030235592012_6392661465698096500_n.jpg | 2025-05-19 11:04 | 106K | |
![[IMG]](/icons/image2.gif) | 2281_Local leader.jpg | 2025-05-19 11:03 | 106K | |
![[IMG]](/icons/image2.gif) | 2539_DR Participant. iACT, 2018.JPG | 2025-05-19 11:04 | 106K | |
![[IMG]](/icons/image2.gif) | 3263_76935584_2451127261873892_58264207782576128_n.jpg | 2025-05-19 11:05 | 106K | |
![[IMG]](/icons/image2.gif) | 916_IMG_3814.JPG | 2025-05-19 11:06 | 106K | |
![[IMG]](/icons/image2.gif) | 6627_IMG-20231204-WA0023.jpg | 2025-05-19 11:03 | 106K | |
![[IMG]](/icons/image2.gif) | 1248_32.jpg | 2025-05-19 11:07 | 106K | |
![[IMG]](/icons/image2.gif) | 1674_18740801_770293753137743_3093688037584530652_n.jpg | 2025-05-19 11:04 | 106K | |
![[IMG]](/icons/image2.gif) | 4778_girls and families receiving food package.jpg | 2025-05-19 11:03 | 106K | |
![[IMG]](/icons/image2.gif) | 760_14438795_1150308101694058_1350325187_o.jpg | 2025-05-19 11:05 | 106K | |
![[IMG]](/icons/image2.gif) | 6633_WhatsApp Image 2024-06-08 at 15.09.39_dce91959.jpg | 2025-05-19 11:07 | 107K | |
![[IMG]](/icons/image2.gif) | 3657_Guillermina pic.png | 2025-05-19 11:06 | 107K | |
![[IMG]](/icons/image2.gif) | 3941_Beads training - Facilitator and trainers.jpg | 2025-05-19 11:05 | 107K | |
![[IMG]](/icons/image2.gif) | 5576_IMG-20230621-WA0034.jpg | 2025-05-19 11:05 | 107K | |
![[IMG]](/icons/image2.gif) | 6627_IMG-20231204-WA0021.jpg | 2025-05-19 11:05 | 107K | |
![[IMG]](/icons/image2.gif) | 5226_IMG-20211127-WA0005.jpg | 2025-05-19 11:05 | 107K | |
![[IMG]](/icons/image2.gif) | 3730_66fdbdd8-d6a4-445a-9573-5286388ccd10.jpg | 2025-05-19 11:05 | 107K | |
![[IMG]](/icons/image2.gif) | 1413_Delivering cow milk w dolly picture.jpg | 2025-05-19 11:05 | 107K | |
![[IMG]](/icons/image2.gif) | 2976_Training of agents.jpg | 2025-05-19 11:03 | 107K | |
![[IMG]](/icons/image2.gif) | 3730_1b10ff57-2d40-42ae-8a48-dd8ddaa08511.jpg | 2025-05-19 11:03 | 108K | |
![[IMG]](/icons/image2.gif) | 5848_IMG-20221109-WA0016.jpg | 2025-05-19 11:03 | 108K | |
![[IMG]](/icons/image2.gif) | 2533_df3d97af-a278-4e71-9722-48984d462546.jpg | 2025-05-19 11:03 | 108K | |
![[IMG]](/icons/image2.gif) | 760_14424141_1150309211693947_980152315_o.jpg | 2025-05-19 11:05 | 108K | |
![[IMG]](/icons/image2.gif) | 760_14446246_1150309268360608_58886936_o.jpg | 2025-05-19 11:03 | 108K | |
![[IMG]](/icons/image2.gif) | 1012_IMG_8549.jpg | 2025-05-19 11:03 | 108K | |
![[IMG]](/icons/image2.gif) | 2533_53257b87-bc2e-4eac-a134-d9e313ce5f82.jpg | 2025-05-19 11:04 | 108K | |
![[IMG]](/icons/image2.gif) | 3730_1d153004-d2ba-4da6-8226-e839492bf398.jpg | 2025-05-19 11:06 | 108K | |
![[IMG]](/icons/image2.gif) | 2117_Sabalito school visit.jpg | 2025-05-19 11:05 | 108K | |
![[IMG]](/icons/image2.gif) | 7017_6.jpg | 2025-06-06 17:54 | 108K | |
![[IMG]](/icons/image2.gif) | 3640_IMG-20221102-WA0011.jpg | 2025-05-19 11:03 | 108K | |
![[IMG]](/icons/image2.gif) | 2507_SG Director awarded.jpg | 2025-05-19 11:04 | 109K | |
![[IMG]](/icons/image2.gif) | 2976_Talent show.jpg | 2025-05-19 11:04 | 109K | |
![[IMG]](/icons/image2.gif) | 2976_IMG-20190726-WA0022.jpg | 2025-05-19 11:05 | 109K | |
![[IMG]](/icons/image2.gif) | 5576_IMG-20230621-WA0035.jpg | 2025-05-19 11:03 | 109K | |
![[IMG]](/icons/image2.gif) | 3155_IMG_2706.JPG | 2025-05-19 11:07 | 109K | |
![[IMG]](/icons/image2.gif) | 760_14446392_1150309065027295_880109028_o.jpg | 2025-05-19 11:06 | 109K | |
![[IMG]](/icons/image2.gif) | 6267_IMG-20241018-WA0027.jpg | 2025-05-19 11:05 | 109K | |
![[IMG]](/icons/image2.gif) | 3730_830f36d1-a852-4ba4-b116-983580170ffb.jpg | 2025-05-19 11:03 | 109K | |
![[IMG]](/icons/image2.gif) | 3709_Pic 2.jpg | 2025-05-19 11:07 | 109K | |
![[IMG]](/icons/image2.gif) | 3730_01cd2391-eee1-490e-aa62-4461314a956d.jpg | 2025-05-19 11:03 | 109K | |
![[IMG]](/icons/image2.gif) | 615_Youth_TB Awareness.jpg | 2025-05-19 11:03 | 110K | |
![[IMG]](/icons/image2.gif) | 3730_2e96639e-af11-4fb3-a4cd-1a70c921356d.jpg | 2025-05-19 11:04 | 110K | |
![[IMG]](/icons/image2.gif) | 3627_image 2.1.jpg | 2025-05-19 11:05 | 110K | |
![[IMG]](/icons/image2.gif) | 3730_c81d0ef2-dadd-4e78-a289-edc90f72d383.jpg | 2025-05-19 11:03 | 110K | |
![[IMG]](/icons/image2.gif) | 2658_29684035_316030062258696_3967043967277522044_n.jpg | 2025-05-19 11:05 | 110K | |
![[IMG]](/icons/image2.gif) | 2672_IMG-20180421-WA0003.jpg | 2025-05-19 11:03 | 110K | |
![[IMG]](/icons/image2.gif) | 3730_8eb7ccfa-a32d-49db-82a5-234c140f6929.jpg | 2025-05-19 11:03 | 110K | |
![[IMG]](/icons/image2.gif) | 2285_IMG-20180212-WA0007.jpg | 2025-05-19 11:07 | 110K | |
![[IMG]](/icons/image2.gif) | 6525_IMG-20230413-WA0073.jpg | 2025-05-19 11:04 | 110K | |
![[IMG]](/icons/image2.gif) | 3730_4191f585-5da8-4cb4-81da-54976d0d6173.jpg | 2025-05-19 11:05 | 110K | |
![[IMG]](/icons/image2.gif) | 2841_51421355_2266248136981383_8297507826641666048_n.jpg | 2025-05-19 11:03 | 111K | |
![[IMG]](/icons/image2.gif) | 5576_IMG-20230621-WA0032.jpg | 2025-05-19 11:03 | 111K | |
![[IMG]](/icons/image2.gif) | 2477_IMG_5072.JPG | 2025-05-19 11:05 | 111K | |
![[IMG]](/icons/image2.gif) | 2530_cistern final.jpg | 2025-05-19 11:03 | 111K | |
![[IMG]](/icons/image2.gif) | 2672_IMG-20180421-WA0002.jpg | 2025-05-19 11:03 | 111K | |
![[IMG]](/icons/image2.gif) | 5648_GuardUp 22.jpg | 2025-05-19 11:05 | 111K | |
![[IMG]](/icons/image2.gif) | 6797_IMG-20240821-WA0014.jpg | 2025-05-19 11:03 | 111K | |
![[IMG]](/icons/image2.gif) | 3730_0b2bef08-212e-4ccf-b83e-629a8f966eb5.jpg | 2025-05-19 11:03 | 112K | |
![[IMG]](/icons/image2.gif) | 3596_FOTO-kryesore.jpg | 2025-05-19 11:03 | 112K | |
![[IMG]](/icons/image2.gif) | 3772_Women Accessing safe water at Pwemphwe.jpg | 2025-05-19 11:03 | 112K | |
![[IMG]](/icons/image2.gif) | 3627_Image 1.1.3.jpg | 2025-05-19 11:05 | 112K | |
![[IMG]](/icons/image2.gif) | 3941_Full Makeup Glam by Partipant.jpg | 2025-05-19 11:05 | 112K | |
![[IMG]](/icons/image2.gif) | 2507_women in workshop.jpg | 2025-05-19 11:04 | 112K | |
![[IMG]](/icons/image2.gif) | 2624_MUSHROOM READY FOR HAARVEST.jpg | 2025-05-19 11:05 | 112K | |
![[IMG]](/icons/image2.gif) | 3155_IMG_2708.JPG | 2025-05-19 11:03 | 113K | |
![[IMG]](/icons/image2.gif) | 1674_18765877_770293786471073_5766167084123860484_n.jpg | 2025-05-19 11:04 | 113K | |
![[IMG]](/icons/image2.gif) | 6551_IMG-20240811-WA0027.jpg | 2025-05-19 11:05 | 113K | |
![[IMG]](/icons/image2.gif) | 2841_51526237_2267540903518773_6341135624719826944_n.jpg | 2025-05-19 11:04 | 113K | |
![[IMG]](/icons/image2.gif) | 859_IMG-20160321-WA0018.jpg | 2025-05-19 11:03 | 113K | |
![[IMG]](/icons/image2.gif) | 6633_WhatsApp Image 2024-06-08 at 15.10.09_a47097d3.jpg | 2025-05-19 11:03 | 113K | |
![[IMG]](/icons/image2.gif) | 822_IMG_6277.JPG | 2025-05-19 11:04 | 113K | |
![[IMG]](/icons/image2.gif) | 760_14408283_1150309255027276_1105871682_o.jpg | 2025-05-19 11:04 | 113K | |
![[IMG]](/icons/image2.gif) | 3730_b61bf0bf-4132-473a-bf6e-00de59c16ec5.jpg | 2025-05-19 11:05 | 114K | |
![[IMG]](/icons/image2.gif) | 3730_c5f1d961-1ad9-45b2-8153-6a6adcecc551.jpg | 2025-05-19 11:03 | 114K | |
![[IMG]](/icons/image2.gif) | 5226_IMG-20211127-WA0047.jpg | 2025-05-19 11:05 | 114K | |
![[IMG]](/icons/image2.gif) | 4421_IMG-20221212-WA0006.jpg | 2025-05-19 11:07 | 114K | |
![[IMG]](/icons/image2.gif) | 4666_incinerator 1.jpg | 2025-05-19 11:05 | 114K | |
![[IMG]](/icons/image2.gif) | 6713_Final Block 1.jpg | 2025-05-19 11:06 | 114K | |
![[IMG]](/icons/image2.gif) | 6713_Final block 2.jpg | 2025-05-19 11:05 | 114K | |
![[IMG]](/icons/image2.gif) | 2976_commnity leader during awareness campaign.jpg | 2025-05-19 11:05 | 114K | |
![[IMG]](/icons/image2.gif) | 4439_IMG-20200422-WA0023.jpg | 2025-05-19 11:04 | 114K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0590.jpg | 2025-05-19 11:04 | 114K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-3.jpg | 2025-05-19 11:03 | 114K | |
![[IMG]](/icons/image2.gif) | 1413_Dolly minga picture 3.jpg | 2025-05-19 11:07 | 114K | |
![[IMG]](/icons/image2.gif) | 5226_IMG-20211127-WA0050.jpg | 2025-05-19 11:06 | 114K | |
![[IMG]](/icons/image2.gif) | 1674_18697990_770293343137784_1873320474640315348_n.jpg | 2025-05-19 11:05 | 114K | |
![[IMG]](/icons/image2.gif) | 1012_IMG_8121.jpg | 2025-05-19 11:05 | 114K | |
![[IMG]](/icons/image2.gif) | 2976_IMG-20190726-WA0014.jpg | 2025-05-19 11:03 | 115K | |
![[ ]](/icons/layout.gif) | 2514_Feuille de presence_Rapport activites_volontaires.pdf | 2025-05-19 11:07 | 115K | |
![[IMG]](/icons/image2.gif) | 2658_29791280_316030378925331_7919014997163725787_n.jpg | 2025-05-19 11:05 | 115K | |
![[IMG]](/icons/image2.gif) | 3730_d1de5ecd-2078-4017-8d83-1027f239cf48.jpg | 2025-05-19 11:03 | 115K | |
![[IMG]](/icons/image2.gif) | 6525_IMG-20230413-WA0075.jpg | 2025-05-19 11:03 | 115K | |
![[IMG]](/icons/image2.gif) | 3335_IMG-20190311-WA0256.jpg | 2025-05-19 11:04 | 115K | |
![[IMG]](/icons/image2.gif) | 2213_IMG-20171012-WA0025.jpg | 2025-05-19 11:05 | 115K | |
![[IMG]](/icons/image2.gif) | 3657_Trip to Museum Mirabal Sisters.png | 2025-05-19 11:06 | 115K | |
![[IMG]](/icons/image2.gif) | 3730_7c5155e3-6174-4f7e-97eb-5cccdd6c3f9c.jpg | 2025-05-19 11:03 | 115K | |
![[IMG]](/icons/image2.gif) | 2658_29683730_316031922258510_1485265003221772914_n.jpg | 2025-05-19 11:04 | 115K | |
![[IMG]](/icons/image2.gif) | 5380_Maize Mill House Contruction Photo.jpg | 2025-05-19 11:03 | 115K | |
![[IMG]](/icons/image2.gif) | 7017_5.jpg | 2025-06-06 17:54 | 115K | |
![[IMG]](/icons/image2.gif) | 3941_Bead work done 3.jpg | 2025-05-19 11:03 | 115K | |
![[IMG]](/icons/image2.gif) | 2400_eTrash2Cash8.jpg | 2025-05-19 11:03 | 115K | |
![[IMG]](/icons/image2.gif) | 4778_food distribution support to families.jpg | 2025-05-19 11:03 | 116K | |
![[IMG]](/icons/image2.gif) | 3340_IMG-20190317-WA0012.jpg | 2025-05-19 11:07 | 116K | |
![[IMG]](/icons/image2.gif) | 6633_WhatsApp Image 2024-06-08 at 15.06.02_f4c29a2d.jpg | 2025-05-19 11:05 | 116K | |
![[IMG]](/icons/image2.gif) | 2658_29597835_316030002258702_1150991999244270987_n.jpg | 2025-05-19 11:05 | 116K | |
![[IMG]](/icons/image2.gif) | 3730_fa7be6f0-fc08-4b2c-834b-e27d967004e9.jpg | 2025-05-19 11:04 | 116K | |
![[IMG]](/icons/image2.gif) | 2658_29790482_316030098925359_3012446803233142097_n.jpg | 2025-05-19 11:05 | 116K | |
![[IMG]](/icons/image2.gif) | 2926_Cristina mentoring Miriam onsite in the PreK Classroom.jpg | 2025-05-19 11:04 | 116K | |
![[ ]](/icons/layout.gif) | 5659_BASIC FASHION CURRICULUM.pdf | 2025-05-19 11:04 | 116K | |
![[IMG]](/icons/image2.gif) | 6155_Teacher's house in final phase.jpg | 2025-05-19 11:05 | 116K | |
![[IMG]](/icons/image2.gif) | 3515_CONNECT PIC 1.jpg | 2025-05-19 11:04 | 116K | |
![[IMG]](/icons/image2.gif) | 2658_29792097_316030575591978_2021339488427348317_n.jpg | 2025-05-19 11:05 | 116K | |
![[IMG]](/icons/image2.gif) | 6515_IMG-20230502-WA0038.jpg | 2025-05-19 11:05 | 117K | |
![[IMG]](/icons/image2.gif) | 3730_9e769de0-a9fc-4a4f-b209-e52fabac2acd.jpg | 2025-05-19 11:07 | 117K | |
![[IMG]](/icons/image2.gif) | 2658_29793041_316029765592059_1739721537523954113_n.jpg | 2025-05-19 11:05 | 117K | |
![[ ]](/icons/layout.gif) | 5659_GRAPHIC DESIGN CURRICULUM.pdf | 2025-05-19 11:06 | 117K | |
![[IMG]](/icons/image2.gif) | 3657_Doctor Suero.png | 2025-05-19 11:04 | 117K | |
![[IMG]](/icons/image2.gif) | 3941_Bead work done 4.jpg | 2025-05-19 11:04 | 117K | |
![[IMG]](/icons/image2.gif) | 3730_c06e2245-e719-413f-b660-5ddc4492d18e.jpg | 2025-05-19 11:03 | 117K | |
![[IMG]](/icons/image2.gif) | 4421_IMG-20221212-WA0004.jpg | 2025-05-19 11:05 | 117K | |
![[IMG]](/icons/image2.gif) | 3730_835ce820-2859-42f6-9673-8c5f6d49b2c3.jpg | 2025-05-19 11:05 | 117K | |
![[IMG]](/icons/image2.gif) | 3730_080b74d6-839a-47e0-a90f-d99064a41a16.jpg | 2025-05-19 11:06 | 117K | |
![[IMG]](/icons/image2.gif) | 2841_54521680_2292369644369232_3775657530315767808_n.jpg | 2025-05-19 11:05 | 117K | |
![[IMG]](/icons/image2.gif) | 3709_IMG-20200126-WA0015.jpg | 2025-05-19 11:05 | 118K | |
![[IMG]](/icons/image2.gif) | 1001_IMG_8875.JPG | 2025-05-19 11:05 | 118K | |
![[IMG]](/icons/image2.gif) | 3730_03e2f50d-4e25-4d58-83af-9e7a77560b19.jpg | 2025-05-19 11:04 | 118K | |
![[IMG]](/icons/image2.gif) | 5815_IMG-20220209-WA0031.jpg | 2025-05-19 11:04 | 118K | |
![[IMG]](/icons/image2.gif) | 3730_f815e7e9-2617-4054-83e4-b6729c573f44.jpg | 2025-05-19 11:05 | 118K | |
![[IMG]](/icons/image2.gif) | 3730_8167d630-2056-42f6-b485-5254be8fefce.jpg | 2025-05-19 11:04 | 118K | |
![[IMG]](/icons/image2.gif) | 2672_IMG-20180421-WA0004.jpg | 2025-05-19 11:06 | 118K | |
![[IMG]](/icons/image2.gif) | 3730_7d0090bd-e740-45eb-afd9-afe0646f4947.jpg | 2025-05-19 11:05 | 118K | |
![[IMG]](/icons/image2.gif) | 6104_malidade community water kiosk project led by world connect.jpg | 2025-05-19 11:07 | 118K | |
![[IMG]](/icons/image2.gif) | 6104_one-of-the-water-kiosks-in-ndirande-malawi-where-ownership-is-a-problem.jpg | 2025-05-19 11:03 | 118K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0371.jpg | 2025-05-19 11:03 | 118K | |
![[IMG]](/icons/image2.gif) | 3730_c0b5ab89-a0b6-417d-a895-d75884fc3964.jpg | 2025-05-19 11:07 | 118K | |
![[IMG]](/icons/image2.gif) | 6525_IMG-20230601-WA0076.jpg | 2025-05-19 11:03 | 118K | |
![[IMG]](/icons/image2.gif) | 1001_IMG_8935.JPG | 2025-05-19 11:06 | 119K | |
![[ ]](/icons/layout.gif) | 2514_Fiche enregistrement des eleves (1).pdf | 2025-05-19 11:04 | 119K | |
![[IMG]](/icons/image2.gif) | 4421_IMG-20221212-WA0027.jpg | 2025-05-19 11:05 | 119K | |
![[IMG]](/icons/image2.gif) | 3263_Work Project.jpg | 2025-05-19 11:04 | 119K | |
![[IMG]](/icons/image2.gif) | 3730_4bb16531-5c35-4865-bc81-b8b6c1b85dd9.jpg | 2025-05-19 11:03 | 119K | |
![[IMG]](/icons/image2.gif) | 1248_1DRRM.jpg | 2025-05-19 11:04 | 119K | |
![[IMG]](/icons/image2.gif) | 2841_54279321_2292305037709026_7874343304765112320_n.jpg | 2025-05-19 11:07 | 119K | |
![[IMG]](/icons/image2.gif) | 2533_IMG_6390.jpg | 2025-05-19 11:06 | 119K | |
![[IMG]](/icons/image2.gif) | 2048_IMG_0951.JPG | 2025-05-19 11:03 | 119K | |
![[IMG]](/icons/image2.gif) | 3730_b2098a5c-a279-497c-a373-af1c16c4a97e.jpg | 2025-05-19 11:03 | 120K | |
![[IMG]](/icons/image2.gif) | 1410_Honey-Beauty-Products.jpg | 2025-05-19 11:03 | 120K | |
![[IMG]](/icons/image2.gif) | 3730_3eb4508b-add0-43bd-9085-426e5e4b6a44.jpg | 2025-05-19 11:05 | 120K | |
![[IMG]](/icons/image2.gif) | 2658_29790751_316029918925377_5624666858933788218_n.jpg | 2025-05-19 11:06 | 120K | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (16).jpg | 2025-05-19 11:07 | 120K | |
![[IMG]](/icons/image2.gif) | 822_LanyardFront.jpg | 2025-05-19 11:03 | 120K | |
![[IMG]](/icons/image2.gif) | 6104_1686315410253.jpg | 2025-05-19 11:05 | 120K | |
![[IMG]](/icons/image2.gif) | 6551_IMG-20240811-WA0053.jpg | 2025-05-19 11:05 | 120K | |
![[IMG]](/icons/image2.gif) | 3731_IMG-20200214-WA0006.jpg | 2025-05-19 11:05 | 120K | |
![[IMG]](/icons/image2.gif) | 6515_IMG-20230502-WA0033.jpg | 2025-05-19 11:05 | 120K | |
![[IMG]](/icons/image2.gif) | 3731_IMG-20200214-WA0015.jpg | 2025-05-19 11:04 | 120K | |
![[IMG]](/icons/image2.gif) | 3730_ece1cb83-a5f2-47d3-8d59-76305a8a8709.jpg | 2025-05-19 11:04 | 120K | |
![[IMG]](/icons/image2.gif) | 6267_IMG-20241018-WA0028.jpg | 2025-05-19 11:07 | 120K | |
![[IMG]](/icons/image2.gif) | 2658_29694667_316029632258739_3783667798722170561_n.jpg | 2025-05-19 11:05 | 120K | |
![[IMG]](/icons/image2.gif) | 3730_06b1bbbe-aa6f-4dde-adae-16d5a408b748.jpg | 2025-05-19 11:06 | 121K | |
![[IMG]](/icons/image2.gif) | 3730_b4ce2dcf-82d7-46ba-9584-30e7df28e98b.jpg | 2025-05-19 11:04 | 121K | |
![[IMG]](/icons/image2.gif) | 6296_IMG-20230126-WA0045.jpg | 2025-05-19 11:03 | 121K | |
![[IMG]](/icons/image2.gif) | 6633_WhatsApp Image 2024-06-08 at 15.10.12_23cfa929.jpg | 2025-05-19 11:04 | 121K | |
![[IMG]](/icons/image2.gif) | 614_11036084_2864821030779_2369353824294913920_n.jpg | 2025-05-19 11:05 | 121K | |
![[IMG]](/icons/image2.gif) | 4678_IMG-20200513-WA0025.jpg | 2025-05-19 11:04 | 121K | |
![[IMG]](/icons/image2.gif) | 6551_IMG-20240811-WA0037.jpg | 2025-05-19 11:06 | 121K | |
![[IMG]](/icons/image2.gif) | 2533_IMG_8695.jpg | 2025-05-19 11:04 | 121K | |
![[IMG]](/icons/image2.gif) | 6713_Hand over 2.jpg | 2025-05-19 11:05 | 121K | |
![[IMG]](/icons/image2.gif) | 7017_21.jpg | 2025-06-06 17:54 | 121K | |
![[IMG]](/icons/image2.gif) | 2048_IMG_0895.JPG | 2025-05-19 11:03 | 121K | |
![[IMG]](/icons/image2.gif) | 822_IMG_7713.JPG | 2025-05-19 11:05 | 121K | |
![[IMG]](/icons/image2.gif) | 3730_311554d8-1249-4da8-a35d-bd97b4a42b83.jpg | 2025-05-19 11:05 | 121K | |
![[IMG]](/icons/image2.gif) | 2048_IMG_0883.JPG | 2025-05-19 11:03 | 121K | |
![[ ]](/icons/layout.gif) | 4258_Area 49 Rec Book one.pdf | 2025-05-19 11:07 | 122K | |
![[IMG]](/icons/image2.gif) | 2841_54520619_2292369651035898_1835417745248747520_n.jpg | 2025-05-19 11:05 | 122K | |
![[IMG]](/icons/image2.gif) | 2658_30124597_316030262258676_2650245069960039608_n.jpg | 2025-05-19 11:05 | 122K | |
![[IMG]](/icons/image2.gif) | 3730_6a6c6bba-543b-4d0e-b646-de1514af0383.jpg | 2025-05-19 11:03 | 122K | |
![[ ]](/icons/layout.gif) | 5284_VENUE FOR TRAINING.pdf | 2025-05-19 11:05 | 122K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0388.jpg | 2025-05-19 11:06 | 122K | |
![[IMG]](/icons/image2.gif) | 3730_6369e93a-10d6-45fb-86e5-5488aac422e5.jpg | 2025-05-19 11:05 | 122K | |
![[IMG]](/icons/image2.gif) | 2255_ea93d67a-4ab6-4aa5-99e8-c77bcd9e5b05.JPG | 2025-05-19 11:05 | 122K | |
![[IMG]](/icons/image2.gif) | 5226_IMG-20211127-WA0049.jpg | 2025-05-19 11:05 | 122K | |
![[IMG]](/icons/image2.gif) | 6515_IMG-20230502-WA0006.jpg | 2025-05-19 11:05 | 123K | |
![[IMG]](/icons/image2.gif) | 3730_9754dd09-3e17-4b50-acfc-7d720ac9eb26.jpg | 2025-05-19 11:04 | 123K | |
![[IMG]](/icons/image2.gif) | 6797_IMG-20240821-WA0024.jpg | 2025-05-19 11:03 | 123K | |
![[IMG]](/icons/image2.gif) | 2658_29598122_316031885591847_8255450579321096710_n.jpg | 2025-05-19 11:05 | 123K | |
![[IMG]](/icons/image2.gif) | 3730_259e183e-6edb-4a71-8641-ca7ebef00583.jpg | 2025-05-19 11:03 | 123K | |
![[ ]](/icons/layout.gif) | 5659_BASIC PHOTOGRAPHY CURRICULUM.pdf | 2025-05-19 11:06 | 124K | |
![[IMG]](/icons/image2.gif) | 6797_IMG-20240821-WA0032.jpg | 2025-05-19 11:05 | 124K | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya (4).jpg | 2025-05-19 11:05 | 124K | |
![[IMG]](/icons/image2.gif) | 2658_IMG-20180605-WA0003.jpg | 2025-05-19 11:05 | 124K | |
![[IMG]](/icons/image2.gif) | 3620_IMG-20190403-WA0041.jpg | 2025-05-19 11:04 | 124K | |
![[IMG]](/icons/image2.gif) | 3730_490bfb89-de61-43e3-8dec-eae3e644b386.jpg | 2025-05-19 11:03 | 124K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231219-WA0233.jpg | 2025-05-19 11:03 | 124K | |
![[IMG]](/icons/image2.gif) | 4666_incinerator 5.jpg | 2025-05-19 11:04 | 124K | |
![[IMG]](/icons/image2.gif) | 3941_Bead work done 2.jpg | 2025-05-19 11:04 | 124K | |
![[IMG]](/icons/image2.gif) | 3730_17df0be3-ef7a-4348-8ed3-a0e55d356842.jpg | 2025-05-19 11:06 | 124K | |
![[IMG]](/icons/image2.gif) | 615_Youth_Sanitation.jpg | 2025-05-19 11:04 | 124K | |
![[IMG]](/icons/image2.gif) | 6551_IMG-20240811-WA0044.jpg | 2025-05-19 11:06 | 124K | |
![[IMG]](/icons/image2.gif) | 2477_IMG_5073.JPG | 2025-05-19 11:04 | 125K | |
![[IMG]](/icons/image2.gif) | 3730_f8346407-3146-4c14-8de5-b424cf072376.jpg | 2025-05-19 11:03 | 125K | |
![[IMG]](/icons/image2.gif) | 3730_6d0520a8-4f87-4139-ad11-3c3d4ca8eaa4.jpg | 2025-05-19 11:04 | 125K | |
![[IMG]](/icons/image2.gif) | 3730_c520189c-4279-4bcd-9972-8de01a9cfbdd.jpg | 2025-05-19 11:04 | 125K | |
![[ ]](/icons/unknown.gif) | 4778_Survey-Effects of corona virus among footsteps beneficiaries (1).docx | 2025-05-19 11:05 | 125K | |
![[IMG]](/icons/image2.gif) | 1001_IMG_9126.JPG | 2025-05-19 11:03 | 125K | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (15).jpg | 2025-05-19 11:07 | 125K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0395.jpg | 2025-05-19 11:05 | 125K | |
![[IMG]](/icons/image2.gif) | 4720_IMG-20200725-WA0046.jpg | 2025-05-19 11:06 | 125K | |
![[IMG]](/icons/image2.gif) | 3730_912b7011-f7b7-4943-9449-fd7b722f9aa6.jpg | 2025-05-19 11:05 | 126K | |
![[IMG]](/icons/image2.gif) | 822_IMG_6442.JPG | 2025-05-19 11:05 | 126K | |
![[IMG]](/icons/image2.gif) | 5582_IMG-20220903-WA0001.jpg | 2025-05-19 11:04 | 126K | |
![[IMG]](/icons/image2.gif) | 2658_IMG-20180605-WA0002.jpg | 2025-05-19 11:03 | 126K | |
![[IMG]](/icons/image2.gif) | 3730_2bd49ec6-a450-46ad-b578-62e642c27de2.jpg | 2025-05-19 11:04 | 126K | |
![[IMG]](/icons/image2.gif) | 2841_IMG-20190521-WA0008.jpg | 2025-05-19 11:04 | 126K | |
![[IMG]](/icons/image2.gif) | 4787_Anrango Morales Family.jpg | 2025-05-19 11:06 | 127K | |
![[IMG]](/icons/image2.gif) | 3730_4f3ac08c-db8a-4e88-9c00-ce1660d8112d.jpg | 2025-05-19 11:07 | 127K | |
![[IMG]](/icons/image2.gif) | 6273_Outcome 2 Kitchen Garden.jpg | 2025-05-19 11:04 | 127K | |
![[IMG]](/icons/image2.gif) | 2658_29791460_316046588923710_4171200983994125869_n.jpg | 2025-05-19 11:04 | 127K | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting multisensory classrooms teacher tour.jpg | 2025-05-19 11:06 | 127K | |
![[IMG]](/icons/image2.gif) | 3730_f12d1ef4-8d4b-4514-92ca-ddc89108fe7c.jpg | 2025-05-19 11:04 | 127K | |
![[IMG]](/icons/image2.gif) | 6306_IMG-20230329-WA0028.jpg | 2025-05-19 11:04 | 127K | |
![[IMG]](/icons/image2.gif) | 2658_30127128_316030038925365_7057761755271120461_n.jpg | 2025-05-19 11:04 | 127K | |
![[IMG]](/icons/image2.gif) | 2976_IMG-20190726-WA0023.jpg | 2025-05-19 11:03 | 127K | |
![[IMG]](/icons/image2.gif) | 2658_29694982_316030705591965_7050642896821346535_n.jpg | 2025-05-19 11:03 | 127K | |
![[IMG]](/icons/image2.gif) | 2976_IMG-20190726-WA0025.jpg | 2025-05-19 11:03 | 127K | |
![[IMG]](/icons/image2.gif) | 3731_IMG-20200214-WA0007.jpg | 2025-05-19 11:05 | 128K | |
![[IMG]](/icons/image2.gif) | 2658_29683148_316030552258647_7949851821233153279_n.jpg | 2025-05-19 11:06 | 128K | |
![[IMG]](/icons/image2.gif) | 3730_d34de46f-46a8-4cf1-b282-172c50fa7269.jpg | 2025-05-19 11:05 | 128K | |
![[ ]](/icons/layout.gif) | 2607_Final Report AWB 2020.pdf | 2025-05-19 11:05 | 129K | |
![[IMG]](/icons/image2.gif) | 2658_29683141_316029558925413_9033862885975185341_n.jpg | 2025-05-19 11:05 | 129K | |
![[ ]](/icons/layout.gif) | 2607_FINAL REPORT AWB .pdf | 2025-05-19 11:07 | 129K | |
![[IMG]](/icons/image2.gif) | 3730_43931863-b740-4924-9d4b-3ce144743a83.jpg | 2025-05-19 11:06 | 129K | |
![[IMG]](/icons/image2.gif) | 4787_Perugachi Bonilla Family .jpg | 2025-05-19 11:03 | 129K | |
![[IMG]](/icons/image2.gif) | 2117_Pataste school visit 1.jpg | 2025-05-19 11:05 | 129K | |
![[IMG]](/icons/image2.gif) | 1308_IMG_1376.JPG | 2025-05-19 11:05 | 129K | |
![[IMG]](/icons/image2.gif) | 1308_IMG_1377.JPG | 2025-05-19 11:07 | 130K | |
![[IMG]](/icons/image2.gif) | 7000_NB4.JPG | 2025-05-19 11:04 | 130K | |
![[IMG]](/icons/image2.gif) | 2658_IMG-20180605-WA0007.jpg | 2025-05-19 11:07 | 130K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0374.jpg | 2025-05-19 11:05 | 130K | |
![[IMG]](/icons/image2.gif) | 3730_c9b985ec-f7cf-43bb-bc64-41f186b2794e.jpg | 2025-05-19 11:05 | 130K | |
![[IMG]](/icons/image2.gif) | 3730_80b90ff0-1632-452d-9f70-cf3d4b41404e.jpg | 2025-05-19 11:05 | 130K | |
![[IMG]](/icons/image2.gif) | 3730_4f089518-cad4-411d-805b-b643cda8d478.jpg | 2025-05-19 11:03 | 130K | |
![[IMG]](/icons/image2.gif) | 859_IMG-20160321-WA0005.jpg | 2025-05-19 11:05 | 130K | |
![[IMG]](/icons/image2.gif) | 2658_29684021_316030628925306_2625536849493138408_n.jpg | 2025-05-19 11:04 | 130K | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (20).jpg | 2025-05-19 11:05 | 131K | |
![[IMG]](/icons/image2.gif) | 2658_29597968_316030292258673_5964406563828925594_n.jpg | 2025-05-19 11:03 | 131K | |
![[IMG]](/icons/image2.gif) | 3263_Playground3.jpg | 2025-05-19 11:03 | 131K | |
![[ ]](/icons/layout.gif) | 2672_00-Complete Application (Mvula, January).pdf | 2025-05-19 11:05 | 132K | |
![[IMG]](/icons/image2.gif) | 2966_image.png | 2025-05-19 11:05 | 132K | |
![[IMG]](/icons/image2.gif) | 2117_Sabalito school visit 1.jpg | 2025-05-19 11:05 | 132K | |
![[IMG]](/icons/image2.gif) | 3730_8d078ca7-2a70-496d-8ba5-25981266c3bb.jpg | 2025-05-19 11:05 | 132K | |
![[IMG]](/icons/image2.gif) | 3730_c00d1b7f-2763-448b-af07-b3046eab1c0e.jpg | 2025-05-19 11:05 | 132K | |
![[IMG]](/icons/image2.gif) | 4678_IMG-20200513-WA0032.jpg | 2025-05-19 11:05 | 132K | |
![[IMG]](/icons/image2.gif) | 987_Enjoying Soy Milk!.JPG | 2025-05-19 11:03 | 132K | |
![[IMG]](/icons/image2.gif) | 3730_fdc643ec-00bf-4035-ad0c-16a70e1bdfe1.jpg | 2025-05-19 11:05 | 132K | |
![[IMG]](/icons/image2.gif) | 2658_29792181_316046558923713_905272839630123946_n.jpg | 2025-05-19 11:05 | 132K | |
![[IMG]](/icons/image2.gif) | 2533_IMG_5467.jpg | 2025-05-19 11:04 | 132K | |
![[IMG]](/icons/image2.gif) | 3730_7f3e22b7-e15c-4088-a9e7-2dc75312629a.jpg | 2025-05-19 11:05 | 132K | |
![[IMG]](/icons/image2.gif) | 2658_29790583_316046488923720_3330748967430393659_n.jpg | 2025-05-19 11:04 | 132K | |
![[IMG]](/icons/image2.gif) | 2841_55443463_2292369671035896_8562714394948009984_n.jpg | 2025-05-19 11:05 | 133K | |
![[IMG]](/icons/image2.gif) | 6633_WhatsApp Image 2024-06-08 at 15.09.54_31af8624.jpg | 2025-05-19 11:04 | 133K | |
![[IMG]](/icons/image2.gif) | 5792_IMG-20221204-WA0033.jpg | 2025-05-19 11:05 | 133K | |
![[IMG]](/icons/image2.gif) | 6525_IMG-20230413-WA0080.jpg | 2025-05-19 11:06 | 133K | |
![[IMG]](/icons/image2.gif) | 6633_WhatsApp Image 2024-06-08 at 15.10.08_084392cf.jpg | 2025-05-19 11:05 | 133K | |
![[IMG]](/icons/image2.gif) | 2507_women fro SGPAP pitching at HTS18.jpg | 2025-05-19 11:03 | 134K | |
![[IMG]](/icons/image2.gif) | 2658_29792627_316032158925153_151663828129168706_n.jpg | 2025-05-19 11:04 | 134K | |
![[IMG]](/icons/image2.gif) | 6141_IMG-20221017-WA0022.jpg | 2025-05-19 11:05 | 134K | |
![[IMG]](/icons/image2.gif) | 5603_IMG-20230421-WA0014.jpg | 2025-05-19 11:04 | 134K | |
![[IMG]](/icons/image2.gif) | 2841_53816995_2292369661035897_4998330175688015872_n.jpg | 2025-05-19 11:05 | 134K | |
![[IMG]](/icons/image2.gif) | 3730_85258fa6-a5bf-4c47-bb9d-3bf63b051452.jpg | 2025-05-19 11:03 | 134K | |
![[IMG]](/icons/image2.gif) | 2658_29695151_316030212258681_723256937871478596_n.jpg | 2025-05-19 11:05 | 134K | |
![[IMG]](/icons/image2.gif) | 3730_339f4b35-3e9b-4c57-abae-3ccd98b86a8c.jpg | 2025-05-19 11:05 | 134K | |
![[IMG]](/icons/image2.gif) | 5815_IMG-20220209-WA0024.jpg | 2025-05-19 11:05 | 134K | |
![[IMG]](/icons/image2.gif) | 3772_Pwemphwe Safe water access.jpg | 2025-05-19 11:05 | 134K | |
![[IMG]](/icons/image2.gif) | 1242_IMG-20161109-WA0004.jpg | 2025-05-19 11:05 | 134K | |
![[IMG]](/icons/image2.gif) | 2976_IMG-20190726-WA0024.jpg | 2025-05-19 11:05 | 134K | |
![[IMG]](/icons/image2.gif) | 2658_29793684_316030152258687_4416454043759718584_n.jpg | 2025-05-19 11:03 | 135K | |
![[IMG]](/icons/image2.gif) | 859_IMG-20160321-WA0011.jpg | 2025-05-19 11:07 | 135K | |
![[IMG]](/icons/image2.gif) | 1013_IMG_3701.JPG | 2025-05-19 11:04 | 135K | |
![[IMG]](/icons/image2.gif) | 2533_IMG_5439.jpg | 2025-05-19 11:03 | 135K | |
![[IMG]](/icons/image2.gif) | 2926_Teachers at Training in Quito.jpg | 2025-05-19 11:03 | 136K | |
![[IMG]](/icons/image2.gif) | 2658_29597547_316029588925410_4954766619185539262_n.jpg | 2025-05-19 11:04 | 136K | |
![[IMG]](/icons/image2.gif) | 2658_29597999_316031535591882_5002621564333080834_n.jpg | 2025-05-19 11:05 | 136K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0128.jpg | 2025-05-19 11:03 | 136K | |
![[IMG]](/icons/image2.gif) | 4778_HMIF3143[1].JPG | 2025-05-19 11:04 | 136K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20230928-WA0016.jpg | 2025-05-19 11:05 | 136K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0138.jpg | 2025-05-19 11:04 | 137K | |
![[IMG]](/icons/image2.gif) | 4421_IMG-20221212-WA0028.jpg | 2025-05-19 11:05 | 137K | |
![[IMG]](/icons/image2.gif) | 3730_68d72c27-284d-4c10-b675-42c88f043559.jpg | 2025-05-19 11:05 | 137K | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting parent therapy training.jpg | 2025-05-19 11:05 | 137K | |
![[IMG]](/icons/image2.gif) | 2810_Clinic view.jpg | 2025-05-19 11:05 | 137K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170721_105936.jpg | 2025-05-19 11:05 | 137K | |
![[IMG]](/icons/image2.gif) | 2533_IMG_8693.jpg | 2025-05-19 11:05 | 137K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231219-WA0169.jpg | 2025-05-19 11:05 | 137K | |
![[IMG]](/icons/image2.gif) | 2841_53884364_2292305104375686_4933287525964840960_n.jpg | 2025-05-19 11:05 | 137K | |
![[IMG]](/icons/image2.gif) | 3730_7fa291c6-f6a9-4903-b685-3f43eb9b6996.jpg | 2025-05-19 11:03 | 137K | |
![[IMG]](/icons/image2.gif) | 3772_Water Access at Pwemphwe.jpg | 2025-05-19 11:05 | 137K | |
![[IMG]](/icons/image2.gif) | 2658_29683222_316030532258649_7627533914408773704_n.jpg | 2025-05-19 11:03 | 137K | |
![[IMG]](/icons/image2.gif) | 1413_Dolly minga picture 4.jpg | 2025-05-19 11:05 | 137K | |
![[IMG]](/icons/image2.gif) | 4421_IMG-20221212-WA0003.jpg | 2025-05-19 11:04 | 137K | |
![[IMG]](/icons/image2.gif) | 6633_WhatsApp Image 2024-06-08 at 15.10.13_daa0a2a5.jpg | 2025-05-19 11:05 | 138K | |
![[IMG]](/icons/image2.gif) | 4514_Peace Nakiyemba.JPG | 2025-05-19 11:04 | 138K | |
![[IMG]](/icons/image2.gif) | 2658_29597854_316030602258642_6496527724013270322_n.jpg | 2025-05-19 11:07 | 138K | |
![[IMG]](/icons/image2.gif) | 6627_IMG-20231204-WA0042.jpg | 2025-05-19 11:03 | 138K | |
![[IMG]](/icons/image2.gif) | 1401_IMG_5310.jpg | 2025-05-19 11:04 | 138K | |
![[IMG]](/icons/image2.gif) | 2285_IMG-20180228-WA0003.jpg | 2025-05-19 11:03 | 138K | |
![[IMG]](/icons/image2.gif) | 2658_29790573_316030352258667_5706734655307997889_n.jpg | 2025-05-19 11:05 | 138K | |
![[IMG]](/icons/image2.gif) | 4666_health worker mpamba.jpg | 2025-05-19 11:06 | 138K | |
![[IMG]](/icons/image2.gif) | 2810_first woman to deliver..jpg | 2025-05-19 11:05 | 138K | |
![[IMG]](/icons/image2.gif) | 5792_IMG-20221123-WA0040.jpg | 2025-05-19 11:04 | 138K | |
![[IMG]](/icons/image2.gif) | 2533_IMG_5449.jpg | 2025-05-19 11:04 | 139K | |
![[IMG]](/icons/image2.gif) | 3730_323e7622-c1b8-49a9-93ac-a7c0c00c99e5.jpg | 2025-05-19 11:05 | 139K | |
![[IMG]](/icons/image2.gif) | 2841_51644430_2267538903518973_7223080697659916288_n.jpg | 2025-05-19 11:03 | 139K | |
![[IMG]](/icons/image2.gif) | 2976_IMG-20190726-WA0026.jpg | 2025-05-19 11:03 | 139K | |
![[IMG]](/icons/image2.gif) | 2507_women workshop HTS18.jpg | 2025-05-19 11:04 | 139K | |
![[IMG]](/icons/image2.gif) | 2658_29790212_316031852258517_1325816399654005141_n.jpg | 2025-05-19 11:07 | 139K | |
![[IMG]](/icons/image2.gif) | 6627_IMG-20231204-WA0020.jpg | 2025-05-19 11:05 | 139K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231218-WA0040.jpg | 2025-05-19 11:04 | 139K | |
![[IMG]](/icons/image2.gif) | 4778_testimonial.jpg | 2025-05-19 11:05 | 139K | |
![[IMG]](/icons/image2.gif) | 987_Theory Training.JPG | 2025-05-19 11:05 | 140K | |
![[IMG]](/icons/image2.gif) | 3620_IMG-20190403-WA0039.jpg | 2025-05-19 11:03 | 140K | |
![[IMG]](/icons/image2.gif) | 3730_2b9a4f6a-ade6-4f0e-91d1-845ec6113208.jpg | 2025-05-19 11:07 | 140K | |
![[IMG]](/icons/image2.gif) | 1335_23627101_1914921965235308_213721420_o (1).jpg | 2025-05-19 11:03 | 140K | |
![[IMG]](/icons/image2.gif) | 1335_23627101_1914921965235308_213721420_o (2).jpg | 2025-05-19 11:05 | 140K | |
![[IMG]](/icons/image2.gif) | 1335_23627101_1914921965235308_213721420_o.jpg | 2025-05-19 11:05 | 140K | |
![[IMG]](/icons/image2.gif) | 5697_DSC00775.JPG | 2025-05-19 11:04 | 140K | |
![[IMG]](/icons/image2.gif) | 2117_San Miguel School visit 1.jpg | 2025-05-19 11:04 | 140K | |
![[IMG]](/icons/image2.gif) | 2658_29695051_316032032258499_4255355890933674355_n.jpg | 2025-05-19 11:04 | 140K | |
![[IMG]](/icons/image2.gif) | 3620_IMG-20190403-WA0040.jpg | 2025-05-19 11:05 | 140K | |
![[IMG]](/icons/image2.gif) | 3730_ca60e7f6-63ba-4f2a-bd89-06a65f134668.jpg | 2025-05-19 11:07 | 141K | |
![[IMG]](/icons/image2.gif) | 2658_29792441_316030792258623_5934420149110996568_n.jpg | 2025-05-19 11:05 | 141K | |
![[IMG]](/icons/image2.gif) | 5775_26.jpg | 2025-05-19 11:04 | 141K | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting parent therapy.jpg | 2025-05-19 11:05 | 141K | |
![[IMG]](/icons/image2.gif) | 3730_70bedc3e-dcfe-4917-bc92-29680de0986b.jpg | 2025-05-19 11:04 | 141K | |
![[IMG]](/icons/image2.gif) | 2658_29684019_316030668925302_8692724173906182679_n.jpg | 2025-05-19 11:04 | 141K | |
![[IMG]](/icons/image2.gif) | 3730_e20cb0dc-fd4d-431b-af2f-a5925e1d525c.jpg | 2025-05-19 11:03 | 141K | |
![[IMG]](/icons/image2.gif) | 3730_0a7aaad7-30b3-4814-b0a9-6c75b0521a52.jpg | 2025-05-19 11:05 | 141K | |
![[IMG]](/icons/image2.gif) | 3643_Sareh Wuring children at desks.JPG | 2025-05-19 11:04 | 141K | |
![[IMG]](/icons/image2.gif) | 1413_Dolly minga picture 1.jpg | 2025-05-19 11:05 | 142K | |
![[IMG]](/icons/image2.gif) | 2841_54278420_2292305071042356_5672787908294082560_n.jpg | 2025-05-19 11:04 | 142K | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (12).jpg | 2025-05-19 11:04 | 142K | |
![[IMG]](/icons/image2.gif) | 987_Preparing the peanut butter.JPG | 2025-05-19 11:03 | 142K | |
![[IMG]](/icons/image2.gif) | 2658_29792384_316030815591954_9029726803613381975_n.jpg | 2025-05-19 11:05 | 142K | |
![[IMG]](/icons/image2.gif) | 615_Young Children_Hygine Education.jpg | 2025-05-19 11:05 | 142K | |
![[IMG]](/icons/image2.gif) | 1335_23627190_1914924275235077_672897618_o.jpg | 2025-05-19 11:05 | 142K | |
![[IMG]](/icons/image2.gif) | 5034_MR AYIM AND RACHEL.jpg | 2025-05-19 11:04 | 143K | |
![[IMG]](/icons/image2.gif) | 1413_Dolly minga picture 5.jpg | 2025-05-19 11:04 | 143K | |
![[IMG]](/icons/image2.gif) | 2658_IMG-20180605-WA0001.jpg | 2025-05-19 11:05 | 143K | |
![[IMG]](/icons/image2.gif) | 2658_24862307_316030922258610_7015116237341548769_n.jpg | 2025-05-19 11:04 | 143K | |
![[IMG]](/icons/image2.gif) | 1335_22908411_1889714604422711_707882150_o (1).jpg | 2025-05-19 11:03 | 143K | |
![[IMG]](/icons/image2.gif) | 1335_22908411_1889714604422711_707882150_o.jpg | 2025-05-19 11:03 | 143K | |
![[IMG]](/icons/image2.gif) | 3731_IMG-20200214-WA0010.jpg | 2025-05-19 11:03 | 143K | |
![[IMG]](/icons/image2.gif) | 2507_women pionner summit mentors.jpg | 2025-05-19 11:05 | 143K | |
![[IMG]](/icons/image2.gif) | 2658_29790229_316046598923709_4539098436642512053_n.jpg | 2025-05-19 11:05 | 143K | |
![[IMG]](/icons/image2.gif) | 3730_09270b97-d9b3-424e-8ccb-0be5396c772a.jpg | 2025-05-19 11:03 | 144K | |
![[IMG]](/icons/image2.gif) | 2658_29694985_316031075591928_3137894544001900510_n.jpg | 2025-05-19 11:03 | 144K | |
![[ ]](/icons/layout.gif) | 2128_Image051217021939.pdf | 2025-05-19 11:05 | 144K | |
![[IMG]](/icons/image2.gif) | 3730_0eddee1a-686f-4bf4-9003-a5e6c981bbea.jpg | 2025-05-19 11:03 | 144K | |
![[IMG]](/icons/image2.gif) | 6104_1686216359083.jpg | 2025-05-19 11:04 | 144K | |
![[IMG]](/icons/image2.gif) | 1012_IMG_8117.jpg | 2025-05-19 11:03 | 144K | |
![[IMG]](/icons/image2.gif) | 2507_Women workshop 7.jpg | 2025-05-19 11:03 | 144K | |
![[IMG]](/icons/image2.gif) | 6713_Hand over 9.jpg | 2025-05-19 11:03 | 144K | |
![[IMG]](/icons/image2.gif) | 3730_c12f66a6-65b0-46f9-84fe-760b224c7aa5.jpg | 2025-05-19 11:05 | 144K | |
![[IMG]](/icons/image2.gif) | 6525_IMG-20230413-WA0077.jpg | 2025-05-19 11:04 | 144K | |
![[IMG]](/icons/image2.gif) | 1001_IMG_9539.JPG | 2025-05-19 11:05 | 144K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0125.jpg | 2025-05-19 11:04 | 145K | |
![[IMG]](/icons/image2.gif) | 2048_IMG_0923.JPG | 2025-05-19 11:04 | 145K | |
![[IMG]](/icons/image2.gif) | 987_Racing the rain.JPG | 2025-05-19 11:03 | 145K | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (18).jpg | 2025-05-19 11:07 | 145K | |
![[IMG]](/icons/image2.gif) | 6797_IMG-20240821-WA0038.jpg | 2025-05-19 11:05 | 145K | |
![[IMG]](/icons/image2.gif) | 2658_IMG-20180605-WA0005.jpg | 2025-05-19 11:05 | 145K | |
![[IMG]](/icons/image2.gif) | 3730_3cc0c186-ca79-4eda-94d7-dd02da8ee910.jpg | 2025-05-19 11:07 | 145K | |
![[IMG]](/icons/image2.gif) | 3730_070652c6-aaf9-42dc-b773-694aea57e5ab.jpg | 2025-05-19 11:05 | 145K | |
![[IMG]](/icons/image2.gif) | 987_Making the tofu.JPG | 2025-05-19 11:07 | 146K | |
![[IMG]](/icons/image2.gif) | 6104_1686315416165.jpg | 2025-05-19 11:04 | 146K | |
![[IMG]](/icons/image2.gif) | 6306_arewa spelling bee competition 3.png | 2025-05-19 11:05 | 146K | |
![[IMG]](/icons/image2.gif) | 2394_27067692_1828374980508801_1174291698354622372_n.jpg | 2025-05-19 11:05 | 146K | |
![[IMG]](/icons/image2.gif) | 5697_DSC00783.JPG | 2025-05-19 11:07 | 146K | |
![[IMG]](/icons/image2.gif) | 3155_IMG_2709.JPG | 2025-05-19 11:03 | 146K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231220-WA0038.jpg | 2025-05-19 11:04 | 146K | |
![[IMG]](/icons/image2.gif) | 3263_Playground2.jpg | 2025-05-19 11:03 | 147K | |
![[IMG]](/icons/image2.gif) | 3774_poultry and incubator drills.jpg | 2025-05-19 11:07 | 147K | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (19).jpg | 2025-05-19 11:03 | 147K | |
![[IMG]](/icons/image2.gif) | 987_Men as role models.JPG | 2025-05-19 11:04 | 147K | |
![[IMG]](/icons/image2.gif) | 3730_691ae105-1159-41a6-9c59-7d6221d6e7b4.jpg | 2025-05-19 11:05 | 147K | |
![[IMG]](/icons/image2.gif) | 2658_29683130_316047052256997_5208598328896743213_n.jpg | 2025-05-19 11:04 | 147K | |
![[IMG]](/icons/image2.gif) | 2048_IMG_0954.JPG | 2025-05-19 11:05 | 147K | |
![[IMG]](/icons/image2.gif) | 987_Teamwork!.JPG | 2025-05-19 11:04 | 147K | |
![[ ]](/icons/layout.gif) | 4695_Pamtondo photo 2.pdf | 2025-05-19 11:04 | 148K | |
![[IMG]](/icons/image2.gif) | 4678_IMG-20200516-WA0018.jpg | 2025-05-19 11:03 | 148K | |
![[IMG]](/icons/image2.gif) | 2658_29695527_316047365590299_2346026247850523077_n.jpg | 2025-05-19 11:04 | 148K | |
![[IMG]](/icons/image2.gif) | 2533_IMG_8697.jpg | 2025-05-19 11:03 | 148K | |
![[IMG]](/icons/image2.gif) | 6713_Mphatso Mzima.JPG | 2025-05-19 11:03 | 148K | |
![[IMG]](/icons/image2.gif) | 2658_IMG-20180605-WA0000.jpg | 2025-05-19 11:06 | 148K | |
![[IMG]](/icons/image2.gif) | 6314_IMG-20230811-WA0000.jpg | 2025-05-19 11:05 | 148K | |
![[IMG]](/icons/image2.gif) | 6713_Chibanja primary 6.jpg | 2025-05-19 11:03 | 148K | |
![[IMG]](/icons/image2.gif) | 6524_IMG-20230729-WA0022.jpg | 2025-05-19 11:04 | 149K | |
![[IMG]](/icons/image2.gif) | 2658_29790118_316046625590373_4066616649288181027_n.jpg | 2025-05-19 11:04 | 149K | |
![[IMG]](/icons/image2.gif) | 3620_IMG-20190403-WA0033.jpg | 2025-05-19 11:05 | 149K | |
![[IMG]](/icons/image2.gif) | 987_Trying tofu.JPG | 2025-05-19 11:05 | 149K | |
![[IMG]](/icons/image2.gif) | 6262_IMG-20230330-WA0347.jpg | 2025-05-19 11:04 | 150K | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (13).jpg | 2025-05-19 11:05 | 150K | |
![[IMG]](/icons/image2.gif) | 6525_IMG-20230601-WA0061.jpg | 2025-05-19 11:06 | 150K | |
![[IMG]](/icons/image2.gif) | 2658_29683118_316030402258662_981750644051357735_n.jpg | 2025-05-19 11:03 | 150K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231220-WA0083.jpg | 2025-05-19 11:03 | 150K | |
![[IMG]](/icons/image2.gif) | 5697_DSC00794.JPG | 2025-05-19 11:05 | 150K | |
![[IMG]](/icons/image2.gif) | 2127_520f8b2d-f956-4050-96cc-3204fc61d34e.jpg | 2025-05-19 11:05 | 150K | |
![[IMG]](/icons/image2.gif) | 3620_IMG-20190403-WA0037.jpg | 2025-05-19 11:06 | 150K | |
![[IMG]](/icons/image2.gif) | 1308_IMG_1373.JPG | 2025-05-19 11:03 | 150K | |
![[IMG]](/icons/image2.gif) | 2255_IMG_20180814_185342_944.jpg | 2025-05-19 11:03 | 151K | |
![[IMG]](/icons/image2.gif) | 4666_Women beneficiaries- incinerator .jpg | 2025-05-19 11:03 | 151K | |
![[IMG]](/icons/image2.gif) | 2658_IMG-20180605-WA0011.jpg | 2025-05-19 11:06 | 151K | |
![[IMG]](/icons/image2.gif) | 767_18491688_829299042580_749380457427830771_o.jpg | 2025-05-19 11:06 | 151K | |
![[IMG]](/icons/image2.gif) | 6273_Outcome 1 Kitchen Garden.jpg | 2025-05-19 11:05 | 151K | |
![[IMG]](/icons/image2.gif) | 2048_IMG_0926.JPG | 2025-05-19 11:03 | 151K | |
![[ ]](/icons/layout.gif) | 5436_TRAINING ON POST HARVEST MANAGEMENT.pdf | 2025-05-19 11:04 | 151K | |
![[IMG]](/icons/image2.gif) | 2658_29694749_316031002258602_5761707190646852231_n.jpg | 2025-05-19 11:05 | 151K | |
![[ ]](/icons/unknown.gif) | 3156_Books are My Friends! Classroom Poster.docx | 2025-05-19 11:05 | 151K | |
![[IMG]](/icons/image2.gif) | 2507_SG meeting with volunteers.jpg | 2025-05-19 11:07 | 151K | |
![[IMG]](/icons/image2.gif) | 3340_IMG-20190316-WA0013.jpg | 2025-05-19 11:05 | 152K | |
![[IMG]](/icons/image2.gif) | 2658_29791383_316046498923719_537343734268189838_n.jpg | 2025-05-19 11:05 | 152K | |
![[IMG]](/icons/image2.gif) | 2658_29792113_316032138925155_8482761320631404584_n.jpg | 2025-05-19 11:04 | 152K | |
![[IMG]](/icons/image2.gif) | 1413_Dolly minga picture 6.jpg | 2025-05-19 11:05 | 152K | |
![[IMG]](/icons/image2.gif) | 2127_56af2aec-95a4-47a6-a587-e30b7611e934.jpg | 2025-05-19 11:03 | 152K | |
![[IMG]](/icons/image2.gif) | 4514_ce3aeaab-2740-4276-82e1-c7de863d8b29.JPG | 2025-05-19 11:04 | 153K | |
![[IMG]](/icons/image2.gif) | 2285_IMG-20180205-WA0000.jpg | 2025-05-19 11:06 | 153K | |
![[IMG]](/icons/image2.gif) | 2285_IMG-20180130-WA0003.jpg | 2025-05-19 11:04 | 153K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0132.jpg | 2025-05-19 11:05 | 153K | |
![[IMG]](/icons/image2.gif) | 6314_IMG-20230811-WA0008.jpg | 2025-05-19 11:07 | 154K | |
![[IMG]](/icons/image2.gif) | 1308_IMG_1379.JPG | 2025-05-19 11:06 | 154K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0127.jpg | 2025-05-19 11:05 | 154K | |
![[IMG]](/icons/image2.gif) | 2658_29684076_316030318925337_7951986330600282099_n.jpg | 2025-05-19 11:03 | 154K | |
![[IMG]](/icons/image2.gif) | 2810_Myself Ndansi Elvis.jpg | 2025-05-19 11:03 | 154K | |
![[IMG]](/icons/image2.gif) | 6897_HLFTGC3.jpg | 2025-05-19 11:04 | 154K | |
![[IMG]](/icons/image2.gif) | 4514_8dae8355-9ddc-47e7-9ad9-64c4a56908ff.JPG | 2025-05-19 11:04 | 154K | |
![[IMG]](/icons/image2.gif) | 6273_piglets delivery day 20 june.jpg | 2025-05-19 11:07 | 155K | |
![[IMG]](/icons/image2.gif) | 5697_DSC00785 (1).JPG | 2025-05-19 11:04 | 155K | |
![[IMG]](/icons/image2.gif) | 5697_DSC00785.JPG | 2025-05-19 11:03 | 155K | |
![[ ]](/icons/compressed.gif) | Final Report_ (banda, Smart) - Files.zip | 2025-05-19 11:07 | 155K | |
![[IMG]](/icons/image2.gif) | 3250_cassava plants.jpg | 2025-05-19 11:03 | 156K | |
![[IMG]](/icons/image2.gif) | 4778_AXFE6933[1].JPG | 2025-05-19 11:03 | 156K | |
![[IMG]](/icons/image2.gif) | 3340_IMG-20190317-WA0016.jpg | 2025-05-19 11:04 | 156K | |
![[IMG]](/icons/image2.gif) | 3340_IMG-20190317-WA0017.jpg | 2025-05-19 11:03 | 156K | |
![[IMG]](/icons/image2.gif) | 987_Preparing the soybeans.JPG | 2025-05-19 11:04 | 156K | |
![[IMG]](/icons/image2.gif) | 2658_29695052_316032445591791_5698721592520630539_n.jpg | 2025-05-19 11:05 | 156K | |
![[IMG]](/icons/image2.gif) | 1668_IMG_9476.JPG | 2025-05-19 11:05 | 156K | |
![[IMG]](/icons/image2.gif) | 1668_Ladrim Shehu with Donart Tota, a Youth Activist.JPG | 2025-05-19 11:06 | 156K | |
![[IMG]](/icons/image2.gif) | 3620_IMG-20190403-WA0038.jpg | 2025-05-19 11:05 | 156K | |
![[IMG]](/icons/image2.gif) | 7017_11.jpg | 2025-06-06 17:54 | 156K | |
![[IMG]](/icons/image2.gif) | 2658_29792836_316031055591930_8122082000657968292_n.jpg | 2025-05-19 11:03 | 156K | |
![[ ]](/icons/layout.gif) | 5284_LAND.pdf | 2025-05-19 11:05 | 157K | |
![[IMG]](/icons/image2.gif) | 2127_fdf88b1d-f167-44bb-828b-75eea6d34c48.jpg | 2025-05-19 11:06 | 157K | |
![[IMG]](/icons/image2.gif) | 3620_IMG-20190403-WA0035.jpg | 2025-05-19 11:05 | 157K | |
![[IMG]](/icons/image2.gif) | 2658_29683754_316032245591811_3831632236864457557_n.jpg | 2025-05-19 11:05 | 157K | |
![[IMG]](/icons/image2.gif) | 2658_29683669_316030425591993_591568676759612342_n.jpg | 2025-05-19 11:03 | 157K | |
![[IMG]](/icons/image2.gif) | 6797_IMG_20240822_191044.jpg | 2025-05-19 11:03 | 158K | |
![[IMG]](/icons/image2.gif) | 1308_IMG_1372.JPG | 2025-05-19 11:04 | 158K | |
![[IMG]](/icons/image2.gif) | 1308_IMG_1195.JPG | 2025-05-19 11:04 | 158K | |
![[IMG]](/icons/image2.gif) | 2285_IMG-20180130-WA0007.jpg | 2025-05-19 11:07 | 158K | |
![[IMG]](/icons/image2.gif) | 2213_IMG-20170618-WA0013.jpg | 2025-05-19 11:03 | 158K | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3956.JPG | 2025-05-19 11:03 | 158K | |
![[IMG]](/icons/image2.gif) | 3774_Luso Langa talent show for fundraiser.jpg | 2025-05-19 11:03 | 158K | |
![[IMG]](/icons/image2.gif) | 2533_IMG_8598.jpg | 2025-05-19 11:04 | 158K | |
![[IMG]](/icons/image2.gif) | 1094_Counterpart Lettie Mae.jpg | 2025-05-19 11:05 | 158K | |
![[IMG]](/icons/image2.gif) | 3941_Makeup Training - Artiste and Model.jpg | 2025-05-19 11:05 | 158K | |
![[IMG]](/icons/image2.gif) | 2658_30123815_316032318925137_3981347582167064798_n.jpg | 2025-05-19 11:05 | 158K | |
![[IMG]](/icons/image2.gif) | 6601_IMG-20231220-WA0084.jpg | 2025-05-19 11:04 | 158K | |
![[IMG]](/icons/image2.gif) | 987_Fiinding the right location.JPG | 2025-05-19 11:04 | 159K | |
![[IMG]](/icons/image2.gif) | 987_Engaging the mamas.JPG | 2025-05-19 11:03 | 159K | |
![[IMG]](/icons/image2.gif) | 3730_9ee7dcb2-5813-41ba-9ff8-ad7e216437ce.jpg | 2025-05-19 11:05 | 159K | |
![[IMG]](/icons/image2.gif) | 3620_IMG-20190403-WA0036.jpg | 2025-05-19 11:04 | 159K | |
![[IMG]](/icons/image2.gif) | 6633_WhatsApp Image 2024-06-08 at 15.05.28_71f327e4.jpg | 2025-05-19 11:03 | 159K | |
![[IMG]](/icons/image2.gif) | 2373_IMG-20170125-WA0011.jpg | 2025-05-19 11:04 | 160K | |
![[IMG]](/icons/image2.gif) | 6314_IMG-20230811-WA0004.jpg | 2025-05-19 11:05 | 160K | |
![[IMG]](/icons/image2.gif) | 4545_IMG-20190102-WA0020.jpg | 2025-05-19 11:05 | 160K | |
![[IMG]](/icons/image2.gif) | 6525_IMG-20230413-WA0081.jpg | 2025-05-19 11:04 | 160K | |
![[IMG]](/icons/image2.gif) | 2658_29792094_316031982258504_641803457108095609_n.jpg | 2025-05-19 11:05 | 160K | |
![[IMG]](/icons/image2.gif) | 2658_30123963_316030978925271_7421169317663307218_n.jpg | 2025-05-19 11:05 | 160K | |
![[IMG]](/icons/image2.gif) | 2658_IMG-20180605-WA0006.jpg | 2025-05-19 11:07 | 161K | |
![[IMG]](/icons/image2.gif) | 1397_september yoga.jpg | 2025-05-19 11:04 | 161K | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3957.JPG | 2025-05-19 11:04 | 161K | |
![[IMG]](/icons/image2.gif) | 2658_29791884_316030892258613_8575711868784892851_n.jpg | 2025-05-19 11:03 | 161K | |
![[IMG]](/icons/image2.gif) | 4778_FSBR2083[1].JPG | 2025-05-19 11:05 | 162K | |
![[IMG]](/icons/image2.gif) | 5658_PXL_20230215_150648046.MP.jpg | 2025-05-19 11:04 | 162K | |
![[IMG]](/icons/image2.gif) | 2658_29791253_316031022258600_3947321272406763545_n.jpg | 2025-05-19 11:03 | 162K | |
![[IMG]](/icons/image2.gif) | 3730_500c1a97-efc2-4318-8e50-03b86934f39c.jpg | 2025-05-19 11:06 | 162K | |
![[IMG]](/icons/image2.gif) | 3294_IMG-20181203-WA0024.jpg | 2025-05-19 11:05 | 162K | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (11).jpg | 2025-05-19 11:04 | 162K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_9009_1024.jpg | 2025-05-19 11:04 | 162K | |
![[IMG]](/icons/image2.gif) | 2658_29695332_316047398923629_8275441228004634479_n.jpg | 2025-05-19 11:05 | 162K | |
![[IMG]](/icons/image2.gif) | 3730_37e25e3f-e7de-467e-a423-e515a72fd424.jpg | 2025-05-19 11:07 | 163K | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3952.JPG | 2025-05-19 11:06 | 163K | |
![[IMG]](/icons/image2.gif) | 2389_IMG-20180414-WA0008.jpg | 2025-05-19 11:05 | 163K | |
![[IMG]](/icons/image2.gif) | 2658_29789965_316047442256958_6869105696964532498_n.jpg | 2025-05-19 11:07 | 164K | |
![[IMG]](/icons/image2.gif) | 987_Planting the seedlings.JPG | 2025-05-19 11:07 | 164K | |
![[ ]](/icons/compressed.gif) | Final Report_17-123 (Nsengiyumva, Aimable ) - Files.zip | 2025-05-19 11:03 | 164K | |
![[IMG]](/icons/image2.gif) | 2658_29683529_316030948925274_2360009365408794006_n.jpg | 2025-05-19 11:07 | 164K | |
![[IMG]](/icons/image2.gif) | 987_RUBARURA Theoneste.JPG | 2025-05-19 11:03 | 164K | |
![[IMG]](/icons/image2.gif) | 3730_1d2041f4-d148-4b25-b280-b52d5cc88cfc.jpg | 2025-05-19 11:05 | 164K | |
![[IMG]](/icons/image2.gif) | 2127_IMG-20170312-WA0021.jpg | 2025-05-19 11:03 | 164K | |
![[IMG]](/icons/image2.gif) | 5658_PXL_20230215_141745753.MP.jpg | 2025-05-19 11:05 | 164K | |
![[IMG]](/icons/image2.gif) | 4778_thank you letter 4.jpg | 2025-05-19 11:04 | 164K | |
![[IMG]](/icons/image2.gif) | 2389_IMG-20180414-WA0007.jpg | 2025-05-19 11:03 | 165K | |
![[IMG]](/icons/image2.gif) | 2658_29595522_316046878923681_6735898211749097829_n.jpg | 2025-05-19 11:04 | 165K | |
![[IMG]](/icons/image2.gif) | 987_Everyone can help!.JPG | 2025-05-19 11:04 | 165K | |
![[IMG]](/icons/image2.gif) | 2117_Pataste school visit 2.jpg | 2025-05-19 11:03 | 165K | |
![[IMG]](/icons/image2.gif) | 2658_19656922_316032005591835_6763871598389236574_n.jpg | 2025-05-19 11:03 | 165K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1215.JPG | 2025-05-19 11:05 | 165K | |
![[IMG]](/icons/image2.gif) | 2117_Preschool visit 2.jpg | 2025-05-19 11:04 | 165K | |
![[IMG]](/icons/image2.gif) | 6273_Delivery day 20 jne.jpg | 2025-05-19 11:05 | 165K | |
![[IMG]](/icons/image2.gif) | 6797_IMG-20240821-WA0015.jpg | 2025-05-19 11:06 | 165K | |
![[IMG]](/icons/image2.gif) | 2658_29597692_316032352258467_1836256509926800539_n.jpg | 2025-05-19 11:04 | 165K | |
![[IMG]](/icons/image2.gif) | 2658_29790317_316033075591728_7447332095061240472_n.jpg | 2025-05-19 11:04 | 166K | |
![[IMG]](/icons/image2.gif) | 3730_547448a0-c083-4914-8c24-0a12104c327a.jpg | 2025-05-19 11:05 | 166K | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting literacy project art gallery trip.jpg | 2025-05-19 11:04 | 166K | |
![[IMG]](/icons/image2.gif) | 3340_IMG-20190316-WA0022.jpg | 2025-05-19 11:05 | 166K | |
![[IMG]](/icons/image2.gif) | 5658_PXL_20230215_140607587.MP (1).jpg | 2025-05-19 11:03 | 166K | |
![[IMG]](/icons/image2.gif) | 3025_Showing the RRC gadgets to the Minister of Education during a School event.jpg | 2025-05-19 11:05 | 166K | |
![[IMG]](/icons/image2.gif) | 2658_IMG-20180605-WA0008.jpg | 2025-05-19 11:06 | 167K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1223.JPG | 2025-05-19 11:04 | 167K | |
![[IMG]](/icons/image2.gif) | 6897_HLFTGC9.jpg | 2025-05-19 11:05 | 167K | |
![[IMG]](/icons/image2.gif) | 2131_bins.jpg | 2025-05-19 11:05 | 167K | |
![[IMG]](/icons/image2.gif) | 2658_29791857_316032062258496_5783601763045481617_n.jpg | 2025-05-19 11:03 | 167K | |
![[IMG]](/icons/image2.gif) | 2658_29792881_316032878925081_3741449607302716114_n.jpg | 2025-05-19 11:05 | 168K | |
![[IMG]](/icons/image2.gif) | 6299_Harvest obtained, thanks to pig manure manure.jpg | 2025-05-19 11:04 | 168K | |
![[IMG]](/icons/image2.gif) | 5447_IMG_20200510_125627_126.jpg | 2025-05-19 11:05 | 168K | |
![[IMG]](/icons/image2.gif) | 1308_IMG_1374.JPG | 2025-05-19 11:04 | 168K | |
![[IMG]](/icons/image2.gif) | 859_IMG-20160321-WA0004.jpg | 2025-05-19 11:05 | 168K | |
![[IMG]](/icons/image2.gif) | 2658_11221833_316032268925142_6901442297956976427_n.jpg | 2025-05-19 11:05 | 168K | |
![[IMG]](/icons/image2.gif) | 6267_IMG-20240212-WA0036.jpg | 2025-05-19 11:03 | 168K | |
![[IMG]](/icons/image2.gif) | 1308_IMG_1378.JPG | 2025-05-19 11:04 | 168K | |
![[IMG]](/icons/image2.gif) | 2533_IMG_8699.jpg | 2025-05-19 11:03 | 169K | |
![[IMG]](/icons/image2.gif) | 2658_IMG-20180605-WA0009.jpg | 2025-05-19 11:05 | 169K | |
![[IMG]](/icons/image2.gif) | 2658_29789884_316030868925282_108923402622365462_n.jpg | 2025-05-19 11:03 | 170K | |
![[IMG]](/icons/image2.gif) | 2658_29790847_316031102258592_7585039234779354569_n.jpg | 2025-05-19 11:05 | 170K | |
![[IMG]](/icons/image2.gif) | 6713_Chibanja Primary 3.jpg | 2025-05-19 11:04 | 171K | |
![[IMG]](/icons/image2.gif) | 4678_IMG-20200513-WA0014.jpg | 2025-05-19 11:05 | 171K | |
![[IMG]](/icons/image2.gif) | 2117_sabalito school visit 3.jpg | 2025-05-19 11:05 | 171K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_9695_1024.jpg | 2025-05-19 11:05 | 171K | |
![[IMG]](/icons/image2.gif) | 2117_sabalito school visit 2.jpg | 2025-05-19 11:05 | 171K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0137.jpg | 2025-05-19 11:04 | 172K | |
![[IMG]](/icons/image2.gif) | 1335_22883571_1889713074422864_141693025_o (1).jpg | 2025-05-19 11:05 | 172K | |
![[IMG]](/icons/image2.gif) | 1335_22883571_1889713074422864_141693025_o.jpg | 2025-05-19 11:03 | 172K | |
![[IMG]](/icons/image2.gif) | 6314_IMG-20230811-WA0002.jpg | 2025-05-19 11:05 | 172K | |
![[IMG]](/icons/image2.gif) | 2658_IMG-20180605-WA0010.jpg | 2025-05-19 11:05 | 173K | |
![[ ]](/icons/layout.gif) | 4695_Pamtondo photo 3.pdf | 2025-05-19 11:06 | 173K | |
![[IMG]](/icons/image2.gif) | 1060_Khadija Amahal - Testimonial.jpg | 2025-05-19 11:04 | 173K | |
![[ ]](/icons/layout.gif) | 1445_Mobile CLC Workshop Programme.pdf | 2025-05-19 11:03 | 173K | |
![[IMG]](/icons/image2.gif) | 2658_29793601_316031835591852_2449311796896772927_n.jpg | 2025-05-19 11:07 | 173K | |
![[IMG]](/icons/image2.gif) | 3730_5be29a49-1d99-4c37-b30c-a8c8351e1e60.jpg | 2025-05-19 11:07 | 173K | |
![[IMG]](/icons/image2.gif) | 2533_IMG_8705.jpg | 2025-05-19 11:05 | 173K | |
![[IMG]](/icons/image2.gif) | 5714_ingurube.jpg | 2025-05-19 11:05 | 173K | |
![[IMG]](/icons/image2.gif) | 1335_22883842_1889712887756216_1976240365_o.jpg | 2025-05-19 11:03 | 174K | |
![[IMG]](/icons/image2.gif) | 2658_29790390_316031192258583_1960620050007087182_n.jpg | 2025-05-19 11:03 | 174K | |
![[IMG]](/icons/image2.gif) | 2658_29066798_316028512258851_8804285737579833829_n (1).jpg | 2025-05-19 11:05 | 174K | |
![[IMG]](/icons/image2.gif) | 2658_29066798_316028512258851_8804285737579833829_n.jpg | 2025-05-19 11:04 | 174K | |
![[IMG]](/icons/image2.gif) | 714_1st world problems.jpg | 2025-05-19 11:05 | 174K | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting teacher workshop2.jpg | 2025-05-19 11:05 | 174K | |
![[IMG]](/icons/image2.gif) | 5775_34.jpg | 2025-05-19 11:07 | 174K | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting literacy projects presentation 2018.jpg | 2025-05-19 11:05 | 174K | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting literacy project school murals.jpg | 2025-05-19 11:05 | 174K | |
![[IMG]](/icons/image2.gif) | 5658_PXL_20230215_142816485.jpg | 2025-05-19 11:03 | 174K | |
![[IMG]](/icons/image2.gif) | 3730_bf52b2ee-dfa0-444a-80ff-3884399eba3c.jpg | 2025-05-19 11:05 | 175K | |
![[IMG]](/icons/image2.gif) | 6314_IMG-20230811-WA0007.jpg | 2025-05-19 11:07 | 175K | |
![[IMG]](/icons/image2.gif) | 2117_Preschool visit1.jpg | 2025-05-19 11:06 | 176K | |
![[IMG]](/icons/image2.gif) | 2658_29790213_316047488923620_6216210341691022151_n.jpg | 2025-05-19 11:04 | 176K | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting literacy project museum visit.jpg | 2025-05-19 11:04 | 176K | |
![[IMG]](/icons/image2.gif) | 859_IMG-20160321-WA0003 (1).jpg | 2025-05-19 11:05 | 176K | |
![[IMG]](/icons/image2.gif) | 859_IMG-20160321-WA0003.jpg | 2025-05-19 11:05 | 176K | |
![[IMG]](/icons/image2.gif) | 6314_IMG-20230811-WA0001.jpg | 2025-05-19 11:05 | 176K | |
![[IMG]](/icons/image2.gif) | 2658_29598244_316032288925140_7303317463694486228_n.jpg | 2025-05-19 11:04 | 177K | |
![[IMG]](/icons/image2.gif) | 5697_DSC00771.JPG | 2025-05-19 11:07 | 177K | |
![[IMG]](/icons/image2.gif) | 2658_29790019_316030845591951_8611507850511872232_n.jpg | 2025-05-19 11:05 | 177K | |
![[IMG]](/icons/image2.gif) | 2227_IMG-20170804-WA0065.jpg | 2025-05-19 11:06 | 178K | |
![[IMG]](/icons/image2.gif) | 2117_Before new roof.jpg | 2025-05-19 11:03 | 178K | |
![[IMG]](/icons/image2.gif) | 822_IMG_7203.JPG | 2025-05-19 11:05 | 178K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0124.jpg | 2025-05-19 11:05 | 178K | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (17).jpg | 2025-05-19 11:03 | 178K | |
![[IMG]](/icons/image2.gif) | 2127_76ccf02d-d14f-43e2-8f9e-248df605a008.jpg | 2025-05-19 11:03 | 179K | |
![[IMG]](/icons/image2.gif) | 1335_22883989_1889712687756236_1444642356_o (1).jpg | 2025-05-19 11:04 | 179K | |
![[IMG]](/icons/image2.gif) | 1335_22883989_1889712687756236_1444642356_o (2).jpg | 2025-05-19 11:05 | 179K | |
![[IMG]](/icons/image2.gif) | 1335_22883989_1889712687756236_1444642356_o.jpg | 2025-05-19 11:05 | 179K | |
![[IMG]](/icons/image2.gif) | 2127_IMG-20170401-WA0000.jpg | 2025-05-19 11:03 | 179K | |
![[IMG]](/icons/image2.gif) | 1013_IMG_3845.JPG | 2025-05-19 11:04 | 180K | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3955.JPG | 2025-05-19 11:04 | 180K | |
![[IMG]](/icons/image2.gif) | 3730_697e5c6b-ec0a-4849-a835-ab0b7c508c79.jpg | 2025-05-19 11:05 | 180K | |
![[IMG]](/icons/image2.gif) | 6897_HLFTGC8.jpg | 2025-05-19 11:07 | 181K | |
![[IMG]](/icons/image2.gif) | 6314_IMG-20230811-WA0009.jpg | 2025-05-19 11:06 | 181K | |
![[IMG]](/icons/image2.gif) | 1248_2DRRM.jpg | 2025-05-19 11:03 | 181K | |
![[IMG]](/icons/image2.gif) | 3730_bdfb4d46-fa07-4e01-9580-7d698ce66cb0.jpg | 2025-05-19 11:04 | 181K | |
![[IMG]](/icons/image2.gif) | 6104_1686073390832.jpg | 2025-05-19 11:03 | 182K | |
![[IMG]](/icons/image2.gif) | 6104_1686316988024.jpg | 2025-05-19 11:04 | 182K | |
![[IMG]](/icons/image2.gif) | 3730_ef65df6f-1cc4-42b2-a32e-1a0e6138b5b6.jpg | 2025-05-19 11:04 | 182K | |
![[IMG]](/icons/image2.gif) | 5775_25.jpg | 2025-05-19 11:05 | 182K | |
![[IMG]](/icons/image2.gif) | 3730_64d147c1-bc01-42f3-93ce-62df2bae2572.jpg | 2025-05-19 11:05 | 182K | |
![[IMG]](/icons/image2.gif) | 2117_San juan school visit 1.jpg | 2025-05-19 11:07 | 182K | |
![[IMG]](/icons/image2.gif) | 2658_IMG-20180605-WA0004.jpg | 2025-05-19 11:05 | 183K | |
![[IMG]](/icons/image2.gif) | 3730_9c701842-6cc4-4d46-8c7b-abb23a3c8f99.jpg | 2025-05-19 11:05 | 183K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0129.jpg | 2025-05-19 11:03 | 183K | |
![[IMG]](/icons/image2.gif) | 7057_3a33ae8f-f274-46a6-82fc-1273e31c1594.JPG | 2025-05-19 11:04 | 183K | |
![[IMG]](/icons/image2.gif) | 6897_HLFTGC4.jpg | 2025-05-19 11:03 | 184K | |
![[IMG]](/icons/image2.gif) | 5576_IMG-20230621-WA0002 (1).jpg | 2025-05-19 11:04 | 184K | |
![[IMG]](/icons/image2.gif) | 5576_IMG-20230621-WA0002.jpg | 2025-05-19 11:05 | 184K | |
![[IMG]](/icons/image2.gif) | 2658_29790424_316032108925158_6737639034578838958_n.jpg | 2025-05-19 11:03 | 184K | |
![[IMG]](/icons/image2.gif) | 1094_Beneficiary 2 testimonial.jpg | 2025-05-19 11:05 | 185K | |
![[IMG]](/icons/image2.gif) | 6267_IMG-20240212-WA0032.jpg | 2025-05-19 11:04 | 185K | |
![[IMG]](/icons/image2.gif) | 5775_28.jpg | 2025-05-19 11:03 | 185K | |
![[IMG]](/icons/image2.gif) | 2794_Training Session (12).JPG | 2025-05-19 11:05 | 186K | |
![[IMG]](/icons/image2.gif) | 745_Healing garden.jpg | 2025-05-19 11:04 | 186K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1334.JPG | 2025-05-19 11:05 | 186K | |
![[IMG]](/icons/image2.gif) | 3772_Enock Kausiwa-Emerging leader.jpg | 2025-05-19 11:04 | 186K | |
![[IMG]](/icons/image2.gif) | 3730_1318124a-ac2a-4a44-9470-171cf70cb962.jpg | 2025-05-19 11:05 | 186K | |
![[IMG]](/icons/image2.gif) | 1242_IMG-20161113-WA0002.jpg | 2025-05-19 11:03 | 186K | |
![[IMG]](/icons/image2.gif) | 2384_5dbe1682-1518-42ed-af4a-91cd86b53a77.jpg | 2025-05-19 11:05 | 186K | |
![[IMG]](/icons/image2.gif) | 2384_CAMME Classroom 1.jpg | 2025-05-19 11:04 | 186K | |
![[IMG]](/icons/image2.gif) | 2414_IMG-20180220-WA0019 (1).jpg | 2025-05-19 11:05 | 187K | |
![[IMG]](/icons/image2.gif) | 3730_4a9c9611-f25c-4bcc-92cb-12a69c481be6.jpg | 2025-05-19 11:03 | 187K | |
![[IMG]](/icons/image2.gif) | 4778_FAFM6379[1].JPG | 2025-05-19 11:03 | 187K | |
![[IMG]](/icons/image2.gif) | 4678_IMG-20200513-WA0015.jpg | 2025-05-19 11:04 | 187K | |
![[IMG]](/icons/image2.gif) | 6314_IMG-20230811-WA0011.jpg | 2025-05-19 11:04 | 187K | |
![[IMG]](/icons/image2.gif) | 3730_9502fe70-ac95-4d64-968f-ac40b22c2864.jpg | 2025-05-19 11:05 | 187K | |
![[IMG]](/icons/image2.gif) | 1413_PCPP Community Letter.jpg | 2025-05-19 11:05 | 187K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_9411_1024.jpg | 2025-05-19 11:04 | 187K | |
![[IMG]](/icons/image2.gif) | 2533_IMG_8690.jpg | 2025-05-19 11:04 | 188K | |
![[IMG]](/icons/image2.gif) | 2102_DWVH3361.jpg | 2025-05-19 11:07 | 188K | |
![[IMG]](/icons/image2.gif) | 5658_PXL_20230215_192349.jpg | 2025-05-19 11:03 | 188K | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting community center class graduates.jpg | 2025-05-19 11:04 | 188K | |
![[IMG]](/icons/image2.gif) | 1335_23023250_1889712904422881_1985130997_o.jpg | 2025-05-19 11:05 | 189K | |
![[IMG]](/icons/image2.gif) | 2533_IMG_8701.jpg | 2025-05-19 11:04 | 189K | |
![[IMG]](/icons/image2.gif) | 2117_San Miguel school visit.jpg | 2025-05-19 11:05 | 189K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_9070_1024.jpg | 2025-05-19 11:04 | 189K | |
![[IMG]](/icons/image2.gif) | 6692_Kayesera Branding.jpg | 2025-05-19 11:05 | 189K | |
![[IMG]](/icons/image2.gif) | 5678_Mutembo goats now.jpg | 2025-05-19 11:05 | 190K | |
![[ ]](/icons/layout.gif) | 2128_Image051217022021.pdf | 2025-05-19 11:07 | 190K | |
![[IMG]](/icons/image2.gif) | 3155_IMG_2707.JPG | 2025-05-19 11:03 | 190K | |
![[IMG]](/icons/image2.gif) | 6897_HLFTGC1.jpg | 2025-05-19 11:05 | 191K | |
![[IMG]](/icons/image2.gif) | 6104_1686316982148.jpg | 2025-05-19 11:05 | 191K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_7365_1024.jpg | 2025-05-19 11:07 | 192K | |
![[ ]](/icons/layout.gif) | 6618_THE BBF PROJECT FINANCIAL REPORT.pdf | 2025-05-19 11:05 | 192K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1218.JPG | 2025-05-19 11:05 | 192K | |
![[IMG]](/icons/image2.gif) | 3657_Objectives of the project. RPCV often sent them to team and other key actors as reminders.jpg | 2025-05-19 11:05 | 192K | |
![[IMG]](/icons/image2.gif) | 7017_14.jpg | 2025-06-06 17:54 | 192K | |
![[IMG]](/icons/image2.gif) | 5536_1738390414863.jpg | 2025-05-19 11:03 | 192K | |
![[IMG]](/icons/image2.gif) | 3730_7f8e9705-f200-4f9e-a19a-811ac2ecefa4.jpg | 2025-05-19 11:07 | 193K | |
![[IMG]](/icons/image2.gif) | 3730_31dcfadf-3d7a-4885-a0e1-763b2a19439d.jpg | 2025-05-19 11:04 | 193K | |
![[IMG]](/icons/image2.gif) | 2117_Pataste School visit.jpg | 2025-05-19 11:04 | 193K | |
![[IMG]](/icons/image2.gif) | 6627_IMG-20231128-WA0012.jpg | 2025-05-19 11:03 | 194K | |
![[IMG]](/icons/image2.gif) | 6314_IMG-20230811-WA0003.jpg | 2025-05-19 11:05 | 194K | |
![[IMG]](/icons/image2.gif) | 3354_20200229_053132.jpg | 2025-05-19 11:04 | 195K | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3946.JPG | 2025-05-19 11:07 | 195K | |
![[IMG]](/icons/image2.gif) | 2926_Volunteer mother and PreK Students on a Farm.jpg | 2025-05-19 11:06 | 196K | |
![[IMG]](/icons/image2.gif) | 3730_bb80d84d-8dea-41db-8156-90eb214f79d2.jpg | 2025-05-19 11:04 | 196K | |
![[ ]](/icons/layout.gif) | 4695_Pamtondo photo 1.pdf | 2025-05-19 11:05 | 197K | |
![[IMG]](/icons/image2.gif) | 6273_Outcome 3 Kitchen Grden.jpg | 2025-05-19 11:06 | 197K | |
![[IMG]](/icons/image2.gif) | 859_IMG-20160321-WA0002.jpg | 2025-05-19 11:04 | 198K | |
![[IMG]](/icons/image2.gif) | 2117_San juan school visit.jpg | 2025-05-19 11:05 | 198K | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting literacy project school murals 2.jpg | 2025-05-19 11:05 | 198K | |
![[IMG]](/icons/image2.gif) | 6273_Delivery day 20 june.jpg | 2025-05-19 11:03 | 198K | |
![[IMG]](/icons/image2.gif) | 2414_IMG-20180220-WA0020 (1).jpg | 2025-05-19 11:03 | 198K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1219.JPG | 2025-05-19 11:04 | 198K | |
![[IMG]](/icons/image2.gif) | 5848_IMG-20221230-WA0039.jpg | 2025-05-19 11:05 | 198K | |
![[IMG]](/icons/image2.gif) | 7017_19.jpg | 2025-06-06 17:54 | 199K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1332.JPG | 2025-05-19 11:05 | 199K | |
![[IMG]](/icons/image2.gif) | 1308_IMG_1371.JPG | 2025-05-19 11:05 | 199K | |
![[IMG]](/icons/image2.gif) | 7017_2.jpg | 2025-06-06 17:54 | 199K | |
![[IMG]](/icons/image2.gif) | 6314_IMG-20230811-WA0010.jpg | 2025-05-19 11:04 | 200K | |
![[IMG]](/icons/image2.gif) | 1308_IMG_1380.JPG | 2025-05-19 11:04 | 200K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_9010_1024.jpg | 2025-05-19 11:03 | 202K | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3948.JPG | 2025-05-19 11:05 | 203K | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting parent workshop.jpg | 2025-05-19 11:03 | 203K | |
![[IMG]](/icons/image2.gif) | 6113_IMG-20230215-WA0065.jpg | 2025-05-19 11:03 | 203K | |
![[IMG]](/icons/image2.gif) | 5576_IMG-20230621-WA0052.jpg | 2025-05-19 11:07 | 203K | |
![[IMG]](/icons/image2.gif) | 7017_9.jpg | 2025-06-06 17:54 | 204K | |
![[ ]](/icons/layout.gif) | 5284_LUSO COMMUNITY CONTRIBUTION.pdf | 2025-05-19 11:03 | 204K | |
![[IMG]](/icons/image2.gif) | 6273_Delivery day 17 july.jpg | 2025-05-19 11:03 | 204K | |
![[IMG]](/icons/image2.gif) | 4778_testimonial 2.jpg | 2025-05-19 11:05 | 204K | |
![[IMG]](/icons/image2.gif) | 6306_winner of arewa spelling competition.png | 2025-05-19 11:05 | 204K | |
![[IMG]](/icons/image2.gif) | 2477_4c253c60-7e00-4be6-ab84-9a5b4d7c4b2a 3.JPG | 2025-05-19 11:04 | 205K | |
![[IMG]](/icons/image2.gif) | 5775_36.jpg | 2025-05-19 11:05 | 206K | |
![[IMG]](/icons/image2.gif) | 6273_ECD Chantal Pig after 6 months.jpg | 2025-05-19 11:04 | 206K | |
![[IMG]](/icons/image2.gif) | 1379_Maria Pintado1.jpg | 2025-05-19 11:05 | 206K | |
![[ ]](/icons/compressed.gif) | Final Report_20-034 (Tembo, Austine) - Files.zip | 2025-05-19 11:03 | 206K | |
![[IMG]](/icons/image2.gif) | 3730_4471b586-2e2d-4fe4-8a40-c62e9f642bc6.jpg | 2025-05-19 11:04 | 207K | |
![[IMG]](/icons/image2.gif) | 3730_de4b4bb2-5c48-4819-a9b8-d80de328ad83.jpg | 2025-05-19 11:04 | 208K | |
![[IMG]](/icons/image2.gif) | 6306_arewa spelling bee competition.png | 2025-05-19 11:04 | 208K | |
![[IMG]](/icons/image2.gif) | 7017_3.jpg | 2025-06-06 17:54 | 208K | |
![[IMG]](/icons/image2.gif) | 1060_Othman El Bouni.jpg | 2025-05-19 11:04 | 208K | |
![[IMG]](/icons/image2.gif) | 5536_1738388350836.jpg | 2025-05-19 11:04 | 209K | |
![[IMG]](/icons/image2.gif) | 7017_10.jpg | 2025-06-06 17:54 | 209K | |
![[IMG]](/icons/image2.gif) | 7000_NB5.JPG | 2025-05-19 11:05 | 209K | |
![[IMG]](/icons/image2.gif) | 6627_IMG-20231122-WA0037.jpg | 2025-05-19 11:03 | 209K | |
![[IMG]](/icons/image2.gif) | 2658_29793033_316047432256959_4339695271183873339_n.jpg | 2025-05-19 11:04 | 209K | |
![[IMG]](/icons/image2.gif) | 5848_IMG-20221230-WA0040.jpg | 2025-05-19 11:05 | 209K | |
![[IMG]](/icons/image2.gif) | 6551_IMG-20240811-WA0069.jpg | 2025-05-19 11:05 | 209K | |
![[IMG]](/icons/image2.gif) | 4778_thank you letter 2.jpg | 2025-05-19 11:04 | 210K | |
![[ ]](/icons/unknown.gif) | 1445_Duke_PCGOFinalReport.PDF | 2025-05-19 11:04 | 210K | |
![[IMG]](/icons/image2.gif) | 6299_Visit to Maman Sarah.jpg | 2025-05-19 11:05 | 211K | |
![[IMG]](/icons/image2.gif) | 3730_a12e86a4-0b12-4749-bfc4-38c58c94bd37.jpg | 2025-05-19 11:03 | 211K | |
![[IMG]](/icons/image2.gif) | 6306_arewa spelling bee competition 2.png | 2025-05-19 11:05 | 211K | |
![[ ]](/icons/unknown.gif) | 2504_AV Equipment Loan Form_UEP_LRC.docx | 2025-05-19 11:03 | 212K | |
![[ ]](/icons/layout.gif) | 2128_Image051217022001.pdf | 2025-05-19 11:05 | 212K | |
![[IMG]](/icons/image2.gif) | 3730_bb33eb25-b5ab-4d53-8cd0-fbabb29f0a1d.jpg | 2025-05-19 11:05 | 212K | |
![[IMG]](/icons/image2.gif) | 1312_DormWalls.jpg | 2025-05-19 11:05 | 212K | |
![[ ]](/icons/layout.gif) | 2128_Image051217022243.pdf | 2025-05-19 11:04 | 212K | |
![[IMG]](/icons/image2.gif) | 7017_20.jpg | 2025-06-06 17:54 | 213K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_0587_1024.jpg | 2025-05-19 11:03 | 213K | |
![[IMG]](/icons/image2.gif) | 5810_CHPS Compound While Building 2.jpg | 2025-05-19 11:03 | 214K | |
![[ ]](/icons/compressed.gif) | Solar Power and Running Water for Village Health Hut in Senegal-final_report-files.zip | 2025-05-19 11:03 | 214K | |
![[ ]](/icons/compressed.gif) | Final Report_17-056 (Henry, Nkwa) - Files.zip | 2025-05-19 11:05 | 214K | |
![[ ]](/icons/compressed.gif) | Final Report_20-090 (Tembo, Austine) - Budget Files.zip | 2025-05-19 11:03 | 214K | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3945.JPG | 2025-05-19 11:03 | 214K | |
![[IMG]](/icons/image2.gif) | 2213_IMG-20171012-WA0022.jpg | 2025-05-19 11:05 | 214K | |
![[IMG]](/icons/image2.gif) | 3730_8a8c6d01-d76a-4878-add3-710bc9fe803d.jpg | 2025-05-19 11:06 | 214K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1331.JPG | 2025-05-19 11:04 | 215K | |
![[IMG]](/icons/image2.gif) | 6713_Chibanja Primary 5.jpg | 2025-05-19 11:05 | 215K | |
![[IMG]](/icons/image2.gif) | 3730_6d45418e-0eb0-4afe-8ebc-20fe0a4d5d1c.jpg | 2025-05-19 11:07 | 215K | |
![[IMG]](/icons/image2.gif) | 1397_august 8.jpg | 2025-05-19 11:05 | 215K | |
![[IMG]](/icons/image2.gif) | 6897_HLFTGC5.jpg | 2025-05-19 11:04 | 215K | |
![[IMG]](/icons/image2.gif) | 3730_Complete list of 2019 parades Banda Comunal Paraiso 2019.JPG | 2025-05-19 11:04 | 215K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_9011_1024.jpg | 2025-05-19 11:04 | 216K | |
![[ ]](/icons/layout.gif) | 2128_Image051217022414.pdf | 2025-05-19 11:03 | 216K | |
![[IMG]](/icons/image2.gif) | 2213_IMG-20171012-WA0024.jpg | 2025-05-19 11:04 | 216K | |
![[IMG]](/icons/image2.gif) | 3730_32bf95c3-1cd2-4c17-98d8-1baa03643ace.jpg | 2025-05-19 11:03 | 216K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_0592_1024.jpg | 2025-05-19 11:04 | 216K | |
![[IMG]](/icons/image2.gif) | 1430_IMG-20170620-WA0006.jpg | 2025-05-19 11:05 | 217K | |
![[IMG]](/icons/image2.gif) | 1013_IMG_3851.JPG | 2025-05-19 11:04 | 217K | |
![[IMG]](/icons/image2.gif) | 7370_1b78b873-641f-43f1-b7ee-6f99d27cd5d6.jpg | 2025-07-24 16:47 | 217K | |
![[IMG]](/icons/image2.gif) | 7017_4.jpg | 2025-06-06 17:54 | 218K | |
![[IMG]](/icons/image2.gif) | 2213_IMG-20171012-WA0020.jpg | 2025-05-19 11:05 | 218K | |
![[IMG]](/icons/image2.gif) | 7017_7.jpg | 2025-06-06 17:54 | 219K | |
![[IMG]](/icons/image2.gif) | 7017_15.jpg | 2025-06-06 17:54 | 219K | |
![[ ]](/icons/layout.gif) | 7101_Site plans.pdf | 2025-05-19 11:03 | 220K | |
![[IMG]](/icons/image2.gif) | 3354_FB_IMG_15829744961476404.jpg | 2025-05-19 11:04 | 220K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_9432_1024.jpg | 2025-05-19 11:03 | 221K | |
![[IMG]](/icons/image2.gif) | 7017_13.jpg | 2025-06-06 17:54 | 221K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_9422_1024.jpg | 2025-05-19 11:05 | 222K | |
![[IMG]](/icons/image2.gif) | 7370_6b14773d-e059-4f91-ab9e-c005eb588da5.jpg | 2025-07-24 16:47 | 222K | |
![[IMG]](/icons/image2.gif) | 3730_23a42a52-b782-48e0-b8fb-ca1b545bd9f6.jpg | 2025-05-19 11:03 | 223K | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3947.JPG | 2025-05-19 11:05 | 223K | |
![[IMG]](/icons/image2.gif) | 3263_Group Photo.jpg | 2025-05-19 11:06 | 223K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_9013_1024.jpg | 2025-05-19 11:06 | 225K | |
![[IMG]](/icons/image2.gif) | 6897_HLFTGC10.jpg | 2025-05-19 11:03 | 225K | |
![[IMG]](/icons/image2.gif) | 3155_IMG_2705.JPG | 2025-05-19 11:04 | 226K | |
![[IMG]](/icons/image2.gif) | 4778_thank you letter from community.jpg | 2025-05-19 11:03 | 226K | |
![[ ]](/icons/compressed.gif) | Final Report_20-031 (Nyenyezi, James) - Budget Files.zip | 2025-05-19 11:03 | 226K | |
![[IMG]](/icons/image2.gif) | 2658_18485934_316047205590315_6207716436915470779_n.jpg | 2025-05-19 11:05 | 227K | |
![[IMG]](/icons/image2.gif) | 4369_t shirts.jpg | 2025-05-19 11:07 | 227K | |
![[ ]](/icons/layout.gif) | 2128_Image051217022324.pdf | 2025-05-19 11:03 | 227K | |
![[IMG]](/icons/image2.gif) | 2213_IMG-20171012-WA0021.jpg | 2025-05-19 11:03 | 228K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_8962_1024.jpg | 2025-05-19 11:07 | 228K | |
![[IMG]](/icons/image2.gif) | 859_IMG_20160318_072143.jpg | 2025-05-19 11:05 | 228K | |
![[ ]](/icons/compressed.gif) | Final Report_20-031 (Nyenyezi, James) - Files.zip | 2025-05-19 11:05 | 228K | |
![[IMG]](/icons/image2.gif) | 6897_HLFTGC7.jpg | 2025-05-19 11:05 | 228K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_9415_1024.jpg | 2025-05-19 11:04 | 229K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_9709_1024.jpg | 2025-05-19 11:06 | 229K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_9420_1024.jpg | 2025-05-19 11:07 | 229K | |
![[IMG]](/icons/image2.gif) | 2794_Training Session- Established Field Partner Addressing beneficiaries).JPG | 2025-05-19 11:04 | 230K | |
![[IMG]](/icons/image2.gif) | 1401_IMG_4814.jpg | 2025-05-19 11:04 | 230K | |
![[IMG]](/icons/image2.gif) | 1397_august 9.jpg | 2025-05-19 11:05 | 230K | |
![[IMG]](/icons/image2.gif) | 1308_IMG_1370.JPG | 2025-05-19 11:07 | 230K | |
![[IMG]](/icons/image2.gif) | 2102_Feria photo.jpg | 2025-05-19 11:04 | 231K | |
![[IMG]](/icons/image2.gif) | 2213_IMG-20171012-WA0023.jpg | 2025-05-19 11:03 | 231K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_9012_1024.jpg | 2025-05-19 11:03 | 231K | |
![[IMG]](/icons/image2.gif) | 6797_IMG_20240822_191211.jpg | 2025-05-19 11:03 | 232K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0114.jpg | 2025-05-19 11:03 | 233K | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (10).jpg | 2025-05-19 11:03 | 235K | |
![[IMG]](/icons/image2.gif) | 3730_dbacae63-bb72-484a-9049-10c37bad5174.jpg | 2025-05-19 11:03 | 235K | |
![[IMG]](/icons/image2.gif) | 3730_6151e0c8-5feb-43bc-bf19-7952468fb838.jpg | 2025-05-19 11:03 | 235K | |
![[ ]](/icons/layout.gif) | 760_20161130_ad_Flying HIS Officer20161202164524.pdf | 2025-05-19 11:05 | 235K | |
![[IMG]](/icons/image2.gif) | 859_IMG_20160318_072118.jpg | 2025-05-19 11:06 | 236K | |
![[IMG]](/icons/image2.gif) | 859_solar panel and church.jpg | 2025-05-19 11:05 | 236K | |
![[IMG]](/icons/image2.gif) | 6797_IMG_20240822_191517.jpg | 2025-05-19 11:05 | 236K | |
![[IMG]](/icons/image2.gif) | 1004_26218146680_f8bebbcaf9_b.jpg | 2025-05-19 11:03 | 237K | |
![[ ]](/icons/layout.gif) | 2503_wc3.pdf | 2025-05-19 11:06 | 238K | |
![[IMG]](/icons/image2.gif) | 4778_thank you letter 3.jpg | 2025-05-19 11:03 | 238K | |
![[IMG]](/icons/image2.gif) | 2127_17016818_390824577962957_5492464023938977148_o.jpg | 2025-05-19 11:05 | 238K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_7816_1024.jpg | 2025-05-19 11:05 | 238K | |
![[IMG]](/icons/image2.gif) | 6267_IMG-20240212-WA0034.jpg | 2025-05-19 11:04 | 239K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_9435_1024.jpg | 2025-05-19 11:05 | 240K | |
![[IMG]](/icons/image2.gif) | 4514_136a6677-589b-4337-9007-9f3ab539e995.jpg | 2025-05-19 11:03 | 240K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_9416_1024.jpg | 2025-05-19 11:03 | 241K | |
![[ ]](/icons/layout.gif) | 2128_Image051217022131.pdf | 2025-05-19 11:04 | 241K | |
![[IMG]](/icons/image2.gif) | 3074_100_1319.JPG | 2025-05-19 11:03 | 241K | |
![[ ]](/icons/layout.gif) | 2115_Village Appropriate Banana Tissue culture.doc.pdf | 2025-05-19 11:03 | 241K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_9054_1024.jpg | 2025-05-19 11:03 | 242K | |
![[IMG]](/icons/image2.gif) | 6306_Screenshot_20230822-081448_1.png | 2025-05-19 11:03 | 243K | |
![[IMG]](/icons/image2.gif) | 7000_NB6.JPG | 2025-05-19 11:03 | 244K | |
![[IMG]](/icons/image2.gif) | 4778_AHAE1055[1].JPG | 2025-05-19 11:05 | 244K | |
![[ ]](/icons/compressed.gif) | Final Report_20-032 (Kasambala, Kondwani) - Files.zip | 2025-05-19 11:05 | 245K | |
![[IMG]](/icons/image2.gif) | 1004_26218143130_6101a5d4df_b.jpg | 2025-05-19 11:05 | 245K | |
![[IMG]](/icons/image2.gif) | 5536_1738388314680.jpg | 2025-05-19 11:04 | 247K | |
![[IMG]](/icons/image2.gif) | 3730_68f67ce2-e6c7-4560-91ee-f9644f74fc1d.jpg | 2025-05-19 11:05 | 247K | |
![[IMG]](/icons/image2.gif) | 1312_DormitoryPlan.jpg | 2025-05-19 11:05 | 248K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_9073_1024.jpg | 2025-05-19 11:03 | 248K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1222.JPG | 2025-05-19 11:03 | 249K | |
![[IMG]](/icons/image2.gif) | 2794_Training Session - head of training discussing tomato processing.JPG | 2025-05-19 11:06 | 250K | |
![[IMG]](/icons/image2.gif) | 3245_clean poster.jpg | 2025-05-19 11:05 | 250K | |
![[IMG]](/icons/image2.gif) | 3730_2e7fd916-37b1-46e8-a4fc-c3d930505f6f.jpg | 2025-05-19 11:07 | 250K | |
![[IMG]](/icons/image2.gif) | 1004_26218148640_58767d687f_b.jpg | 2025-05-19 11:04 | 252K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_8955_1024.jpg | 2025-05-19 11:05 | 252K | |
![[ ]](/icons/layout.gif) | 2503_WC1.pdf | 2025-05-19 11:03 | 252K | |
![[IMG]](/icons/image2.gif) | 6239_IMG_20230825_154648_930.jpg | 2025-05-19 11:05 | 253K | |
![[IMG]](/icons/image2.gif) | 1013_IMG_3835.JPG | 2025-05-19 11:05 | 253K | |
![[IMG]](/icons/image2.gif) | 5576_IMG-20230621-WA0017.jpg | 2025-05-19 11:03 | 254K | |
![[IMG]](/icons/image2.gif) | 2507_Startup gring 16th event.jpg | 2025-05-19 11:03 | 255K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0111.jpg | 2025-05-19 11:05 | 257K | |
![[IMG]](/icons/image2.gif) | 6288_MAA Making Liquid Soap Training.jpg | 2025-05-19 11:05 | 257K | |
![[IMG]](/icons/image2.gif) | 4369_sewing machines.jpg | 2025-05-19 11:04 | 257K | |
![[ ]](/icons/unknown.gif) | 1277_ropes course certivicate.docx | 2025-05-19 11:03 | 257K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1337.JPG | 2025-05-19 11:05 | 258K | |
![[IMG]](/icons/image2.gif) | 3730_9f1ea856-977a-4e64-8296-92a2cc7497eb.jpg | 2025-05-19 11:05 | 258K | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting teacher workshop.jpg | 2025-05-19 11:05 | 258K | |
![[IMG]](/icons/image2.gif) | 6525_IMG-20230531-WA0032.jpg | 2025-05-19 11:04 | 259K | |
![[IMG]](/icons/image2.gif) | 2794_Training Session- Head of Training discussing packaging.JPG | 2025-05-19 11:05 | 261K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_8966_1024.jpg | 2025-05-19 11:03 | 262K | |
![[IMG]](/icons/image2.gif) | 2389_04142018_NigelHunter_Coffee Mill Training 5.jpg.jpg | 2025-05-19 11:05 | 262K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_8943_1024.jpg | 2025-05-19 11:05 | 264K | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting community center class graduates 2.jpg | 2025-05-19 11:05 | 265K | |
![[IMG]](/icons/image2.gif) | 5815_1639858081479.jpg | 2025-05-19 11:04 | 266K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170707_105336_131525782478445805.jpg | 2025-05-19 11:03 | 266K | |
![[IMG]](/icons/image2.gif) | 2531_EMILYMIKI - WIN_20190328_203538.JPG | 2025-05-19 11:06 | 267K | |
![[IMG]](/icons/image2.gif) | 783_IMG_7600.JPG | 2025-05-19 11:06 | 267K | |
![[IMG]](/icons/image2.gif) | 1668_Crew Photo.jpg | 2025-05-19 11:03 | 267K | |
![[IMG]](/icons/image2.gif) | 7102_FIG X TG Talleres Culinarios (1).jpg | 2025-05-19 11:05 | 268K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_9710_1024.jpg | 2025-05-19 11:06 | 269K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_9428_1024.jpg | 2025-05-19 11:05 | 270K | |
![[IMG]](/icons/image2.gif) | 6897_HLFTGC6.jpg | 2025-05-19 11:07 | 270K | |
![[IMG]](/icons/image2.gif) | 859_IMG-20160226-WA0003.jpg | 2025-05-19 11:06 | 271K | |
![[IMG]](/icons/image2.gif) | 2539_Donkey Ripples. iACT 2018.jpg | 2025-05-19 11:04 | 271K | |
![[IMG]](/icons/image2.gif) | 5536_1738388564161.jpg | 2025-05-19 11:05 | 272K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_9426_1024.jpg | 2025-05-19 11:04 | 272K | |
![[IMG]](/icons/image2.gif) | 2794_Training Session (17).JPG | 2025-05-19 11:05 | 274K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1144.JPG | 2025-05-19 11:05 | 274K | |
![[ ]](/icons/layout.gif) | 2128_Image051217022303.pdf | 2025-05-19 11:05 | 276K | |
![[IMG]](/icons/image2.gif) | 5576_IMG-20230621-WA0012.jpg | 2025-05-19 11:05 | 276K | |
![[IMG]](/icons/image2.gif) | 3074_100_1326.JPG | 2025-05-19 11:05 | 276K | |
![[IMG]](/icons/image2.gif) | 6671_IMG_1446.jpg | 2025-05-19 11:03 | 277K | |
![[IMG]](/icons/image2.gif) | 991_15310836_1813523822250500_1041166730_o.jpg | 2025-05-19 11:05 | 277K | |
![[IMG]](/icons/image2.gif) | 6306_arewa spelling bee competition 4.png | 2025-05-19 11:04 | 280K | |
![[IMG]](/icons/image2.gif) | 7370_a699ec83-b205-4b33-9401-bc4dd416304a.jpg | 2025-07-24 16:47 | 282K | |
![[IMG]](/icons/image2.gif) | 1397_august 2.jpg | 2025-05-19 11:04 | 288K | |
![[IMG]](/icons/image2.gif) | 1401_IMG_4750.jpg | 2025-05-19 11:05 | 288K | |
![[IMG]](/icons/image2.gif) | 3074_100_1349.JPG | 2025-05-19 11:06 | 290K | |
![[IMG]](/icons/image2.gif) | 3074_100_1325.JPG | 2025-05-19 11:05 | 290K | |
![[IMG]](/icons/image2.gif) | 2971_IMG_20190114_114000.jpg | 2025-05-19 11:05 | 291K | |
![[IMG]](/icons/image2.gif) | 3730_0e8effbd-9e96-4414-8802-ae67a52f0150.jpg | 2025-05-19 11:05 | 291K | |
![[ ]](/icons/layout.gif) | 2128_Image051217022156.pdf | 2025-05-19 11:03 | 291K | |
![[IMG]](/icons/image2.gif) | 1004_25888152153_f3f0ee792b_b.jpg | 2025-05-19 11:03 | 292K | |
![[ ]](/icons/compressed.gif) | Localled Culinary Tourism in the Ecuadorian Andes-final_report-files.zip | 2025-05-19 11:03 | 293K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170707_113629_131525782511517864.jpg | 2025-05-19 11:06 | 293K | |
![[IMG]](/icons/image2.gif) | 1397_march.jpg | 2025-05-19 11:05 | 293K | |
![[IMG]](/icons/image2.gif) | 3074_100_1320.JPG | 2025-05-19 11:03 | 293K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_8958_1024.jpg | 2025-05-19 11:03 | 293K | |
![[IMG]](/icons/image2.gif) | 7370_b7862f83-fe2c-46b2-9c83-6a4341fe09e6.jpg | 2025-07-24 16:47 | 294K | |
![[IMG]](/icons/image2.gif) | 6267_IMG-20240212-WA0033.jpg | 2025-05-19 11:03 | 294K | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (8).jpg | 2025-05-19 11:03 | 295K | |
![[IMG]](/icons/image2.gif) | 2117_Environmental Committee Group Photo.jpg | 2025-05-19 11:07 | 295K | |
![[IMG]](/icons/image2.gif) | 3074_100_1324.JPG | 2025-05-19 11:04 | 296K | |
![[IMG]](/icons/image2.gif) | 7101_285c50c5-4b48-41e7-bace-7b35accc317f.jpg | 2025-05-19 11:05 | 296K | |
![[IMG]](/icons/image2.gif) | 3745_Tisange.png | 2025-05-19 11:05 | 296K | |
![[IMG]](/icons/image2.gif) | 1401_IMG_4549.jpg | 2025-05-19 11:05 | 297K | |
![[IMG]](/icons/image2.gif) | 1397_march 3.jpg | 2025-05-19 11:06 | 297K | |
![[IMG]](/icons/image2.gif) | 3730_c45e2261-e47d-4f33-a2fe-1ad4e9500fc0.jpg | 2025-05-19 11:03 | 298K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_9074_1024.jpg | 2025-05-19 11:05 | 298K | |
![[IMG]](/icons/image2.gif) | 7000_MG4.JPG | 2025-05-19 11:05 | 300K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170707_120026_131525783379347388.jpg | 2025-05-19 11:05 | 301K | |
![[IMG]](/icons/image2.gif) | 2376_24132080_10155992165507082_4481757067372251470_o.jpg | 2025-05-19 11:06 | 301K | |
![[IMG]](/icons/image2.gif) | 7370_733325ea-4649-45de-8bf6-902808a5ee86.jpg | 2025-07-24 16:47 | 302K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170715_103214.jpg | 2025-05-19 11:03 | 303K | |
![[ ]](/icons/layout.gif) | 5284_Kuroilers-Africa.pdf | 2025-05-19 11:05 | 303K | |
![[IMG]](/icons/image2.gif) | 997_IMG_0499.JPG | 2025-05-19 11:03 | 304K | |
![[IMG]](/icons/image2.gif) | 5536_1738388369899.jpg | 2025-05-19 11:05 | 304K | |
![[IMG]](/icons/image2.gif) | 3074_100_1315.JPG | 2025-05-19 11:06 | 305K | |
![[IMG]](/icons/image2.gif) | 1397_march 5.jpg | 2025-05-19 11:04 | 305K | |
![[IMG]](/icons/image2.gif) | 1004_26465064666_2f46316e03_b.jpg | 2025-05-19 11:05 | 306K | |
![[IMG]](/icons/image2.gif) | 6525_IMG-20230531-WA0028.jpg | 2025-05-19 11:06 | 306K | |
![[ ]](/icons/compressed.gif) | Final Report_20-041 (Kanyoza, Francis) - Budget Files.zip | 2025-05-19 11:03 | 308K | |
![[ ]](/icons/unknown.gif) | 1277_SOS manual 2.docx | 2025-05-19 11:05 | 308K | |
![[IMG]](/icons/image2.gif) | 2397_Next Gen Female CEO 9.JPG | 2025-05-19 11:06 | 308K | |
![[IMG]](/icons/image2.gif) | 1668_Crew at Work.jpg | 2025-05-19 11:05 | 308K | |
![[IMG]](/icons/image2.gif) | 7370_f2536db8-02f7-4e5b-8f71-7881f7ec25f8.jpg | 2025-07-24 16:47 | 309K | |
![[IMG]](/icons/image2.gif) | 3657_Guillermina's testimony in Spanish. Cena = Zena.png | 2025-05-19 11:05 | 309K | |
![[IMG]](/icons/image2.gif) | 6306_arewa spelling bee competition 1.png | 2025-05-19 11:06 | 309K | |
![[IMG]](/icons/image2.gif) | 3730_e40d7ff9-d418-415d-87ca-2380a04283ff.jpg | 2025-05-19 11:03 | 311K | |
![[ ]](/icons/layout.gif) | 6104_Malidade community water project 3.pdf | 2025-05-19 11:03 | 311K | |
![[IMG]](/icons/image2.gif) | 1312_Stonework.jpg | 2025-05-19 11:03 | 313K | |
![[IMG]](/icons/image2.gif) | 7057_dcc05680-d6df-4fee-ab3e-b36927f9216b.JPG | 2025-05-19 11:03 | 313K | |
![[IMG]](/icons/image2.gif) | 1397_march 4.jpg | 2025-05-19 11:06 | 314K | |
![[IMG]](/icons/image2.gif) | 2794_Training Session (9).JPG | 2025-05-19 11:05 | 314K | |
![[IMG]](/icons/image2.gif) | 2475_IMG_3524.JPG | 2025-05-19 11:07 | 314K | |
![[IMG]](/icons/image2.gif) | 5576_IMG-20230621-WA0013.jpg | 2025-05-19 11:03 | 315K | |
![[ ]](/icons/layout.gif) | 2128_Image051217022043.pdf | 2025-05-19 11:05 | 315K | |
![[IMG]](/icons/image2.gif) | 1312_MrSengerema_ProjectManager.png | 2025-05-19 11:06 | 316K | |
![[IMG]](/icons/image2.gif) | 3074_100_1321.JPG | 2025-05-19 11:04 | 317K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170715_102813.jpg | 2025-05-19 11:05 | 320K | |
![[IMG]](/icons/image2.gif) | 3730_fde98b4d-19de-4e69-8f46-617687704789.jpg | 2025-05-19 11:03 | 320K | |
![[IMG]](/icons/image2.gif) | 3730_4d4aca92-d814-4001-ac7f-50631c84f87b.jpg | 2025-05-19 11:05 | 320K | |
![[IMG]](/icons/image2.gif) | 7000_MT2.JPG | 2025-05-19 11:04 | 320K | |
![[IMG]](/icons/image2.gif) | 1397_march 6.jpg | 2025-05-19 11:04 | 321K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_8970_1024.jpg | 2025-05-19 11:03 | 322K | |
![[IMG]](/icons/image2.gif) | 7000_SS3.JPG | 2025-05-19 11:07 | 322K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1228.JPG | 2025-05-19 11:05 | 322K | |
![[IMG]](/icons/image2.gif) | 1397_march 7.jpg | 2025-05-19 11:04 | 322K | |
![[IMG]](/icons/image2.gif) | 859_solar panel charla2.jpg | 2025-05-19 11:03 | 322K | |
![[IMG]](/icons/image2.gif) | 7370_5089ba93-ed12-4e00-88bb-66b05135432b.jpg | 2025-07-24 16:47 | 323K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1140.JPG | 2025-05-19 11:03 | 323K | |
![[IMG]](/icons/image2.gif) | 3074_100_1342.JPG | 2025-05-19 11:05 | 324K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170715_102513.jpg | 2025-05-19 11:03 | 325K | |
![[ ]](/icons/compressed.gif) | Final Report_19-088 (Silungwe Khembo, Patience) - Files.zip | 2025-05-19 11:07 | 325K | |
![[IMG]](/icons/image2.gif) | 3074_100_1311.JPG | 2025-05-19 11:03 | 326K | |
![[ ]](/icons/layout.gif) | 2311_LIYO YOUTH EMPOWERED WITH ENVIRONMENTAL ENTREPRENEURSHIP SKILLS.pdf | 2025-05-19 11:05 | 326K | |
![[IMG]](/icons/image2.gif) | 5226_IMG-20211127-WA0028.jpg | 2025-05-19 11:05 | 326K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170708_094239.jpg | 2025-05-19 11:05 | 327K | |
![[ ]](/icons/layout.gif) | 2514_Action-Eco_Programme mai 2018.pdf | 2025-05-19 11:03 | 327K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170715_102407.jpg | 2025-05-19 11:05 | 328K | |
![[IMG]](/icons/image2.gif) | 2604_stat.jpg | 2025-05-19 11:07 | 329K | |
![[IMG]](/icons/image2.gif) | 1013_IMG_3836.JPG | 2025-05-19 11:03 | 330K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170715_104253.jpg | 2025-05-19 11:05 | 330K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170715_102424.jpg | 2025-05-19 11:06 | 331K | |
![[IMG]](/icons/image2.gif) | 2794_Training Session (23).JPG | 2025-05-19 11:03 | 331K | |
![[IMG]](/icons/image2.gif) | 2533_IMG_8706.jpg | 2025-05-19 11:04 | 334K | |
![[IMG]](/icons/image2.gif) | 1397_march 2.jpg | 2025-05-19 11:04 | 336K | |
![[IMG]](/icons/image2.gif) | 3730_582fc98d-5ece-4919-9d87-e905698e8254.jpg | 2025-05-19 11:06 | 336K | |
![[IMG]](/icons/image2.gif) | 3074_100_1367.JPG | 2025-05-19 11:03 | 337K | |
![[IMG]](/icons/image2.gif) | 2475_IMG_3525.JPG | 2025-05-19 11:05 | 337K | |
![[IMG]](/icons/image2.gif) | 1015_IMG_2515.jpg | 2025-05-19 11:06 | 337K | |
![[IMG]](/icons/image2.gif) | 2794_Training Session- Community Leader Addressing Audience.JPG | 2025-05-19 11:03 | 337K | |
![[IMG]](/icons/image2.gif) | 5848_Under tree clinic at chaseta.jpg | 2025-05-19 11:04 | 337K | |
![[IMG]](/icons/image2.gif) | 7000_MT1.JPG | 2025-05-19 11:05 | 338K | |
![[IMG]](/icons/image2.gif) | 3074_100_1312.JPG | 2025-05-19 11:05 | 338K | |
![[ ]](/icons/layout.gif) | 2128_Image051217022106.pdf | 2025-05-19 11:04 | 338K | |
![[IMG]](/icons/image2.gif) | 3657_Abstinence. Gender and Health..HIV, teen pregnancy and maternal mortality..png | 2025-05-19 11:03 | 339K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1234.JPG | 2025-05-19 11:05 | 339K | |
![[IMG]](/icons/image2.gif) | 6288_MAA Community Service.jpg | 2025-05-19 11:05 | 339K | |
![[IMG]](/icons/image2.gif) | 1397_august 7.jpg | 2025-05-19 11:05 | 339K | |
![[IMG]](/icons/image2.gif) | 859_IMG-20160226-WA0001.jpg | 2025-05-19 11:04 | 339K | |
![[IMG]](/icons/image2.gif) | 859_solar panel charla.jpg | 2025-05-19 11:03 | 339K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170715_110111.jpg | 2025-05-19 11:03 | 340K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1186.JPG | 2025-05-19 11:05 | 341K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_7490_1024.jpg | 2025-05-19 11:03 | 342K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1176.JPG | 2025-05-19 11:05 | 343K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170715_103052.jpg | 2025-05-19 11:05 | 344K | |
![[IMG]](/icons/image2.gif) | 1013_IMG_3678.JPG | 2025-05-19 11:05 | 344K | |
![[IMG]](/icons/image2.gif) | 7370_6e4fa086-6900-4b59-b5bd-f1b839c88e93.jpg | 2025-07-24 16:47 | 344K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1212.JPG | 2025-05-19 11:05 | 344K | |
![[IMG]](/icons/image2.gif) | 1397_october 2.jpg | 2025-05-19 11:03 | 345K | |
![[IMG]](/icons/image2.gif) | 2794_Training Session- 2 Community Leaders middle, chairman cooperative left, Established field partner second right, Head of training cordinator right .JPG | 2025-05-19 11:03 | 345K | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (7).jpg | 2025-05-19 11:05 | 345K | |
![[IMG]](/icons/image2.gif) | 7000_SS4.JPG | 2025-05-19 11:06 | 346K | |
![[IMG]](/icons/image2.gif) | 3627_image 1.1.2.png | 2025-05-19 11:04 | 346K | |
![[IMG]](/icons/image2.gif) | 7370_cc27fdfd-bbd1-4f95-819e-aea660efe614.jpg | 2025-07-24 16:47 | 347K | |
![[IMG]](/icons/image2.gif) | 3074_100_1313.JPG | 2025-05-19 11:05 | 348K | |
![[IMG]](/icons/image2.gif) | 3074_100_1340.JPG | 2025-05-19 11:04 | 349K | |
![[ ]](/icons/unknown.gif) | 2799_Copy of 05_Pigs_rev2.doc | 2025-05-19 11:03 | 349K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_7322_1024.jpg | 2025-05-19 11:04 | 350K | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-12.jpg | 2025-05-19 11:05 | 351K | |
![[IMG]](/icons/image2.gif) | 7370_IMG_4862.JPG | 2025-07-24 16:48 | 352K | |
![[IMG]](/icons/image2.gif) | 2794_Training Session (16).JPG | 2025-05-19 11:04 | 352K | |
![[IMG]](/icons/image2.gif) | 1308_IMG_1194.JPG | 2025-05-19 11:03 | 353K | |
![[IMG]](/icons/image2.gif) | 997_IMG_0509.JPG | 2025-05-19 11:03 | 353K | |
![[IMG]](/icons/image2.gif) | 2794_Training Session- Training Session- photo shoot after one of the trainings (29).JPG | 2025-05-19 11:05 | 353K | |
![[IMG]](/icons/image2.gif) | 3074_100_1316.JPG | 2025-05-19 11:07 | 354K | |
![[IMG]](/icons/image2.gif) | 997_IMG_0493.JPG | 2025-05-19 11:04 | 355K | |
![[ ]](/icons/compressed.gif) | Final Report_23-117 (Njoka, Tamandani ) - Files.zip | 2025-05-19 11:05 | 355K | |
![[ ]](/icons/layout.gif) | 7000_Proyecto de Ley de Fomento y Regulación de la Apicultura.pdf | 2025-05-19 11:05 | 356K | |
![[IMG]](/icons/image2.gif) | 2794_Training Session - beneficiaries recieving lectures.JPG | 2025-05-19 11:04 | 357K | |
![[IMG]](/icons/image2.gif) | 2475_IMG_3512.JPG | 2025-05-19 11:05 | 358K | |
![[IMG]](/icons/image2.gif) | 3074_100_1317.JPG | 2025-05-19 11:04 | 360K | |
![[IMG]](/icons/image2.gif) | 3074_100_1310.JPG | 2025-05-19 11:05 | 361K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0119.jpg | 2025-05-19 11:04 | 361K | |
![[IMG]](/icons/image2.gif) | 2128_2000_0104_072507_001.JPG | 2025-05-19 11:03 | 361K | |
![[IMG]](/icons/image2.gif) | 3074_100_1354.JPG | 2025-05-19 11:03 | 362K | |
![[IMG]](/icons/image2.gif) | 3074_100_1338.JPG | 2025-05-19 11:04 | 363K | |
![[IMG]](/icons/image2.gif) | 2794_Training Session (10).JPG | 2025-05-19 11:05 | 363K | |
![[IMG]](/icons/image2.gif) | 997_IMG_0492.JPG | 2025-05-19 11:03 | 363K | |
![[IMG]](/icons/image2.gif) | 3074_100_1350.JPG | 2025-05-19 11:03 | 364K | |
![[IMG]](/icons/image2.gif) | 5658_PXL_20230315_195055.jpg | 2025-05-19 11:04 | 365K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_7361_1024.jpg | 2025-05-19 11:06 | 366K | |
![[IMG]](/icons/image2.gif) | 3074_100_1353.JPG | 2025-05-19 11:05 | 366K | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (9).jpg | 2025-05-19 11:05 | 366K | |
![[IMG]](/icons/image2.gif) | 3074_100_1233.jpg | 2025-05-19 11:03 | 367K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_7317_1024.jpg | 2025-05-19 11:06 | 367K | |
![[IMG]](/icons/image2.gif) | 3074_100_1368.JPG | 2025-05-19 11:07 | 367K | |
![[IMG]](/icons/image2.gif) | 2971_IMG_20190114_114039.jpg | 2025-05-19 11:07 | 367K | |
![[IMG]](/icons/image2.gif) | 1312_MadamMvilleSpeech.png | 2025-05-19 11:06 | 368K | |
![[ ]](/icons/compressed.gif) | Final Report_18-132 (Kamoto, Sara) - Files.zip | 2025-05-19 11:07 | 369K | |
![[IMG]](/icons/image2.gif) | 997_IMG_0485.JPG | 2025-05-19 11:03 | 370K | |
![[IMG]](/icons/image2.gif) | 2600_Driving Lesson.png | 2025-05-19 11:03 | 371K | |
![[IMG]](/icons/image2.gif) | 1397_august 4.jpg | 2025-05-19 11:05 | 371K | |
![[IMG]](/icons/image2.gif) | 3074_100_1333.JPG | 2025-05-19 11:05 | 372K | |
![[IMG]](/icons/image2.gif) | 3074_100_1341.JPG | 2025-05-19 11:04 | 372K | |
![[ ]](/icons/layout.gif) | 3515_ASUD WORLD CONNECT STORIES.pdf | 2025-05-19 11:03 | 373K | |
![[IMG]](/icons/image2.gif) | 3074_100_1335.JPG | 2025-05-19 11:05 | 373K | |
![[IMG]](/icons/image2.gif) | 3074_100_1234.jpg | 2025-05-19 11:04 | 373K | |
![[IMG]](/icons/image2.gif) | 2121_IMG_20180125_104740452_HDR.jpg | 2025-05-19 11:05 | 374K | |
![[IMG]](/icons/image2.gif) | 3074_100_1365.JPG | 2025-05-19 11:03 | 375K | |
![[IMG]](/icons/image2.gif) | 3074_100_1345.JPG | 2025-05-19 11:05 | 375K | |
![[IMG]](/icons/image2.gif) | 1312_TeachersCheckingProgress.jpg | 2025-05-19 11:05 | 377K | |
![[IMG]](/icons/image2.gif) | 2531_EMILYMIKI - WIN_20190328_203925.JPG | 2025-05-19 11:04 | 377K | |
![[IMG]](/icons/image2.gif) | 3074_100_1352.JPG | 2025-05-19 11:04 | 377K | |
![[IMG]](/icons/image2.gif) | 2794_Training Session (14).JPG | 2025-05-19 11:03 | 378K | |
![[IMG]](/icons/image2.gif) | 3074_100_1348.JPG | 2025-05-19 11:04 | 378K | |
![[IMG]](/icons/image2.gif) | 1312_ToiletConstruction.jpg | 2025-05-19 11:04 | 378K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170715_104244.jpg | 2025-05-19 11:03 | 378K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_9693_1024.jpg | 2025-05-19 11:05 | 379K | |
![[IMG]](/icons/image2.gif) | 3074_100_1301.JPG | 2025-05-19 11:04 | 379K | |
![[IMG]](/icons/image2.gif) | 3074_100_1318.JPG | 2025-05-19 11:03 | 379K | |
![[IMG]](/icons/image2.gif) | 7057_fa4e3397-66e2-4dcd-8b52-6935d7318503.JPG | 2025-05-19 11:05 | 380K | |
![[IMG]](/icons/image2.gif) | 3074_100_1309.JPG | 2025-05-19 11:05 | 381K | |
![[IMG]](/icons/image2.gif) | 6671_IMG_1443.jpg | 2025-05-19 11:05 | 381K | |
![[IMG]](/icons/image2.gif) | 3074_100_1351.JPG | 2025-05-19 11:05 | 381K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_8974_1024.jpg | 2025-05-19 11:03 | 381K | |
![[IMG]](/icons/image2.gif) | 3074_100_1343.JPG | 2025-05-19 11:03 | 383K | |
![[IMG]](/icons/image2.gif) | 3074_100_1356.JPG | 2025-05-19 11:05 | 384K | |
![[IMG]](/icons/image2.gif) | 7017_12.jpg | 2025-06-06 17:54 | 384K | |
![[IMG]](/icons/image2.gif) | 2794_Training Session- photo shoot after one of the trainings.JPG | 2025-05-19 11:04 | 385K | |
![[IMG]](/icons/image2.gif) | 1312_RisingWalls.jpg | 2025-05-19 11:04 | 385K | |
![[IMG]](/icons/image2.gif) | 3074_100_1344.JPG | 2025-05-19 11:04 | 386K | |
![[ ]](/icons/layout.gif) | 7000_NTE INEN 3209 NORMA TÉCNICA ECUATORIANA NORMA PARA LA MIEL (CODEX STAN , MOD) Quito Ecuador HONEY BEE. REQUIREMENTS (CODEX STAN , MOD).pdf | 2025-05-19 11:03 | 386K | |
![[IMG]](/icons/image2.gif) | 3074_100_1331.JPG | 2025-05-19 11:03 | 386K | |
![[ ]](/icons/layout.gif) | 2128_Image051217022221.pdf | 2025-05-19 11:05 | 387K | |
![[IMG]](/icons/image2.gif) | 3657_Students, museum guide, school counselor during commemoration to Mirabal Sisters.png | 2025-05-19 11:03 | 387K | |
![[IMG]](/icons/image2.gif) | 2121_IMG_20180125_104735379.jpg | 2025-05-19 11:03 | 388K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0123.jpg | 2025-05-19 11:04 | 389K | |
![[IMG]](/icons/image2.gif) | 2600_Kivumo Reading Competition 2.png | 2025-05-19 11:07 | 389K | |
![[ ]](/icons/unknown.gif) | 2124_Croquis para puestos de reciclajes basura y el local para guardar la basura.docx | 2025-05-19 11:05 | 389K | |
![[IMG]](/icons/image2.gif) | 3074_100_1362.JPG | 2025-05-19 11:04 | 390K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170708_092433.jpg | 2025-05-19 11:07 | 390K | |
![[IMG]](/icons/image2.gif) | 6671_IMG_1445.jpg | 2025-05-19 11:06 | 391K | |
![[IMG]](/icons/image2.gif) | 2971_IMG_20190114_113539.jpg | 2025-05-19 11:03 | 391K | |
![[IMG]](/icons/image2.gif) | 5659_MPS_1607.jpg | 2025-05-19 11:03 | 391K | |
![[IMG]](/icons/image2.gif) | 7000_NB3.JPG | 2025-05-19 11:03 | 392K | |
![[IMG]](/icons/image2.gif) | 3074_100_1346.JPG | 2025-05-19 11:05 | 392K | |
![[ ]](/icons/layout.gif) | 2514_ACTIVEH_Action-Eco Resume.pdf | 2025-05-19 11:07 | 392K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170717_102044.jpg | 2025-05-19 11:03 | 393K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0118.jpg | 2025-05-19 11:03 | 393K | |
![[IMG]](/icons/image2.gif) | 1397_august 3.jpg | 2025-05-19 11:04 | 394K | |
![[IMG]](/icons/image2.gif) | 2121_IMG_20171215_123644577_HDR.jpg | 2025-05-19 11:05 | 394K | |
![[IMG]](/icons/image2.gif) | 2531_EMILYMIKI - WIN_20190328_204056.JPG | 2025-05-19 11:03 | 394K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1236.JPG | 2025-05-19 11:05 | 394K | |
![[IMG]](/icons/image2.gif) | 3074_100_1361.JPG | 2025-05-19 11:05 | 395K | |
![[IMG]](/icons/image2.gif) | 2856_41934236_852742781782068_6942129870168129536_n - Copy.jpg | 2025-05-19 11:07 | 395K | |
![[IMG]](/icons/image2.gif) | 4369_printer and laptops.jpg | 2025-05-19 11:05 | 396K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_7360_1024.jpg | 2025-05-19 11:04 | 397K | |
![[IMG]](/icons/image2.gif) | 3074_100_1314.JPG | 2025-05-19 11:03 | 397K | |
![[IMG]](/icons/image2.gif) | 3074_100_1334.JPG | 2025-05-19 11:04 | 398K | |
![[ ]](/icons/layout.gif) | 2472_recommendation letter 2.pdf | 2025-05-19 11:05 | 398K | |
![[IMG]](/icons/image2.gif) | 5226_20220802_065334.jpg | 2025-05-19 11:05 | 399K | |
![[IMG]](/icons/image2.gif) | 5809_Facilitator giving training on Neem as Bio-pesticides.jpg | 2025-05-19 11:03 | 400K | |
![[IMG]](/icons/image2.gif) | 2531_EMILYMIKI - WIN_20190328_203833.JPG | 2025-05-19 11:05 | 400K | |
![[IMG]](/icons/image2.gif) | 2971_IMG_20190114_113746.jpg | 2025-05-19 11:06 | 401K | |
![[IMG]](/icons/image2.gif) | 2376_24131914_10155980829712082_349393189487825988_o.jpg | 2025-05-19 11:05 | 401K | |
![[IMG]](/icons/image2.gif) | 3074_100_1332.JPG | 2025-05-19 11:07 | 401K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170721_110731.jpg | 2025-05-19 11:04 | 404K | |
![[IMG]](/icons/image2.gif) | 3074_100_1238.jpg | 2025-05-19 11:05 | 405K | |
![[IMG]](/icons/image2.gif) | 2600_Art Club 1.png | 2025-05-19 11:04 | 405K | |
![[IMG]](/icons/image2.gif) | 1060_02.jpg | 2025-05-19 11:05 | 407K | |
![[IMG]](/icons/image2.gif) | 3627_image 1.1.1.png | 2025-05-19 11:06 | 408K | |
![[IMG]](/icons/image2.gif) | 2531_EMILYMIKI - WIN_20190328_200151.JPG | 2025-05-19 11:05 | 408K | |
![[ ]](/icons/layout.gif) | 2128_Image051217022352.pdf | 2025-05-19 11:07 | 410K | |
![[IMG]](/icons/image2.gif) | 3074_100_1339.JPG | 2025-05-19 11:05 | 410K | |
![[IMG]](/icons/image2.gif) | 5707_IMG-20230907-WA0010.jpg | 2025-05-19 11:06 | 410K | |
![[IMG]](/icons/image2.gif) | 1312_WaterFoundation.jpg | 2025-05-19 11:04 | 411K | |
![[IMG]](/icons/image2.gif) | 1046_IMG_1935.JPG | 2025-05-19 11:04 | 412K | |
![[IMG]](/icons/image2.gif) | 2121_IMG_20171122_104748516_HDR.jpg | 2025-05-19 11:05 | 412K | |
![[IMG]](/icons/image2.gif) | 6713_Chibanja Primary 4.jpg | 2025-05-19 11:07 | 413K | |
![[IMG]](/icons/image2.gif) | 1312_Materials.jpg | 2025-05-19 11:03 | 414K | |
![[IMG]](/icons/image2.gif) | 2971_IMG_20190711_094636.jpg | 2025-05-19 11:06 | 418K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170708_093748.jpg | 2025-05-19 11:04 | 418K | |
![[IMG]](/icons/image2.gif) | 3074_100_1303.JPG | 2025-05-19 11:05 | 421K | |
![[IMG]](/icons/image2.gif) | 1401_IMG_4565.jpg | 2025-05-19 11:05 | 424K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170708_093102.jpg | 2025-05-19 11:07 | 424K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170708_093102_131525785325606806.jpg | 2025-05-19 11:03 | 424K | |
![[IMG]](/icons/image2.gif) | 4369_screen printing and ink.jpg | 2025-05-19 11:05 | 425K | |
![[IMG]](/icons/image2.gif) | 1046_IMG_1949.JPG | 2025-05-19 11:04 | 426K | |
![[IMG]](/icons/image2.gif) | 997_IMG_0498.JPG | 2025-05-19 11:07 | 429K | |
![[IMG]](/icons/image2.gif) | 2342_IMG_0936.JPG | 2025-05-19 11:05 | 429K | |
![[IMG]](/icons/image2.gif) | 4369_mesh screen and video flex.jpg | 2025-05-19 11:05 | 430K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170708_093752.jpg | 2025-05-19 11:05 | 430K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170708_093752_131525786433832753.jpg | 2025-05-19 11:05 | 430K | |
![[IMG]](/icons/image2.gif) | 2794_Training Session - Chairman Adressing audience.JPG | 2025-05-19 11:03 | 431K | |
![[IMG]](/icons/image2.gif) | 1046_IMG_1937.JPG | 2025-05-19 11:04 | 431K | |
![[IMG]](/icons/image2.gif) | 2794_1 product3 (2).jpg | 2025-05-19 11:04 | 431K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170708_092430.jpg | 2025-05-19 11:05 | 434K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170708_092430_131525785105022419.jpg | 2025-05-19 11:05 | 434K | |
![[IMG]](/icons/image2.gif) | 2794_Training Session- beneficiaries.JPG | 2025-05-19 11:05 | 436K | |
![[IMG]](/icons/image2.gif) | 3657_Beneficiaries in bus during trip to Museum, rewarding completion of program.png | 2025-05-19 11:03 | 436K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170708_093754.jpg | 2025-05-19 11:03 | 437K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_7351_1024.jpg | 2025-05-19 11:03 | 437K | |
![[IMG]](/icons/image2.gif) | 2794_1 Products.jpg | 2025-05-19 11:03 | 437K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1175.JPG | 2025-05-19 11:05 | 438K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170707_115626.jpg | 2025-05-19 11:04 | 439K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170707_115626_131525783638931844.jpg | 2025-05-19 11:04 | 439K | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3909.jpg | 2025-05-19 11:03 | 439K | |
![[IMG]](/icons/image2.gif) | 3074_100_1359.JPG | 2025-05-19 11:06 | 440K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0109.jpg | 2025-05-19 11:04 | 440K | |
![[IMG]](/icons/image2.gif) | 3074_100_1366.JPG | 2025-05-19 11:03 | 441K | |
![[ ]](/icons/layout.gif) | 1333_Tests-Elva.pdf | 2025-05-19 11:05 | 441K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_8969_1024.jpg | 2025-05-19 11:06 | 443K | |
![[ ]](/icons/layout.gif) | 2514_Action-Eco_Programme Oct 2018.pdf | 2025-05-19 11:03 | 444K | |
![[IMG]](/icons/image2.gif) | 4369_heater heavy machine.jpg | 2025-05-19 11:03 | 444K | |
![[ ]](/icons/layout.gif) | 6618_z1.pdf | 2025-05-19 11:04 | 444K | |
![[IMG]](/icons/image2.gif) | 2600_Kivumo Reading Competition.png | 2025-05-19 11:04 | 445K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_8957_1024.jpg | 2025-05-19 11:03 | 445K | |
![[IMG]](/icons/image2.gif) | 2121_IMG_20180125_104909752.jpg | 2025-05-19 11:04 | 445K | |
![[ ]](/icons/layout.gif) | 5436_STORAGEX FARMERS FINANCING.pdf | 2025-05-19 11:05 | 445K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_8973_1024.jpg | 2025-05-19 11:07 | 445K | |
![[IMG]](/icons/image2.gif) | 997_IMG_0495.JPG | 2025-05-19 11:03 | 446K | |
![[ ]](/icons/layout.gif) | 7102_Cuchillos 101 - Lesson 1 TG CEP.pdf | 2025-05-19 11:03 | 447K | |
![[ ]](/icons/layout.gif) | 6618_Receipts.pdf | 2025-05-19 11:06 | 449K | |
![[IMG]](/icons/image2.gif) | 2507_SGPAP Director Ten top Entrepreneurs.png | 2025-05-19 11:03 | 450K | |
![[IMG]](/icons/image2.gif) | 2530_cistern.jpg | 2025-05-19 11:03 | 451K | |
![[IMG]](/icons/image2.gif) | 2794_Training Session (15).JPG | 2025-05-19 11:04 | 452K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_8967_1024.jpg | 2025-05-19 11:07 | 453K | |
![[ ]](/icons/layout.gif) | 2514_Gestion des clubs_RonelLefranc.pdf | 2025-05-19 11:03 | 459K | |
![[IMG]](/icons/image2.gif) | 1303_IMG_0440.PNG | 2025-05-19 11:06 | 460K | |
![[ ]](/icons/unknown.gif) | 859_Estatutos del Grupo de Turismo.docx | 2025-05-19 11:07 | 461K | |
![[IMG]](/icons/image2.gif) | 2397_Next Gen Female CEO 21.jpg | 2025-05-19 11:05 | 461K | |
![[IMG]](/icons/image2.gif) | 1046_IMG_1947.JPG | 2025-05-19 11:06 | 462K | |
![[IMG]](/icons/image2.gif) | 5226_20220802_065205.jpg | 2025-05-19 11:07 | 462K | |
![[IMG]](/icons/image2.gif) | 2794_Training Session (11).JPG | 2025-05-19 11:04 | 462K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1171.JPG | 2025-05-19 11:04 | 462K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170717_121338.jpg | 2025-05-19 11:05 | 463K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0120.jpg | 2025-05-19 11:04 | 464K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170708_093110.jpg | 2025-05-19 11:04 | 464K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170708_093107.jpg | 2025-05-19 11:04 | 466K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170708_093107_131525785546191194.jpg | 2025-05-19 11:03 | 466K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1168.JPG | 2025-05-19 11:05 | 467K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170717_101903.jpg | 2025-05-19 11:06 | 467K | |
![[IMG]](/icons/image2.gif) | 1397_august 5.jpg | 2025-05-19 11:03 | 468K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170707_115622.jpg | 2025-05-19 11:04 | 468K | |
![[IMG]](/icons/image2.gif) | 2181_thumb_IMG_7349_1024.jpg | 2025-05-19 11:03 | 468K | |
![[IMG]](/icons/image2.gif) | 2794_Training Session- grinding tomatoes into pulp for quality standard.JPG | 2025-05-19 11:05 | 469K | |
![[ ]](/icons/compressed.gif) | Final Report_19-102 (Banda, Zahira) - Files.zip | 2025-05-19 11:05 | 469K | |
![[IMG]](/icons/image2.gif) | 2121_IMG_20180125_102255245.jpg | 2025-05-19 11:03 | 470K | |
![[IMG]](/icons/image2.gif) | 2530_water project work.jpg | 2025-05-19 11:04 | 470K | |
![[IMG]](/icons/image2.gif) | 1013_IMG_3452.JPG | 2025-05-19 11:03 | 473K | |
![[ ]](/icons/layout.gif) | 6104_Malidade community water pipe.pdf | 2025-05-19 11:05 | 473K | |
![[IMG]](/icons/image2.gif) | 1668_IMG_2817.jpg | 2025-05-19 11:03 | 474K | |
![[IMG]](/icons/image2.gif) | 3657_Machismo and limiting beliefs in Dominican politics.jpg | 2025-05-19 11:05 | 475K | |
![[IMG]](/icons/image2.gif) | 1397_august 6.jpg | 2025-05-19 11:03 | 476K | |
![[IMG]](/icons/image2.gif) | 2531_EMILYMIKI - WIN_20190328_225132.JPG | 2025-05-19 11:04 | 477K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170707_101409.jpg | 2025-05-19 11:05 | 479K | |
![[ ]](/icons/layout.gif) | 2472_Recommendation letter 1.pdf | 2025-05-19 11:05 | 479K | |
![[IMG]](/icons/image2.gif) | 1060_10.jpg | 2025-05-19 11:03 | 480K | |
![[IMG]](/icons/image2.gif) | 2600_Jarama Reading Competition.png | 2025-05-19 11:05 | 480K | |
![[IMG]](/icons/image2.gif) | 2531_EMILYMIKI - WIN_20190328_203307.JPG | 2025-05-19 11:03 | 480K | |
![[IMG]](/icons/image2.gif) | 3074_100_1358.JPG | 2025-05-19 11:03 | 480K | |
![[IMG]](/icons/image2.gif) | 3657_Lining up...time to go back home.png | 2025-05-19 11:06 | 482K | |
![[IMG]](/icons/image2.gif) | 1046_IMG_1928.JPG | 2025-05-19 11:03 | 484K | |
![[IMG]](/icons/image2.gif) | 1046_IMG_1929.JPG | 2025-05-19 11:05 | 486K | |
![[IMG]](/icons/image2.gif) | 6267_IMG-20240212-WA0035.jpg | 2025-05-19 11:05 | 490K | |
![[IMG]](/icons/image2.gif) | 2600_Sewing Classes.png | 2025-05-19 11:03 | 491K | |
![[IMG]](/icons/image2.gif) | 5536_1738388521391.jpg | 2025-05-19 11:07 | 491K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1166.JPG | 2025-05-19 11:03 | 492K | |
![[IMG]](/icons/image2.gif) | 2121_IMG_20171215_122956284.jpg | 2025-05-19 11:05 | 492K | |
![[IMG]](/icons/image2.gif) | 997_IMG_0501.JPG | 2025-05-19 11:03 | 493K | |
![[IMG]](/icons/image2.gif) | 1060_06.jpg | 2025-05-19 11:04 | 494K | |
![[IMG]](/icons/image2.gif) | 6939_WhatsApp Image 2024-12-30 at 18.35.11_049fad62.jpg | 2025-05-19 11:05 | 494K | |
![[IMG]](/icons/image2.gif) | 1242_IMG_20161104_132028.jpg | 2025-05-19 11:06 | 494K | |
![[IMG]](/icons/image2.gif) | 4369_vinyl cutter.jpg | 2025-05-19 11:03 | 494K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1181.JPG | 2025-05-19 11:04 | 495K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170721_114859.jpg | 2025-05-19 11:04 | 496K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170721_114859_131525788105063688.jpg | 2025-05-19 11:05 | 496K | |
![[ ]](/icons/compressed.gif) | Link to Educate Environmental Social Entrepreneurship-final_report-files.zip | 2025-05-19 11:05 | 497K | |
![[IMG]](/icons/image2.gif) | 1046_IMG_1930.JPG | 2025-05-19 11:06 | 498K | |
![[IMG]](/icons/image2.gif) | 2971_IMG_20190403_104359.jpg | 2025-05-19 11:05 | 500K | |
![[IMG]](/icons/image2.gif) | 2121_IMG_20171122_095625663_HDR.jpg | 2025-05-19 11:05 | 500K | |
![[ ]](/icons/compressed.gif) | Final Report_20-030 (Chikopa , Luckier ) - Files.zip | 2025-05-19 11:05 | 502K | |
![[IMG]](/icons/image2.gif) | 2600_Library Committee at School.png | 2025-05-19 11:05 | 503K | |
![[IMG]](/icons/image2.gif) | 2600_Cooking Lesson.png | 2025-05-19 11:04 | 504K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170721_114900.jpg | 2025-05-19 11:04 | 504K | |
![[IMG]](/icons/image2.gif) | 7000_MG3.JPG | 2025-05-19 11:04 | 507K | |
![[IMG]](/icons/image2.gif) | 1060_04.jpg | 2025-05-19 11:04 | 508K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170707_105336.jpg | 2025-05-19 11:06 | 508K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170721_110734.jpg | 2025-05-19 11:04 | 509K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170707_105333.jpg | 2025-05-19 11:04 | 511K | |
![[IMG]](/icons/image2.gif) | 2600_Rural Woman Day at Library.png | 2025-05-19 11:07 | 511K | |
![[ ]](/icons/layout.gif) | 4236_Desiny Produce Business Plan.pdf | 2025-05-19 11:03 | 512K | |
![[IMG]](/icons/image2.gif) | 2600_Library Meeting 2.png | 2025-05-19 11:05 | 514K | |
![[IMG]](/icons/image2.gif) | 2124_Croquis para puestos.jpg | 2025-05-19 11:05 | 516K | |
![[IMG]](/icons/image2.gif) | 991_15293216_1813523565583859_1837809038_o.jpg | 2025-05-19 11:05 | 517K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0108.jpg | 2025-05-19 11:06 | 518K | |
![[IMG]](/icons/image2.gif) | 859_studying by flashlight.jpg | 2025-05-19 11:04 | 518K | |
![[ ]](/icons/layout.gif) | 2324_Community Cash Contribution.pdf | 2025-05-19 11:05 | 518K | |
![[ ]](/icons/compressed.gif) | Youth Inspirations Academy in Congo -final_report-files.zip | 2025-05-19 11:06 | 518K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170721_110001.jpg | 2025-05-19 11:03 | 518K | |
![[IMG]](/icons/image2.gif) | 3657_Part of our group at the Sisters Tomb.png | 2025-05-19 11:04 | 519K | |
![[IMG]](/icons/image2.gif) | 923_image.jpg | 2025-05-19 11:03 | 519K | |
![[IMG]](/icons/image2.gif) | 1046_IMG_1946.JPG | 2025-05-19 11:03 | 520K | |
![[IMG]](/icons/image2.gif) | 3772_Some of Pwemphwe Beneficiaries.jpg | 2025-05-19 11:03 | 521K | |
![[IMG]](/icons/image2.gif) | 5809_IMGM1303.jpg | 2025-05-19 11:03 | 521K | |
![[ ]](/icons/compressed.gif) | Final Report_22-080 (Togborlo , Victor ) - Files.zip | 2025-05-19 11:05 | 522K | |
![[IMG]](/icons/image2.gif) | 2794_1 women leaders of 1st set of Beneficiaries to commercialize their product - with Chairman on the right and established field partner seconf right.jpg | 2025-05-19 11:06 | 522K | |
![[IMG]](/icons/image2.gif) | 2531_EMILYMIKI - WIN_20190328_225143.JPG | 2025-05-19 11:04 | 523K | |
![[IMG]](/icons/image2.gif) | 1060_05.jpg | 2025-05-19 11:05 | 523K | |
![[IMG]](/icons/image2.gif) | 6939_WhatsApp Image 2024-12-30 at 18.35.02_686d6789.jpg | 2025-05-19 11:05 | 525K | |
![[IMG]](/icons/image2.gif) | 7370_5e71609b-408a-400d-83e6-1cd4a42c2498.jpg | 2025-07-24 16:47 | 525K | |
![[IMG]](/icons/image2.gif) | 5660_IMG-20220727-WA0012.jpg | 2025-05-19 11:03 | 526K | |
![[IMG]](/icons/image2.gif) | 2121_IMG_20171215_111242843.jpg | 2025-05-19 11:04 | 526K | |
![[ ]](/icons/layout.gif) | 2324_Third Party In-Kind Contribution.pdf | 2025-05-19 11:04 | 527K | |
![[IMG]](/icons/image2.gif) | 2854_Pic...2 .png | 2025-05-19 11:05 | 528K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170717_101849.jpg | 2025-05-19 11:05 | 529K | |
![[IMG]](/icons/image2.gif) | 2600_Art Club.png | 2025-05-19 11:06 | 529K | |
![[IMG]](/icons/image2.gif) | 2559_Teacher Jean D'Amour and Teacher Elisee Painting 2.png | 2025-05-19 11:05 | 529K | |
![[IMG]](/icons/image2.gif) | 1668_Project Presentation 1.jpg | 2025-05-19 11:06 | 530K | |
![[IMG]](/icons/image2.gif) | 3657_Mini lecture with RPCV after touring museum, pointing out the gender part left out.png | 2025-05-19 11:04 | 533K | |
![[IMG]](/icons/image2.gif) | 1046_IMG_1948.JPG | 2025-05-19 11:03 | 533K | |
![[IMG]](/icons/image2.gif) | 4258_IMG_20200122_130839.jpg | 2025-05-19 11:03 | 534K | |
![[IMG]](/icons/image2.gif) | 1397_august.jpg | 2025-05-19 11:05 | 534K | |
![[IMG]](/icons/image2.gif) | 1060_22.jpg | 2025-05-19 11:03 | 537K | |
![[IMG]](/icons/image2.gif) | 3607_20191031_114901 (2).jpg | 2025-05-19 11:05 | 539K | |
![[IMG]](/icons/image2.gif) | 1046_IMG_1939.JPG | 2025-05-19 11:07 | 540K | |
![[IMG]](/icons/image2.gif) | 2507_Women at SG 1.png | 2025-05-19 11:03 | 542K | |
![[IMG]](/icons/image2.gif) | 5809_Women practicing their own plantain multiplication.jpg | 2025-05-19 11:03 | 542K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170721_110737.jpg | 2025-05-19 11:06 | 543K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170721_110737_131525787616314830 (1).jpg | 2025-05-19 11:06 | 543K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170721_110737_131525787616314830.jpg | 2025-05-19 11:05 | 543K | |
![[ ]](/icons/layout.gif) | 6665_SSH Award Provisions for Rural Resilience Foundation.pdf | 2025-05-19 11:05 | 544K | |
![[IMG]](/icons/image2.gif) | 1060_11.jpg | 2025-05-19 11:05 | 544K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170707_113626.jpg | 2025-05-19 11:03 | 545K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170717_121328.jpg | 2025-05-19 11:03 | 545K | |
![[IMG]](/icons/image2.gif) | 1242_IMG_20161104_132034.jpg | 2025-05-19 11:05 | 546K | |
![[IMG]](/icons/image2.gif) | 2600_Library Meeting.png | 2025-05-19 11:03 | 548K | |
![[IMG]](/icons/image2.gif) | 2121_IMG_20180125_101328346.jpg | 2025-05-19 11:03 | 549K | |
![[IMG]](/icons/image2.gif) | 6939_WhatsApp Image 2024-12-30 at 18.35.18_6d8af782.jpg | 2025-05-19 11:06 | 550K | |
![[IMG]](/icons/image2.gif) | 1060_03.jpg | 2025-05-19 11:05 | 550K | |
![[IMG]](/icons/image2.gif) | 2121_IMG_20171215_122859087.jpg | 2025-05-19 11:04 | 550K | |
![[IMG]](/icons/image2.gif) | 1060_01.jpg | 2025-05-19 11:05 | 552K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0110.jpg | 2025-05-19 11:05 | 554K | |
![[ ]](/icons/compressed.gif) | Final Report_20-041 (Kanyoza, Francis) - Files.zip | 2025-05-19 11:05 | 554K | |
![[IMG]](/icons/image2.gif) | 5792_IMG-20221204-WA0025.jpg | 2025-05-19 11:04 | 555K | |
![[IMG]](/icons/image2.gif) | 2475_IMG_3520.JPG | 2025-05-19 11:03 | 555K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170922_145433_613.jpg | 2025-05-19 11:05 | 556K | |
![[IMG]](/icons/image2.gif) | 2507_Women at SG 2.png | 2025-05-19 11:04 | 556K | |
![[ ]](/icons/compressed.gif) | Final Report_20-080 (Kondowe, Ulala) - Budget Files.zip | 2025-05-19 11:04 | 556K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1199.JPG | 2025-05-19 11:06 | 557K | |
![[ ]](/icons/layout.gif) | 6618_z.pdf | 2025-05-19 11:03 | 558K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170707_113629.jpg | 2025-05-19 11:05 | 559K | |
![[IMG]](/icons/image2.gif) | 1303_IMG_0439.PNG | 2025-05-19 11:05 | 560K | |
![[IMG]](/icons/image2.gif) | 2600_African Child Day.png | 2025-05-19 11:04 | 561K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170717_121331.jpg | 2025-05-19 11:03 | 562K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170707_120026.jpg | 2025-05-19 11:06 | 564K | |
![[IMG]](/icons/image2.gif) | 3772_Estere Manyozo.jpg | 2025-05-19 11:06 | 565K | |
![[IMG]](/icons/image2.gif) | 2794_Training Session- beneficiaries(3).JPG | 2025-05-19 11:06 | 565K | |
![[IMG]](/icons/image2.gif) | 2794_1 product3 (1).jpg | 2025-05-19 11:05 | 567K | |
![[IMG]](/icons/image2.gif) | 2507_SG testimonies.png | 2025-05-19 11:05 | 568K | |
![[IMG]](/icons/image2.gif) | 1046_IMG_1938.JPG | 2025-05-19 11:05 | 569K | |
![[IMG]](/icons/image2.gif) | 2096_Classroom observation March follow up training.jpg | 2025-05-19 11:05 | 570K | |
![[IMG]](/icons/image2.gif) | 5447_2k.jpg | 2025-05-19 11:03 | 571K | |
![[IMG]](/icons/image2.gif) | 1415_IMG_9088.jpg | 2025-05-19 11:03 | 571K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170707_115610.jpg | 2025-05-19 11:04 | 571K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170707_115610_131525783857956228.jpg | 2025-05-19 11:05 | 571K | |
![[ ]](/icons/layout.gif) | 2324_Previous Community Contribution (2016).pdf | 2025-05-19 11:04 | 571K | |
![[IMG]](/icons/image2.gif) | 2213_IMG_20170707_115609.jpg | 2025-05-19 11:03 | 572K | |
![[IMG]](/icons/image2.gif) | 767_P1100146.JPG | 2025-05-19 11:05 | 573K | |
![[IMG]](/icons/image2.gif) | 7370_IMG_4845.JPG | 2025-07-24 16:48 | 574K | |
![[IMG]](/icons/image2.gif) | 2121_IMG_20171122_105822796.jpg | 2025-05-19 11:05 | 575K | |
![[IMG]](/icons/image2.gif) | 7370_103204935_3142740792471806_528903728930976757_n (1).jpg | 2025-07-24 16:47 | 575K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0113.jpg | 2025-05-19 11:06 | 577K | |
![[ ]](/icons/compressed.gif) | Final Report_19-142 (EzenwaOkoro nee Omovbude, Rita ) - Budget Files.zip | 2025-05-19 11:04 | 580K | |
![[IMG]](/icons/image2.gif) | 1046_IMG_1933.JPG | 2025-05-19 11:04 | 581K | |
![[IMG]](/icons/image2.gif) | 2559_Teacher Jean D'Amour and Teacher Elisee Painting.png | 2025-05-19 11:05 | 584K | |
![[IMG]](/icons/image2.gif) | 2507_Women at SG.png | 2025-05-19 11:05 | 586K | |
![[ ]](/icons/layout.gif) | 1333_Tests-Yaritzel.pdf | 2025-05-19 11:05 | 586K | |
![[IMG]](/icons/image2.gif) | 1046_IMG_1945.JPG | 2025-05-19 11:06 | 589K | |
![[ ]](/icons/layout.gif) | 1094_DSWD latrine making proposal pp2.pdf | 2025-05-19 11:04 | 591K | |
![[IMG]](/icons/image2.gif) | 1046_IMG_1943.JPG | 2025-05-19 11:04 | 594K | |
![[IMG]](/icons/image2.gif) | 5792_IMG-20221204-WA0011.jpg | 2025-05-19 11:05 | 594K | |
![[IMG]](/icons/image2.gif) | 2352_IMG_20160102_010228.jpg | 2025-05-19 11:07 | 595K | |
![[IMG]](/icons/image2.gif) | 2589_guardhouse blessing 5.JPG | 2025-05-19 11:04 | 598K | |
![[IMG]](/icons/image2.gif) | 1046_IMG_1944.JPG | 2025-05-19 11:03 | 599K | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting community center activity.jpg | 2025-05-19 11:05 | 600K | |
![[IMG]](/icons/image2.gif) | 2352_IMG_20160102_010240.jpg | 2025-05-19 11:04 | 600K | |
![[IMG]](/icons/image2.gif) | 3074_100_1304.JPG | 2025-05-19 11:04 | 600K | |
![[ ]](/icons/compressed.gif) | Donkey Ripples-final_report-files.zip | 2025-05-19 11:03 | 603K | |
![[ ]](/icons/compressed.gif) | Final Report_17-096 (Haroun, AlFateh) - Files.zip | 2025-05-19 11:03 | 603K | |
![[IMG]](/icons/image2.gif) | 2971_IMG_20190114_114047.jpg | 2025-05-19 11:07 | 604K | |
![[IMG]](/icons/image2.gif) | 767_P1100083.JPG | 2025-05-19 11:04 | 607K | |
![[IMG]](/icons/image2.gif) | 5792_IMG-20221204-WA0010.jpg | 2025-05-19 11:06 | 607K | |
![[ ]](/icons/layout.gif) | 1030_IMG_0003.pdf | 2025-05-19 11:05 | 607K | |
![[IMG]](/icons/image2.gif) | 1046_IMG_1941.JPG | 2025-05-19 11:07 | 608K | |
![[IMG]](/icons/image2.gif) | 1312_SepticHole.jpg | 2025-05-19 11:04 | 609K | |
![[IMG]](/icons/image2.gif) | 3657_4% municipal budget (education, health gender) assigned to PROGRAMS executed by organized community groups. Law 176-07. Mayors are in control and do not want to let it go.jpg | 2025-05-19 11:03 | 609K | |
![[IMG]](/icons/image2.gif) | 4258_IMG_20200130_120710.jpg | 2025-05-19 11:07 | 610K | |
![[IMG]](/icons/image2.gif) | 767_P1100084.JPG | 2025-05-19 11:03 | 612K | |
![[IMG]](/icons/image2.gif) | 714_IMG_20161006_112343.jpg | 2025-05-19 11:07 | 612K | |
![[IMG]](/icons/image2.gif) | 1398_IMG_1196.JPG | 2025-05-19 11:04 | 616K | |
![[IMG]](/icons/image2.gif) | 767_P1100092.JPG | 2025-05-19 11:04 | 618K | |
![[IMG]](/icons/image2.gif) | 767_P1160464.JPG | 2025-05-19 11:04 | 621K | |
![[IMG]](/icons/image2.gif) | 767_P1160483.JPG | 2025-05-19 11:04 | 622K | |
![[IMG]](/icons/image2.gif) | 767_P1100119.JPG | 2025-05-19 11:05 | 624K | |
![[IMG]](/icons/image2.gif) | 859_kerosene lamp with bleysi.jpg | 2025-05-19 11:07 | 627K | |
![[IMG]](/icons/image2.gif) | 2376_23847383_10155980829217082_3702153963639148667_o.jpg | 2025-05-19 11:03 | 627K | |
![[IMG]](/icons/image2.gif) | 2121_IMG_20171122_104642677.jpg | 2025-05-19 11:05 | 628K | |
![[IMG]](/icons/image2.gif) | 2531_IMG_20181031_094230.jpg | 2025-05-19 11:07 | 628K | |
![[ ]](/icons/layout.gif) | 2366_World Connect Grant project curriculum.pdf | 2025-05-19 11:04 | 631K | |
![[IMG]](/icons/image2.gif) | 1046_IMG_1950.JPG | 2025-05-19 11:04 | 631K | |
![[IMG]](/icons/image2.gif) | 1046_IMG_1931.JPG | 2025-05-19 11:05 | 633K | |
![[ ]](/icons/compressed.gif) | Action for Women Bakery-final_report-files.zip | 2025-05-19 11:03 | 633K | |
![[IMG]](/icons/image2.gif) | 767_P1100105.JPG | 2025-05-19 11:04 | 634K | |
![[IMG]](/icons/image2.gif) | 767_P1100111.JPG | 2025-05-19 11:04 | 634K | |
![[IMG]](/icons/image2.gif) | 767_P1160485.JPG | 2025-05-19 11:06 | 636K | |
![[IMG]](/icons/image2.gif) | 5640_PAG_7078.jpg | 2025-05-19 11:05 | 636K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0116.jpg | 2025-05-19 11:05 | 637K | |
![[ ]](/icons/compressed.gif) | Final Report_19-126 (Idehai, Rita) - Budget Files.zip | 2025-05-19 11:05 | 638K | |
![[IMG]](/icons/image2.gif) | 767_P1100010.JPG | 2025-05-19 11:05 | 639K | |
![[IMG]](/icons/image2.gif) | 767_P1160472.JPG | 2025-05-19 11:03 | 639K | |
![[IMG]](/icons/image2.gif) | 767_P1100046.JPG | 2025-05-19 11:03 | 639K | |
![[IMG]](/icons/image2.gif) | 767_P1100234.JPG | 2025-05-19 11:03 | 639K | |
![[IMG]](/icons/image2.gif) | 745_leveling with House Mother.jpg | 2025-05-19 11:04 | 639K | |
![[IMG]](/icons/image2.gif) | 767_P1100028.JPG | 2025-05-19 11:03 | 640K | |
![[ ]](/icons/layout.gif) | 2183_AWB Final Report.docx.pdf | 2025-05-19 11:05 | 640K | |
![[IMG]](/icons/image2.gif) | 2559_Teacher Fortune and Teacher Sylvie with desktop and printer.png | 2025-05-19 11:03 | 641K | |
![[IMG]](/icons/image2.gif) | 2600_Bukiro Reading Competition.png | 2025-05-19 11:05 | 642K | |
![[IMG]](/icons/image2.gif) | 767_P1100145.JPG | 2025-05-19 11:03 | 642K | |
![[IMG]](/icons/image2.gif) | 2121_IMG_20171215_121936024.jpg | 2025-05-19 11:03 | 643K | |
![[IMG]](/icons/image2.gif) | 767_P1160475.JPG | 2025-05-19 11:04 | 644K | |
![[IMG]](/icons/image2.gif) | 1250_Mayerlin.jpg | 2025-05-19 11:05 | 645K | |
![[ ]](/icons/compressed.gif) | Final Report_19-080 (Kondowe, Ulala) - Files.zip | 2025-05-19 11:05 | 647K | |
![[ ]](/icons/layout.gif) | 1030_IMG_0002.pdf | 2025-05-19 11:03 | 649K | |
![[IMG]](/icons/image2.gif) | 767_P1100020.JPG | 2025-05-19 11:03 | 649K | |
![[IMG]](/icons/image2.gif) | 2131_Trash Pick Up Day.png | 2025-05-19 11:05 | 649K | |
![[IMG]](/icons/image2.gif) | 767_P1100120.JPG | 2025-05-19 11:07 | 650K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0115.jpg | 2025-05-19 11:05 | 652K | |
![[IMG]](/icons/image2.gif) | 767_P1100112.JPG | 2025-05-19 11:04 | 654K | |
![[ ]](/icons/compressed.gif) | Final Report_20-149 (Agunloye, Jennifer ) - Budget Files.zip | 2025-05-19 11:06 | 654K | |
![[IMG]](/icons/image2.gif) | 767_P1100068.JPG | 2025-05-19 11:05 | 656K | |
![[IMG]](/icons/image2.gif) | 2531_EMILYMIKI - WIN_20190328_202901.JPG | 2025-05-19 11:05 | 658K | |
![[IMG]](/icons/image2.gif) | 2792_IMG_20191214_145456_9~2.jpg | 2025-05-19 11:05 | 661K | |
![[IMG]](/icons/image2.gif) | 2475_IMG_3513.JPG | 2025-05-19 11:03 | 665K | |
![[IMG]](/icons/image2.gif) | 6939_WhatsApp Image 2024-12-30 at 18.36.17_9b4e5fa6.jpg | 2025-05-19 11:05 | 666K | |
![[ ]](/icons/layout.gif) | 1030_IMG.pdf | 2025-05-19 11:04 | 667K | |
![[IMG]](/icons/image2.gif) | 3245_Image (2).jpg | 2025-05-19 11:06 | 675K | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2324.jpg | 2025-05-19 11:05 | 677K | |
![[IMG]](/icons/image2.gif) | 5640_DSC_1660.jpg | 2025-05-19 11:04 | 679K | |
![[IMG]](/icons/image2.gif) | 5447_1k.jpg | 2025-05-19 11:03 | 679K | |
![[IMG]](/icons/image2.gif) | 4787_9.png | 2025-05-19 11:04 | 681K | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2325.jpg | 2025-05-19 11:04 | 683K | |
![[IMG]](/icons/image2.gif) | 767_P1100034.JPG | 2025-05-19 11:03 | 684K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0112.jpg | 2025-05-19 11:03 | 684K | |
![[ ]](/icons/layout.gif) | 4236_PROJECT IN PICTURES.pdf | 2025-05-19 11:07 | 685K | |
![[ ]](/icons/layout.gif) | 1030_IMG_0005.pdf | 2025-05-19 11:03 | 688K | |
![[IMG]](/icons/image2.gif) | 6710_IMG-20240721-WA0117.jpg | 2025-05-19 11:06 | 692K | |
![[IMG]](/icons/image2.gif) | 5810_CHPS Compound in use.jpg | 2025-05-19 11:04 | 696K | |
![[ ]](/icons/layout.gif) | 1030_IMG_0004.pdf | 2025-05-19 11:07 | 696K | |
![[IMG]](/icons/image2.gif) | 1308_IMG_1362.JPG | 2025-05-19 11:04 | 699K | |
![[IMG]](/icons/image2.gif) | 3627_Image27.png | 2025-05-19 11:05 | 700K | |
![[IMG]](/icons/image2.gif) | 714_IMG_20161006_112542.jpg | 2025-05-19 11:03 | 700K | |
![[IMG]](/icons/image2.gif) | 3335_Desplaying a Pad during training.png | 2025-05-19 11:05 | 700K | |
![[IMG]](/icons/image2.gif) | 3335_untitled.p.png | 2025-05-19 11:06 | 700K | |
![[IMG]](/icons/image2.gif) | 1262_Remera3.png | 2025-05-19 11:05 | 703K | |
![[IMG]](/icons/image2.gif) | 2376_24254959_10155992165607082_4373241441418056799_o.jpg | 2025-05-19 11:05 | 703K | |
![[IMG]](/icons/image2.gif) | 6797_IMG_20240828_005724.jpg | 2025-05-19 11:03 | 709K | |
![[IMG]](/icons/image2.gif) | 1692_IMG_3928.jpg | 2025-05-19 11:05 | 712K | |
![[IMG]](/icons/image2.gif) | 3971_75486042_3357016900991572_4170395862683353088_o.jpg | 2025-05-19 11:04 | 713K | |
![[ ]](/icons/layout.gif) | 2794_Technocerve-AbdulLateef_ MOU.pdf | 2025-05-19 11:05 | 718K | |
![[IMG]](/icons/image2.gif) | 3354_20200229_052637.jpg | 2025-05-19 11:04 | 723K | |
![[IMG]](/icons/image2.gif) | 2794_Training Session (2).JPG | 2025-05-19 11:03 | 723K | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2769.jpg | 2025-05-19 11:05 | 724K | |
![[IMG]](/icons/image2.gif) | 3354_20200229_052648.jpg | 2025-05-19 11:07 | 726K | |
![[IMG]](/icons/image2.gif) | 3596_IMG_20190518_143549.jpg | 2025-05-19 11:03 | 731K | |
![[IMG]](/icons/image2.gif) | 6381_IMG_20230725_194441.jpg | 2025-05-19 11:03 | 732K | |
![[IMG]](/icons/image2.gif) | 6288_ggggggg.jpg | 2025-05-19 11:04 | 732K | |
![[IMG]](/icons/image2.gif) | 3627_Image26.png | 2025-05-19 11:04 | 733K | |
![[IMG]](/icons/image2.gif) | 3607_20191031_115004 (2).jpg | 2025-05-19 11:05 | 735K | |
![[ ]](/icons/layout.gif) | 2324_Transport Receipts.pdf | 2025-05-19 11:03 | 735K | |
![[IMG]](/icons/image2.gif) | 1224_IMG_4032.jpg | 2025-05-19 11:03 | 737K | |
![[IMG]](/icons/image2.gif) | 6113_IMG-20240905-WA0031.jpg | 2025-05-19 11:05 | 742K | |
![[IMG]](/icons/image2.gif) | 2794_Training Session (1).JPG | 2025-05-19 11:03 | 743K | |
![[IMG]](/icons/image2.gif) | 5640_DSC_1610.jpg | 2025-05-19 11:05 | 744K | |
![[IMG]](/icons/image2.gif) | 2792_Bukky from Mount Carmel, Ikare.jpg | 2025-05-19 11:05 | 744K | |
![[ ]](/icons/compressed.gif) | Final Report_18-083 (Scott Monge, Stephanie) - Files.zip | 2025-05-19 11:03 | 746K | |
![[IMG]](/icons/image2.gif) | 2475_IMG_3519.JPG | 2025-05-19 11:03 | 746K | |
![[IMG]](/icons/image2.gif) | 1242_IMG_20161012_131341.jpg | 2025-05-19 11:05 | 749K | |
![[IMG]](/icons/image2.gif) | 7000_MT4.jpg | 2025-05-19 11:05 | 749K | |
![[IMG]](/icons/image2.gif) | 6296_IMG-0566.jpg | 2025-05-19 11:03 | 753K | |
![[IMG]](/icons/image2.gif) | 2255_IMG_1398.JPG | 2025-05-19 11:05 | 754K | |
![[IMG]](/icons/image2.gif) | 5640_DSC_1643.jpg | 2025-05-19 11:05 | 754K | |
![[IMG]](/icons/image2.gif) | 2971_IMG_20190711_094625.jpg | 2025-05-19 11:05 | 755K | |
![[IMG]](/icons/image2.gif) | 6843_A73A9591.jpg | 2025-05-19 11:04 | 759K | |
![[IMG]](/icons/image2.gif) | 3596_danielle.jpg | 2025-05-19 11:03 | 760K | |
![[IMG]](/icons/image2.gif) | 6843_A73A9622.jpg | 2025-05-19 11:05 | 761K | |
![[IMG]](/icons/image2.gif) | 2971_IMG_20190114_114100.jpg | 2025-05-19 11:05 | 761K | |
![[IMG]](/icons/image2.gif) | 6843_A73A9620.jpg | 2025-05-19 11:05 | 762K | |
![[IMG]](/icons/image2.gif) | 2475_IMG_3514.JPG | 2025-05-19 11:05 | 764K | |
![[IMG]](/icons/image2.gif) | 3657_One version of the project for Town Hall. Incorporating the municipal budget with gender focus....jpg | 2025-05-19 11:05 | 765K | |
![[IMG]](/icons/image2.gif) | 2285_IMG_20180227_173613.jpg | 2025-05-19 11:04 | 765K | |
![[IMG]](/icons/image2.gif) | 6939_WhatsApp Image 2024-12-30 at 13.58.18_a6c22a85.jpg | 2025-05-19 11:04 | 766K | |
![[IMG]](/icons/image2.gif) | 912_IMG_20141204_143519.jpg | 2025-05-19 11:05 | 769K | |
![[ ]](/icons/compressed.gif) | Catmon Marine Protected Area Network-final_report-files.zip | 2025-05-19 11:06 | 770K | |
![[ ]](/icons/unknown.gif) | 2124_Evaluación estudiantil escuela.docx | 2025-05-19 11:05 | 770K | |
![[IMG]](/icons/image2.gif) | 3774_incubator and solar power training.jpg | 2025-05-19 11:07 | 773K | |
![[IMG]](/icons/image2.gif) | 3596_IMG_20190227_110943.jpg | 2025-05-19 11:06 | 773K | |
![[ ]](/icons/compressed.gif) | Final Report_19-026 (NGWIRA, THOMAS NGWIRA) - Files.zip | 2025-05-19 11:06 | 774K | |
![[IMG]](/icons/image2.gif) | 3774_solar incubator training.jpg | 2025-05-19 11:04 | 783K | |
![[IMG]](/icons/image2.gif) | 2559_Teacher Sylvie Working on the Desktop.png | 2025-05-19 11:05 | 783K | |
![[IMG]](/icons/image2.gif) | 1419_PaschalChengeng_WithGoodShephardAbangoh.jpg | 2025-05-19 11:04 | 787K | |
![[IMG]](/icons/image2.gif) | 1419_PaschalChengeng_WithChildrenFromtheStreets.jpg | 2025-05-19 11:03 | 787K | |
![[ ]](/icons/compressed.gif) | Crochet Club-final_report-files.zip | 2025-05-19 11:04 | 791K | |
![[IMG]](/icons/image2.gif) | 4787_1.png | 2025-05-19 11:05 | 793K | |
![[IMG]](/icons/image2.gif) | 1262_Remera4.png | 2025-05-19 11:05 | 794K | |
![[IMG]](/icons/image2.gif) | 2373_IMG_20160731_122243.jpg | 2025-05-19 11:05 | 795K | |
![[IMG]](/icons/image2.gif) | 6296_IMG-0561.jpg | 2025-05-19 11:03 | 795K | |
![[IMG]](/icons/image2.gif) | 4787_7.png | 2025-05-19 11:04 | 796K | |
![[ ]](/icons/layout.gif) | 3772_Collection of receipts for Safe and Clean water Access.pdf | 2025-05-19 11:05 | 796K | |
![[IMG]](/icons/image2.gif) | 2971_IMG_20190403_104333.jpg | 2025-05-19 11:07 | 799K | |
![[IMG]](/icons/image2.gif) | 1312_MwengeCelebration.jpg | 2025-05-19 11:03 | 799K | |
![[IMG]](/icons/image2.gif) | 4258_IMG_20200430_100932.jpg | 2025-05-19 11:05 | 799K | |
![[IMG]](/icons/image2.gif) | 4524_CVS_3115.jpg | 2025-05-19 11:03 | 799K | |
![[IMG]](/icons/image2.gif) | 4787_3.png | 2025-05-19 11:04 | 801K | |
![[ ]](/icons/layout.gif) | 5603_BUSINESS PLAN FINAL23.pdf | 2025-05-19 11:05 | 805K | |
![[IMG]](/icons/image2.gif) | 1692_IMG_3926.jpg | 2025-05-19 11:05 | 809K | |
![[IMG]](/icons/image2.gif) | 6787_IMG-5.jpg | 2025-05-19 11:06 | 809K | |
![[ ]](/icons/compressed.gif) | GarbageRecycle Bins -final_report-files.zip | 2025-05-19 11:03 | 809K | |
![[IMG]](/icons/image2.gif) | 6172_DSC_0027.jpg | 2025-05-19 11:05 | 812K | |
![[ ]](/icons/layout.gif) | 6948_tailoring material .pdf | 2025-05-19 11:05 | 814K | |
![[IMG]](/icons/image2.gif) | 5810_CHPS Compound Front.jpg | 2025-05-19 11:03 | 815K | |
![[IMG]](/icons/image2.gif) | 1692_IMG_3918.jpg | 2025-05-19 11:05 | 815K | |
![[IMG]](/icons/image2.gif) | 912_IMG_20141204_143246.jpg | 2025-05-19 11:04 | 818K | |
![[IMG]](/icons/image2.gif) | 2971_IMG_20190403_104349.jpg | 2025-05-19 11:06 | 826K | |
![[IMG]](/icons/image2.gif) | 1060_Local Club Workshop.jpg | 2025-05-19 11:05 | 827K | |
![[ ]](/icons/layout.gif) | 6980_Agatabo ko kwigisha ubuhinzi bw' ibihumyo.pdf | 2025-05-19 11:06 | 827K | |
![[ ]](/icons/compressed.gif) | 7106_SVEAP Resources.zip | 2025-05-19 11:03 | 832K | |
![[IMG]](/icons/image2.gif) | 714_IMG_20161006_112406.jpg | 2025-05-19 11:03 | 833K | |
![[IMG]](/icons/image2.gif) | 2514_action-eco-Promotional flyer.jpg | 2025-05-19 11:05 | 833K | |
![[IMG]](/icons/image2.gif) | 5810_CHPS Compound in use 2.jpg | 2025-05-19 11:05 | 834K | |
![[IMG]](/icons/image2.gif) | 2870_IMG_8121.jpg | 2025-05-19 11:03 | 835K | |
![[IMG]](/icons/image2.gif) | 1282_IMG_2692.jpg | 2025-05-19 11:05 | 836K | |
![[IMG]](/icons/image2.gif) | 3627_Image29.png | 2025-05-19 11:05 | 837K | |
![[IMG]](/icons/image2.gif) | 3774_fixing solar panel 2.jpg | 2025-05-19 11:07 | 839K | |
![[IMG]](/icons/image2.gif) | 2971_IMG_20190711_094712.jpg | 2025-05-19 11:05 | 842K | |
![[IMG]](/icons/image2.gif) | 3774_The Poultry and Power house.jpg | 2025-05-19 11:04 | 844K | |
![[IMG]](/icons/image2.gif) | 6843_A73A9627.jpg | 2025-05-19 11:05 | 847K | |
![[IMG]](/icons/image2.gif) | 1692_IMG_3927.jpg | 2025-05-19 11:03 | 847K | |
![[IMG]](/icons/image2.gif) | 6939_WhatsApp Image 2024-12-30 at 18.36.22_9ba04cb3.jpg | 2025-05-19 11:05 | 854K | |
![[IMG]](/icons/image2.gif) | 2097_IMG_0668.JPG | 2025-05-19 11:07 | 857K | |
![[IMG]](/icons/image2.gif) | 6172_DSC_0024.jpg | 2025-05-19 11:06 | 858K | |
![[IMG]](/icons/image2.gif) | 1262_Remera.png | 2025-05-19 11:04 | 861K | |
![[IMG]](/icons/image2.gif) | 3657_Elements of training in project, also sent by whatsapp to key actors and team, as a study guide tool.jpg | 2025-05-19 11:05 | 864K | |
![[IMG]](/icons/image2.gif) | 6172_DSC_0026.jpg | 2025-05-19 11:05 | 866K | |
![[IMG]](/icons/image2.gif) | 2376_24173648_10155992166242082_8293503164304238215_o.jpg | 2025-05-19 11:06 | 866K | |
![[ ]](/icons/layout.gif) | 3774_MIKOLONGWE MANAGEMENT TRAINING MANUAL.pdf | 2025-05-19 11:03 | 867K | |
![[ ]](/icons/compressed.gif) | 2414_resizedtospecifications.zip | 2025-05-19 11:03 | 867K | |
![[IMG]](/icons/image2.gif) | 1268_LAZARO RICHARD, THE HEAD ELECTRICIAN AT MRHC. SEEN HERE AT THE PCV's HOUSE GIVING A TESTIMONY ABOUT THE ELECTRICITY PROJECT..jpg | 2025-05-19 11:03 | 868K | |
![[IMG]](/icons/image2.gif) | 3627_Image25.png | 2025-05-19 11:06 | 868K | |
![[IMG]](/icons/image2.gif) | 5447_6.jpg | 2025-05-19 11:05 | 870K | |
![[IMG]](/icons/image2.gif) | 6843_A73A9576.jpg | 2025-05-19 11:04 | 873K | |
![[IMG]](/icons/image2.gif) | 1242_IMG_20161104_131647.jpg | 2025-05-19 11:04 | 874K | |
![[ ]](/icons/layout.gif) | 6948_crafting materials .pdf | 2025-05-19 11:05 | 875K | |
![[IMG]](/icons/image2.gif) | 2047_IMG_3062.jpg | 2025-05-19 11:06 | 877K | |
![[IMG]](/icons/image2.gif) | 3627_Image24.png | 2025-05-19 11:03 | 878K | |
![[ ]](/icons/layout.gif) | 1094_DSWD latrine making proposal pp3.pdf | 2025-05-19 11:04 | 878K | |
![[IMG]](/icons/image2.gif) | 5447_2.jpg | 2025-05-19 11:04 | 878K | |
![[IMG]](/icons/image2.gif) | 3627_Image14.png | 2025-05-19 11:05 | 880K | |
![[IMG]](/icons/image2.gif) | 2971_IMG_20190114_113916.jpg | 2025-05-19 11:05 | 881K | |
![[IMG]](/icons/image2.gif) | 3263_Event Invite.png | 2025-05-19 11:06 | 881K | |
![[IMG]](/icons/image2.gif) | 3354_20200229_052759.jpg | 2025-05-19 11:05 | 883K | |
![[IMG]](/icons/image2.gif) | 2971_IMG_20190114_113502.jpg | 2025-05-19 11:04 | 883K | |
![[IMG]](/icons/image2.gif) | 5697_IMG_20220925_223612.jpg | 2025-05-19 11:04 | 888K | |
![[IMG]](/icons/image2.gif) | 5447_12.jpg | 2025-05-19 11:05 | 888K | |
![[IMG]](/icons/image2.gif) | 5640_DSC_1705.jpg | 2025-05-19 11:05 | 888K | |
![[IMG]](/icons/image2.gif) | 3627_Image23.png | 2025-05-19 11:03 | 890K | |
![[IMG]](/icons/image2.gif) | 5447_1.jpg | 2025-05-19 11:07 | 891K | |
![[IMG]](/icons/image2.gif) | 1692_IMG_3923.jpg | 2025-05-19 11:03 | 898K | |
![[IMG]](/icons/image2.gif) | 3354_20200229_050640.jpg | 2025-05-19 11:05 | 900K | |
![[IMG]](/icons/image2.gif) | 2691_20180626_161800.jpg | 2025-05-19 11:04 | 902K | |
![[IMG]](/icons/image2.gif) | 5640_DSC_1530.jpg | 2025-05-19 11:05 | 902K | |
![[IMG]](/icons/image2.gif) | 1248_IMG_6216.JPG | 2025-05-19 11:04 | 906K | |
![[IMG]](/icons/image2.gif) | 2121_IMG_20171122_104052949.jpg | 2025-05-19 11:05 | 907K | |
![[IMG]](/icons/image2.gif) | 1692_IMG_3924.jpg | 2025-05-19 11:05 | 911K | |
![[IMG]](/icons/image2.gif) | 4666_Mavuto Luwe-local leader .jpg | 2025-05-19 11:03 | 912K | |
![[IMG]](/icons/image2.gif) | 4666_mpamba incinerator 6.jpg | 2025-05-19 11:05 | 912K | |
![[IMG]](/icons/image2.gif) | 1060_Participants interviewing students at Ouarzazate University.jpg | 2025-05-19 11:04 | 913K | |
![[IMG]](/icons/image2.gif) | 3774_barbershop running on solar.jpg | 2025-05-19 11:05 | 914K | |
![[IMG]](/icons/image2.gif) | 6787_IMG-6.jpg | 2025-05-19 11:06 | 916K | |
![[IMG]](/icons/image2.gif) | 3354_20200229_052611.jpg | 2025-05-19 11:04 | 918K | |
![[IMG]](/icons/image2.gif) | 1060_Participats Covering a Story.jpg | 2025-05-19 11:04 | 920K | |
![[IMG]](/icons/image2.gif) | 6843_A73A9628.jpg | 2025-05-19 11:03 | 922K | |
![[IMG]](/icons/image2.gif) | 3354_20200229_051047.jpg | 2025-05-19 11:05 | 926K | |
![[ ]](/icons/layout.gif) | 7000_Buenas-Prácticas-Apícolas-Agrocalidad.pdf | 2025-05-19 11:05 | 929K | |
![[IMG]](/icons/image2.gif) | 6843_A73A9588.jpg | 2025-05-19 11:05 | 929K | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2539.jpg | 2025-05-19 11:07 | 930K | |
![[IMG]](/icons/image2.gif) | 6296_IMG-0094.JPG | 2025-05-19 11:03 | 930K | |
![[IMG]](/icons/image2.gif) | 5640_DSC_1562.jpg | 2025-05-19 11:04 | 931K | |
![[IMG]](/icons/image2.gif) | 1692_IMG_3917.jpg | 2025-05-19 11:04 | 934K | |
![[IMG]](/icons/image2.gif) | 4787_5.png | 2025-05-19 11:06 | 938K | |
![[IMG]](/icons/image2.gif) | 3627_Image18.png | 2025-05-19 11:05 | 940K | |
![[IMG]](/icons/image2.gif) | 6843_A73A9600.jpg | 2025-05-19 11:03 | 941K | |
![[IMG]](/icons/image2.gif) | 5447_5.jpg | 2025-05-19 11:03 | 943K | |
![[IMG]](/icons/image2.gif) | 3774_DSC_0145.JPG | 2025-05-19 11:03 | 951K | |
![[ ]](/icons/compressed.gif) | 7007_PHOTOS.zip | 2025-05-19 11:05 | 952K | |
![[IMG]](/icons/image2.gif) | 3627_Image28.png | 2025-05-19 11:05 | 954K | |
![[IMG]](/icons/image2.gif) | 1448_IMG_20170426_135958.jpg | 2025-05-19 11:05 | 955K | |
![[IMG]](/icons/image2.gif) | 3627_Image16.png | 2025-05-19 11:05 | 955K | |
![[IMG]](/icons/image2.gif) | 1242_IMG_20161025_145718.jpg | 2025-05-19 11:04 | 956K | |
![[IMG]](/icons/image2.gif) | 3354_20200229_053337.jpg | 2025-05-19 11:04 | 957K | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2359.jpg | 2025-05-19 11:04 | 959K | |
![[IMG]](/icons/image2.gif) | 6939_WhatsApp Image 2024-12-30 at 18.36.21_69c5792f.jpg | 2025-05-19 11:05 | 962K | |
![[IMG]](/icons/image2.gif) | 745_Dressed to Impress.jpg | 2025-05-19 11:06 | 963K | |
![[IMG]](/icons/image2.gif) | 2604_IMG_20180119_092007[1].jpg | 2025-05-19 11:03 | 963K | |
![[ ]](/icons/compressed.gif) | Final Report_23-128 (Bello, Aisha) - Budget Files.zip | 2025-05-19 11:05 | 965K | |
![[ ]](/icons/compressed.gif) | Final Report_20-043 (Kaponda, Francis) - Budget Files.zip | 2025-05-19 11:05 | 970K | |
![[IMG]](/icons/image2.gif) | 6843_A73A9565.jpg | 2025-05-19 11:03 | 971K | |
![[IMG]](/icons/image2.gif) | 5447_8.jpg | 2025-05-19 11:03 | 972K | |
![[IMG]](/icons/image2.gif) | 1224_IMG_4707.jpg | 2025-05-19 11:03 | 1.0M | |
![[VID]](/icons/movie.gif) | 6325_WhatsApp Video 2024-02-27 at 17.08.46.mp4 | 2025-05-19 11:03 | 1.0M | |
![[IMG]](/icons/image2.gif) | 3039_meeting_with_block_leaders.jpg | 2025-05-19 11:05 | 1.0M | |
![[IMG]](/icons/image2.gif) | 4713_IMG_20200513_110020.jpg | 2025-05-19 11:03 | 1.0M | |
![[IMG]](/icons/image2.gif) | 4258_IMG_20200123_110157.jpg | 2025-05-19 11:03 | 1.0M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9619.jpg | 2025-05-19 11:04 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1242_IMG_20161025_145648.jpg | 2025-05-19 11:03 | 1.0M | |
![[IMG]](/icons/image2.gif) | 745_leveling finished.jpg | 2025-05-19 11:04 | 1.0M | |
![[IMG]](/icons/image2.gif) | 6299_Nyirarwimo family.jpg | 2025-05-19 11:06 | 1.0M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9577.jpg | 2025-05-19 11:06 | 1.0M | |
![[IMG]](/icons/image2.gif) | 2589_GOPR3414.JPG | 2025-05-19 11:04 | 1.0M | |
![[IMG]](/icons/image2.gif) | 2589_Martin Bernales Participant 3(2).JPG | 2025-05-19 11:05 | 1.0M | |
![[ ]](/icons/compressed.gif) | Final Report_19-191 (Mkandawire, Malita) - Budget Files.zip | 2025-05-19 11:03 | 1.0M | |
![[ ]](/icons/layout.gif) | 6618_z2.pdf | 2025-05-19 11:05 | 1.0M | |
![[IMG]](/icons/image2.gif) | 2870_IMG_8177.jpg | 2025-05-19 11:05 | 1.0M | |
![[IMG]](/icons/image2.gif) | 3627_Image17.png | 2025-05-19 11:04 | 1.0M | |
![[IMG]](/icons/image2.gif) | 3774_Solar installation.jpg | 2025-05-19 11:04 | 1.0M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9603.jpg | 2025-05-19 11:05 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1013_IMG_3665.JPG | 2025-05-19 11:05 | 1.0M | |
![[ ]](/icons/compressed.gif) | Final Report_22-084 (UWIMANA, Claude) - Budget Files.zip | 2025-05-19 11:03 | 1.0M | |
![[IMG]](/icons/image2.gif) | 463_13.jpg | 2025-05-19 11:05 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1262_Remera2.png | 2025-05-19 11:04 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1668_Ramp After.jpg | 2025-05-19 11:03 | 1.0M | |
![[IMG]](/icons/image2.gif) | 2348_Health agents participating in training 2 at LPHC.jpg | 2025-05-19 11:04 | 1.0M | |
![[IMG]](/icons/image2.gif) | 2342_IMG_0935.JPG | 2025-05-19 11:03 | 1.0M | |
![[IMG]](/icons/image2.gif) | 6299_Kayitesi husband taking care of their pig.jpg | 2025-05-19 11:03 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1692_IMG_3929.jpg | 2025-05-19 11:04 | 1.0M | |
![[IMG]](/icons/image2.gif) | 7226_THEORY-OF-CHANGE_REVISED _2.jpg | 2025-05-19 11:07 | 1.0M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9573.jpg | 2025-05-19 11:03 | 1.0M | |
![[IMG]](/icons/image2.gif) | 5447_3.jpg | 2025-05-19 11:05 | 1.0M | |
![[IMG]](/icons/image2.gif) | 5447_13.jpg | 2025-05-19 11:05 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1224_IMG_4004.jpg | 2025-05-19 11:05 | 1.0M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9556.jpg | 2025-05-19 11:04 | 1.0M | |
![[IMG]](/icons/image2.gif) | 3696_unnamed[2].jpg | 2025-05-19 11:06 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1242_IMG_20161025_145712.jpg | 2025-05-19 11:05 | 1.0M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2358.jpg | 2025-05-19 11:04 | 1.0M | |
![[IMG]](/icons/image2.gif) | 3039_salon_section.jpg | 2025-05-19 11:06 | 1.0M | |
![[IMG]](/icons/image2.gif) | 2227_20170918_183827.jpg | 2025-05-19 11:05 | 1.0M | |
![[IMG]](/icons/image2.gif) | 4524_CVS_3187.jpg | 2025-05-19 11:05 | 1.0M | |
![[IMG]](/icons/image2.gif) | 3354_20200229_053146.jpg | 2025-05-19 11:03 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1224_IMG_3975.jpg | 2025-05-19 11:04 | 1.0M | |
![[IMG]](/icons/image2.gif) | 2281_IMG_20191029_085454.jpg | 2025-05-19 11:07 | 1.0M | |
![[IMG]](/icons/image2.gif) | 3039_section_salon.jpg | 2025-05-19 11:04 | 1.0M | |
![[VID]](/icons/movie.gif) | 3730_798dbd85-170c-4e74-a23b-fe350b4644dc.mp4 | 2025-05-19 11:07 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1692_IMG_3038.jpg | 2025-05-19 11:03 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1242_IMG_20161025_145704.jpg | 2025-05-19 11:04 | 1.0M | |
![[IMG]](/icons/image2.gif) | 2971_IMG_20190403_104239.jpg | 2025-05-19 11:06 | 1.0M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2506.jpg | 2025-05-19 11:03 | 1.0M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9612.jpg | 2025-05-19 11:05 | 1.0M | |
![[IMG]](/icons/image2.gif) | 5447_4.jpg | 2025-05-19 11:05 | 1.0M | |
![[IMG]](/icons/image2.gif) | 3627_Image31.png | 2025-05-19 11:03 | 1.0M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9581.jpg | 2025-05-19 11:06 | 1.0M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9602.jpg | 2025-05-19 11:05 | 1.0M | |
![[IMG]](/icons/image2.gif) | 2856_IMG_20180914_174535.jpg | 2025-05-19 11:03 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1013_IMG_3735.JPG | 2025-05-19 11:03 | 1.0M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_0250.JPG | 2025-05-19 11:06 | 1.0M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9632.jpg | 2025-05-19 11:07 | 1.0M | |
![[IMG]](/icons/image2.gif) | 4524_CVS_3114.jpg | 2025-05-19 11:05 | 1.0M | |
![[IMG]](/icons/image2.gif) | 3172_Screen Shot 2020-02-01 at 2.30.02 PM.png | 2025-05-19 11:04 | 1.0M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2508.jpg | 2025-05-19 11:05 | 1.0M | |
![[ ]](/icons/compressed.gif) | Final Report_18-143 (Ayubi, Benazire) - Files.zip | 2025-05-19 11:05 | 1.0M | |
![[IMG]](/icons/image2.gif) | 5447_10.jpg | 2025-05-19 11:05 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1248_IMG_6117.JPG | 2025-05-19 11:07 | 1.1M | |
![[IMG]](/icons/image2.gif) | 2281_IMG_20191029_085506.jpg | 2025-05-19 11:03 | 1.1M | |
![[IMG]](/icons/image2.gif) | 5447_9.jpg | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 3627_Image4.png | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 3039_get_together.jpg | 2025-05-19 11:04 | 1.1M | |
![[IMG]](/icons/image2.gif) | 627_makin speech.jpg | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 6299_Amarambya and Gisunzu community.jpg | 2025-05-19 11:03 | 1.1M | |
![[ ]](/icons/layout.gif) | 1419_LifeSkillsManual_WorldConnect.pdf | 2025-05-19 11:03 | 1.1M | |
![[IMG]](/icons/image2.gif) | 2514_IMG_9213.JPG | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 3627_Image20.png | 2025-05-19 11:03 | 1.1M | |
![[IMG]](/icons/image2.gif) | 2514_IMG_9278.JPG | 2025-05-19 11:03 | 1.1M | |
![[ ]](/icons/compressed.gif) | Community MicroClinic Maternity Project-final_report-files.zip | 2025-05-19 11:06 | 1.1M | |
![[IMG]](/icons/image2.gif) | 745_Digging with House Mother.jpg | 2025-05-19 11:07 | 1.1M | |
![[IMG]](/icons/image2.gif) | 2870_IMG_8178.jpg | 2025-05-19 11:04 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1248_IMG_6144.JPG | 2025-05-19 11:06 | 1.1M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9598.jpg | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 2870_IMG_8176.jpg | 2025-05-19 11:04 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1224_IMG_4018.jpg | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 3627_Image12.png | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2360.jpg | 2025-05-19 11:05 | 1.1M | |
![[ ]](/icons/layout.gif) | 6618_z3.pdf | 2025-05-19 11:04 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1248_IMG_6123.JPG | 2025-05-19 11:03 | 1.1M | |
![[IMG]](/icons/image2.gif) | 5447_11.jpg | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 3039_together.jpg | 2025-05-19 11:07 | 1.1M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9567.jpg | 2025-05-19 11:03 | 1.1M | |
![[IMG]](/icons/image2.gif) | 2514_IMG_9391.JPG | 2025-05-19 11:03 | 1.1M | |
![[IMG]](/icons/image2.gif) | 2348_health agents participating in training at LPHC.jpg | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 3627_Image6.png | 2025-05-19 11:04 | 1.1M | |
![[IMG]](/icons/image2.gif) | 3156_IMG_20180926_124124555.jpg | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 5447_7.jpg | 2025-05-19 11:04 | 1.1M | |
![[IMG]](/icons/image2.gif) | 627_rosa speech.jpg | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1248_IMG_6119.JPG | 2025-05-19 11:03 | 1.1M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2509.jpg | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 3025_USAID. World Connect Ladder to Learning and Zaluso Arts logos on RRC wall (2).JPG | 2025-05-19 11:04 | 1.1M | |
![[IMG]](/icons/image2.gif) | 3172_Screen Shot 2020-02-01 at 2.30.13 PM.png | 2025-05-19 11:04 | 1.1M | |
![[IMG]](/icons/image2.gif) | 2141_IMG_20170301_140836.jpg | 2025-05-19 11:03 | 1.1M | |
![[IMG]](/icons/image2.gif) | 3657_Toribio Rosario. Long time friend & political party supporter of Mayor. Stood up and defended the community rights regarding the municipal budgets for education, gender and health.jpg | 2025-05-19 11:03 | 1.1M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9578.jpg | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1060_Award Ceremony - Group Photo 2.jpg | 2025-05-19 11:03 | 1.1M | |
![[IMG]](/icons/image2.gif) | 2141_IMG_20170301_153635.jpg | 2025-05-19 11:03 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1248_IMG_6171.JPG | 2025-05-19 11:03 | 1.1M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9564.jpg | 2025-05-19 11:04 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1248_IMG_6162.JPG | 2025-05-19 11:04 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1224_IMG_3979.jpg | 2025-05-19 11:03 | 1.1M | |
![[IMG]](/icons/image2.gif) | 2477_DSC09929 2.JPG | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 6429_District education office inaugurates the new Panykworo toilets.jpg | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 7303_IMG_1888.jpg | 2025-05-19 11:06 | 1.1M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9631.jpg | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 3039_salon_sectionx.jpg | 2025-05-19 11:04 | 1.1M | |
![[IMG]](/icons/image2.gif) | 3627_Image30.png | 2025-05-19 11:04 | 1.1M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2339.jpg | 2025-05-19 11:03 | 1.1M | |
![[IMG]](/icons/image2.gif) | 2127_image.png | 2025-05-19 11:07 | 1.1M | |
![[IMG]](/icons/image2.gif) | 3627_Image13.png | 2025-05-19 11:03 | 1.1M | |
![[IMG]](/icons/image2.gif) | 592_Nian and Crissa leading workshop 2.png | 2025-05-19 11:06 | 1.1M | |
![[IMG]](/icons/image2.gif) | 592_Nina Acasio and Crissa Gallarde leading workshop 2.png | 2025-05-19 11:03 | 1.1M | |
![[IMG]](/icons/image2.gif) | 592_Nina Acasio and Crissa leading workshop 2.png | 2025-05-19 11:07 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1224_IMG_4686.jpg | 2025-05-19 11:06 | 1.1M | |
![[ ]](/icons/compressed.gif) | Final Report_19-184 (Msiska, Tizgowere) - Files.zip | 2025-05-19 11:04 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1060_Photo Submission.jpg | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2903.jpg | 2025-05-19 11:03 | 1.1M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9596.jpg | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9563.jpg | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 6172_DSC_0038.jpg | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1692_IMG_3041.jpg | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 859_environmental class with help from the government.jpg | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 6948_14.png | 2025-05-19 11:03 | 1.1M | |
![[IMG]](/icons/image2.gif) | 6948_15.png | 2025-05-19 11:03 | 1.1M | |
![[IMG]](/icons/image2.gif) | 3627_Image5.png | 2025-05-19 11:03 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1013_IMG_3820.JPG | 2025-05-19 11:04 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1248_IMG_6219.JPG | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9618.jpg | 2025-05-19 11:05 | 1.1M | |
![[ ]](/icons/layout.gif) | 3774_Incubation Handbook.pdf | 2025-05-19 11:04 | 1.1M | |
![[IMG]](/icons/image2.gif) | 3039_ICT_section.jpg | 2025-05-19 11:04 | 1.1M | |
![[IMG]](/icons/image2.gif) | 3156_IMG_20180927_155907875.jpg | 2025-05-19 11:04 | 1.1M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2361.jpg | 2025-05-19 11:04 | 1.1M | |
![[IMG]](/icons/image2.gif) | 3172_Screen Shot 2020-02-01 at 2.29.54 PM.png | 2025-05-19 11:04 | 1.1M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2383.jpg | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 7370_IMG_1800.JPG | 2025-07-24 16:48 | 1.1M | |
![[IMG]](/icons/image2.gif) | 912_20141127_144836.jpg | 2025-05-19 11:05 | 1.1M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9630.jpg | 2025-05-19 11:04 | 1.1M | |
![[IMG]](/icons/image2.gif) | 1060_Award Ceremony - Group Photo.jpg | 2025-05-19 11:04 | 1.1M | |
![[IMG]](/icons/image2.gif) | 2971_IMG_20190711_094721.jpg | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 3657_Part of the national legal framework used in gender project and oftern a reminder to the group.jpg | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1224_IMG_4110.jpg | 2025-05-19 11:03 | 1.2M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9587.jpg | 2025-05-19 11:04 | 1.2M | |
![[IMG]](/icons/image2.gif) | 783_IMG_2742.JPG | 2025-05-19 11:03 | 1.2M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9610.jpg | 2025-05-19 11:04 | 1.2M | |
![[IMG]](/icons/image2.gif) | 6948_18.png | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 6948_19.png | 2025-05-19 11:03 | 1.2M | |
![[ ]](/icons/layout.gif) | 745_Healing Garden Manual.pdf | 2025-05-19 11:03 | 1.2M | |
![[IMG]](/icons/image2.gif) | 3156_IMG_20180925_111418592_HDR.jpg | 2025-05-19 11:04 | 1.2M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9608.jpg | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 2870_IMG_8179.jpg | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 3156_IMG_20180927_161218731.jpg | 2025-05-19 11:04 | 1.2M | |
![[IMG]](/icons/image2.gif) | 2299_IMG_3669.jpg | 2025-05-19 11:03 | 1.2M | |
![[IMG]](/icons/image2.gif) | 2589_A. Dumaguin Participant 1 B.JPG | 2025-05-19 11:04 | 1.2M | |
![[IMG]](/icons/image2.gif) | 2227_20170922_185218.jpg | 2025-05-19 11:06 | 1.2M | |
![[IMG]](/icons/image2.gif) | 783_IMG_6400.JPG | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 3657_Salvador Alcala in the front seat, going to Mirabal Sisters Museum.png | 2025-05-19 11:04 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1248_IMG_6192.JPG | 2025-05-19 11:06 | 1.2M | |
![[IMG]](/icons/image2.gif) | 2141_IMG_20170301_154418.jpg | 2025-05-19 11:07 | 1.2M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3944.JPG | 2025-05-19 11:07 | 1.2M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2362.jpg | 2025-05-19 11:06 | 1.2M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9582.jpg | 2025-05-19 11:03 | 1.2M | |
![[IMG]](/icons/image2.gif) | 4713_IMG_20200513_100052.jpg | 2025-05-19 11:04 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1248_IMG_6178.JPG | 2025-05-19 11:03 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1268_INSIDE A WELL LIT UP LABOR ROOM AT MNAZI RURAL HELATHCARE CENTER (MRHC).jpg | 2025-05-19 11:04 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1397_october 7.jpg | 2025-05-19 11:03 | 1.2M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9592.jpg | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 463_15.jpg | 2025-05-19 11:06 | 1.2M | |
![[IMG]](/icons/image2.gif) | 912_20141127_145415.jpg | 2025-05-19 11:03 | 1.2M | |
![[IMG]](/icons/image2.gif) | 627_Saki Tzul.jpg | 2025-05-19 11:04 | 1.2M | |
![[IMG]](/icons/image2.gif) | 2227_20170922_185838.jpg | 2025-05-19 11:04 | 1.2M | |
![[IMG]](/icons/image2.gif) | 2227_20170922_172419.jpg | 2025-05-19 11:06 | 1.2M | |
![[IMG]](/icons/image2.gif) | 3627_Image11.png | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1224_IMG_3965.jpg | 2025-05-19 11:03 | 1.2M | |
![[IMG]](/icons/image2.gif) | 2971_IMG_20190711_094647.jpg | 2025-05-19 11:07 | 1.2M | |
![[IMG]](/icons/image2.gif) | 6948_12.png | 2025-05-19 11:07 | 1.2M | |
![[IMG]](/icons/image2.gif) | 6948_13.png | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9558.jpg | 2025-05-19 11:05 | 1.2M | |
![[ ]](/icons/compressed.gif) | Final Report_19-184 (Msiska, Tizgowere) - Budget Files.zip | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 739_bathroom1 - Copy.JPG | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 739_bathroom1.JPG | 2025-05-19 11:04 | 1.2M | |
![[IMG]](/icons/image2.gif) | 2096_August training participants and facilitators.jpg | 2025-05-19 11:04 | 1.2M | |
![[IMG]](/icons/image2.gif) | 2227_20170922_185820.jpg | 2025-05-19 11:04 | 1.2M | |
![[ ]](/icons/layout.gif) | 2324_Labor Receipts.pdf | 2025-05-19 11:07 | 1.2M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9572.jpg | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9605.jpg | 2025-05-19 11:06 | 1.2M | |
![[ ]](/icons/unknown.gif) | 2989_Final - REPORT ON WOMEN LED HONEY VALUE CHAIN DEVELOPMENT PROJEC1.docx | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 3172_Screen Shot 2020-02-01 at 2.30.37 PM.png | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 463_14.jpg | 2025-05-19 11:03 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1224_IMG_3997 - Copy.jpg | 2025-05-19 11:03 | 1.2M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9625.jpg | 2025-05-19 11:04 | 1.2M | |
![[IMG]](/icons/image2.gif) | 745_leveling with PC volunteer.jpg | 2025-05-19 11:03 | 1.2M | |
![[ ]](/icons/compressed.gif) | Final Report_19-037 (Mndala, Dalitso) - Files.zip | 2025-05-19 11:04 | 1.2M | |
![[ ]](/icons/compressed.gif) | Final Report_18-098 (Mkupu, Hilda) - Files.zip | 2025-05-19 11:06 | 1.2M | |
![[IMG]](/icons/image2.gif) | 3627_Image21.png | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 6141_20221007_172439.jpg | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 2227_20170922_190044.jpg | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2905.jpg | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 2227_20170918_192356.jpg | 2025-05-19 11:05 | 1.2M | |
![[ ]](/icons/layout.gif) | 2324_Community In-Kind Contribution.pdf | 2025-05-19 11:04 | 1.2M | |
![[IMG]](/icons/image2.gif) | 2227_20170922_185244.jpg | 2025-05-19 11:03 | 1.2M | |
![[IMG]](/icons/image2.gif) | 2227_20170922_185501.jpg | 2025-05-19 11:04 | 1.2M | |
![[IMG]](/icons/image2.gif) | 3657_Religious leader Ramon Capois and math teacher, Lidsany during the gender and health workshop.png | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1013_IMG_3817.JPG | 2025-05-19 11:03 | 1.2M | |
![[IMG]](/icons/image2.gif) | 2227_20170923_174137.jpg | 2025-05-19 11:03 | 1.2M | |
![[IMG]](/icons/image2.gif) | 2255_IMG_1260.JPG | 2025-05-19 11:03 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1248_IMG_6136.JPG | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9614.jpg | 2025-05-19 11:06 | 1.2M | |
![[IMG]](/icons/image2.gif) | 3627_Image19.png | 2025-05-19 11:03 | 1.2M | |
![[IMG]](/icons/image2.gif) | 3627_Image7.png | 2025-05-19 11:04 | 1.2M | |
![[IMG]](/icons/image2.gif) | 2802_DSC_0798.JPG | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1268_LIT UP CLASS ROOM BLOCKS AT MNAZI SECONDARY SCHOOL.jpg | 2025-05-19 11:06 | 1.2M | |
![[IMG]](/icons/image2.gif) | 3172_Screen Shot 2020-02-01 at 2.29.42 PM.png | 2025-05-19 11:05 | 1.2M | |
![[ ]](/icons/compressed.gif) | Final Report_20-103 (MTHULULA, HAPPY) - Budget Files.zip | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 3156_IMG_20180926_102034123_HDR.jpg | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1692_IMG_3915.jpg | 2025-05-19 11:07 | 1.2M | |
![[IMG]](/icons/image2.gif) | 2227_20170923_193542.jpg | 2025-05-19 11:05 | 1.2M | |
![[IMG]](/icons/image2.gif) | 627_new roof.jpg | 2025-05-19 11:03 | 1.2M | |
![[IMG]](/icons/image2.gif) | 2048_IMG_0296.JPG | 2025-05-19 11:03 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1248_IMG_6164.JPG | 2025-05-19 11:07 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1692_IMG_3930.jpg | 2025-05-19 11:04 | 1.3M | |
![[ ]](/icons/layout.gif) | 3774_INCUBATOR GUIDELINES TRAINING MANUAL.pdf | 2025-05-19 11:03 | 1.3M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9574.jpg | 2025-05-19 11:06 | 1.3M | |
![[IMG]](/icons/image2.gif) | 745_Finished leveling.jpg | 2025-05-19 11:04 | 1.3M | |
![[ ]](/icons/layout.gif) | 2324_October 14 Training Attendance List.pdf | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2299_IMG_3691.jpg | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9568.jpg | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2227_20170922_190056.jpg | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9590.jpg | 2025-05-19 11:04 | 1.3M | |
![[ ]](/icons/layout.gif) | 7097_Brujas Sponsorship Deck 2023.pdf | 2025-05-19 11:04 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2802_DSC_0800.JPG | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2141_IMG_20170301_144544.jpg | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2227_20170923_193837.jpg | 2025-05-19 11:03 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1015_IMG_6705.jpg | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9589.jpg | 2025-05-19 11:04 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2870_IMG_8156.jpg | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2357.jpg | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2589_guardhouse blessing 6.JPG | 2025-05-19 11:06 | 1.3M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9583.jpg | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2097_IMG_0587.JPG | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2227_20170922_185436.jpg | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2270_IMG_2843.jpg | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 3172_Screen Shot 2020-02-01 at 2.30.24 PM.png | 2025-05-19 11:06 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2802_DSC_0748.JPG | 2025-05-19 11:04 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2104_IMG_2858.JPG | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 745_finished leveling 2.jpg | 2025-05-19 11:03 | 1.3M | |
![[IMG]](/icons/image2.gif) | 3039_salon_makeup.jpg | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 3156_IMG_20180927_161534206_HDR.jpg | 2025-05-19 11:05 | 1.3M | |
![[ ]](/icons/compressed.gif) | Final Report_21-119 (Nkorerimana, Eric) - Budget Files.zip | 2025-05-19 11:03 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3884.JPG | 2025-05-19 11:04 | 1.3M | |
![[ ]](/icons/compressed.gif) | Final Report_18-092 (Kafotokoza, Mercy) - Budget Files.zip | 2025-05-19 11:03 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2971_IMG_20190114_125810.jpg | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 912_20141127_145528.jpg | 2025-05-19 11:03 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2672_IMG_20180420_153435.jpg | 2025-05-19 11:06 | 1.3M | |
![[ ]](/icons/compressed.gif) | Sustainable Reforestation on Indigenous Family Farms-final_report-files.zip | 2025-05-19 11:04 | 1.3M | |
![[IMG]](/icons/image2.gif) | 6948_16.png | 2025-05-19 11:04 | 1.3M | |
![[IMG]](/icons/image2.gif) | 6948_17.png | 2025-05-19 11:03 | 1.3M | |
![[IMG]](/icons/image2.gif) | 3627_Image15.png | 2025-05-19 11:03 | 1.3M | |
![[IMG]](/icons/image2.gif) | 912_20141127_153242.jpg | 2025-05-19 11:06 | 1.3M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9561.jpg | 2025-05-19 11:04 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2324_IMG_5717.JPG | 2025-05-19 11:04 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2227_20170918_183946.jpg | 2025-05-19 11:04 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2672_IMG_20180420_152418.jpg | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2227_20170923_190942.jpg | 2025-05-19 11:04 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2477_DSC09867 2.JPG | 2025-05-19 11:04 | 1.3M | |
![[IMG]](/icons/image2.gif) | 3039_salon_service.jpg | 2025-05-19 11:07 | 1.3M | |
![[IMG]](/icons/image2.gif) | 3696_unnamed[3].jpg | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2227_20170923_191328.jpg | 2025-05-19 11:03 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2514_IMG_9234.JPG | 2025-05-19 11:04 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1020_IMG_2485.JPG | 2025-05-19 11:07 | 1.3M | |
![[IMG]](/icons/image2.gif) | 3025_Reading session in Learning Space..JPG | 2025-05-19 11:03 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2802_DSC_0848.JPG | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2227_20170922_185400.jpg | 2025-05-19 11:04 | 1.3M | |
![[IMG]](/icons/image2.gif) | 3039_tailoring....jpg | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9566.jpg | 2025-05-19 11:03 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2515.jpg | 2025-05-19 11:03 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1015_IMG_2506.jpg | 2025-05-19 11:04 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2870_IMG_8175.jpg | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1012_IMG_3510.JPG | 2025-05-19 11:04 | 1.3M | |
![[IMG]](/icons/image2.gif) | 3156_IMG_20180927_163306818_HDR.jpg | 2025-05-19 11:04 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2227_20170922_185315.jpg | 2025-05-19 11:06 | 1.3M | |
![[IMG]](/icons/image2.gif) | 5659_DSC_0297.jpg | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 3039_salon.jpg | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2299_IMG_3671.jpg | 2025-05-19 11:04 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2589_Bantay Dagat Patrol 2.JPG | 2025-05-19 11:03 | 1.3M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (21).jpg | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2141_IMG_20170301_144512.jpg | 2025-05-19 11:06 | 1.3M | |
![[IMG]](/icons/image2.gif) | 3657_Students attentive to condom ed..jpg | 2025-05-19 11:03 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2672_IMG_20180420_153429.jpg | 2025-05-19 11:07 | 1.3M | |
![[IMG]](/icons/image2.gif) | 745_Before.jpg | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1308_IMG_5285.JPG | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 3596_20191021_165554.jpg | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2672_IMG_20180420_153433.jpg | 2025-05-19 11:04 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1268_FROM RIGHT TO LEFT MR. KOMBO THE DEPUTY HEAD TEACHER, MR. ISAAC MASSANGA, THE HEAD TEACHER, GIFT OMARI - THE HEAD ELECTRICIAN (THIRD FROM RIGHT) AND AMIRI ADIRI (FOURTH LEFT) THE ASSISTANT ELECTRICIANS.jpg | 2025-05-19 11:04 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1268_IMG_20150102_092149.jpg | 2025-05-19 11:03 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2971_IMG_20190114_125812.jpg | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2326.jpg | 2025-05-19 11:04 | 1.3M | |
![[IMG]](/icons/image2.gif) | 3596_IMG_20190518_143609.jpg | 2025-05-19 11:03 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1224_IMG_4107.jpg | 2025-05-19 11:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1397_october 3.jpg | 2025-05-19 11:04 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1224_IMG_4666.jpg | 2025-05-19 11:07 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1397_october 4.jpg | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 3156_IMG_20180926_105004225.jpg | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2227_20170923_193658.jpg | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2227_20170923_193518.jpg | 2025-05-19 11:03 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2672_IMG_20180420_145548.jpg | 2025-05-19 11:03 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1268_IMG_20150102_092143.jpg | 2025-05-19 11:04 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2324_IMG_5619.JPG | 2025-05-19 11:03 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2227_20170918_192305.jpg | 2025-05-19 11:03 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2227_20170918_183910.jpg | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2324_IMG_5704.JPG | 2025-05-19 11:07 | 1.4M | |
![[IMG]](/icons/image2.gif) | 803_IMG_1414.JPG | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1230_IMG_1044.jpg | 2025-05-19 11:04 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2227_20170924_103237.jpg | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1668_Ramp - Before.jpg | 2025-05-19 11:04 | 1.4M | |
![[IMG]](/icons/image2.gif) | 3627_Image9.png | 2025-05-19 11:07 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1248_IMG_6193.JPG | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2802_DSC_0811.JPG | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1012_IMG_8399.jpg | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2971_IMG_20190403_104354.jpg | 2025-05-19 11:07 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2624_DSC01152.JPG | 2025-05-19 11:03 | 1.4M | |
![[IMG]](/icons/image2.gif) | 3025_USAID. World Connect Ladder to Learning and Zaluso Arts logos on RRC wall (1).JPG | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2048_IMG_0295.JPG | 2025-05-19 11:03 | 1.4M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9579.jpg | 2025-05-19 11:04 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2589_A. Dumaguin Participant 1.JPG | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2589_GOPR3429.JPG | 2025-05-19 11:03 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2299_IMG_3673.jpg | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1430_IMG_20160818_181000974.jpg | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2589_MSO FGD 1.JPG | 2025-05-19 11:07 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2227_20170918_192309.jpg | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 3025_The revamped learning space .JPG | 2025-05-19 11:03 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1268_COSMAS HEAD OF THE LABORATORY DEPARTMENT (TO THE LEFT IN A GRAY T-SHIRT & AZIZI NANJASYE (MAROON T-SHIRT) THE HEAD OF MRHC.jpg | 2025-05-19 11:03 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1224_IMG_3987.jpg | 2025-05-19 11:03 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1308_IMG_5226.JPG | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2904.jpg | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 3657_3 types of empowernment. Poliitcal, social, and individual.jpg | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2227_20170918_183956.jpg | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1692_IMG_3922.jpg | 2025-05-19 11:03 | 1.4M | |
![[IMG]](/icons/image2.gif) | 3657_Young man practicing putting on the condom.png | 2025-05-19 11:03 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2227_20170924_103551.jpg | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 6172_DSC_0044.jpg | 2025-05-19 11:07 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2589_Martin Bernales Participant 3.JPG | 2025-05-19 11:04 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2589_P8250109.JPG | 2025-05-19 11:07 | 1.4M | |
![[IMG]](/icons/image2.gif) | 3627_Image8.png | 2025-05-19 11:03 | 1.4M | |
![[IMG]](/icons/image2.gif) | 6671_IMG_2368.jpg | 2025-05-19 11:05 | 1.4M | |
![[ ]](/icons/compressed.gif) | Final Report_19-237 (Baidoo, Ebenezer) - Files.zip | 2025-05-19 11:06 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2227_20170922_172612.jpg | 2025-05-19 11:03 | 1.4M | |
![[IMG]](/icons/image2.gif) | 3039_tailoring.jpg | 2025-05-19 11:04 | 1.4M | |
![[VID]](/icons/movie.gif) | 3730_82a332ed-413a-4c0a-9d1a-59f3a286ef5d.mp4 | 2025-05-19 11:06 | 1.4M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9594.jpg | 2025-05-19 11:04 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2324_IMG_5624.JPG | 2025-05-19 11:03 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2141_IMG_20170301_144525.jpg | 2025-05-19 11:04 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2227_20170923_174222.jpg | 2025-05-19 11:05 | 1.4M | |
![[VID]](/icons/movie.gif) | 1248_MVI_6242.MOV | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2324_IMG_5610.JPG | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2802_DSC_0752.JPG | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2227_20170922_172446.jpg | 2025-05-19 11:03 | 1.4M | |
![[IMG]](/icons/image2.gif) | 3039_makeup_salon.jpg | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1430_IMG_20160826_132910997.jpg | 2025-05-19 11:04 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1268_IMG_20161127_232235.jpg | 2025-05-19 11:03 | 1.4M | |
![[IMG]](/icons/image2.gif) | 3657_Award to Zena, presented by Doctor Abreu and Doctor Sierra for commitment and effort supporting the gender program.jpg | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2141_IMG_20170301_154438.jpg | 2025-05-19 11:07 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2270_IMG_2827.jpg | 2025-05-19 11:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9559.jpg | 2025-05-19 11:05 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2503_Picture FR_ WC.docx | 2025-05-19 11:03 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2971_IMG_20190114_125813.jpg | 2025-05-19 11:03 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2802_DSC_0774.JPG | 2025-05-19 11:04 | 1.4M | |
![[IMG]](/icons/image2.gif) | 1268_A WELL LIT-UP OUT-PATIENT DEPARTMENT (OPD) CORRIDOR.jpg | 2025-05-19 11:04 | 1.4M | |
![[IMG]](/icons/image2.gif) | 2672_IMG_20180420_152905.jpg | 2025-05-19 11:04 | 1.5M | |
![[IMG]](/icons/image2.gif) | 463_16.jpg | 2025-05-19 11:05 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1268_A LIT CLASS ROOM BLOCK AT MNAZI SECONDARY SCHOOL.jpg | 2025-05-19 11:04 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2270_IMG_2830.jpg | 2025-05-19 11:05 | 1.5M | |
![[VID]](/icons/movie.gif) | 7097_IMG_3710.MOV | 2025-05-19 11:04 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1268_TO THE LEFT, COSMAS LUWHELELE - THE INCHARGE OF THE LABORATORY DEPARTMENT AT MRHC AND TO THE RIGHT, AZIZI NANJASYE, THE HEAD OF MRHC.jpg | 2025-05-19 11:05 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2227_20170924_103720.jpg | 2025-05-19 11:04 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2227_20170923_191014.jpg | 2025-05-19 11:03 | 1.5M | |
![[IMG]](/icons/image2.gif) | 803_IMG_1307.JPG | 2025-05-19 11:05 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1397_october.jpg | 2025-05-19 11:03 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2514_IMG_9897.JPG | 2025-05-19 11:04 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2802_DSC_0876.JPG | 2025-05-19 11:05 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2802_DSC_0816.JPG | 2025-05-19 11:07 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1224_IMG_4699.jpg | 2025-05-19 11:05 | 1.5M | |
![[IMG]](/icons/image2.gif) | 5536_IMG_20220909_095340.jpg | 2025-05-19 11:05 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1448_IMG_20170315_135418.jpg | 2025-05-19 11:03 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2802_DSC_0845.JPG | 2025-05-19 11:06 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2589_Bantay Dagat Patrol 3.JPG | 2025-05-19 11:07 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2971_IMG_20190711_094706.jpg | 2025-05-19 11:05 | 1.5M | |
![[IMG]](/icons/image2.gif) | 745_leveling 2.jpg | 2025-05-19 11:04 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1421_IMG_2629.JPG | 2025-05-19 11:03 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1268_FORM TWO STUDENTS -CLASS OF 2015 ATTENDING NIGHT STUDIES IN PREPARATION FOR THE NECTA NATIONAL EXAMINATIONS (1).jpg | 2025-05-19 11:03 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2802_DSC_0802.JPG | 2025-05-19 11:04 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2802_DSC_0858.JPG | 2025-05-19 11:05 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2227_20170920_062946.jpg | 2025-05-19 11:04 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9852.JPG | 2025-05-19 11:05 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2097_IMG_0628.JPG | 2025-05-19 11:03 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2802_DSC_0873.JPG | 2025-05-19 11:03 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2299_IMG_3679.jpg | 2025-05-19 11:07 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1692_IMG_3921.jpg | 2025-05-19 11:04 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2097_IMG_0606.JPG | 2025-05-19 11:03 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2802_DSC_0846.JPG | 2025-05-19 11:03 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2227_20170924_102041.jpg | 2025-05-19 11:05 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2802_DSC_0837.JPG | 2025-05-19 11:05 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1668_Project Presentation 2.JPG | 2025-05-19 11:06 | 1.5M | |
![[IMG]](/icons/image2.gif) | 463_3.jpg | 2025-05-19 11:04 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2850_IMG_20190215_134426_5.jpg | 2025-05-19 11:03 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2227_20170923_174101.jpg | 2025-05-19 11:05 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1268_PCV MICHAEL, WELCOMED BY THE HEAD TEACHER, ISAAC MASSANGA TO THE GIRLS' HOSTEL. THIS WAS DURING ONE OF THE NIGHT VISITS TO ASCERTAIN THE BENEFITS & CHALLENGES FACED BY STUDENTS AT SCHOOL..jpg | 2025-05-19 11:04 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1268_A LIT UP ADMINISTRATIVE BLOCK AT MNAZI SECONDARY SCHOOL.jpg | 2025-05-19 11:04 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2672_IMG_20180420_152850.jpg | 2025-05-19 11:06 | 1.5M | |
![[IMG]](/icons/image2.gif) | 4545_IMG_20211103_163900_8.jpg | 2025-05-19 11:04 | 1.5M | |
![[IMG]](/icons/image2.gif) | 6172_DSC_0042.jpg | 2025-05-19 11:04 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2227_20170923_161429.jpg | 2025-05-19 11:06 | 1.5M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9585.jpg | 2025-05-19 11:07 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1248_IMG_6228.JPG | 2025-05-19 11:04 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2870_IMG_8116.jpg | 2025-05-19 11:03 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2589_MSO FGD 2.JPG | 2025-05-19 11:04 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1430_IMG_20160826_132828185.jpg | 2025-05-19 11:04 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2234_2015-02-09 16.37.34.jpg | 2025-05-19 11:05 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2235_2015-02-09 16.37.34.jpg | 2025-05-19 11:04 | 1.5M | |
![[IMG]](/icons/image2.gif) | 5648_DSC_4734.JPG | 2025-05-19 11:03 | 1.5M | |
![[IMG]](/icons/image2.gif) | 4006_IMG_20200122_120540_1_resize_20.jpg | 2025-05-19 11:05 | 1.5M | |
![[IMG]](/icons/image2.gif) | 5648_DSC_4828.JPG | 2025-05-19 11:03 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2604_IMG_20180119_092141.jpg | 2025-05-19 11:05 | 1.5M | |
![[IMG]](/icons/image2.gif) | 3025_Segal Family Foundation's SII cohort visit the RRC learning space (2).JPG | 2025-05-19 11:06 | 1.5M | |
![[IMG]](/icons/image2.gif) | 3025_The revamped learning space (back side).JPG | 2025-05-19 11:03 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1397_october 5.jpg | 2025-05-19 11:06 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1230_IMG_1601.jpg | 2025-05-19 11:05 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1430_IMG_20160826_132807782.jpg | 2025-05-19 11:04 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1268_THE WOMENS' WARD (IN-PATIENT DEPARTMENT).jpg | 2025-05-19 11:06 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1268_ANOTHER FORM TWO FEMALE STUDENT (CLASS OF 2015) TESTIFYING ABOUT THE BENEFITS OF HAVING ELECTRICITY AT THE SCHOOL. THIS WAS DURING ONE OF THE IMPROMPTU NIGHT VISITS BY THE PEACE CORPS VOLUNTEER - MICHAEL..jpg | 2025-05-19 11:03 | 1.5M | |
![[IMG]](/icons/image2.gif) | 3039_block_leader_Nyaziba.jpg | 2025-05-19 11:04 | 1.5M | |
![[IMG]](/icons/image2.gif) | 4006_IMG_20200122_120534_9_resize_94.jpg | 2025-05-19 11:05 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2227_20170923_161440.jpg | 2025-05-19 11:04 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2324_IMG_5621.JPG | 2025-05-19 11:05 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2589_P5230156.JPG | 2025-05-19 11:03 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1448_IMG_20170513_170444.jpg | 2025-05-19 11:03 | 1.5M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (23).jpg | 2025-05-19 11:06 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1268_IMG_20150102_092232.jpg | 2025-05-19 11:05 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1448_IMG_20170513_170559.jpg | 2025-05-19 11:04 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2299_IMG_3670.jpg | 2025-05-19 11:05 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1268_A WELL LIT UP OUTSIDE CORRIDOR ADJOINING THE OUT-PATIENT DEPARTMENT AND THE IN-PATIENT DEPARTMENT.jpg | 2025-05-19 11:04 | 1.5M | |
![[IMG]](/icons/image2.gif) | 463_10.jpg | 2025-05-19 11:03 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2389_IMAG0553.jpg | 2025-05-19 11:06 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2227_20170920_062927.jpg | 2025-05-19 11:03 | 1.5M | |
![[IMG]](/icons/image2.gif) | 1224_IMG_3978 - Copy.jpg | 2025-05-19 11:05 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2227_20170924_103427.jpg | 2025-05-19 11:05 | 1.5M | |
![[ ]](/icons/compressed.gif) | Final Report_18-169 (Phiri, Enelless) - Files.zip | 2025-05-19 11:06 | 1.5M | |
![[IMG]](/icons/image2.gif) | 2324_IMG_5612.JPG | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1397_october 6.jpg | 2025-05-19 11:03 | 1.6M | |
![[IMG]](/icons/image2.gif) | 2604_IMG_20180119_092023.jpg | 2025-05-19 11:03 | 1.6M | |
![[IMG]](/icons/image2.gif) | 2281_IMG_20191231_195909.jpg | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1020_IMG_2037.jpg | 2025-05-19 11:04 | 1.6M | |
![[IMG]](/icons/image2.gif) | 463_4.jpg | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1230_IMG_1690.jpg | 2025-05-19 11:06 | 1.6M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9865.JPG | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2902.jpg | 2025-05-19 11:03 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1668_Speaking with Local Media.JPG | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1020_IMG_2457.JPG | 2025-05-19 11:04 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_6461.jpg | 2025-05-19 11:04 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1268_INSIDE A WELL LIT UP INPATIENT DEPARTMENT (IPD) WOMENS' WARD.jpg | 2025-05-19 11:03 | 1.6M | |
![[IMG]](/icons/image2.gif) | 783_IMG_7305.JPG | 2025-05-19 11:04 | 1.6M | |
![[IMG]](/icons/image2.gif) | 2672_IMG_20180420_151443.jpg | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 739_inside1.JPG | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2505.jpg | 2025-05-19 11:04 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1421_IMG_2666.JPG | 2025-05-19 11:06 | 1.6M | |
![[IMG]](/icons/image2.gif) | 2589__Abello Betita Participant 1JPG.jpg | 2025-05-19 11:03 | 1.6M | |
![[IMG]](/icons/image2.gif) | 4006_IMG_20200122_140345_1_resize_64.jpg | 2025-05-19 11:04 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1268_A WELL LIT UP SIDE BLOCK OF THE IN-PATIENT DEPARTMENT (IPD) AT MRHC.jpg | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 4006_IMG_20200122_140410_7_resize_95.jpg | 2025-05-19 11:03 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1250_Victoria.jpg | 2025-05-19 11:03 | 1.6M | |
![[ ]](/icons/layout.gif) | 1419_HIVAdolescenceGender_WorldConnect.pdf | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1020_IMG_2488.jpg | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1268_INSIDE THE MALES' WARD AT THE IN-PATIENTS DEPARTMENT (IPD).jpg | 2025-05-19 11:03 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1268_THE WOMEN'S WARD (ROOM TWO) AT THE IN-PATIENT DEPARTMENT.jpg | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 4006_IMG_20200122_140416_0_resize_65.jpg | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1015_IMG_6728.jpg | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 2672_IMG_20180420_153636.jpg | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1268_ONE OF THE LIT UP CLASSROOM BLOCKS AT MNAZI SECONDARY SCHOOL.jpg | 2025-05-19 11:03 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1224_IMG_4683.jpg | 2025-05-19 11:03 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1421_IMG_2663.JPG | 2025-05-19 11:03 | 1.6M | |
![[ ]](/icons/compressed.gif) | Mburamazi Market Expansion Project-final_report-files.zip | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 2672_IMG_20180420_151448.jpg | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 3025_The revamped learning space (2).JPG | 2025-05-19 11:06 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1268_FATUMA THAHABU (FORM TWO, CLASS OF 2015) SPEAKING TO PCV MICHAEL AND THE HEAD TEACHER, ISAAC MASSANGA ABOUT THE BENEFITS OF HAVING ELECTRICITY. THIS WAS DURING A NIGHT STUDY IMPROMPTU VISIT BY THE PC VOLUNTEER.jpg | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 2672_IMG_20180420_152946.jpg | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 739_inside2.JPG | 2025-05-19 11:07 | 1.6M | |
![[IMG]](/icons/image2.gif) | 2129_20170112_172225.jpg | 2025-05-19 11:04 | 1.6M | |
![[IMG]](/icons/image2.gif) | 2514_IMG_9896.JPG | 2025-05-19 11:04 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1421_IMG_2665.JPG | 2025-05-19 11:06 | 1.6M | |
![[IMG]](/icons/image2.gif) | 2589_Marna Punay (L) and Renita Rendon (R) Participant 2.JPG | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1668_Ramp During.jpg | 2025-05-19 11:03 | 1.6M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3917.JPG | 2025-05-19 11:04 | 1.6M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2915.jpg | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9863.JPG | 2025-05-19 11:04 | 1.6M | |
![[IMG]](/icons/image2.gif) | 5648_DSC_4785.JPG | 2025-05-19 11:06 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1268_THE SIDE BLOCK OF THE IN-PATIENT DEPARTMENT OVERLOOKING THE LATRINES.jpg | 2025-05-19 11:04 | 1.6M | |
![[IMG]](/icons/image2.gif) | 4545_20180803_074637.jpg | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 3587_20200216_105151.jpg | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 2604_IMG_20180119_092134.jpg | 2025-05-19 11:04 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1268_THE HEAD TEACHER, MR ISAAC MASSANGA (TO THE RIGHT) INTRODUCING THE PEACE CORPS VOLUNTEER, MICHAEL TO HIS STUDENTS DURING ONE OF THE IMPROMPTU NIGHT VISITS TO THE SCHOOL..jpg | 2025-05-19 11:03 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1268_THE HEAD TEACHER, MR ISAAC MASSANGA (TO THE RIGHT) INTRODUCING THE PEACE CORPS VOLUNTEER, MICHAEL TO HIS STUDENTS DURING ON THE IMPROMPTU NIGHT VISITS TO THE SCHOOL..jpg | 2025-05-19 11:04 | 1.6M | |
![[VID]](/icons/movie.gif) | 7370_IMG_2330.MOV | 2025-07-24 16:48 | 1.6M | |
![[IMG]](/icons/image2.gif) | 2227_20170924_104219.jpg | 2025-05-19 11:04 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1268_OUT SIDE OF THE CLINIC.jpg | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_5414.jpg | 2025-05-19 11:04 | 1.6M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2321.jpg | 2025-05-19 11:03 | 1.6M | |
![[IMG]](/icons/image2.gif) | 2324_IMG_5719.JPG | 2025-05-19 11:03 | 1.6M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9584.jpg | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 2227_20170922_172635.jpg | 2025-05-19 11:03 | 1.6M | |
![[ ]](/icons/compressed.gif) | Final Report_19-245 (OseiAppaw, Akosua) - Budget Files.zip | 2025-05-19 11:07 | 1.6M | |
![[IMG]](/icons/image2.gif) | 2477_DSC09320 2.JPG | 2025-05-19 11:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2392.jpg | 2025-05-19 11:06 | 1.6M | |
![[IMG]](/icons/image2.gif) | 745_Leveling.jpg | 2025-05-19 11:03 | 1.6M | |
![[IMG]](/icons/image2.gif) | 4006_IMG_20200122_140402_1_resize_0.jpg | 2025-05-19 11:03 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1020_IMG_2472.jpg | 2025-05-19 11:03 | 1.6M | |
![[IMG]](/icons/image2.gif) | 1268_OUTSIDE OF MRHC.jpg | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1692_IMG_3920.jpg | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 3587_20200216_105137.jpg | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3901.JPG | 2025-05-19 11:03 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1268_INSIDE THE FORM TWO (CLASS OF 2016) BOYS' HOSTEL.jpg | 2025-05-19 11:04 | 1.7M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2504.jpg | 2025-05-19 11:03 | 1.7M | |
![[IMG]](/icons/image2.gif) | 3587_20200216_105144.jpg | 2025-05-19 11:07 | 1.7M | |
![[IMG]](/icons/image2.gif) | 2227_20170924_103637.jpg | 2025-05-19 11:04 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1410_Creating_Beauty_Products.jpg | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 745_Wall Construction.jpg | 2025-05-19 11:04 | 1.7M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2503.jpg | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 4678_20200502_130118 - Copy.jpg | 2025-05-19 11:03 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1311_IMG_5268.JPG | 2025-05-19 11:06 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1421_IMG_2667.JPG | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 3025_The revamped learning space (1).JPG | 2025-05-19 11:03 | 1.7M | |
![[IMG]](/icons/image2.gif) | 2324_IMG_5613.JPG | 2025-05-19 11:03 | 1.7M | |
![[ ]](/icons/compressed.gif) | Final Report_18-183 (Mwale, Patrick ) - Files.zip | 2025-05-19 11:03 | 1.7M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_0259.JPG | 2025-05-19 11:06 | 1.7M | |
![[IMG]](/icons/image2.gif) | 2129_20170112_152018.jpg | 2025-05-19 11:06 | 1.7M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (22).jpg | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 7370_IMG_1716.JPG | 2025-07-24 16:47 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1268_PCV MICHAEL ENTERING THE FORM TWO BOYS HOSTEL (CLASS OF 2016). AT THE FRONT IS THE HEAD TEACHER, MR. ISAAC MASSANGA..jpg | 2025-05-19 11:03 | 1.7M | |
![[ ]](/icons/compressed.gif) | Organized Women of Salitre Community CleanUp Program-final_report-files.zip | 2025-05-19 11:03 | 1.7M | |
![[ ]](/icons/layout.gif) | 2798_1 Pamphlet_Igbo.pdf | 2025-05-19 11:03 | 1.7M | |
![[ ]](/icons/layout.gif) | 5284_COMMUNITY CONTRIBUTION LUSO UP-SCALING POULTRY FARMING LUSO LANGA.pdf | 2025-05-19 11:06 | 1.7M | |
![[ ]](/icons/layout.gif) | 2798_1 Pamphlet_English.pdf | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1421_IMG_2632.JPG | 2025-05-19 11:03 | 1.7M | |
![[IMG]](/icons/image2.gif) | 2270_IMG_2839.jpg | 2025-05-19 11:07 | 1.7M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3860.JPG | 2025-05-19 11:07 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1268_DURING ONE OF THE LATE NIGHT MEETINGS AT THE HEAD TEACHER'S OFFICE. FRONT LEFT IS MR. KOMBO, THE DEPUTY HEAD TEACHER, AMIRI ADILI (ASSITANT ELECTRICIAN), GIFT OMARI (HEAD ELECTRICIAN) AND HM, ISAAC MASSANGA.jpg | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 5659_DSC_0399.jpg | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1020_IMG_2460.JPG | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1248_IMG_6102.JPG | 2025-05-19 11:04 | 1.7M | |
![[IMG]](/icons/image2.gif) | 6141_20221010_163143.jpg | 2025-05-19 11:03 | 1.7M | |
![[IMG]](/icons/image2.gif) | 2281_IMG_20191029_085356.jpg | 2025-05-19 11:07 | 1.7M | |
![[IMG]](/icons/image2.gif) | 4006_IMG_20200115_101056_7_resize_3.jpg | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 4006_IMG_20200122_120558_1_resize_57.jpg | 2025-05-19 11:06 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1230_IMG_1603.jpg | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 595_IMG_0926.jpg | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9869.JPG | 2025-05-19 11:03 | 1.7M | |
![[IMG]](/icons/image2.gif) | 4678_20200508_144137.jpg | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1015_IMG_2492.jpg | 2025-05-19 11:04 | 1.7M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9850.JPG | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 3587_20200216_105252.jpg | 2025-05-19 11:06 | 1.7M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_191420.jpg | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1268_INSIDE THE GIRLS HOSTEL. THIS WAS DURING ONE THE IMPROMPTU NIGHT VISIT BY THE PCV LED BY THE HEAD TEACHER, ISAAC MASSANGA..jpg | 2025-05-19 11:05 | 1.7M | |
![[ ]](/icons/compressed.gif) | Final Report_22-071 (Kondowe, Wedson) - Files.zip | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1248_IMG_6226.JPG | 2025-05-19 11:04 | 1.7M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2916.jpg | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 4713_IMG_20200513_085752.jpg | 2025-05-19 11:03 | 1.7M | |
![[IMG]](/icons/image2.gif) | 5648_DSC_4854.JPG | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1268_INSIDE THE FORM TWO GIRLS' HOSTEL. HERE GIRLS ARE SEEN SEATED ON THEIR MATTRESSES..jpg | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 3250_IMG_19700102_041753.jpg | 2025-05-19 11:04 | 1.7M | |
![[IMG]](/icons/image2.gif) | 463_12.jpg | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3907.JPG | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1268_THE HEAD TEACHER, ISAAC MASSANGA (SEATED AT THE FRONT) INSIDE THE FORM TWO BOYS' HOSTEL (CLASS OF 2016).jpg | 2025-05-19 11:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1230_IMG_1645.jpg | 2025-05-19 11:05 | 1.7M | |
![[ ]](/icons/layout.gif) | 4713_EWS Chaseta WC Project in Pictures.pdf | 2025-05-19 11:04 | 1.7M | |
![[IMG]](/icons/image2.gif) | 1268_INSIDE THE FORM TWO BOYS HOSTEL (CLASS OF 2016).jpg | 2025-05-19 11:04 | 1.7M | |
![[IMG]](/icons/image2.gif) | 5848_Chaseta Under5 Clinic sketch.jpg | 2025-05-19 11:03 | 1.8M | |
![[IMG]](/icons/image2.gif) | 5659_DSC_0089.jpg | 2025-05-19 11:03 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1013_IMG_3660.JPG | 2025-05-19 11:05 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_0257.JPG | 2025-05-19 11:03 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9851.JPG | 2025-05-19 11:04 | 1.8M | |
![[IMG]](/icons/image2.gif) | 5648_GuardUp 5.jpg | 2025-05-19 11:03 | 1.8M | |
![[IMG]](/icons/image2.gif) | 4006_IMG_20200122_121319_2_resize_77.jpg | 2025-05-19 11:04 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2227_20170924_102038.jpg | 2025-05-19 11:04 | 1.8M | |
![[IMG]](/icons/image2.gif) | 6843_A73A9569.jpg | 2025-05-19 11:05 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1412_IMG_0035.JPG | 2025-05-19 11:04 | 1.8M | |
![[IMG]](/icons/image2.gif) | 783_IMG_3615.JPG | 2025-05-19 11:05 | 1.8M | |
![[IMG]](/icons/image2.gif) | 4713_IMG_20200513_110304.jpg | 2025-05-19 11:04 | 1.8M | |
![[IMG]](/icons/image2.gif) | 4006_IMG_20200122_120550_2_resize_58.jpg | 2025-05-19 11:03 | 1.8M | |
![[IMG]](/icons/image2.gif) | 5648_DSC_4860.JPG | 2025-05-19 11:04 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2097_IMG_0663.JPG | 2025-05-19 11:04 | 1.8M | |
![[IMG]](/icons/image2.gif) | 592_P1010153.jpg | 2025-05-19 11:03 | 1.8M | |
![[IMG]](/icons/image2.gif) | 592_Rogela Alcantara and daughter.jpg | 2025-05-19 11:06 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_0260.JPG | 2025-05-19 11:05 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_7023.jpg | 2025-05-19 11:03 | 1.8M | |
![[IMG]](/icons/image2.gif) | 4678_20200502_124634 - Copy.jpg | 2025-05-19 11:05 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2322.jpg | 2025-05-19 11:07 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2589_A. Dumaguin (R) and A. Betita (L).JPG | 2025-05-19 11:03 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2227_20170920_062935.jpg | 2025-05-19 11:04 | 1.8M | |
![[IMG]](/icons/image2.gif) | 4713_IMG_20200513_100645.jpg | 2025-05-19 11:04 | 1.8M | |
![[IMG]](/icons/image2.gif) | 3596_20191010_171726 (1).jpg | 2025-05-19 11:03 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_191407.jpg | 2025-05-19 11:04 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_0262.JPG | 2025-05-19 11:03 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1415_DSCN2981.jpg | 2025-05-19 11:04 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_E7366.jpg | 2025-05-19 11:07 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2559_Teacher Training.png | 2025-05-19 11:07 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1311_IMG_4576.JPG | 2025-05-19 11:03 | 1.8M | |
![[IMG]](/icons/image2.gif) | 5659_DSC_0256.jpg | 2025-05-19 11:07 | 1.8M | |
![[IMG]](/icons/image2.gif) | 5659_DSC_0407.jpg | 2025-05-19 11:04 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2270_IMG_2818.jpg | 2025-05-19 11:05 | 1.8M | |
![[ ]](/icons/layout.gif) | 5678_List of corpsAfrica beneficiaries received WorldConnect goats.pdf | 2025-05-19 11:03 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2487.jpg | 2025-05-19 11:04 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_6428.jpg | 2025-05-19 11:06 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2514_IMG_9895.JPG | 2025-05-19 11:03 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2213_20170922_115717.jpg | 2025-05-19 11:04 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1412_IMG_8400.JPG | 2025-05-19 11:03 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2589_Martin Bernales Participant 3(4).JPG | 2025-05-19 11:04 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3906.JPG | 2025-05-19 11:05 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1303_IMG_0319.JPG | 2025-05-19 11:06 | 1.8M | |
![[IMG]](/icons/image2.gif) | 4545_20180810_104218.jpg | 2025-05-19 11:05 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2129_20170112_173356.jpg | 2025-05-19 11:05 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2324_IMG_5607.JPG | 2025-05-19 11:05 | 1.8M | |
![[ ]](/icons/compressed.gif) | Final Report_20-028 (MTHULULA, HAPPY) - Budget Files.zip | 2025-05-19 11:05 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1668_Picture 4.jpg | 2025-05-19 11:06 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2117_Independence Day Parade1.jpg | 2025-05-19 11:05 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_0256.JPG | 2025-05-19 11:06 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_0258.JPG | 2025-05-19 11:05 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2589_Martin Bernales Participant 3(3).JPG | 2025-05-19 11:05 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2589_P8250107.JPG | 2025-05-19 11:05 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1268_STANDING AT THE FRONT TO THE RIGHT IN A RED TSHIRT IS PCV (MICHAEL), TO THE LEFT (THE HEAD TEACHER, ISAAC MASSANGA) VISITING THE FORM TWO STUDENTS (CLASS OF 2015) DURING THE NIGHT STUDY TIME.jpg | 2025-05-19 11:04 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2324_IMG_5715.JPG | 2025-05-19 11:05 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2341.jpg | 2025-05-19 11:05 | 1.8M | |
![[IMG]](/icons/image2.gif) | 3155_IMG_2651.JPG | 2025-05-19 11:07 | 1.8M | |
![[IMG]](/icons/image2.gif) | 1412_IMG_9903.JPG | 2025-05-19 11:05 | 1.8M | |
![[IMG]](/icons/image2.gif) | 7100_PXL_20231104_132849477.jpg | 2025-05-19 11:07 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2328.jpg | 2025-05-19 11:07 | 1.9M | |
![[IMG]](/icons/image2.gif) | 5648_GuardUp 12.jpg | 2025-05-19 11:03 | 1.9M | |
![[ ]](/icons/compressed.gif) | Final Report_23-066 (Asamoah, Courage) - Budget Files.zip | 2025-05-19 11:06 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1412_IMG_8579.JPG | 2025-05-19 11:05 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2559_ICT Computer Lab .jpg | 2025-05-19 11:05 | 1.9M | |
![[IMG]](/icons/image2.gif) | 5648_DSC_4858.JPG | 2025-05-19 11:03 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_7365.jpg | 2025-05-19 11:04 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3865.JPG | 2025-05-19 11:03 | 1.9M | |
![[ ]](/icons/compressed.gif) | Final Report_23-143 (Adewunmi, Abosede) - Files.zip | 2025-05-19 11:04 | 1.9M | |
![[IMG]](/icons/image2.gif) | 615_IMG_5512.jpg | 2025-05-19 11:04 | 1.9M | |
![[IMG]](/icons/image2.gif) | 615_Justina.jpg | 2025-05-19 11:04 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3868.JPG | 2025-05-19 11:04 | 1.9M | |
![[IMG]](/icons/image2.gif) | 3643_IMG_6970.jpg | 2025-05-19 11:03 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2227_20170924_103530.jpg | 2025-05-19 11:03 | 1.9M | |
![[IMG]](/icons/image2.gif) | 7000_TL1.jpg | 2025-05-19 11:05 | 1.9M | |
![[IMG]](/icons/image2.gif) | 739_OfficeRoom.JPG | 2025-05-19 11:06 | 1.9M | |
![[IMG]](/icons/image2.gif) | 3354_20200229_060636.jpg | 2025-05-19 11:06 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3904.JPG | 2025-05-19 11:04 | 1.9M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (44).jpg | 2025-05-19 11:07 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3876.JPG | 2025-05-19 11:03 | 1.9M | |
![[IMG]](/icons/image2.gif) | 778_IMG_6810.JPG | 2025-05-19 11:05 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1412_IMG_8766.JPG | 2025-05-19 11:04 | 1.9M | |
![[ ]](/icons/layout.gif) | 6706_Chiomba Project in Pictures I.pdf | 2025-05-19 11:03 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_5413.jpg | 2025-05-19 11:03 | 1.9M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_14022.jpg | 2025-05-19 11:07 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3644.JPG | 2025-05-19 11:06 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2342_IMG_0339.jpg | 2025-05-19 11:03 | 1.9M | |
![[IMG]](/icons/image2.gif) | 3587_20200216_105213.jpg | 2025-05-19 11:03 | 1.9M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (38).jpg | 2025-05-19 11:04 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_0263.JPG | 2025-05-19 11:04 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_0255.JPG | 2025-05-19 11:05 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1303_IMG_0313.JPG | 2025-05-19 11:06 | 1.9M | |
![[IMG]](/icons/image2.gif) | 3039_students_sewing.jpg | 2025-05-19 11:05 | 1.9M | |
![[ ]](/icons/compressed.gif) | Final Report_20-124 (Bako, Peace) - Budget Files.zip | 2025-05-19 11:04 | 1.9M | |
![[ ]](/icons/compressed.gif) | Final Report_17-068 (Dorleon, Nicolas) - Files.zip | 2025-05-19 11:05 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_0241.JPG | 2025-05-19 11:03 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1303_IMG_0366.JPG | 2025-05-19 11:05 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2270_IMG_2833.jpg | 2025-05-19 11:06 | 1.9M | |
![[IMG]](/icons/image2.gif) | 739_Hilario Valdez Morillo-leadmason - Copy.JPG | 2025-05-19 11:05 | 1.9M | |
![[IMG]](/icons/image2.gif) | 739_Hilario Valdez Morillo-leadmason.JPG | 2025-05-19 11:03 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2227_20170920_063001.jpg | 2025-05-19 11:06 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2128_2000-01-04 07.25.33.jpg | 2025-05-19 11:05 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1038_IMG_4513.JPG | 2025-05-19 11:05 | 1.9M | |
![[IMG]](/icons/image2.gif) | 997_IMG_0478.JPG | 2025-05-19 11:03 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9861.JPG | 2025-05-19 11:06 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1250_Wendy.JPG | 2025-05-19 11:04 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9876.JPG | 2025-05-19 11:04 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3910.JPG | 2025-05-19 11:04 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2129_20170112_152011.jpg | 2025-05-19 11:06 | 1.9M | |
![[ ]](/icons/compressed.gif) | Born Ready for Technology Computer Education for a Competitive Future-final_report-files.zip | 2025-05-19 11:04 | 1.9M | |
![[IMG]](/icons/image2.gif) | 5648_DSC_4823.JPG | 2025-05-19 11:04 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2589_Members of Bantay Dagat and BARMDA.JPG | 2025-05-19 11:07 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2589_P8250136.JPG | 2025-05-19 11:07 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9853.JPG | 2025-05-19 11:05 | 1.9M | |
![[IMG]](/icons/image2.gif) | 4439_20200422_095514.jpg | 2025-05-19 11:05 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1230_IMG_1644.jpg | 2025-05-19 11:05 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_0245.JPG | 2025-05-19 11:05 | 1.9M | |
![[IMG]](/icons/image2.gif) | 3587_20200216_105223.jpg | 2025-05-19 11:06 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_0249.JPG | 2025-05-19 11:05 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2104_IMG_2898.JPG | 2025-05-19 11:05 | 1.9M | |
![[IMG]](/icons/image2.gif) | 463_1.jpg | 2025-05-19 11:03 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1303_IMG_0333.JPG | 2025-05-19 11:04 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1020_IMG_2341.jpg | 2025-05-19 11:03 | 1.9M | |
![[IMG]](/icons/image2.gif) | 6625_MZAMBAZI WATER PROJECT THE FIRST TANK.jpg | 2025-05-19 11:03 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2477_DSC09154 3.JPG | 2025-05-19 11:05 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2129_20170112_151953.jpg | 2025-05-19 11:05 | 1.9M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_0243.JPG | 2025-05-19 11:05 | 1.9M | |
![[IMG]](/icons/image2.gif) | 6288_688A8497.JPG | 2025-05-19 11:05 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1282_IMG_2410.jpg | 2025-05-19 11:04 | 1.9M | |
![[IMG]](/icons/image2.gif) | 1100_The finished wall before murals were painted .jpg | 2025-05-19 11:04 | 1.9M | |
![[IMG]](/icons/image2.gif) | 739_Bathroom2 - Copy.JPG | 2025-05-19 11:05 | 2.0M | |
![[IMG]](/icons/image2.gif) | 739_Bathroom2.JPG | 2025-05-19 11:04 | 2.0M | |
![[IMG]](/icons/image2.gif) | 810_Lahat Picture.JPG | 2025-05-19 11:03 | 2.0M | |
![[IMG]](/icons/image2.gif) | 5648_DSC_4833.JPG | 2025-05-19 11:03 | 2.0M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3882.JPG | 2025-05-19 11:03 | 2.0M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9877.JPG | 2025-05-19 11:05 | 2.0M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9864.JPG | 2025-05-19 11:04 | 2.0M | |
![[IMG]](/icons/image2.gif) | 2129_20170112_152014.jpg | 2025-05-19 11:05 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1668_Picture 2.jpg | 2025-05-19 11:05 | 2.0M | |
![[IMG]](/icons/image2.gif) | 4545_IMG_20190318_122002_1CS.jpg | 2025-05-19 11:03 | 2.0M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_0248.JPG | 2025-05-19 11:04 | 2.0M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9871.JPG | 2025-05-19 11:05 | 2.0M | |
![[IMG]](/icons/image2.gif) | 2589_Canvassed Patrol Boat.JPG | 2025-05-19 11:04 | 2.0M | |
![[IMG]](/icons/image2.gif) | 4678_20200502_130042 - Copy.jpg | 2025-05-19 11:04 | 2.0M | |
![[IMG]](/icons/image2.gif) | 3049_20191108_062129.jpg | 2025-05-19 11:05 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1691_IMG_20170210_101018.jpg | 2025-05-19 11:05 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_6734.jpg | 2025-05-19 11:03 | 2.0M | |
![[IMG]](/icons/image2.gif) | 4678_20200508_144134.jpg | 2025-05-19 11:04 | 2.0M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3873.JPG | 2025-05-19 11:05 | 2.0M | |
![[IMG]](/icons/image2.gif) | 2270_IMG_2837.JPG | 2025-05-19 11:04 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1412_IMG_8531.JPG | 2025-05-19 11:03 | 2.0M | |
![[IMG]](/icons/image2.gif) | 4006_IMG_20200115_100804_1_resize_29.jpg | 2025-05-19 11:06 | 2.0M | |
![[IMG]](/icons/image2.gif) | 3039_designing_class.jpg | 2025-05-19 11:04 | 2.0M | |
![[IMG]](/icons/image2.gif) | 595_IMG_0924.jpg | 2025-05-19 11:03 | 2.0M | |
![[IMG]](/icons/image2.gif) | 2334_IMG_1900.JPG | 2025-05-19 11:03 | 2.0M | |
![[IMG]](/icons/image2.gif) | 3643_IMG_6965.jpg | 2025-05-19 11:05 | 2.0M | |
![[IMG]](/icons/image2.gif) | 2329_IMG_20180316_162246.jpg | 2025-05-19 11:05 | 2.0M | |
![[IMG]](/icons/image2.gif) | 3774_20200511_131408.jpg | 2025-05-19 11:05 | 2.0M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9859.JPG | 2025-05-19 11:03 | 2.0M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3874.JPG | 2025-05-19 11:07 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_6479.jpg | 2025-05-19 11:03 | 2.0M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_0251.JPG | 2025-05-19 11:03 | 2.0M | |
![[ ]](/icons/unknown.gif) | 865_C.L.I.M.B Manual 2012.docx | 2025-05-19 11:04 | 2.0M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_0240.JPG | 2025-05-19 11:04 | 2.0M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3922.JPG | 2025-05-19 11:03 | 2.0M | |
![[IMG]](/icons/image2.gif) | 816_IMG_8712.JPG | 2025-05-19 11:05 | 2.0M | |
![[IMG]](/icons/image2.gif) | 463_8.jpg | 2025-05-19 11:03 | 2.0M | |
![[IMG]](/icons/image2.gif) | 676_IMG_20160804_155406.jpg | 2025-05-19 11:03 | 2.0M | |
![[ ]](/icons/compressed.gif) | Final Report_18-179 (Chiunjira, Stephen) - Budget Files.zip | 2025-05-19 11:04 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1100_Nutrition mural located on the inside of the wall.jpg | 2025-05-19 11:04 | 2.0M | |
![[IMG]](/icons/image2.gif) | 4678_20200428_131104 - Copy.jpg | 2025-05-19 11:04 | 2.0M | |
![[ ]](/icons/unknown.gif) | 2658_ECO-Friendly School Yard Curriclum - Albanian, doc.docx | 2025-05-19 11:07 | 2.0M | |
![[IMG]](/icons/image2.gif) | 3172_Screen Shot 2020-02-01 at 2.30.58 PM.png | 2025-05-19 11:05 | 2.0M | |
![[IMG]](/icons/image2.gif) | 3039_students_staff_gettogether.jpg | 2025-05-19 11:04 | 2.0M | |
![[ ]](/icons/layout.gif) | 4787_June Impact Newsletter.pdf | 2025-05-19 11:06 | 2.0M | |
![[IMG]](/icons/image2.gif) | 4713_IMG_20200513_084354.jpg | 2025-05-19 11:05 | 2.0M | |
![[IMG]](/icons/image2.gif) | 645_IMG_4286.jpg | 2025-05-19 11:04 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1030_Chizenje SMAG Ba Jonathan Reviewing Reporting Form 15 March 2016.jpg | 2025-05-19 11:06 | 2.0M | |
![[IMG]](/icons/image2.gif) | 2102_IMG_2229.JPG | 2025-05-19 11:03 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1668_Picture 3.jpg | 2025-05-19 11:04 | 2.0M | |
![[IMG]](/icons/image2.gif) | 3774_Second set of eggs being incubated.jpg | 2025-05-19 11:03 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1012_IMG_0127.jpg | 2025-05-19 11:04 | 2.0M | |
![[IMG]](/icons/image2.gif) | 3250_IMG_19700102_020934.jpg | 2025-05-19 11:05 | 2.0M | |
![[IMG]](/icons/image2.gif) | 2589_Report1.JPG | 2025-05-19 11:05 | 2.0M | |
![[IMG]](/icons/image2.gif) | 4678_20200428_131025 - Copy.jpg | 2025-05-19 11:04 | 2.0M | |
![[IMG]](/icons/image2.gif) | 2115_Paul and Alicia.jpg | 2025-05-19 11:06 | 2.0M | |
![[IMG]](/icons/image2.gif) | 3250_IMG_19700102_013834.jpg | 2025-05-19 11:05 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1311_IMG_4578.JPG | 2025-05-19 11:05 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1421_IMG_2639.JPG | 2025-05-19 11:06 | 2.0M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9862.JPG | 2025-05-19 11:07 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1030_Chizenje SMAG Review of Key Concepts 15 March 2016.jpg | 2025-05-19 11:03 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_7022.jpg | 2025-05-19 11:06 | 2.0M | |
![[IMG]](/icons/image2.gif) | 3039_barbing_services.jpg | 2025-05-19 11:04 | 2.0M | |
![[IMG]](/icons/image2.gif) | 3941_Beads Training.jpg | 2025-05-19 11:05 | 2.0M | |
![[ ]](/icons/compressed.gif) | Final Report_23-147 (AKINLOSE, TITILAYO) - Budget Files.zip | 2025-05-19 11:07 | 2.0M | |
![[IMG]](/icons/image2.gif) | 4678_20200502_125931 - Copy.jpg | 2025-05-19 11:06 | 2.1M | |
![[IMG]](/icons/image2.gif) | 4678_20200502_125957 - Copy.jpg | 2025-05-19 11:05 | 2.1M | |
![[IMG]](/icons/image2.gif) | 2334_IMG_1832.JPG | 2025-05-19 11:03 | 2.1M | |
![[IMG]](/icons/image2.gif) | 783_IMG_3629.JPG | 2025-05-19 11:03 | 2.1M | |
![[VID]](/icons/movie.gif) | 4678_VID-20200502-WA0068.mp4 | 2025-05-19 11:07 | 2.1M | |
![[IMG]](/icons/image2.gif) | 4713_IMG_20200513_084329.jpg | 2025-05-19 11:07 | 2.1M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2662.jpg | 2025-05-19 11:05 | 2.1M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9857.JPG | 2025-05-19 11:05 | 2.1M | |
![[ ]](/icons/layout.gif) | 650_Erik Naranjo - Grant Executive Summary.pdf | 2025-05-19 11:05 | 2.1M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175049.jpg | 2025-05-19 11:05 | 2.1M | |
![[IMG]](/icons/image2.gif) | 2129_20170112_151945.jpg | 2025-05-19 11:03 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_6380.jpg | 2025-05-19 11:05 | 2.1M | |
![[IMG]](/icons/image2.gif) | 5648_DSC_4850.JPG | 2025-05-19 11:03 | 2.1M | |
![[IMG]](/icons/image2.gif) | 2389_IMAG0557.jpg | 2025-05-19 11:03 | 2.1M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2536.jpg | 2025-05-19 11:05 | 2.1M | |
![[IMG]](/icons/image2.gif) | 4678_20200502_125934 - Copy.jpg | 2025-05-19 11:05 | 2.1M | |
![[IMG]](/icons/image2.gif) | 4678_20200502_130134 - Copy.jpg | 2025-05-19 11:03 | 2.1M | |
![[IMG]](/icons/image2.gif) | 3774_20200727_155235.jpg | 2025-05-19 11:04 | 2.1M | |
![[IMG]](/icons/image2.gif) | 4713_IMG_20200513_105021.jpg | 2025-05-19 11:05 | 2.1M | |
![[IMG]](/icons/image2.gif) | 2334_IMG_1843.JPG | 2025-05-19 11:06 | 2.1M | |
![[IMG]](/icons/image2.gif) | 2589_Bantay Dagat Patrol 1.JPG | 2025-05-19 11:07 | 2.1M | |
![[IMG]](/icons/image2.gif) | 4678_20200502_130013 - Copy.jpg | 2025-05-19 11:05 | 2.1M | |
![[IMG]](/icons/image2.gif) | 5648_DSC_4814.JPG | 2025-05-19 11:03 | 2.1M | |
![[IMG]](/icons/image2.gif) | 3155_IMG_2639.JPG | 2025-05-19 11:03 | 2.1M | |
![[IMG]](/icons/image2.gif) | 3643_IMG_6969.jpg | 2025-05-19 11:05 | 2.1M | |
![[IMG]](/icons/image2.gif) | 2096_Participants in the March Follow up training.jpg | 2025-05-19 11:06 | 2.1M | |
![[IMG]](/icons/image2.gif) | 4713_IMG_20200513_085744.jpg | 2025-05-19 11:04 | 2.1M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3870.JPG | 2025-05-19 11:05 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_6059.jpg | 2025-05-19 11:04 | 2.1M | |
![[IMG]](/icons/image2.gif) | 2589_Martin Bernales Participant 3(5).JPG | 2025-05-19 11:05 | 2.1M | |
![[IMG]](/icons/image2.gif) | 3250_IMG_19700102_015100.jpg | 2025-05-19 11:03 | 2.1M | |
![[ ]](/icons/compressed.gif) | Final Report_18-193 (Matipwiri, James) - Budget Files.zip | 2025-05-19 11:03 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1450_IMG_20170718_134301.jpg | 2025-05-19 11:03 | 2.1M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9866.JPG | 2025-05-19 11:04 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1021_IMG_1832.JPG | 2025-05-19 11:04 | 2.1M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9868.JPG | 2025-05-19 11:04 | 2.1M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3867.JPG | 2025-05-19 11:07 | 2.1M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3913.JPG | 2025-05-19 11:04 | 2.1M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2340.jpg | 2025-05-19 11:04 | 2.1M | |
![[IMG]](/icons/image2.gif) | 2589_Sir Henry Golingan Executive Director of BARMDA.JPG | 2025-05-19 11:04 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1450_IMG_20170721_104957.jpg | 2025-05-19 11:03 | 2.1M | |
![[IMG]](/icons/image2.gif) | 463_6.jpg | 2025-05-19 11:07 | 2.1M | |
![[ ]](/icons/compressed.gif) | Latrines for Dassilame Ba Boutilimite and Saroudia -final_report-files.zip | 2025-05-19 11:04 | 2.1M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3914.JPG | 2025-05-19 11:04 | 2.1M | |
![[IMG]](/icons/image2.gif) | 7000_TL3.jpg | 2025-05-19 11:04 | 2.1M | |
![[IMG]](/icons/image2.gif) | 3250_IMG_19700102_015604.jpg | 2025-05-19 11:05 | 2.1M | |
![[ ]](/icons/compressed.gif) | Final Report_18-159 (Tolbert, Alli) - Files.zip | 2025-05-19 11:04 | 2.1M | |
![[IMG]](/icons/image2.gif) | 4678_20200502_125857 - Copy.jpg | 2025-05-19 11:06 | 2.1M | |
![[IMG]](/icons/image2.gif) | 2115_Paul teaching.jpg | 2025-05-19 11:07 | 2.1M | |
![[IMG]](/icons/image2.gif) | 4713_IMG_20200513_084334.jpg | 2025-05-19 11:05 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1012_IMG_3509.JPG | 2025-05-19 11:04 | 2.1M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3857.JPG | 2025-05-19 11:03 | 2.1M | |
![[IMG]](/icons/image2.gif) | 6316_IMG_6586[1].JPG | 2025-05-19 11:05 | 2.1M | |
![[IMG]](/icons/image2.gif) | 4678_20200428_130906 - Copy.jpg | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1030_Katandala SMAG Ba Solomon Breastfeeding 09 March 2016.jpg | 2025-05-19 11:04 | 2.2M | |
![[IMG]](/icons/image2.gif) | 645_IMG_4515.jpg | 2025-05-19 11:07 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1006_IMG_1617.jpg | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3875.JPG | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2589_Marna Punay (L) and Renita Rendon (R) Participant 2(1).JPG | 2025-05-19 11:06 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2589_P8250132.JPG | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_6675.jpg | 2025-05-19 11:04 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2342_IMG_0345.jpg | 2025-05-19 11:06 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1430_IMG_20170610_123343892.jpg | 2025-05-19 11:05 | 2.2M | |
![[ ]](/icons/compressed.gif) | Final Report_19-123 (Ngambi, Gomezgan) - Budget Files.zip | 2025-05-19 11:07 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9867.JPG | 2025-05-19 11:04 | 2.2M | |
![[IMG]](/icons/image2.gif) | 7000_JM2.jpg | 2025-05-19 11:04 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting community center community use.jpg | 2025-05-19 11:04 | 2.2M | |
![[IMG]](/icons/image2.gif) | 4713_IMG_20200513_084343.jpg | 2025-05-19 11:05 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2334_IMG_1870.JPG | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9870.JPG | 2025-05-19 11:07 | 2.2M | |
![[IMG]](/icons/image2.gif) | 6316_IMG_6604[1].JPG | 2025-05-19 11:05 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1100_The headmaster of the school, Momath Sy, instructs students on the importanc eof handwashing.jpg | 2025-05-19 11:05 | 2.2M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1077.JPG | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 816_IMG_8876.JPG | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2589_Members of BARMDA and Bantay Dagat 1.JPG | 2025-05-19 11:03 | 2.2M | |
![[ ]](/icons/layout.gif) | 6551_Picture report for the Kpatili Shea center.pdf | 2025-05-19 11:05 | 2.2M | |
![[IMG]](/icons/image2.gif) | 6316_IMG_6600[1].JPG | 2025-05-19 11:05 | 2.2M | |
![[IMG]](/icons/image2.gif) | 3058_Local Leader.JPG | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2373.jpg | 2025-05-19 11:05 | 2.2M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1182.JPG | 2025-05-19 11:04 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_7017.jpg | 2025-05-19 11:06 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_0252.JPG | 2025-05-19 11:05 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2477_DSC09313 2.JPG | 2025-05-19 11:05 | 2.2M | |
![[IMG]](/icons/image2.gif) | 4678_20200502_130153.jpg | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3883.JPG | 2025-05-19 11:05 | 2.2M | |
![[IMG]](/icons/image2.gif) | 4678_20200501_131044 - Copy.jpg | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2589_Marna Punay (L) and Renita Rendon (R) Participant 2(2).JPG | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3921.JPG | 2025-05-19 11:07 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1412_IMG_8483.JPG | 2025-05-19 11:05 | 2.2M | |
![[IMG]](/icons/image2.gif) | 5648_DSC_4732.JPG | 2025-05-19 11:04 | 2.2M | |
![[IMG]](/icons/image2.gif) | 803_IMG_1300.JPG | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2589_Members of Bantay Dagat and BARMDA 2.JPG | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 595_IMG_0922.jpg | 2025-05-19 11:05 | 2.2M | |
![[ ]](/icons/compressed.gif) | Final Report_20-139 (Onyeledo, Samuel) - Budget Files.zip | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2993_IMG-20190831-WA0041.jpg | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 745_Fountain.JPG | 2025-05-19 11:06 | 2.2M | |
![[IMG]](/icons/image2.gif) | 3193_Charles Kaponya.jpg | 2025-05-19 11:05 | 2.2M | |
![[IMG]](/icons/image2.gif) | 3587_20200216_105359.jpg | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1412_IMG_8656.JPG | 2025-05-19 11:04 | 2.2M | |
![[IMG]](/icons/image2.gif) | 803_IMG_1416.JPG | 2025-05-19 11:05 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1038_IMG_4411.JPG | 2025-05-19 11:04 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1430_IMG_20170608_105435870.jpg | 2025-05-19 11:04 | 2.2M | |
![[IMG]](/icons/image2.gif) | 3587_20200216_105401.jpg | 2025-05-19 11:04 | 2.2M | |
![[IMG]](/icons/image2.gif) | 645_IMG_5057.JPG | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 6829_20231214_143432.jpg | 2025-05-19 11:04 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1030_Katandala SMAG Role Play 09 March 2016.jpg | 2025-05-19 11:05 | 2.2M | |
![[IMG]](/icons/image2.gif) | 778_IMG_6996.JPG | 2025-05-19 11:05 | 2.2M | |
![[IMG]](/icons/image2.gif) | 3587_20200216_105345.jpg | 2025-05-19 11:04 | 2.2M | |
![[ ]](/icons/layout.gif) | 1419_WASHManual_WorldConnect.pdf | 2025-05-19 11:04 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2356.jpg | 2025-05-19 11:07 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_6716.jpg | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 5648_DSC_4874.JPG | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 645_IMG_4370.JPG | 2025-05-19 11:05 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting literacy projects presentation 2017.jpg | 2025-05-19 11:05 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1230_IMG_1599.jpg | 2025-05-19 11:05 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2334_IMG_1961.JPG | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 3137_Iradukunda Chantal.jpg | 2025-05-19 11:04 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1100_Entrance of the school.jpg | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 739_front - Copy.JPG | 2025-05-19 11:05 | 2.2M | |
![[IMG]](/icons/image2.gif) | 739_front.JPG | 2025-05-19 11:06 | 2.2M | |
![[IMG]](/icons/image2.gif) | 3250_IMG_19700102_042033.jpg | 2025-05-19 11:04 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3920.JPG | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3926.JPG | 2025-05-19 11:04 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1311_IMG_5266.JPG | 2025-05-19 11:04 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_6033.jpg | 2025-05-19 11:07 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1012_IMG_6380.jpg | 2025-05-19 11:06 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2514_IMG_0085.JPG | 2025-05-19 11:05 | 2.2M | |
![[VID]](/icons/movie.gif) | 5585_Ngwenya Literacy Hub Project (2).mp4 | 2025-05-19 11:04 | 2.2M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (39).jpg | 2025-05-19 11:06 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1015_IMG_6703.jpg | 2025-05-19 11:04 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2334_IMG_1913.JPG | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1303_IMG_0328.JPG | 2025-05-19 11:05 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9854.JPG | 2025-05-19 11:04 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_6399.jpg | 2025-05-19 11:05 | 2.2M | |
![[IMG]](/icons/image2.gif) | 5648_GuardUp 7.jpg | 2025-05-19 11:06 | 2.2M | |
![[IMG]](/icons/image2.gif) | 4524_CVS_3035.jpg | 2025-05-19 11:03 | 2.2M | |
![[IMG]](/icons/image2.gif) | 4678_20200502_124843 - Copy.jpg | 2025-05-19 11:05 | 2.2M | |
![[IMG]](/icons/image2.gif) | 3587_20200216_105312.jpg | 2025-05-19 11:04 | 2.2M | |
![[IMG]](/icons/image2.gif) | 2334_IMG_1853.JPG | 2025-05-19 11:05 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1020_IMG_2201.JPG | 2025-05-19 11:07 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1012_IMG_6379.jpg | 2025-05-19 11:03 | 2.3M | |
![[ ]](/icons/layout.gif) | 2798_1pamphlet_Yoruba.pdf | 2025-05-19 11:06 | 2.3M | |
![[IMG]](/icons/image2.gif) | 7370_IMG_1327.JPG | 2025-07-24 16:47 | 2.3M | |
![[IMG]](/icons/image2.gif) | 645_IMG_4263.JPG | 2025-05-19 11:03 | 2.3M | |
![[ ]](/icons/layout.gif) | 2798_1pamphlet_Hausa.pdf | 2025-05-19 11:04 | 2.3M | |
![[IMG]](/icons/image2.gif) | 3155_IMG_2656.JPG | 2025-05-19 11:05 | 2.3M | |
![[IMG]](/icons/image2.gif) | 676_IMG_20160802_172827.jpg | 2025-05-19 11:04 | 2.3M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9858.JPG | 2025-05-19 11:04 | 2.3M | |
![[ ]](/icons/compressed.gif) | Final Report_18-108 (Kunkeyani, Silvester) - Files.zip | 2025-05-19 11:03 | 2.3M | |
![[ ]](/icons/compressed.gif) | Final Report_18-094 (Nthara, Dan) - Files.zip | 2025-05-19 11:05 | 2.3M | |
![[IMG]](/icons/image2.gif) | 2129_20170113_143737.jpg | 2025-05-19 11:05 | 2.3M | |
![[IMG]](/icons/image2.gif) | 7000_JM3.jpg | 2025-05-19 11:04 | 2.3M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3866.JPG | 2025-05-19 11:03 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1020_IMG_2352.jpg | 2025-05-19 11:04 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1311_IMG_5474.JPG | 2025-05-19 11:04 | 2.3M | |
![[IMG]](/icons/image2.gif) | 2047_IMG_2319.jpg | 2025-05-19 11:05 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1100_VIew of the wall from the inside of the school.jpg | 2025-05-19 11:05 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting parent workshop 2.jpg | 2025-05-19 11:03 | 2.3M | |
![[IMG]](/icons/image2.gif) | 3039_designing_students.jpg | 2025-05-19 11:03 | 2.3M | |
![[IMG]](/icons/image2.gif) | 6316_IMG_6624[1].JPG | 2025-05-19 11:05 | 2.3M | |
![[IMG]](/icons/image2.gif) | 676_IMG_20160803_180708.jpg | 2025-05-19 11:04 | 2.3M | |
![[IMG]](/icons/image2.gif) | 6429_Excitement at the opening of the new toilet.jpg | 2025-05-19 11:06 | 2.3M | |
![[IMG]](/icons/image2.gif) | 6551_3.JPG | 2025-05-19 11:03 | 2.3M | |
![[ ]](/icons/layout.gif) | 1094_DSWD latrine making proposal pp1.pdf | 2025-05-19 11:03 | 2.3M | |
![[IMG]](/icons/image2.gif) | 3155_IMG_2702.JPG | 2025-05-19 11:05 | 2.3M | |
![[IMG]](/icons/image2.gif) | 2614_Aissatou.jpg | 2025-05-19 11:04 | 2.3M | |
![[IMG]](/icons/image2.gif) | 2281_IMG_20191029_085518.jpg | 2025-05-19 11:04 | 2.3M | |
![[IMG]](/icons/image2.gif) | 2334_IMG_1873.JPG | 2025-05-19 11:05 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1230_IMG_1045.jpg | 2025-05-19 11:05 | 2.3M | |
![[IMG]](/icons/image2.gif) | 7000_MG1.jpg | 2025-05-19 11:03 | 2.3M | |
![[IMG]](/icons/image2.gif) | 2614_Soap4.jpg | 2025-05-19 11:07 | 2.3M | |
![[IMG]](/icons/image2.gif) | 3774_some of the chicks hatched from incubator.jpg | 2025-05-19 11:05 | 2.3M | |
![[IMG]](/icons/image2.gif) | 816_IMG_9041.JPG | 2025-05-19 11:05 | 2.3M | |
![[ ]](/icons/compressed.gif) | Final Report_19-121 (Lindsey, Charlie) - Files.zip | 2025-05-19 11:03 | 2.3M | |
![[IMG]](/icons/image2.gif) | 2836_IMG_20180724_163844.jpg | 2025-05-19 11:05 | 2.3M | |
![[IMG]](/icons/image2.gif) | 6627_IMG-20240228-WA0009.jpg | 2025-05-19 11:03 | 2.3M | |
![[IMG]](/icons/image2.gif) | 7000_SV3.jpg | 2025-05-19 11:04 | 2.3M | |
![[IMG]](/icons/image2.gif) | 7000_TL2.jpg | 2025-05-19 11:04 | 2.3M | |
![[IMG]](/icons/image2.gif) | 2324_IMG_5631.JPG | 2025-05-19 11:05 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1430_IMG_20170608_112047982.jpg | 2025-05-19 11:03 | 2.3M | |
![[IMG]](/icons/image2.gif) | 2589_Arnold Gonzales Participant 1.jpg | 2025-05-19 11:06 | 2.3M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3908.JPG | 2025-05-19 11:06 | 2.3M | |
![[IMG]](/icons/image2.gif) | 3155_IMG_2649.JPG | 2025-05-19 11:03 | 2.3M | |
![[IMG]](/icons/image2.gif) | 6551_5.JPG | 2025-05-19 11:04 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1412_IMG_8502.JPG | 2025-05-19 11:04 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1013_IMG_3825.JPG | 2025-05-19 11:06 | 2.3M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3929.JPG | 2025-05-19 11:05 | 2.3M | |
![[IMG]](/icons/image2.gif) | 778_IMG_6691.JPG | 2025-05-19 11:06 | 2.3M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20230127_123133.jpg | 2025-05-19 11:03 | 2.3M | |
![[IMG]](/icons/image2.gif) | 816_IMG_8661.JPG | 2025-05-19 11:03 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1311_IMG_5270.JPG | 2025-05-19 11:04 | 2.3M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9856.JPG | 2025-05-19 11:05 | 2.3M | |
![[IMG]](/icons/image2.gif) | 5648_GuardUp 9.jpg | 2025-05-19 11:03 | 2.3M | |
![[IMG]](/icons/image2.gif) | 778_IMG_6801.JPG | 2025-05-19 11:05 | 2.3M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3928.JPG | 2025-05-19 11:03 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1230_IMG_1596.jpg | 2025-05-19 11:03 | 2.3M | |
![[ ]](/icons/layout.gif) | 2956_Mushroom Manual.pdf | 2025-05-19 11:05 | 2.3M | |
![[IMG]](/icons/image2.gif) | 3250_IMG_19700102_041946.jpg | 2025-05-19 11:05 | 2.3M | |
![[IMG]](/icons/image2.gif) | 676_IMG_20160804_152430.jpg | 2025-05-19 11:07 | 2.3M | |
![[IMG]](/icons/image2.gif) | 1013_IMG_3710.JPG | 2025-05-19 11:07 | 2.3M | |
![[IMG]](/icons/image2.gif) | 820_Belize- GLOW girls- Amanda Masse.JPG | 2025-05-19 11:05 | 2.4M | |
![[IMG]](/icons/image2.gif) | 4524_CVS_2968.jpg | 2025-05-19 11:05 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1013_IMG_3330.JPG | 2025-05-19 11:03 | 2.4M | |
![[IMG]](/icons/image2.gif) | 782_IMG_1956.JPG | 2025-05-19 11:04 | 2.4M | |
![[IMG]](/icons/image2.gif) | 4678_20200502_125827 - Copy.jpg | 2025-05-19 11:05 | 2.4M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3903.JPG | 2025-05-19 11:05 | 2.4M | |
![[IMG]](/icons/image2.gif) | 676_IMG_20160719_135153.jpg | 2025-05-19 11:05 | 2.4M | |
![[IMG]](/icons/image2.gif) | 4678_20200501_105151 - Copy.jpg | 2025-05-19 11:05 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1103_Panama_Lucrecia_KarenRitland.JPG | 2025-05-19 11:04 | 2.4M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3872.JPG | 2025-05-19 11:04 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1015_DSCN1566.jpg | 2025-05-19 11:06 | 2.4M | |
![[IMG]](/icons/image2.gif) | 463_9.jpg | 2025-05-19 11:03 | 2.4M | |
![[IMG]](/icons/image2.gif) | 3250_IMG_19700102_010653.jpg | 2025-05-19 11:03 | 2.4M | |
![[IMG]](/icons/image2.gif) | 2110_February 2017 Hearth Program.jpg | 2025-05-19 11:07 | 2.4M | |
![[IMG]](/icons/image2.gif) | 2856_IMG_20180914_174246 - Copy.jpg | 2025-05-19 11:04 | 2.4M | |
![[IMG]](/icons/image2.gif) | 2614_Soap3.jpg | 2025-05-19 11:05 | 2.4M | |
![[IMG]](/icons/image2.gif) | 2624_IMG_20180604_062024_resized_20180630_053403693.jpg | 2025-05-19 11:05 | 2.4M | |
![[IMG]](/icons/image2.gif) | 3250_IMG_19700102_012548.jpg | 2025-05-19 11:03 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1412_IMG_8808.JPG | 2025-05-19 11:05 | 2.4M | |
![[IMG]](/icons/image2.gif) | 463_7.jpg | 2025-05-19 11:05 | 2.4M | |
![[IMG]](/icons/image2.gif) | 2329_IMG_20171006_153039.jpg | 2025-05-19 11:05 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1333_IMG_3661.JPG | 2025-05-19 11:06 | 2.4M | |
![[ ]](/icons/unknown.gif) | 6882_Project aidmoms medical diagnosis report.docx | 2025-05-19 11:04 | 2.4M | |
![[IMG]](/icons/image2.gif) | 3172_Screen Shot 2020-02-01 at 2.29.05 PM.png | 2025-05-19 11:03 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1436_IMG_2651.JPG | 2025-05-19 11:05 | 2.4M | |
![[IMG]](/icons/image2.gif) | 2270_DSC_0559.JPG | 2025-05-19 11:07 | 2.4M | |
![[IMG]](/icons/image2.gif) | 5648_DSC_4889.JPG | 2025-05-19 11:04 | 2.4M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3925.JPG | 2025-05-19 11:03 | 2.4M | |
![[IMG]](/icons/image2.gif) | 3250_IMG_19700102_011101.jpg | 2025-05-19 11:03 | 2.4M | |
![[IMG]](/icons/image2.gif) | 3250_IMG_19700102_012815.jpg | 2025-05-19 11:06 | 2.4M | |
![[IMG]](/icons/image2.gif) | 3172_Screen Shot 2020-02-01 at 2.29.16 PM.png | 2025-05-19 11:04 | 2.4M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3919.JPG | 2025-05-19 11:03 | 2.4M | |
![[IMG]](/icons/image2.gif) | 2589_A. Betita and A. Gonzales Participant 1.JPG | 2025-05-19 11:06 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1100_Badara Drame instructs the children on the importance of handwashing.jpg | 2025-05-19 11:03 | 2.4M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3900.JPG | 2025-05-19 11:03 | 2.4M | |
![[IMG]](/icons/image2.gif) | 2128_2000-02-18 05.34.34.jpg | 2025-05-19 11:05 | 2.4M | |
![[IMG]](/icons/image2.gif) | 816_IMG_9143.JPG | 2025-05-19 11:05 | 2.4M | |
![[IMG]](/icons/image2.gif) | 3632_IMG_20200305_140151.jpg | 2025-05-19 11:07 | 2.4M | |
![[ ]](/icons/compressed.gif) | Funding a Feria-final_report-files.zip | 2025-05-19 11:07 | 2.4M | |
![[IMG]](/icons/image2.gif) | 3250_IMG_19700102_011057.jpg | 2025-05-19 11:06 | 2.4M | |
![[IMG]](/icons/image2.gif) | 4439_DSC_2616.JPG | 2025-05-19 11:04 | 2.4M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3924.JPG | 2025-05-19 11:04 | 2.4M | |
![[IMG]](/icons/image2.gif) | 5648_DSC_4870.JPG | 2025-05-19 11:05 | 2.4M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3931.JPG | 2025-05-19 11:07 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1415_DSCN3002.jpg | 2025-05-19 11:03 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1311_IMG_5269.JPG | 2025-05-19 11:04 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1230_IMG_1666.jpg | 2025-05-19 11:05 | 2.4M | |
![[IMG]](/icons/image2.gif) | 676_IMG_20160804_152642.jpg | 2025-05-19 11:05 | 2.4M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (43).jpg | 2025-05-19 11:03 | 2.4M | |
![[IMG]](/icons/image2.gif) | 595_IMG_0925.jpg | 2025-05-19 11:03 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1412_IMG_8353.JPG | 2025-05-19 11:04 | 2.4M | |
![[IMG]](/icons/image2.gif) | 2614_Soap1.jpg | 2025-05-19 11:04 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1020_IMG_2347.jpg | 2025-05-19 11:04 | 2.4M | |
![[VID]](/icons/movie.gif) | 5585_Ngwenya Literacy Hub Project (3).mp4 | 2025-05-19 11:05 | 2.5M | |
![[IMG]](/icons/image2.gif) | 645_IMG_4268.JPG | 2025-05-19 11:07 | 2.5M | |
![[IMG]](/icons/image2.gif) | 1311_IMG_5471.JPG | 2025-05-19 11:03 | 2.5M | |
![[IMG]](/icons/image2.gif) | 676_IMG_20160725_173724.jpg | 2025-05-19 11:04 | 2.5M | |
![[IMG]](/icons/image2.gif) | 676_IMG_20160719_135158.jpg | 2025-05-19 11:06 | 2.5M | |
![[IMG]](/icons/image2.gif) | 645_IMG_4262.JPG | 2025-05-19 11:03 | 2.5M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3902.JPG | 2025-05-19 11:06 | 2.5M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_0244.JPG | 2025-05-19 11:05 | 2.5M | |
![[IMG]](/icons/image2.gif) | 7000_JM5.jpg | 2025-05-19 11:05 | 2.5M | |
![[IMG]](/icons/image2.gif) | 816_IMG_9049.JPG | 2025-05-19 11:03 | 2.5M | |
![[IMG]](/icons/image2.gif) | 676_IMG_20160804_153100.jpg | 2025-05-19 11:03 | 2.5M | |
![[IMG]](/icons/image2.gif) | 2334_IMG_1874.JPG | 2025-05-19 11:03 | 2.5M | |
![[VID]](/icons/movie.gif) | 3730_WhatsApp Video 2019-09-15 at 10.34.00 PM.mp4 | 2025-05-19 11:04 | 2.5M | |
![[IMG]](/icons/image2.gif) | 778_IMG_6734.JPG | 2025-05-19 11:05 | 2.5M | |
![[IMG]](/icons/image2.gif) | 1450_IMG_20170719_115518.jpg | 2025-05-19 11:04 | 2.5M | |
![[IMG]](/icons/image2.gif) | 6281_PXL_20230425_122536578_093217.jpg | 2025-05-19 11:05 | 2.5M | |
![[IMG]](/icons/image2.gif) | 676_IMG_20160725_075612.jpg | 2025-05-19 11:05 | 2.5M | |
![[IMG]](/icons/image2.gif) | 2589_Lupe Dumaguin.JPG | 2025-05-19 11:03 | 2.5M | |
![[IMG]](/icons/image2.gif) | 2117_New scale to measure recycling.jpg | 2025-05-19 11:03 | 2.5M | |
![[IMG]](/icons/image2.gif) | 2477_Copy of Haiti Painting Vila Rosa Tap Tap_creditis_Shari Rupert_2016.JPG | 2025-05-19 11:05 | 2.5M | |
![[IMG]](/icons/image2.gif) | 2514_IMG_0002.jpg | 2025-05-19 11:03 | 2.5M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3915.JPG | 2025-05-19 11:03 | 2.5M | |
![[IMG]](/icons/image2.gif) | 5582_IMG_8699.jpg | 2025-05-19 11:05 | 2.5M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3880.JPG | 2025-05-19 11:03 | 2.5M | |
![[IMG]](/icons/image2.gif) | 2117_After new roof.jpg | 2025-05-19 11:06 | 2.5M | |
![[IMG]](/icons/image2.gif) | 1020_IMG_2219.JPG | 2025-05-19 11:04 | 2.5M | |
![[IMG]](/icons/image2.gif) | 3137_Gatoya Andrew.jpg | 2025-05-19 11:03 | 2.5M | |
![[IMG]](/icons/image2.gif) | 2589_Martin Bernales Participant 3(1).JPG | 2025-05-19 11:06 | 2.5M | |
![[IMG]](/icons/image2.gif) | 2270_DSC_0564.JPG | 2025-05-19 11:04 | 2.5M | |
![[IMG]](/icons/image2.gif) | 676_IMG_20160719_135117.jpg | 2025-05-19 11:07 | 2.5M | |
![[IMG]](/icons/image2.gif) | 1230_IMG_1594.jpg | 2025-05-19 11:05 | 2.5M | |
![[IMG]](/icons/image2.gif) | 1100_View from the inside of the school.jpg | 2025-05-19 11:04 | 2.5M | |
![[IMG]](/icons/image2.gif) | 1038_IMG_4512.JPG | 2025-05-19 11:05 | 2.5M | |
![[IMG]](/icons/image2.gif) | 1030_Kasenga SMAG Role Play 11 March 2016.jpg | 2025-05-19 11:04 | 2.5M | |
![[IMG]](/icons/image2.gif) | 7000_SV4.jpg | 2025-05-19 11:04 | 2.5M | |
![[IMG]](/icons/image2.gif) | 2117_Independence Day Parade 2.jpg | 2025-05-19 11:05 | 2.5M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3877.JPG | 2025-05-19 11:05 | 2.5M | |
![[IMG]](/icons/image2.gif) | 816_IMG_9435.JPG | 2025-05-19 11:03 | 2.5M | |
![[IMG]](/icons/image2.gif) | 3632_IMG_20191122_121133.jpg | 2025-05-19 11:05 | 2.5M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3912.JPG | 2025-05-19 11:04 | 2.5M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190304_115004.jpg | 2025-05-19 11:04 | 2.5M | |
![[IMG]](/icons/image2.gif) | 3058_Established Field Partner.JPG | 2025-05-19 11:05 | 2.5M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_6390.jpg | 2025-05-19 11:03 | 2.5M | |
![[IMG]](/icons/image2.gif) | 595_IMG_0929.jpg | 2025-05-19 11:05 | 2.5M | |
![[ ]](/icons/compressed.gif) | Final Report_18-008 (Gordon, Paige) - Files.zip | 2025-05-19 11:03 | 2.5M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1114.JPG | 2025-05-19 11:05 | 2.5M | |
![[IMG]](/icons/image2.gif) | 6429_These parents helped to dig the new latrine pit.jpg | 2025-05-19 11:05 | 2.5M | |
![[IMG]](/icons/image2.gif) | 2841_IMG_20181011_123106_5.jpg | 2025-05-19 11:04 | 2.5M | |
![[IMG]](/icons/image2.gif) | 3193_Elita Milimbo.jpg | 2025-05-19 11:03 | 2.5M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3930.JPG | 2025-05-19 11:05 | 2.5M | |
![[IMG]](/icons/image2.gif) | 6429_Parents and teachers outside the new Panykworo toilets (1).jpg | 2025-05-19 11:04 | 2.5M | |
![[IMG]](/icons/image2.gif) | 816_IMG_8794.JPG | 2025-05-19 11:05 | 2.5M | |
![[IMG]](/icons/image2.gif) | 803_IMG_1422.JPG | 2025-05-19 11:07 | 2.6M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_0254.JPG | 2025-05-19 11:07 | 2.6M | |
![[IMG]](/icons/image2.gif) | 2115_Excising banana tissue.jpg | 2025-05-19 11:04 | 2.6M | |
![[IMG]](/icons/image2.gif) | 2117_New Roof 2.jpg | 2025-05-19 11:03 | 2.6M | |
![[IMG]](/icons/image2.gif) | 4439_DSC_2620.JPG | 2025-05-19 11:05 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1430_IMG_20170531_155836856.jpg | 2025-05-19 11:06 | 2.6M | |
![[ ]](/icons/layout.gif) | 5443_My dream. childrens book (1).pdf | 2025-05-19 11:05 | 2.6M | |
![[IMG]](/icons/image2.gif) | 6288_688A8539.JPG | 2025-05-19 11:04 | 2.6M | |
![[IMG]](/icons/image2.gif) | 676_IMG_20160803_180750.jpg | 2025-05-19 11:05 | 2.6M | |
![[IMG]](/icons/image2.gif) | 5648_DSC_4879.JPG | 2025-05-19 11:04 | 2.6M | |
![[IMG]](/icons/image2.gif) | 5648_GuardUp 6.jpg | 2025-05-19 11:07 | 2.6M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3927.JPG | 2025-05-19 11:03 | 2.6M | |
![[IMG]](/icons/image2.gif) | 5536_IMG_20220119_050852.jpg | 2025-05-19 11:03 | 2.6M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9848.JPG | 2025-05-19 11:05 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1282_IMG_2631.jpg | 2025-05-19 11:03 | 2.6M | |
![[IMG]](/icons/image2.gif) | 5829_20220119_111306.jpg | 2025-05-19 11:05 | 2.6M | |
![[IMG]](/icons/image2.gif) | 3632_IMG_20200406_145605.jpg | 2025-05-19 11:03 | 2.6M | |
![[IMG]](/icons/image2.gif) | 645_IMG_4505.jpg | 2025-05-19 11:06 | 2.6M | |
![[VID]](/icons/movie.gif) | 2956_68086182_2343620992562198_7022060323943219200_n.mp4 | 2025-05-19 11:04 | 2.6M | |
![[IMG]](/icons/image2.gif) | 6266__MG_1826.JPG | 2025-05-19 11:04 | 2.6M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9860.JPG | 2025-05-19 11:03 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1430_IMG_20170531_155818264.jpg | 2025-05-19 11:05 | 2.6M | |
![[IMG]](/icons/image2.gif) | 676_IMG_20160804_153259.jpg | 2025-05-19 11:07 | 2.6M | |
![[IMG]](/icons/image2.gif) | 676_IMG_20160804_153055.jpg | 2025-05-19 11:04 | 2.6M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1059.jpg | 2025-05-19 11:03 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1430_IMG_20170602_112731212.jpg | 2025-05-19 11:03 | 2.6M | |
![[IMG]](/icons/image2.gif) | 2589_P8250127.JPG | 2025-05-19 11:05 | 2.6M | |
![[IMG]](/icons/image2.gif) | 2589_Sir Henry, Sir LM, and Sir Sugar.JPG | 2025-05-19 11:04 | 2.6M | |
![[ ]](/icons/compressed.gif) | Final Report_19-191 (Mkandawire, Malita) - Files.zip | 2025-05-19 11:05 | 2.6M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3871.JPG | 2025-05-19 11:05 | 2.6M | |
![[IMG]](/icons/image2.gif) | 2854_20180928_140345.jpg | 2025-05-19 11:05 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1430_IMG_20170608_111948737_HDR.jpg | 2025-05-19 11:05 | 2.6M | |
![[IMG]](/icons/image2.gif) | 4524_CVS_2982.jpg | 2025-05-19 11:07 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1412_IMG_8551.JPG | 2025-05-19 11:03 | 2.6M | |
![[IMG]](/icons/image2.gif) | 803_IMG_1461.JPG | 2025-05-19 11:05 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1430_IMG_20170530_111937274_HDR.jpg | 2025-05-19 11:04 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1100_Teacher, Badara Drame, offers encouragement to a young student washing his hands.jpg | 2025-05-19 11:05 | 2.6M | |
![[IMG]](/icons/image2.gif) | 6429_IMG_8575.JPG | 2025-05-19 11:03 | 2.6M | |
![[IMG]](/icons/image2.gif) | 821_Belize-Carmen, Marely-Molly.jpg | 2025-05-19 11:06 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_7682.jpg | 2025-05-19 11:04 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1430_IMG_20170412_104107488_HDR.jpg | 2025-05-19 11:05 | 2.6M | |
![[IMG]](/icons/image2.gif) | 7100_pasted image 0.png | 2025-05-19 11:06 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1015_DSCN1571.jpg | 2025-05-19 11:06 | 2.6M | |
![[IMG]](/icons/image2.gif) | 6281_PXL_20230622_120956201_093130.jpg | 2025-05-19 11:05 | 2.6M | |
![[IMG]](/icons/image2.gif) | 6266__MG_9624.JPG | 2025-05-19 11:03 | 2.6M | |
![[IMG]](/icons/image2.gif) | 2854_20180828_134239.jpg | 2025-05-19 11:05 | 2.6M | |
![[IMG]](/icons/image2.gif) | 4545_20180702_120136.jpg | 2025-05-19 11:03 | 2.6M | |
![[IMG]](/icons/image2.gif) | 821_Belize-Eddylcar, Carmen, Edilson-Molly.jpg | 2025-05-19 11:05 | 2.6M | |
![[IMG]](/icons/image2.gif) | 7000_MV5.jpg | 2025-05-19 11:03 | 2.6M | |
![[IMG]](/icons/image2.gif) | 2792_Mount Carmel, Ikare 1.jpg | 2025-05-19 11:05 | 2.6M | |
![[IMG]](/icons/image2.gif) | 4545_20180817_152430.jpg | 2025-05-19 11:06 | 2.6M | |
![[IMG]](/icons/image2.gif) | 7000_MG2.jpg | 2025-05-19 11:05 | 2.6M | |
![[IMG]](/icons/image2.gif) | 1312_MadameMvilleStudentsWater.jpg | 2025-05-19 11:03 | 2.7M | |
![[IMG]](/icons/image2.gif) | 5401_solidarity group.jpg | 2025-05-19 11:03 | 2.7M | |
![[IMG]](/icons/image2.gif) | 2993_IMG-20190831-WA0026.jpg | 2025-05-19 11:05 | 2.7M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_4692.jpg | 2025-05-19 11:03 | 2.7M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1086.jpg | 2025-05-19 11:05 | 2.7M | |
![[ ]](/icons/layout.gif) | 2798_1Stop Pneumonia Sponsors Banner.pdf | 2025-05-19 11:05 | 2.7M | |
![[IMG]](/icons/image2.gif) | 6109_20230804_113444.jpg | 2025-05-19 11:05 | 2.7M | |
![[IMG]](/icons/image2.gif) | 595_IMG_0927.jpg | 2025-05-19 11:05 | 2.7M | |
![[IMG]](/icons/image2.gif) | 2342_IMG_0344.jpg | 2025-05-19 11:03 | 2.7M | |
![[IMG]](/icons/image2.gif) | 676_IMG_20160804_153142.jpg | 2025-05-19 11:05 | 2.7M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3923.JPG | 2025-05-19 11:05 | 2.7M | |
![[ ]](/icons/compressed.gif) | Final Report_19-224 (Kuipa, Philmon) - Budget Files.zip | 2025-05-19 11:03 | 2.7M | |
![[IMG]](/icons/image2.gif) | 2792_IMG_20191113_112657_5.jpg | 2025-05-19 11:03 | 2.7M | |
![[IMG]](/icons/image2.gif) | 1015_DSCN1567.jpg | 2025-05-19 11:03 | 2.7M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_7026.jpg | 2025-05-19 11:03 | 2.7M | |
![[IMG]](/icons/image2.gif) | 1015_DSCN1572.jpg | 2025-05-19 11:05 | 2.7M | |
![[IMG]](/icons/image2.gif) | 1038_IMG_4458.JPG | 2025-05-19 11:07 | 2.7M | |
![[IMG]](/icons/image2.gif) | 1038_IMG_4492.JPG | 2025-05-19 11:03 | 2.7M | |
![[IMG]](/icons/image2.gif) | 2514_IMG_0520.JPG | 2025-05-19 11:03 | 2.7M | |
![[IMG]](/icons/image2.gif) | 2854_20180928_160840.jpg | 2025-05-19 11:04 | 2.7M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_6732.jpg | 2025-05-19 11:03 | 2.7M | |
![[IMG]](/icons/image2.gif) | 2589_MSO 2 Group Photo.JPG | 2025-05-19 11:05 | 2.7M | |
![[IMG]](/icons/image2.gif) | 1096_Courtyard Dried Dec 19.jpg | 2025-05-19 11:07 | 2.7M | |
![[ ]](/icons/compressed.gif) | Final Report_19-266 (ATEGEKA, FRANK) - Budget Files.zip | 2025-05-19 11:03 | 2.7M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190307_161453.jpg | 2025-05-19 11:05 | 2.7M | |
![[IMG]](/icons/image2.gif) | 3632_IMG_20191120_144953.jpg | 2025-05-19 11:03 | 2.7M | |
![[IMG]](/icons/image2.gif) | 6429_IMG_8512.JPG | 2025-05-19 11:04 | 2.7M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3918.JPG | 2025-05-19 11:05 | 2.7M | |
![[IMG]](/icons/image2.gif) | 4678_20200502_123311 - Copy.jpg | 2025-05-19 11:05 | 2.7M | |
![[IMG]](/icons/image2.gif) | 782_IMG_2185.jpg | 2025-05-19 11:05 | 2.7M | |
![[IMG]](/icons/image2.gif) | 676_IMG_20160804_160736.jpg | 2025-05-19 11:07 | 2.7M | |
![[IMG]](/icons/image2.gif) | 778_IMG_6779.JPG | 2025-05-19 11:05 | 2.7M | |
![[IMG]](/icons/image2.gif) | 1230_IMG_1665.jpg | 2025-05-19 11:04 | 2.7M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3869.JPG | 2025-05-19 11:06 | 2.7M | |
![[IMG]](/icons/image2.gif) | 1450_IMG_20170628_124159.jpg | 2025-05-19 11:05 | 2.7M | |
![[IMG]](/icons/image2.gif) | 745_Swing.JPG | 2025-05-19 11:04 | 2.7M | |
![[IMG]](/icons/image2.gif) | 1021_DSC_0449.JPG | 2025-05-19 11:03 | 2.7M | |
![[IMG]](/icons/image2.gif) | 2792_Methodist, Idanre.jpg | 2025-05-19 11:03 | 2.7M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_6192.jpg | 2025-05-19 11:06 | 2.7M | |
![[IMG]](/icons/image2.gif) | 4678_20200502_124336 - Copy.jpg | 2025-05-19 11:03 | 2.7M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1061.JPG | 2025-05-19 11:05 | 2.7M | |
![[IMG]](/icons/image2.gif) | 2342_IMG_0343.jpg | 2025-05-19 11:04 | 2.7M | |
![[IMG]](/icons/image2.gif) | 5648_DSC_4861.JPG | 2025-05-19 11:04 | 2.7M | |
![[IMG]](/icons/image2.gif) | 1430_IMG_20170608_112142316.jpg | 2025-05-19 11:03 | 2.7M | |
![[IMG]](/icons/image2.gif) | 6829_IMG_20240417_135851_991.jpg | 2025-05-19 11:04 | 2.7M | |
![[IMG]](/icons/image2.gif) | 1410_Beauty Product_Women.jpg | 2025-05-19 11:04 | 2.7M | |
![[IMG]](/icons/image2.gif) | 6429_IMG_8586.JPG | 2025-05-19 11:05 | 2.8M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3859.JPG | 2025-05-19 11:03 | 2.8M | |
![[IMG]](/icons/image2.gif) | 4678_20200502_130816.jpg | 2025-05-19 11:03 | 2.8M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_7289.jpg | 2025-05-19 11:05 | 2.8M | |
![[IMG]](/icons/image2.gif) | 5648_GuardUp 11.jpg | 2025-05-19 11:05 | 2.8M | |
![[IMG]](/icons/image2.gif) | 676_IMG_20160804_153049.jpg | 2025-05-19 11:07 | 2.8M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1036.JPG | 2025-05-19 11:06 | 2.8M | |
![[IMG]](/icons/image2.gif) | 1430_IMG_20170502_095459926_HDR.jpg | 2025-05-19 11:04 | 2.8M | |
![[IMG]](/icons/image2.gif) | 1436_IMG_2648.JPG | 2025-05-19 11:06 | 2.8M | |
![[IMG]](/icons/image2.gif) | 1100_Students, teachers and PCV Michael.jpg | 2025-05-19 11:03 | 2.8M | |
![[IMG]](/icons/image2.gif) | 645_IMG_4272.JPG | 2025-05-19 11:05 | 2.8M | |
![[IMG]](/icons/image2.gif) | 2334_IMG_1861.JPG | 2025-05-19 11:03 | 2.8M | |
![[IMG]](/icons/image2.gif) | 1103_Panama_MariaOvalle_KarenRitland.JPG | 2025-05-19 11:05 | 2.8M | |
![[IMG]](/icons/image2.gif) | 7000_BT1.jpg | 2025-05-19 11:03 | 2.8M | |
![[IMG]](/icons/image2.gif) | 6266__MG_9642.JPG | 2025-05-19 11:05 | 2.8M | |
![[IMG]](/icons/image2.gif) | 1430_IMG_20170601_092809635_HDR.jpg | 2025-05-19 11:03 | 2.8M | |
![[IMG]](/icons/image2.gif) | 4678_20200502_130829.jpg | 2025-05-19 11:03 | 2.8M | |
![[IMG]](/icons/image2.gif) | 7000_NB2.jpg | 2025-05-19 11:04 | 2.8M | |
![[IMG]](/icons/image2.gif) | 778_IMG_6653.JPG | 2025-05-19 11:04 | 2.8M | |
![[IMG]](/icons/image2.gif) | 1430_IMG_20170508_101950346_HDR.jpg | 2025-05-19 11:05 | 2.8M | |
![[IMG]](/icons/image2.gif) | 5648_GuardUp 14.jpg | 2025-05-19 11:05 | 2.8M | |
![[IMG]](/icons/image2.gif) | 6429_lunch at the Panykworo school.jpg | 2025-05-19 11:04 | 2.8M | |
![[IMG]](/icons/image2.gif) | 2117_New Roof 1.jpg | 2025-05-19 11:03 | 2.8M | |
![[IMG]](/icons/image2.gif) | 745_Meditation area.JPG | 2025-05-19 11:04 | 2.8M | |
![[IMG]](/icons/image2.gif) | 6429_IMG_8577.JPG | 2025-05-19 11:07 | 2.8M | |
![[IMG]](/icons/image2.gif) | 676_IMG_20160804_153127.jpg | 2025-05-19 11:05 | 2.8M | |
![[IMG]](/icons/image2.gif) | 5829_20220119_101152.jpg | 2025-05-19 11:05 | 2.8M | |
![[IMG]](/icons/image2.gif) | 5648_GuardUp 15.jpg | 2025-05-19 11:03 | 2.8M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9855.JPG | 2025-05-19 11:05 | 2.8M | |
![[IMG]](/icons/image2.gif) | 2624_IMG_20180604_061601_resized_20180630_053557831.jpg | 2025-05-19 11:03 | 2.8M | |
![[IMG]](/icons/image2.gif) | 3941_Fascinator work done by participant 2.PNG | 2025-05-19 11:04 | 2.8M | |
![[IMG]](/icons/image2.gif) | 6292_IMG_20230109_105257_531.jpg | 2025-05-19 11:06 | 2.8M | |
![[IMG]](/icons/image2.gif) | 7000_JM6.jpg | 2025-05-19 11:07 | 2.8M | |
![[IMG]](/icons/image2.gif) | 6627_IMG-20240228-WA0006.jpg | 2025-05-19 11:07 | 2.8M | |
![[IMG]](/icons/image2.gif) | 2589_MSO 1 Group Photo.JPG | 2025-05-19 11:04 | 2.8M | |
![[IMG]](/icons/image2.gif) | 6288_688A8904.JPG | 2025-05-19 11:05 | 2.8M | |
![[IMG]](/icons/image2.gif) | 2792_IMG_20191113_114016_7.jpg | 2025-05-19 11:03 | 2.8M | |
![[IMG]](/icons/image2.gif) | 2115_Preparing excorms.jpg | 2025-05-19 11:07 | 2.8M | |
![[IMG]](/icons/image2.gif) | 2792_002.jpg | 2025-05-19 11:05 | 2.8M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_E7709.jpg | 2025-05-19 11:04 | 2.8M | |
![[IMG]](/icons/image2.gif) | 2792_IMG_20191214_150553_6.jpg | 2025-05-19 11:05 | 2.8M | |
![[IMG]](/icons/image2.gif) | 2589_Dried Fish (danggit_rabbitfish).JPG | 2025-05-19 11:04 | 2.8M | |
![[IMG]](/icons/image2.gif) | 1100_Students, teacher, and PCV Michael at the entrance of the school.jpg | 2025-05-19 11:04 | 2.8M | |
![[IMG]](/icons/image2.gif) | 3039_tailoring_design.jpg | 2025-05-19 11:04 | 2.8M | |
![[IMG]](/icons/image2.gif) | 6550_IMG_20230428_171139.jpg | 2025-05-19 11:04 | 2.8M | |
![[IMG]](/icons/image2.gif) | 5648_DSC_4769.JPG | 2025-05-19 11:05 | 2.8M | |
![[IMG]](/icons/image2.gif) | 6550_IMG_20230428_163650.jpg | 2025-05-19 11:03 | 2.8M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9874.JPG | 2025-05-19 11:04 | 2.8M | |
![[IMG]](/icons/image2.gif) | 7000_MC3.jpg | 2025-05-19 11:05 | 2.8M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3878.JPG | 2025-05-19 11:05 | 2.8M | |
![[IMG]](/icons/image2.gif) | 778_IMG_6750.JPG | 2025-05-19 11:03 | 2.8M | |
![[IMG]](/icons/image2.gif) | 1096_Concrete Setting.jpg | 2025-05-19 11:06 | 2.8M | |
![[IMG]](/icons/image2.gif) | 6627_IMG-20240228-WA0010.jpg | 2025-05-19 11:03 | 2.8M | |
![[IMG]](/icons/image2.gif) | 6266__MG_1818.JPG | 2025-05-19 11:05 | 2.8M | |
![[IMG]](/icons/image2.gif) | 6713_Job Moyo.jpg | 2025-05-19 11:05 | 2.8M | |
![[IMG]](/icons/image2.gif) | 1282_IMG_2637.jpg | 2025-05-19 11:03 | 2.8M | |
![[ ]](/icons/compressed.gif) | Final Report_20-123 (Muhammed, Sani ) - Budget Files.zip | 2025-05-19 11:05 | 2.8M | |
![[IMG]](/icons/image2.gif) | 4678_20200502_130832.jpg | 2025-05-19 11:04 | 2.8M | |
![[IMG]](/icons/image2.gif) | 3745_IMG_20200513_142134.JPG | 2025-05-19 11:06 | 2.9M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_0246.JPG | 2025-05-19 11:03 | 2.9M | |
![[IMG]](/icons/image2.gif) | 1038_IMG_4468.JPG | 2025-05-19 11:06 | 2.9M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1304.jpg | 2025-05-19 11:03 | 2.9M | |
![[IMG]](/icons/image2.gif) | 645_IMG_4259.JPG | 2025-05-19 11:03 | 2.9M | |
![[IMG]](/icons/image2.gif) | 3941_Fascinator work done by participant 1.PNG | 2025-05-19 11:05 | 2.9M | |
![[IMG]](/icons/image2.gif) | 2305_IMG_6048.JPG | 2025-05-19 11:03 | 2.9M | |
![[IMG]](/icons/image2.gif) | 1450_IMG_20170621_130938.jpg | 2025-05-19 11:05 | 2.9M | |
![[VID]](/icons/movie.gif) | 3685_Justin Borehole Grant Signing.mp4 | 2025-05-19 11:03 | 2.9M | |
![[IMG]](/icons/image2.gif) | 2792_IMG_20191128_075150_7.jpg | 2025-05-19 11:07 | 2.9M | |
![[IMG]](/icons/image2.gif) | 2792_07.jpg | 2025-05-19 11:04 | 2.9M | |
![[IMG]](/icons/image2.gif) | 2854_20181002_160055.jpg | 2025-05-19 11:05 | 2.9M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_E7715.jpg | 2025-05-19 11:03 | 2.9M | |
![[IMG]](/icons/image2.gif) | 3774_Chairman of community group with Mikolongwe chickens.jpg | 2025-05-19 11:05 | 2.9M | |
![[IMG]](/icons/image2.gif) | 3193_Anness Pius.jpg | 2025-05-19 11:04 | 2.9M | |
![[ ]](/icons/compressed.gif) | Final Report_20-022 (Harawa, Mwelura) - Budget Files.zip | 2025-05-19 11:03 | 2.9M | |
![[IMG]](/icons/image2.gif) | 6429_IMG_9187.JPG | 2025-05-19 11:05 | 2.9M | |
![[IMG]](/icons/image2.gif) | 2792_IMG_20191205_134735_9.jpg | 2025-05-19 11:04 | 2.9M | |
![[IMG]](/icons/image2.gif) | 7000_JM1.jpg | 2025-05-19 11:05 | 2.9M | |
![[IMG]](/icons/image2.gif) | 5034_Completed Washroom3.jpg | 2025-05-19 11:03 | 2.9M | |
![[IMG]](/icons/image2.gif) | 2792_Oba Ile.jpg | 2025-05-19 11:03 | 2.9M | |
![[IMG]](/icons/image2.gif) | 2854_20181001_083952.jpg | 2025-05-19 11:04 | 2.9M | |
![[IMG]](/icons/image2.gif) | 1103_Panama_AlbertoGil_KarenRitland.JPG | 2025-05-19 11:03 | 2.9M | |
![[IMG]](/icons/image2.gif) | 3941_Fascinator work done by participant.PNG | 2025-05-19 11:05 | 2.9M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9873.JPG | 2025-05-19 11:06 | 2.9M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9872.JPG | 2025-05-19 11:05 | 2.9M | |
![[IMG]](/icons/image2.gif) | 6829_IMG_20240417_134435_948.jpg | 2025-05-19 11:05 | 2.9M | |
![[IMG]](/icons/image2.gif) | 1282_IMG_2409.jpg | 2025-05-19 11:06 | 2.9M | |
![[IMG]](/icons/image2.gif) | 6109_IMG_20230804_095610.jpg | 2025-05-19 11:06 | 2.9M | |
![[IMG]](/icons/image2.gif) | 2589_BD Training GPS2.JPG | 2025-05-19 11:03 | 2.9M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_0247.JPG | 2025-05-19 11:05 | 2.9M | |
![[IMG]](/icons/image2.gif) | 2589_P6260917.JPG | 2025-05-19 11:07 | 2.9M | |
![[IMG]](/icons/image2.gif) | 821_Belize-Erwin, Edilson, Jeff, Carmen-Molly.JPG | 2025-05-19 11:05 | 2.9M | |
![[IMG]](/icons/image2.gif) | 463_5.JPG | 2025-05-19 11:03 | 2.9M | |
![[IMG]](/icons/image2.gif) | 5829_20220119_110935.jpg | 2025-05-19 11:05 | 2.9M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (45).jpg | 2025-05-19 11:04 | 2.9M | |
![[IMG]](/icons/image2.gif) | 996_DSC_9086.JPG | 2025-05-19 11:06 | 2.9M | |
![[IMG]](/icons/image2.gif) | 2671_IMG_0070.jpg | 2025-05-19 11:03 | 2.9M | |
![[IMG]](/icons/image2.gif) | 5648_DSC_4774.JPG | 2025-05-19 11:04 | 2.9M | |
![[IMG]](/icons/image2.gif) | 2792_IMG_20191113_114029_3.jpg | 2025-05-19 11:06 | 2.9M | |
![[IMG]](/icons/image2.gif) | 6550_IMG_20230428_165909.jpg | 2025-05-19 11:04 | 2.9M | |
![[IMG]](/icons/image2.gif) | 1038_IMG_4478.JPG | 2025-05-19 11:03 | 2.9M | |
![[IMG]](/icons/image2.gif) | 6829_IMG_20240417_144134_211.jpg | 2025-05-19 11:04 | 2.9M | |
![[IMG]](/icons/image2.gif) | 1436_IMG_2627.JPG | 2025-05-19 11:07 | 2.9M | |
![[IMG]](/icons/image2.gif) | 2305_IMG_6024.JPG | 2025-05-19 11:06 | 2.9M | |
![[IMG]](/icons/image2.gif) | 2640_Permet World Connect 1.jpg | 2025-05-19 11:05 | 2.9M | |
![[IMG]](/icons/image2.gif) | 6266__MG_9657.JPG | 2025-05-19 11:03 | 2.9M | |
![[IMG]](/icons/image2.gif) | 2305_IMG_8680.JPG | 2025-05-19 11:06 | 2.9M | |
![[IMG]](/icons/image2.gif) | 2792_04.jpg | 2025-05-19 11:05 | 2.9M | |
![[IMG]](/icons/image2.gif) | 2792_05.jpg | 2025-05-19 11:05 | 2.9M | |
![[IMG]](/icons/image2.gif) | 6266__MG_9639.JPG | 2025-05-19 11:05 | 2.9M | |
![[IMG]](/icons/image2.gif) | 1282_IMG_2400.jpg | 2025-05-19 11:05 | 2.9M | |
![[IMG]](/icons/image2.gif) | 1450_IMG_20170720_114011.jpg | 2025-05-19 11:03 | 2.9M | |
![[IMG]](/icons/image2.gif) | 6550_IMG_20230428_170157.jpg | 2025-05-19 11:05 | 2.9M | |
![[IMG]](/icons/image2.gif) | 2334_IMG_1825.JPG | 2025-05-19 11:05 | 2.9M | |
![[IMG]](/icons/image2.gif) | 3901_DSC_1025.JPG | 2025-05-19 11:06 | 2.9M | |
![[IMG]](/icons/image2.gif) | 6288_MAY 07 ok.jpg | 2025-05-19 11:06 | 2.9M | |
![[IMG]](/icons/image2.gif) | 2856_IMG_20180914_173434 - Copy.jpg | 2025-05-19 11:04 | 2.9M | |
![[IMG]](/icons/image2.gif) | 1242_IMG_4575.JPG | 2025-05-19 11:05 | 2.9M | |
![[IMG]](/icons/image2.gif) | 1445_MCLC_5.JPG | 2025-05-19 11:05 | 3.0M | |
![[IMG]](/icons/image2.gif) | 1430_IMG_20170502_095359034_HDR.jpg | 2025-05-19 11:03 | 3.0M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1087.jpg | 2025-05-19 11:05 | 3.0M | |
![[IMG]](/icons/image2.gif) | 6292_IMG_20230109_104523_961.jpg | 2025-05-19 11:07 | 3.0M | |
![[IMG]](/icons/image2.gif) | 2991_IMG_7259.JPG | 2025-05-19 11:05 | 3.0M | |
![[IMG]](/icons/image2.gif) | 6550_IMG_20230428_171600.jpg | 2025-05-19 11:03 | 3.0M | |
![[IMG]](/icons/image2.gif) | 2305_IMG_6018.JPG | 2025-05-19 11:05 | 3.0M | |
![[IMG]](/icons/image2.gif) | 1282_IMG_2633.jpg | 2025-05-19 11:05 | 3.0M | |
![[IMG]](/icons/image2.gif) | 6671_IMG_0335.jpg | 2025-05-19 11:04 | 3.0M | |
![[IMG]](/icons/image2.gif) | 1445_MCLC_12.JPG | 2025-05-19 11:04 | 3.0M | |
![[IMG]](/icons/image2.gif) | 6281_PXL_20230524_114925275_093149.jpg | 2025-05-19 11:04 | 3.0M | |
![[IMG]](/icons/image2.gif) | 1230_IMG_0318.jpg | 2025-05-19 11:04 | 3.0M | |
![[IMG]](/icons/image2.gif) | 2792_MCI2.jpg | 2025-05-19 11:07 | 3.0M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (42).jpg | 2025-05-19 11:05 | 3.0M | |
![[IMG]](/icons/image2.gif) | 6429_IMG_9180.JPG | 2025-05-19 11:03 | 3.0M | |
![[IMG]](/icons/image2.gif) | 6550_IMG_20230428_171417.jpg | 2025-05-19 11:05 | 3.0M | |
![[IMG]](/icons/image2.gif) | 2342_IMG_0336.jpg | 2025-05-19 11:03 | 3.0M | |
![[IMG]](/icons/image2.gif) | 1430_IMG_20170502_095345130_HDR.jpg | 2025-05-19 11:04 | 3.0M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20200130_151646.jpg | 2025-05-19 11:07 | 3.0M | |
![[IMG]](/icons/image2.gif) | 1430_IMG_20170608_112131147.jpg | 2025-05-19 11:04 | 3.0M | |
![[IMG]](/icons/image2.gif) | 2514_IMG_0658.JPG | 2025-05-19 11:03 | 3.0M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1041.JPG | 2025-05-19 11:03 | 3.0M | |
![[IMG]](/icons/image2.gif) | 2792_IMG_20191115_090242_0 - Copy.jpg | 2025-05-19 11:03 | 3.0M | |
![[IMG]](/icons/image2.gif) | 2792_06.jpg | 2025-05-19 11:07 | 3.0M | |
![[IMG]](/icons/image2.gif) | 2792_Babatunde Kemisola, MCGC Ikare.jpg | 2025-05-19 11:05 | 3.0M | |
![[IMG]](/icons/image2.gif) | 2305_IMG_6021.JPG | 2025-05-19 11:04 | 3.0M | |
![[IMG]](/icons/image2.gif) | 2589_MSO 2.JPG | 2025-05-19 11:04 | 3.0M | |
![[IMG]](/icons/image2.gif) | 2993_20190227_080222.jpg | 2025-05-19 11:04 | 3.0M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_191157.jpg | 2025-05-19 11:05 | 3.0M | |
![[IMG]](/icons/image2.gif) | 6266__MG_9630.JPG | 2025-05-19 11:05 | 3.0M | |
![[IMG]](/icons/image2.gif) | 2870__MG_6744.jpg | 2025-05-19 11:04 | 3.0M | |
![[IMG]](/icons/image2.gif) | 2121_DSC_0962.JPG | 2025-05-19 11:06 | 3.0M | |
![[IMG]](/icons/image2.gif) | 2792_Oba-Ile School.jpg | 2025-05-19 11:07 | 3.0M | |
![[IMG]](/icons/image2.gif) | 3035_IMG_4461.JPG | 2025-05-19 11:04 | 3.0M | |
![[IMG]](/icons/image2.gif) | 2514_IMG_0650.JPG | 2025-05-19 11:05 | 3.0M | |
![[IMG]](/icons/image2.gif) | 2255_IMG_7900.JPG | 2025-05-19 11:06 | 3.0M | |
![[IMG]](/icons/image2.gif) | 3025_IMG_20190225_113537.jpg | 2025-05-19 11:03 | 3.0M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20230127_122626.jpg | 2025-05-19 11:04 | 3.0M | |
![[IMG]](/icons/image2.gif) | 2121_DSC_0923.JPG | 2025-05-19 11:03 | 3.0M | |
![[IMG]](/icons/image2.gif) | 463_2.jpg | 2025-05-19 11:03 | 3.0M | |
![[IMG]](/icons/image2.gif) | 7000_MV4.jpg | 2025-05-19 11:04 | 3.0M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1026.JPG | 2025-05-19 11:04 | 3.0M | |
![[IMG]](/icons/image2.gif) | 2792_Methodist High School, Idanre.jpg | 2025-05-19 11:04 | 3.0M | |
![[ ]](/icons/compressed.gif) | Final Report_19-063 (Ngoma, Rev Fr Eugene ) - Budget Files.zip | 2025-05-19 11:04 | 3.0M | |
![[IMG]](/icons/image2.gif) | 1436_IMG_2575.JPG | 2025-05-19 11:04 | 3.0M | |
![[IMG]](/icons/image2.gif) | 6550_IMG_20230428_170601.jpg | 2025-05-19 11:07 | 3.0M | |
![[IMG]](/icons/image2.gif) | 7000_JM4.jpg | 2025-05-19 11:06 | 3.0M | |
![[IMG]](/icons/image2.gif) | 4545_20180810_140359.jpg | 2025-05-19 11:05 | 3.0M | |
![[IMG]](/icons/image2.gif) | 2305_IMG_6067.JPG | 2025-05-19 11:04 | 3.0M | |
![[IMG]](/icons/image2.gif) | 6266__MG_1819.JPG | 2025-05-19 11:05 | 3.1M | |
![[IMG]](/icons/image2.gif) | 2121_DSC_0883.JPG | 2025-05-19 11:06 | 3.1M | |
![[IMG]](/icons/image2.gif) | 1412_IMG_8525.JPG | 2025-05-19 11:05 | 3.1M | |
![[IMG]](/icons/image2.gif) | 6266__MG_9662.JPG | 2025-05-19 11:05 | 3.1M | |
![[ ]](/icons/layout.gif) | 2324_Materials Receipts (1).pdf | 2025-05-19 11:05 | 3.1M | |
![[IMG]](/icons/image2.gif) | 1445_MCLC_6.JPG | 2025-05-19 11:04 | 3.1M | |
![[IMG]](/icons/image2.gif) | 2991_IMG_7278.JPG | 2025-05-19 11:04 | 3.1M | |
![[IMG]](/icons/image2.gif) | 2792_Ejioba Health Mistress.jpg | 2025-05-19 11:06 | 3.1M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_193658.jpg | 2025-05-19 11:03 | 3.1M | |
![[IMG]](/icons/image2.gif) | 2854_20181001_084203.jpg | 2025-05-19 11:05 | 3.1M | |
![[IMG]](/icons/image2.gif) | 1445_MCLC_1.JPG | 2025-05-19 11:03 | 3.1M | |
![[IMG]](/icons/image2.gif) | 2658_20180315_110327.jpg | 2025-05-19 11:04 | 3.1M | |
![[IMG]](/icons/image2.gif) | 3548_a news article about our activities.jpg | 2025-05-19 11:04 | 3.1M | |
![[IMG]](/icons/image2.gif) | 6550_IMG_20230428_165738.jpg | 2025-05-19 11:04 | 3.1M | |
![[IMG]](/icons/image2.gif) | 6266__MG_1854.JPG | 2025-05-19 11:03 | 3.1M | |
![[IMG]](/icons/image2.gif) | 2128_P6090156.JPG | 2025-05-19 11:03 | 3.1M | |
![[IMG]](/icons/image2.gif) | 6550_IMG_20230428_170426.jpg | 2025-05-19 11:03 | 3.1M | |
![[IMG]](/icons/image2.gif) | 6266__MG_9632.JPG | 2025-05-19 11:03 | 3.1M | |
![[IMG]](/icons/image2.gif) | 820_Belize-GLOW girls, speakers-Amanda Masse.JPG | 2025-05-19 11:03 | 3.1M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175143.jpg | 2025-05-19 11:04 | 3.1M | |
![[IMG]](/icons/image2.gif) | 5034_Completed Washroom 2.jpg | 2025-05-19 11:05 | 3.1M | |
![[ ]](/icons/compressed.gif) | Final Report_19-249 (Afi, Joel) - Budget Files.zip | 2025-05-19 11:03 | 3.1M | |
![[IMG]](/icons/image2.gif) | 2128_P6090139.JPG | 2025-05-19 11:04 | 3.1M | |
![[IMG]](/icons/image2.gif) | 7000_collective2.jpg | 2025-05-19 11:03 | 3.1M | |
![[IMG]](/icons/image2.gif) | 1265_IMG_3481.JPG | 2025-05-19 11:05 | 3.1M | |
![[IMG]](/icons/image2.gif) | 6550_IMG_20230428_165309.jpg | 2025-05-19 11:03 | 3.1M | |
![[IMG]](/icons/image2.gif) | 2342_IMG_0366.jpg | 2025-05-19 11:03 | 3.1M | |
![[IMG]](/icons/image2.gif) | 2128_P6090144.JPG | 2025-05-19 11:03 | 3.1M | |
![[IMG]](/icons/image2.gif) | 2121_DSC_0890.JPG | 2025-05-19 11:04 | 3.1M | |
![[ ]](/icons/layout.gif) | 3536_CAPDI_PROJECT PHOTOS.pdf | 2025-05-19 11:05 | 3.1M | |
![[IMG]](/icons/image2.gif) | 2589_Members of BARMDA and Bantay Dagat Boat Canvassing.JPG | 2025-05-19 11:03 | 3.1M | |
![[IMG]](/icons/image2.gif) | 2858_IMG_20180904_101542.jpg | 2025-05-19 11:06 | 3.1M | |
![[ ]](/icons/compressed.gif) | Final Report_19-044 (Choi, Jane) - Budget Files.zip | 2025-05-19 11:07 | 3.1M | |
![[IMG]](/icons/image2.gif) | 745_Hammock.JPG | 2025-05-19 11:05 | 3.1M | |
![[IMG]](/icons/image2.gif) | 1013_IMG_3818.JPG | 2025-05-19 11:05 | 3.1M | |
![[IMG]](/icons/image2.gif) | 6550_IMG_20230428_170528.jpg | 2025-05-19 11:03 | 3.1M | |
![[IMG]](/icons/image2.gif) | 7000_MC4.jpg | 2025-05-19 11:04 | 3.1M | |
![[IMG]](/icons/image2.gif) | 1445_MCLC_8.JPG | 2025-05-19 11:03 | 3.1M | |
![[IMG]](/icons/image2.gif) | 6429_IMG_9206.JPG | 2025-05-19 11:05 | 3.1M | |
![[IMG]](/icons/image2.gif) | 1265_DSC_1002.jpg | 2025-05-19 11:04 | 3.1M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1058.JPG | 2025-05-19 11:06 | 3.1M | |
![[IMG]](/icons/image2.gif) | 2305_IMG_6045.JPG | 2025-05-19 11:03 | 3.1M | |
![[ ]](/icons/compressed.gif) | Final Report_18-130 (Guelleu, Dopgima) - Budget Files.zip | 2025-05-19 11:03 | 3.1M | |
![[IMG]](/icons/image2.gif) | 1282_IMG_2634.jpg | 2025-05-19 11:06 | 3.1M | |
![[IMG]](/icons/image2.gif) | 2589_guardhouse blessing 15.JPG | 2025-05-19 11:04 | 3.1M | |
![[ ]](/icons/compressed.gif) | Final Report_20-082 (Kamzungu, Coaster) - Budget Files.zip | 2025-05-19 11:05 | 3.1M | |
![[IMG]](/icons/image2.gif) | 6429_IMG_8596.JPG | 2025-05-19 11:03 | 3.1M | |
![[IMG]](/icons/image2.gif) | 6429_IMG_9195.JPG | 2025-05-19 11:04 | 3.1M | |
![[IMG]](/icons/image2.gif) | 2305_IMG_6049.JPG | 2025-05-19 11:04 | 3.1M | |
![[IMG]](/icons/image2.gif) | 2792_006.jpg | 2025-05-19 11:05 | 3.1M | |
![[IMG]](/icons/image2.gif) | 3149_IMG_1098.JPG | 2025-05-19 11:07 | 3.1M | |
![[IMG]](/icons/image2.gif) | 1242_IMG_4254.JPG | 2025-05-19 11:06 | 3.2M | |
![[IMG]](/icons/image2.gif) | 1015_DSCN1570.jpg | 2025-05-19 11:03 | 3.2M | |
![[IMG]](/icons/image2.gif) | 2792_IMG_20191115_085301_1.jpg | 2025-05-19 11:05 | 3.2M | |
![[IMG]](/icons/image2.gif) | 1447_Computer lab 1.jpg | 2025-05-19 11:05 | 3.2M | |
![[IMG]](/icons/image2.gif) | 7000_SV2.jpg | 2025-05-19 11:03 | 3.2M | |
![[IMG]](/icons/image2.gif) | 745_Side view.JPG | 2025-05-19 11:05 | 3.2M | |
![[IMG]](/icons/image2.gif) | 2658_20180519_114537.jpg | 2025-05-19 11:04 | 3.2M | |
![[IMG]](/icons/image2.gif) | 6829_IMG_20240417_134625_890.jpg | 2025-05-19 11:06 | 3.2M | |
![[IMG]](/icons/image2.gif) | 2128_P6090145.JPG | 2025-05-19 11:05 | 3.2M | |
![[IMG]](/icons/image2.gif) | 5660_20220726_174339.jpg | 2025-05-19 11:06 | 3.2M | |
![[IMG]](/icons/image2.gif) | 1693_DSCN1082.JPG | 2025-05-19 11:05 | 3.2M | |
![[IMG]](/icons/image2.gif) | 1282_IMG_2403.jpg | 2025-05-19 11:05 | 3.2M | |
![[IMG]](/icons/image2.gif) | 7102_IMG_6413.jpg | 2025-05-19 11:03 | 3.2M | |
![[IMG]](/icons/image2.gif) | 1242_IMG_4213.JPG | 2025-05-19 11:05 | 3.2M | |
![[IMG]](/icons/image2.gif) | 2792_MCI.jpg | 2025-05-19 11:04 | 3.2M | |
![[IMG]](/icons/image2.gif) | 2342_IMG_0361.jpg | 2025-05-19 11:05 | 3.2M | |
![[IMG]](/icons/image2.gif) | 2854_20180828_134222.jpg | 2025-05-19 11:03 | 3.2M | |
![[IMG]](/icons/image2.gif) | 7000_Collective3.jpg | 2025-05-19 11:05 | 3.2M | |
![[ ]](/icons/layout.gif) | 2324_Dec 2017-Jan 2018 health talk attendance lists (birth plan and health structure delivery).pdf | 2025-05-19 11:05 | 3.2M | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-10.jpg | 2025-05-19 11:03 | 3.2M | |
![[IMG]](/icons/image2.gif) | 2792_004.jpg | 2025-05-19 11:03 | 3.2M | |
![[IMG]](/icons/image2.gif) | 6303_IMG_20221227_161943_994.jpg | 2025-05-19 11:04 | 3.2M | |
![[IMG]](/icons/image2.gif) | 4756_WORLD CONNECT X GiST-18.jpg | 2025-05-19 11:04 | 3.2M | |
![[IMG]](/icons/image2.gif) | 2640_Permet World Connect 2.jpg | 2025-05-19 11:05 | 3.2M | |
![[IMG]](/icons/image2.gif) | 6266__MG_9636.JPG | 2025-05-19 11:03 | 3.2M | |
![[IMG]](/icons/image2.gif) | 6550_IMG_20230428_171306.jpg | 2025-05-19 11:05 | 3.2M | |
![[IMG]](/icons/image2.gif) | 2589_Maam Mary Jane (orange).JPG | 2025-05-19 11:05 | 3.2M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1055.JPG | 2025-05-19 11:05 | 3.2M | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting literacy projects presentation 2017 (2).jpg | 2025-05-19 11:06 | 3.2M | |
![[ ]](/icons/compressed.gif) | Mosquito OVITrap Project-final_report-files.zip | 2025-05-19 11:03 | 3.2M | |
![[ ]](/icons/compressed.gif) | Final Report_21-167 (Kaponda, Francis) - Files.zip | 2025-05-19 11:03 | 3.2M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (24).jpg | 2025-05-19 11:07 | 3.2M | |
![[IMG]](/icons/image2.gif) | 821_Belize-Thank You-Jason.JPG | 2025-05-19 11:06 | 3.2M | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-17.jpg | 2025-05-19 11:03 | 3.2M | |
![[IMG]](/icons/image2.gif) | 6787_IMG_20231129_122529_419.jpg | 2025-05-19 11:05 | 3.2M | |
![[IMG]](/icons/image2.gif) | 1363_20170220_101120.jpg | 2025-05-19 11:05 | 3.2M | |
![[IMG]](/icons/image2.gif) | 7000_NB1.jpg | 2025-05-19 11:06 | 3.2M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (25).jpg | 2025-05-19 11:04 | 3.2M | |
![[IMG]](/icons/image2.gif) | 2589_Local Fisherman.JPG | 2025-05-19 11:03 | 3.2M | |
![[IMG]](/icons/image2.gif) | 6429_girl students at Panykworo beneficiaries of the project.jpg | 2025-05-19 11:04 | 3.2M | |
![[IMG]](/icons/image2.gif) | 467_SAM_0743.JPG | 2025-05-19 11:05 | 3.2M | |
![[IMG]](/icons/image2.gif) | 2991_IMG_7233.JPG | 2025-05-19 11:04 | 3.2M | |
![[IMG]](/icons/image2.gif) | 5034_Completed Washroom5.jpg | 2025-05-19 11:07 | 3.2M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190305_175045.jpg | 2025-05-19 11:05 | 3.2M | |
![[ ]](/icons/compressed.gif) | Final Report_19-080 (Kondowe, Ulala) - Budget Files.zip | 2025-05-19 11:04 | 3.2M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1038.JPG | 2025-05-19 11:07 | 3.2M | |
![[IMG]](/icons/image2.gif) | 3035_IMG_4468.JPG | 2025-05-19 11:03 | 3.2M | |
![[IMG]](/icons/image2.gif) | 6141_20221007_124029.jpg | 2025-05-19 11:03 | 3.2M | |
![[IMG]](/icons/image2.gif) | 3193_Nafie Dandauleni.jpg | 2025-05-19 11:05 | 3.2M | |
![[IMG]](/icons/image2.gif) | 2799_IMG_20180820_114633.jpg | 2025-05-19 11:05 | 3.2M | |
![[IMG]](/icons/image2.gif) | 6829_20240306_133558.jpg | 2025-05-19 11:04 | 3.2M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (41).jpg | 2025-05-19 11:04 | 3.2M | |
![[IMG]](/icons/image2.gif) | 1021_DSC_0107.JPG | 2025-05-19 11:05 | 3.2M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190306_161205.jpg | 2025-05-19 11:06 | 3.2M | |
![[IMG]](/icons/image2.gif) | 6980_Gutera ibihumyo.jpg | 2025-05-19 11:05 | 3.3M | |
![[IMG]](/icons/image2.gif) | 2858_IMG_20180904_150702.jpg | 2025-05-19 11:05 | 3.3M | |
![[ ]](/icons/layout.gif) | 2182_Moonde RHC SMAG training.pdf | 2025-05-19 11:03 | 3.3M | |
![[IMG]](/icons/image2.gif) | 2836_IMG_20180817_085854.jpg | 2025-05-19 11:06 | 3.3M | |
![[IMG]](/icons/image2.gif) | 1445_MCLC_13.JPG | 2025-05-19 11:04 | 3.3M | |
![[IMG]](/icons/image2.gif) | 2792_IMG_20191115_082533_6.jpg | 2025-05-19 11:04 | 3.3M | |
![[IMG]](/icons/image2.gif) | 3025_IMG_20190225_113540.jpg | 2025-05-19 11:04 | 3.3M | |
![[IMG]](/icons/image2.gif) | 6266__MG_9585.JPG | 2025-05-19 11:05 | 3.3M | |
![[IMG]](/icons/image2.gif) | 2121_DSC_0780.JPG | 2025-05-19 11:05 | 3.3M | |
![[IMG]](/icons/image2.gif) | 6671_IMG_0212.jpg | 2025-05-19 11:03 | 3.3M | |
![[IMG]](/icons/image2.gif) | 5660_20220923_130243.jpg | 2025-05-19 11:05 | 3.3M | |
![[IMG]](/icons/image2.gif) | 2640_Permet World Connect 3.jpg | 2025-05-19 11:05 | 3.3M | |
![[ ]](/icons/layout.gif) | 3772_Safe and Clean Water Project file-CCDO.pdf | 2025-05-19 11:05 | 3.3M | |
![[IMG]](/icons/image2.gif) | 6713_Chibanja school 1.jpg | 2025-05-19 11:03 | 3.3M | |
![[IMG]](/icons/image2.gif) | 6829_IMG20231226173455.jpg | 2025-05-19 11:03 | 3.3M | |
![[IMG]](/icons/image2.gif) | 745_Meditation and yoga platform.JPG | 2025-05-19 11:05 | 3.3M | |
![[IMG]](/icons/image2.gif) | 2589_guardhouse blessing 8.JPG | 2025-05-19 11:03 | 3.3M | |
![[IMG]](/icons/image2.gif) | 4756_WORLD CONNECT X GiST-43.jpg | 2025-05-19 11:07 | 3.3M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3916.JPG | 2025-05-19 11:04 | 3.3M | |
![[IMG]](/icons/image2.gif) | 1265_IMG_3482.JPG | 2025-05-19 11:06 | 3.3M | |
![[IMG]](/icons/image2.gif) | 3745_IMG_20200513_133219.jpg | 2025-05-19 11:04 | 3.3M | |
![[IMG]](/icons/image2.gif) | 6625_WORLD CONNECT LOG.jpg | 2025-05-19 11:06 | 3.3M | |
![[IMG]](/icons/image2.gif) | 1445_MCLC_9.JPG | 2025-05-19 11:04 | 3.3M | |
![[IMG]](/icons/image2.gif) | 1277_P9020030.JPG | 2025-05-19 11:03 | 3.3M | |
![[IMG]](/icons/image2.gif) | 1445_MCLC_3.JPG | 2025-05-19 11:04 | 3.3M | |
![[IMG]](/icons/image2.gif) | 467_SAM_0742.JPG | 2025-05-19 11:05 | 3.3M | |
![[IMG]](/icons/image2.gif) | 7000_Collective.jpg | 2025-05-19 11:04 | 3.3M | |
![[IMG]](/icons/image2.gif) | 1430_IMG_20170608_111730268_HDR.jpg | 2025-05-19 11:05 | 3.3M | |
![[IMG]](/icons/image2.gif) | 2589_DSC_0486.JPG | 2025-05-19 11:07 | 3.3M | |
![[IMG]](/icons/image2.gif) | 6550_IMG_20230428_170008.jpg | 2025-05-19 11:05 | 3.3M | |
![[IMG]](/icons/image2.gif) | 3025_IMG_20190225_113535.jpg | 2025-05-19 11:04 | 3.3M | |
![[IMG]](/icons/image2.gif) | 1282_IMG_2283.jpg | 2025-05-19 11:05 | 3.3M | |
![[IMG]](/icons/image2.gif) | 6292_IMG_20230109_101620_161.jpg | 2025-05-19 11:05 | 3.3M | |
![[IMG]](/icons/image2.gif) | 2993_20190227_095647.jpg | 2025-05-19 11:03 | 3.3M | |
![[IMG]](/icons/image2.gif) | 2589_guardhouse blessing 16.JPG | 2025-05-19 11:03 | 3.3M | |
![[IMG]](/icons/image2.gif) | 645_IMG_4378.JPG | 2025-05-19 11:05 | 3.3M | |
![[IMG]](/icons/image2.gif) | 6288_688A8853.JPG | 2025-05-19 11:04 | 3.3M | |
![[IMG]](/icons/image2.gif) | 821_Belize-Zac, David-Molly.jpg | 2025-05-19 11:05 | 3.3M | |
![[IMG]](/icons/image2.gif) | 2589_Guardhouse Construction.JPG | 2025-05-19 11:05 | 3.3M | |
![[IMG]](/icons/image2.gif) | 2607_IMG_9847.JPG | 2025-05-19 11:05 | 3.3M | |
![[IMG]](/icons/image2.gif) | 2514_IMG_0599.JPG | 2025-05-19 11:05 | 3.3M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (40).jpg | 2025-05-19 11:04 | 3.3M | |
![[IMG]](/icons/image2.gif) | 1445_MCLC_7.JPG | 2025-05-19 11:05 | 3.3M | |
![[IMG]](/icons/image2.gif) | 2589_BD Participants.JPG | 2025-05-19 11:04 | 3.3M | |
![[IMG]](/icons/image2.gif) | 1020_IMG_2497.jpg | 2025-05-19 11:03 | 3.3M | |
![[IMG]](/icons/image2.gif) | 4756_GiST Items Offload-37.jpg | 2025-05-19 11:05 | 3.3M | |
![[IMG]](/icons/image2.gif) | 5660_20220727_121548.jpg | 2025-05-19 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 1021_DSC_0346.JPG | 2025-05-19 11:03 | 3.4M | |
![[IMG]](/icons/image2.gif) | 1242_IMG_4220.JPG | 2025-05-19 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 7057_IMG_5928.JPG | 2025-05-19 11:03 | 3.4M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20200130_151809.jpg | 2025-05-19 11:05 | 3.4M | |
![[ ]](/icons/compressed.gif) | Lights Brighten Paradise-final_report-files.zip | 2025-05-19 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 714_IMG_4846.JPG | 2025-05-19 11:07 | 3.4M | |
![[IMG]](/icons/image2.gif) | 3745_IMG_20200513_141958.jpg | 2025-05-19 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1357.jpg | 2025-05-19 11:03 | 3.4M | |
![[IMG]](/icons/image2.gif) | 745_Center.JPG | 2025-05-19 11:03 | 3.4M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1346.jpg | 2025-05-19 11:06 | 3.4M | |
![[IMG]](/icons/image2.gif) | 6429_IMG_8529.JPG | 2025-05-19 11:03 | 3.4M | |
![[IMG]](/icons/image2.gif) | 7000_MC1.jpg | 2025-05-19 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 1445_MCLC_2.JPG | 2025-05-19 11:04 | 3.4M | |
![[IMG]](/icons/image2.gif) | 1445_MCLC_14.JPG | 2025-05-19 11:03 | 3.4M | |
![[IMG]](/icons/image2.gif) | 2792_Imafon Women Cooperative.jpg | 2025-05-19 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 820_Belize- GLOW girls and counselors exercising- Amanda Masse.JPG | 2025-05-19 11:06 | 3.4M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3894.JPG | 2025-05-19 11:04 | 3.4M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1149.jpg | 2025-05-19 11:07 | 3.4M | |
![[IMG]](/icons/image2.gif) | 1445_MCLC_15.JPG | 2025-05-19 11:04 | 3.4M | |
![[IMG]](/icons/image2.gif) | 592_AB English 4 authors with Holly 2 March 2016.jpg | 2025-05-19 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 592_AB English 4 with Holly 2 March 2016.jpg | 2025-05-19 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1358.jpg | 2025-05-19 11:03 | 3.4M | |
![[IMG]](/icons/image2.gif) | 2352_IMG_20180106_135922.jpg | 2025-05-19 11:06 | 3.4M | |
![[ ]](/icons/layout.gif) | 6273_Delivery Form used.pdf | 2025-05-19 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3949.JPG | 2025-05-19 11:07 | 3.4M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1150.JPG | 2025-05-19 11:07 | 3.4M | |
![[ ]](/icons/compressed.gif) | Final Report_18-184 (Nasasara, Benson) - Budget Files.zip | 2025-05-19 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 5401_sewing.jpg | 2025-05-19 11:07 | 3.4M | |
![[IMG]](/icons/image2.gif) | 6429_IMG_9182.JPG | 2025-05-19 11:04 | 3.4M | |
![[IMG]](/icons/image2.gif) | 2352_IMG_20180106_140219.jpg | 2025-05-19 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_174247.jpg | 2025-05-19 11:03 | 3.4M | |
![[IMG]](/icons/image2.gif) | 2658_20180327_131316.jpg | 2025-05-19 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 745_Healing plants.JPG | 2025-05-19 11:03 | 3.4M | |
![[IMG]](/icons/image2.gif) | 2121_DSC_0748.JPG | 2025-05-19 11:03 | 3.4M | |
![[IMG]](/icons/image2.gif) | 3548_final product. organic fertilizer.jpg | 2025-05-19 11:03 | 3.4M | |
![[IMG]](/icons/image2.gif) | 6266__MG_9927.JPG | 2025-05-19 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 5660_20220720_174422.jpg | 2025-05-19 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 6266__MG_1814.JPG | 2025-05-19 11:06 | 3.4M | |
![[IMG]](/icons/image2.gif) | 2570_student leaders.JPG | 2025-05-19 11:07 | 3.4M | |
![[IMG]](/icons/image2.gif) | 467_SAM_0748.JPG | 2025-05-19 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 2858_IMG_20180904_152637.jpg | 2025-05-19 11:04 | 3.4M | |
![[IMG]](/icons/image2.gif) | 2799_IMG_20180820_114638.jpg | 2025-05-19 11:06 | 3.4M | |
![[ ]](/icons/layout.gif) | 2324_November 2017 health talk attendance lists (signs of danger during pregnancy).pdf | 2025-05-19 11:04 | 3.4M | |
![[IMG]](/icons/image2.gif) | 2991_IMG_7283.JPG | 2025-05-19 11:04 | 3.4M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3891.JPG | 2025-05-19 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 2121_DSC_0776.JPG | 2025-05-19 11:04 | 3.4M | |
![[IMG]](/icons/image2.gif) | 5034_Completed Washroom.jpg | 2025-05-19 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 1445_MCLC_4.JPG | 2025-05-19 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 6787_IMG_20231205_124532_375.jpg | 2025-05-19 11:07 | 3.4M | |
![[IMG]](/icons/image2.gif) | 2342_IMG_0347.jpg | 2025-05-19 11:03 | 3.4M | |
![[IMG]](/icons/image2.gif) | 2570_P3200122.JPG | 2025-05-19 11:03 | 3.4M | |
![[IMG]](/icons/image2.gif) | 2570_introductions.JPG | 2025-05-19 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 7102_IMG_6425.jpg | 2025-05-19 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 6787_IMG_20231129_122554_362.jpg | 2025-05-19 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 745_Nipa table.JPG | 2025-05-19 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 6303_IMG_20230328_140245_862.jpg | 2025-05-19 11:04 | 3.4M | |
![[IMG]](/icons/image2.gif) | 3193_IMG_20190920_133708_7.jpg | 2025-05-19 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 1277_P9030078.JPG | 2025-05-19 11:03 | 3.5M | |
![[IMG]](/icons/image2.gif) | 782_IMG_1955.JPG | 2025-05-19 11:04 | 3.5M | |
![[IMG]](/icons/image2.gif) | 1693_DSCN1036.JPG | 2025-05-19 11:04 | 3.5M | |
![[IMG]](/icons/image2.gif) | 467_SAM_0752.JPG | 2025-05-19 11:05 | 3.5M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1154.JPG | 2025-05-19 11:05 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2854_20181002_090128.jpg | 2025-05-19 11:05 | 3.5M | |
![[IMG]](/icons/image2.gif) | 1013_IMG_3815.JPG | 2025-05-19 11:04 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2570_P3210315.JPG | 2025-05-19 11:06 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2570_P3210477.JPG | 2025-05-19 11:05 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2925_DSCN0001.JPG | 2025-05-19 11:03 | 3.5M | |
![[IMG]](/icons/image2.gif) | 5660_20220707_151902.jpg | 2025-05-19 11:06 | 3.5M | |
![[IMG]](/icons/image2.gif) | 1445_MCLC_10.JPG | 2025-05-19 11:05 | 3.5M | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-13.jpg | 2025-05-19 11:04 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2589_MSO FGD 3.JPG | 2025-05-19 11:04 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_191150.jpg | 2025-05-19 11:06 | 3.5M | |
![[IMG]](/icons/image2.gif) | 6550_IMG_20230428_170852.jpg | 2025-05-19 11:04 | 3.5M | |
![[IMG]](/icons/image2.gif) | 467_SAM_0747.JPG | 2025-05-19 11:03 | 3.5M | |
![[IMG]](/icons/image2.gif) | 6787_IMG_20190912_141025_1.jpg | 2025-05-19 11:05 | 3.5M | |
![[IMG]](/icons/image2.gif) | 1265_DSC_1008.JPG | 2025-05-19 11:04 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2589_P8250118.JPG | 2025-05-19 11:03 | 3.5M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1019.JPG | 2025-05-19 11:04 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2854_20180808_141104.jpg | 2025-05-19 11:06 | 3.5M | |
![[IMG]](/icons/image2.gif) | 1447_p1.jpg | 2025-05-19 11:07 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2115_Planting Banana.jpg | 2025-05-19 11:03 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2121_DSC_0758.JPG | 2025-05-19 11:06 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2472_pic three.JPG | 2025-05-19 11:03 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2589_Fish Game 1.JPG | 2025-05-19 11:03 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2570_P3220655.JPG | 2025-05-19 11:05 | 3.5M | |
![[IMG]](/icons/image2.gif) | 1436_GOPR2166.JPG | 2025-05-19 11:04 | 3.5M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190226_090949.jpg | 2025-05-19 11:05 | 3.5M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190307_162049.jpg | 2025-05-19 11:04 | 3.5M | |
![[IMG]](/icons/image2.gif) | 3058_08.jpg | 2025-05-19 11:04 | 3.5M | |
![[IMG]](/icons/image2.gif) | 3058_IMG_20190517_084046_5.jpg | 2025-05-19 11:03 | 3.5M | |
![[ ]](/icons/layout.gif) | 3774_2020 COMMUNITY CONTRIBUTION LUSO LANGA.pdf | 2025-05-19 11:05 | 3.5M | |
![[IMG]](/icons/image2.gif) | 6113_IMG_20230213_150556.jpg | 2025-05-19 11:03 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2570_P3210355.JPG | 2025-05-19 11:04 | 3.5M | |
![[IMG]](/icons/image2.gif) | 3035_IMG_4439.JPG | 2025-05-19 11:07 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2570_P3210457.JPG | 2025-05-19 11:04 | 3.5M | |
![[IMG]](/icons/image2.gif) | 3933_20191023_141521.jpg | 2025-05-19 11:04 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2589_P5081694.JPG | 2025-05-19 11:03 | 3.5M | |
![[IMG]](/icons/image2.gif) | 6797_IMG_20240828_005836.jpg | 2025-05-19 11:06 | 3.5M | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting teacher Fanny.jpg | 2025-05-19 11:06 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2589_BD Team Photo.JPG | 2025-05-19 11:04 | 3.5M | |
![[IMG]](/icons/image2.gif) | 1412_IMG_8591.JPG | 2025-05-19 11:04 | 3.5M | |
![[IMG]](/icons/image2.gif) | 1693_Tere.jpg | 2025-05-19 11:05 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2570_Yume being honored by students.JPG | 2025-05-19 11:03 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2570_P3210518.JPG | 2025-05-19 11:07 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2589_Apprehension1.JPG | 2025-05-19 11:03 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2570_P3210360.JPG | 2025-05-19 11:03 | 3.5M | |
![[IMG]](/icons/image2.gif) | 3137_On Sunday coming from the Church.jpg | 2025-05-19 11:04 | 3.5M | |
![[IMG]](/icons/image2.gif) | 3039_end_of_desiging_training_programme.jpg | 2025-05-19 11:03 | 3.5M | |
![[IMG]](/icons/image2.gif) | 982_image.png | 2025-05-19 11:06 | 3.5M | |
![[ ]](/icons/compressed.gif) | Belel Kelle School Health Mural-final_report-files.zip | 2025-05-19 11:04 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2589_P5081690.JPG | 2025-05-19 11:04 | 3.5M | |
![[IMG]](/icons/image2.gif) | 467_SAM_0750.JPG | 2025-05-19 11:03 | 3.5M | |
![[IMG]](/icons/image2.gif) | 3933_20191119_125451.jpg | 2025-05-19 11:03 | 3.5M | |
![[IMG]](/icons/image2.gif) | 6429_IMG_9190.JPG | 2025-05-19 11:07 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2589_P8250101.JPG | 2025-05-19 11:03 | 3.5M | |
![[IMG]](/icons/image2.gif) | 5648_DSC_4743.JPG | 2025-05-19 11:04 | 3.5M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20230127_125724.jpg | 2025-05-19 11:04 | 3.5M | |
![[IMG]](/icons/image2.gif) | 1038_IMG_4474.JPG | 2025-05-19 11:07 | 3.5M | |
![[IMG]](/icons/image2.gif) | 5660_20220705_110932.jpg | 2025-05-19 11:03 | 3.5M | |
![[IMG]](/icons/image2.gif) | 6713_Chibanja Primary 9.jpg | 2025-05-19 11:06 | 3.5M | |
![[IMG]](/icons/image2.gif) | 6797_IMG_20240822_190747.jpg | 2025-05-19 11:05 | 3.5M | |
![[ ]](/icons/compressed.gif) | Final Report_21-012 (Harawa, Mwelura) - Budget Files.zip | 2025-05-19 11:06 | 3.5M | |
![[IMG]](/icons/image2.gif) | 2570_P3210540.JPG | 2025-05-19 11:05 | 3.5M | |
![[IMG]](/icons/image2.gif) | 6829_IMG_20240102_150631_HDR.jpg | 2025-05-19 11:03 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2570_P3210340.JPG | 2025-05-19 11:06 | 3.6M | |
![[IMG]](/icons/image2.gif) | 6291_IMG_6621.JPG | 2025-05-19 11:04 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2792_Rural sales agents.jpg | 2025-05-19 11:04 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2589_guardhouse blessing 18.JPG | 2025-05-19 11:05 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2570_P3200090.JPG | 2025-05-19 11:05 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2352_IMG_20170821_071709.jpg | 2025-05-19 11:03 | 3.6M | |
![[ ]](/icons/compressed.gif) | Final Report_17-063 (Romano, Evalynn Fae) - Files.zip | 2025-05-19 11:05 | 3.6M | |
![[IMG]](/icons/image2.gif) | 5660_20220706_155241.jpg | 2025-05-19 11:07 | 3.6M | |
![[IMG]](/icons/image2.gif) | 467_SAM_0746.JPG | 2025-05-19 11:03 | 3.6M | |
![[IMG]](/icons/image2.gif) | 1042_IMG_0020.JPG | 2025-05-19 11:07 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2589_guardhouse blessing 19.JPG | 2025-05-19 11:04 | 3.6M | |
![[IMG]](/icons/image2.gif) | 3774_solar and incubation training.JPG | 2025-05-19 11:05 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2589_Tabugon MSO Participants.JPG | 2025-05-19 11:05 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2792_Methodist High School Idanre.jpg | 2025-05-19 11:05 | 3.6M | |
![[IMG]](/icons/image2.gif) | 1021_DSC_0108.JPG | 2025-05-19 11:05 | 3.6M | |
![[IMG]](/icons/image2.gif) | 1447_p5.jpg | 2025-05-19 11:05 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2658_20180327_131309.jpg | 2025-05-19 11:03 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2570_P3220756.JPG | 2025-05-19 11:03 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2589_guardhouse blessing 7.JPG | 2025-05-19 11:05 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2570_P3210627.JPG | 2025-05-19 11:03 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3890.JPG | 2025-05-19 11:04 | 3.6M | |
![[IMG]](/icons/image2.gif) | 6266__MG_9784.JPG | 2025-05-19 11:04 | 3.6M | |
![[IMG]](/icons/image2.gif) | 467_SAM_0745.JPG | 2025-05-19 11:04 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2570_P3220675.JPG | 2025-05-19 11:04 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2570_P3200167.JPG | 2025-05-19 11:04 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2570_P3220689.JPG | 2025-05-19 11:03 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2570_P3200159.JPG | 2025-05-19 11:05 | 3.6M | |
![[IMG]](/icons/image2.gif) | 6713_Chibanja Primary 8.jpg | 2025-05-19 11:04 | 3.6M | |
![[IMG]](/icons/image2.gif) | 1447_p2.jpg | 2025-05-19 11:07 | 3.6M | |
![[IMG]](/icons/image2.gif) | 467_SAM_0749.JPG | 2025-05-19 11:05 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2570_ToT (2).JPG | 2025-05-19 11:04 | 3.6M | |
![[IMG]](/icons/image2.gif) | 467_SAM_0753.JPG | 2025-05-19 11:04 | 3.6M | |
![[IMG]](/icons/image2.gif) | 467_SAM_0744.JPG | 2025-05-19 11:05 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2589_guardhouse blessing 3.JPG | 2025-05-19 11:03 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2570_P3210311.JPG | 2025-05-19 11:04 | 3.6M | |
![[IMG]](/icons/image2.gif) | 714_IMG_4848.JPG | 2025-05-19 11:03 | 3.6M | |
![[IMG]](/icons/image2.gif) | 1447_p7.jpg | 2025-05-19 11:03 | 3.6M | |
![[IMG]](/icons/image2.gif) | 714_IMG_4845.JPG | 2025-05-19 11:05 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2589_P8250114.JPG | 2025-05-19 11:04 | 3.6M | |
![[IMG]](/icons/image2.gif) | 467_SAM_0758.JPG | 2025-05-19 11:04 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2570_P3220695.JPG | 2025-05-19 11:03 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2570_P3210263.JPG | 2025-05-19 11:04 | 3.6M | |
![[IMG]](/icons/image2.gif) | 1436_GOPR2365.JPG | 2025-05-19 11:03 | 3.6M | |
![[IMG]](/icons/image2.gif) | 6829_20240306_133543 (1).jpg | 2025-05-19 11:07 | 3.6M | |
![[IMG]](/icons/image2.gif) | 467_SAM_0741.JPG | 2025-05-19 11:05 | 3.6M | |
![[IMG]](/icons/image2.gif) | 6266__MG_1836.JPG | 2025-05-19 11:04 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2589_P6280975.JPG | 2025-05-19 11:05 | 3.6M | |
![[ ]](/icons/compressed.gif) | Jardines Juntas-final_report-files.zip | 2025-05-19 11:05 | 3.6M | |
![[IMG]](/icons/image2.gif) | 6109_20230803_171535.jpg | 2025-05-19 11:03 | 3.6M | |
![[IMG]](/icons/image2.gif) | 714_IMG_4864.JPG | 2025-05-19 11:04 | 3.6M | |
![[IMG]](/icons/image2.gif) | 5034_Completed Washroom4.jpg | 2025-05-19 11:05 | 3.6M | |
![[IMG]](/icons/image2.gif) | 467_SAM_0407.JPG | 2025-05-19 11:05 | 3.6M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_1412.jpg | 2025-05-19 11:05 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2925_DSCN0008.JPG | 2025-05-19 11:05 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2570_P3250766.JPG | 2025-05-19 11:07 | 3.6M | |
![[IMG]](/icons/image2.gif) | 467_SAM_0740.JPG | 2025-05-19 11:05 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2570_P3220648.JPG | 2025-05-19 11:06 | 3.6M | |
![[IMG]](/icons/image2.gif) | 1013_IMG_3814.JPG | 2025-05-19 11:04 | 3.6M | |
![[IMG]](/icons/image2.gif) | 1430_IMG_20170608_112004368.jpg | 2025-05-19 11:04 | 3.6M | |
![[IMG]](/icons/image2.gif) | 467_SAM_0797.JPG | 2025-05-19 11:05 | 3.6M | |
![[IMG]](/icons/image2.gif) | 3548_demonstration plot maize field.jpg | 2025-05-19 11:05 | 3.6M | |
![[IMG]](/icons/image2.gif) | 4756_GiST Items Offload-1.jpg | 2025-05-19 11:03 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2673_IMG_20190122_163016_1.jpg | 2025-05-19 11:03 | 3.6M | |
![[IMG]](/icons/image2.gif) | 3025_IMG_20190225_113531_BURST1.jpg | 2025-05-19 11:04 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2329_IMG_20180310_094742.jpg | 2025-05-19 11:04 | 3.6M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1066.JPG | 2025-05-19 11:03 | 3.6M | |
![[IMG]](/icons/image2.gif) | 2836_IMG_20180718_143554.jpg | 2025-05-19 11:06 | 3.6M | |
![[IMG]](/icons/image2.gif) | 745_Stepping stones.JPG | 2025-05-19 11:04 | 3.7M | |
![[IMG]](/icons/image2.gif) | 1447_p4.jpg | 2025-05-19 11:04 | 3.7M | |
![[IMG]](/icons/image2.gif) | 467_SAM_0757.JPG | 2025-05-19 11:04 | 3.7M | |
![[IMG]](/icons/image2.gif) | 1277_P9030062.JPG | 2025-05-19 11:03 | 3.7M | |
![[IMG]](/icons/image2.gif) | 6829_IMG_2088.jpeg | 2025-05-19 11:05 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2570_ToT.JPG | 2025-05-19 11:03 | 3.7M | |
![[IMG]](/icons/image2.gif) | 1436_IMG_2619.JPG | 2025-05-19 11:03 | 3.7M | |
![[IMG]](/icons/image2.gif) | 5660_20220720_171533.jpg | 2025-05-19 11:05 | 3.7M | |
![[IMG]](/icons/image2.gif) | 816_IMG_9505.JPG | 2025-05-19 11:05 | 3.7M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1024.JPG | 2025-05-19 11:05 | 3.7M | |
![[IMG]](/icons/image2.gif) | 6625_A REPLACED WATER TANK.jpg | 2025-05-19 11:05 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2794_Training Session - practicalising tomato pulp to puree production.JPG | 2025-05-19 11:05 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2589_BD Training1.JPG | 2025-05-19 11:04 | 3.7M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190305_175028.jpg | 2025-05-19 11:05 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2570_P3210592.JPG | 2025-05-19 11:06 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2589_guardhouse blessing 13.JPG | 2025-05-19 11:03 | 3.7M | |
![[IMG]](/icons/image2.gif) | 1277_P9020025.JPG | 2025-05-19 11:05 | 3.7M | |
![[IMG]](/icons/image2.gif) | 6109_20230622_174413.jpg | 2025-05-19 11:03 | 3.7M | |
![[IMG]](/icons/image2.gif) | 5034_Agyekum.jpg | 2025-05-19 11:07 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2570_P3200163.JPG | 2025-05-19 11:05 | 3.7M | |
![[IMG]](/icons/image2.gif) | 6141_20221007_121440.jpg | 2025-05-19 11:04 | 3.7M | |
![[IMG]](/icons/image2.gif) | 3552_IMG20200304133713.jpg | 2025-05-19 11:05 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2589_MSO Group Photo (LM Marcelo on left).JPG | 2025-05-19 11:06 | 3.7M | |
![[IMG]](/icons/image2.gif) | 1277_P9030066.JPG | 2025-05-19 11:06 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2570_P3200179.JPG | 2025-05-19 11:04 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2570_Nelly Mistio sharing her story.JPG | 2025-05-19 11:03 | 3.7M | |
![[IMG]](/icons/image2.gif) | 5571_IMG_20211005_174453_598.jpg | 2025-05-19 11:05 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2570_student leader leading.JPG | 2025-05-19 11:06 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2570_P3200164.JPG | 2025-05-19 11:06 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2589_MSO 3 Participants.JPG | 2025-05-19 11:05 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_162838.jpg | 2025-05-19 11:05 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2589_P5061112.JPG | 2025-05-19 11:03 | 3.7M | |
![[IMG]](/icons/image2.gif) | 467_SAM_0754.JPG | 2025-05-19 11:05 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2589_P5061113.JPG | 2025-05-19 11:04 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2589_DSC_0485.JPG | 2025-05-19 11:04 | 3.7M | |
![[IMG]](/icons/image2.gif) | 1277_P9020034.JPG | 2025-05-19 11:04 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2570_P3210238.JPG | 2025-05-19 11:03 | 3.7M | |
![[IMG]](/icons/image2.gif) | 1436_GOPR2387.JPG | 2025-05-19 11:05 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2925_DSCN0022.JPG | 2025-05-19 11:05 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2570_P3200215.JPG | 2025-05-19 11:05 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2589_P8250148.JPG | 2025-05-19 11:05 | 3.7M | |
![[IMG]](/icons/image2.gif) | 1021_DSC_0085.JPG | 2025-05-19 11:03 | 3.7M | |
![[IMG]](/icons/image2.gif) | 6292_IMG_20230109_105434_822.jpg | 2025-05-19 11:04 | 3.7M | |
![[IMG]](/icons/image2.gif) | 1242_IMG_4227.JPG | 2025-05-19 11:07 | 3.7M | |
![[IMG]](/icons/image2.gif) | 1277_P9030056.JPG | 2025-05-19 11:03 | 3.7M | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting literacy project teacher training.jpg | 2025-05-19 11:03 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2792_09.jpg | 2025-05-19 11:04 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2570_P3210301.JPG | 2025-05-19 11:05 | 3.7M | |
![[IMG]](/icons/image2.gif) | 3180_Initial training on Moringa Production.jpg | 2025-05-19 11:05 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2570_P3210240.JPG | 2025-05-19 11:04 | 3.7M | |
![[IMG]](/icons/image2.gif) | 6141_20221005_164942.jpg | 2025-05-19 11:03 | 3.7M | |
![[IMG]](/icons/image2.gif) | 3025_IMG_20181112_155306.jpg | 2025-05-19 11:04 | 3.7M | |
![[IMG]](/icons/image2.gif) | 1447_p6.jpg | 2025-05-19 11:05 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2589_MSO 3B.JPG | 2025-05-19 11:03 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2570_P3210503.JPG | 2025-05-19 11:04 | 3.7M | |
![[IMG]](/icons/image2.gif) | 2589_Emelisa Baltar.JPG | 2025-05-19 11:04 | 3.8M | |
![[IMG]](/icons/image2.gif) | 6291_IMG_6620.JPG | 2025-05-19 11:06 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2570_student leader working with PCV.JPG | 2025-05-19 11:03 | 3.8M | |
![[IMG]](/icons/image2.gif) | 1096_Brick fire line.jpg | 2025-05-19 11:03 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2570_other PCVs helping.JPG | 2025-05-19 11:04 | 3.8M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190307_160248.jpg | 2025-05-19 11:05 | 3.8M | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-16.jpg | 2025-05-19 11:03 | 3.8M | |
![[IMG]](/icons/image2.gif) | 1015_DSCN1565.jpg | 2025-05-19 11:07 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2589_MSO 1B.JPG | 2025-05-19 11:03 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2589_J. Bandojo.JPG | 2025-05-19 11:05 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2570_P3210310.JPG | 2025-05-19 11:05 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2589_Guardhouse Construction Platform.JPG | 2025-05-19 11:04 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2570_P3220738.JPG | 2025-05-19 11:06 | 3.8M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190307_184456.jpg | 2025-05-19 11:06 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2589_GOPR3416.JPG | 2025-05-19 11:05 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2589_Apprehension 2.JPG | 2025-05-19 11:03 | 3.8M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190306_172556.jpg | 2025-05-19 11:03 | 3.8M | |
![[IMG]](/icons/image2.gif) | 1096_House angle.jpg | 2025-05-19 11:03 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2589_P6280967.JPG | 2025-05-19 11:05 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2570_alex and ara mae with me at graduation ball.JPG | 2025-05-19 11:05 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2658_20180327_131312.jpg | 2025-05-19 11:03 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2570_P3220736.JPG | 2025-05-19 11:04 | 3.8M | |
![[IMG]](/icons/image2.gif) | 463_11.JPG | 2025-05-19 11:07 | 3.8M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1294.jpg | 2025-05-19 11:06 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2589_MSO 1C.JPG | 2025-05-19 11:04 | 3.8M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190307_161450.jpg | 2025-05-19 11:07 | 3.8M | |
![[IMG]](/icons/image2.gif) | 1013_IMG_3816.JPG | 2025-05-19 11:04 | 3.8M | |
![[IMG]](/icons/image2.gif) | 5648_DSC_4832.JPG | 2025-05-19 11:04 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2589_P5161936.JPG | 2025-05-19 11:04 | 3.8M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190225_165544.jpg | 2025-05-19 11:03 | 3.8M | |
![[IMG]](/icons/image2.gif) | 3137_Muriyesu Chantal.jpg | 2025-05-19 11:03 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2570_opening energizer.JPG | 2025-05-19 11:04 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2589_BD Training GPS.JPG | 2025-05-19 11:03 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2570_alex leading team building.JPG | 2025-05-19 11:05 | 3.8M | |
![[ ]](/icons/compressed.gif) | Final Report_23-066 (Asamoah, Courage) - Files.zip | 2025-05-19 11:04 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2589_P5230158.JPG | 2025-05-19 11:03 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2589_Report 2.JPG | 2025-05-19 11:05 | 3.8M | |
![[IMG]](/icons/image2.gif) | 1282_IMG_2105.jpg | 2025-05-19 11:04 | 3.8M | |
![[IMG]](/icons/image2.gif) | 1242_IMG_4214.JPG | 2025-05-19 11:04 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2570_registration.JPG | 2025-05-19 11:05 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2589_Bantay Dagat Patrol 5.JPG | 2025-05-19 11:05 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2570_P3220741.JPG | 2025-05-19 11:05 | 3.8M | |
![[ ]](/icons/compressed.gif) | Final Report_17-025 (Tercina Meance, Maudeline) - Files.zip | 2025-05-19 11:03 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2570_P3210412.JPG | 2025-05-19 11:05 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_162858.jpg | 2025-05-19 11:05 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2570_P3220754.JPG | 2025-05-19 11:04 | 3.8M | |
![[ ]](/icons/unknown.gif) | 6139_Kalambo project pictures.docx | 2025-05-19 11:03 | 3.8M | |
![[IMG]](/icons/image2.gif) | 2570_P3210372.JPG | 2025-05-19 11:05 | 3.8M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190306_112133.jpg | 2025-05-19 11:05 | 3.8M | |
![[IMG]](/icons/image2.gif) | 6262_059.JPG | 2025-05-19 11:04 | 3.8M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190308_164633.jpg | 2025-05-19 11:04 | 3.8M | |
![[IMG]](/icons/image2.gif) | 6262_088.JPG | 2025-05-19 11:04 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6262_203.JPG | 2025-05-19 11:07 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6429_IMG_8553.JPG | 2025-05-19 11:06 | 3.9M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191106_133353.jpg | 2025-05-19 11:04 | 3.9M | |
![[ ]](/icons/unknown.gif) | 2658_ECO-Friendly School Yard Curriclum - English.docx | 2025-05-19 11:04 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6262_055.JPG | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190305_175111.jpg | 2025-05-19 11:06 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6829_IMG_20240405_113109.jpg | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6262_011.JPG | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 2854_20181001_083401.jpg | 2025-05-19 11:03 | 3.9M | |
![[IMG]](/icons/image2.gif) | 2589_DSC_0500.JPG | 2025-05-19 11:03 | 3.9M | |
![[IMG]](/icons/image2.gif) | 2589_DSC_0495.JPG | 2025-05-19 11:06 | 3.9M | |
![[IMG]](/icons/image2.gif) | 714_IMG_4839.JPG | 2025-05-19 11:04 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6829_6.jpg | 2025-05-19 11:04 | 3.9M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175153.jpg | 2025-05-19 11:06 | 3.9M | |
![[ ]](/icons/compressed.gif) | Final Report_18-069 (Bui, Kaycey) - Files.zip | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 5648_DSC_4869.JPG | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6625_MZAMBAZI BOREHOLE (2).jpg | 2025-05-19 11:04 | 3.9M | |
![[IMG]](/icons/image2.gif) | 2589_guardhouse blessing 11.JPG | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6262_114.JPG | 2025-05-19 11:04 | 3.9M | |
![[IMG]](/icons/image2.gif) | 1277_P9030044.JPG | 2025-05-19 11:03 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6262_162.JPG | 2025-05-19 11:06 | 3.9M | |
![[IMG]](/icons/image2.gif) | 2589_P8250102.JPG | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6262_113.JPG | 2025-05-19 11:03 | 3.9M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1023.JPG | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6262_030.JPG | 2025-05-19 11:04 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6671_IMG_0333.jpg | 2025-05-19 11:07 | 3.9M | |
![[IMG]](/icons/image2.gif) | 2589_Beginning Guardhouse Construction.JPG | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3938.JPG | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 2658_20180327_135052.jpg | 2025-05-19 11:03 | 3.9M | |
![[IMG]](/icons/image2.gif) | 2570_P3200040.JPG | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6262_165.JPG | 2025-05-19 11:04 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6262_082.JPG | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190225_165248.jpg | 2025-05-19 11:04 | 3.9M | |
![[IMG]](/icons/image2.gif) | 5034_Water tank.jpg | 2025-05-19 11:07 | 3.9M | |
![[IMG]](/icons/image2.gif) | 1277_P9030048.JPG | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190307_160743.jpg | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 2570_P3210443.JPG | 2025-05-19 11:03 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6262_161.JPG | 2025-05-19 11:03 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6262_160.JPG | 2025-05-19 11:07 | 3.9M | |
![[IMG]](/icons/image2.gif) | 820_Belize-GLOW girls, Rachel Bollens- Amanda Masse.JPG | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 2570_P3200147.JPG | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 3180_finishing Moringa house construction.jpg | 2025-05-19 11:06 | 3.9M | |
![[IMG]](/icons/image2.gif) | 2570_P3210350.JPG | 2025-05-19 11:03 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20230127_125609.jpg | 2025-05-19 11:04 | 3.9M | |
![[IMG]](/icons/image2.gif) | 714_IMG_4871.JPG | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1071.jpg | 2025-05-19 11:04 | 3.9M | |
![[IMG]](/icons/image2.gif) | 2854_20180802_095020.jpg | 2025-05-19 11:04 | 3.9M | |
![[IMG]](/icons/image2.gif) | 2589_MSO 1.JPG | 2025-05-19 11:05 | 3.9M | |
![[ ]](/icons/layout.gif) | 2324_October 2017 health talk attendance lists (importance of ANC visits).pdf | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 2570_P3210278.JPG | 2025-05-19 11:04 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6829_IMG20231226151632.jpg | 2025-05-19 11:04 | 3.9M | |
![[IMG]](/icons/image2.gif) | 2514_IMG_0777.JPG | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 5571_IMG_20221104_130838_746.jpg | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 5571_IMG_20221104_130837_607.jpg | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6829_IMG20231226155845.jpg | 2025-05-19 11:03 | 3.9M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_164248.jpg | 2025-05-19 11:03 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6262_135 - Copy (2) - Copy.JPG | 2025-05-19 11:04 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6262_135.JPG | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 1277_P9020027.JPG | 2025-05-19 11:06 | 3.9M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_164250.jpg | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 1282_IMG_2408.jpg | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 1242_IMG_4251.jpg | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 2589_Bantay Dagat Patrol 4.JPG | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6262_106.JPG | 2025-05-19 11:07 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6262_141 - Copy (2) - Copy.JPG | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 4756_GiST 1st-06-41.jpg | 2025-05-19 11:04 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6262_174.JPG | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 2570_P3200171.JPG | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6262_123 - Copy.JPG | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 6625_MZAMBAZI SCHOOL VEGETABLE GARDEN-DRIPPING IRRIGATION USING TAP WATER.jpg | 2025-05-19 11:05 | 3.9M | |
![[IMG]](/icons/image2.gif) | 2570_arriving at venue.JPG | 2025-05-19 11:05 | 4.0M | |
![[IMG]](/icons/image2.gif) | 2414_DSC_8402.JPG | 2025-05-19 11:03 | 4.0M | |
![[IMG]](/icons/image2.gif) | 6262_159.JPG | 2025-05-19 11:03 | 4.0M | |
![[IMG]](/icons/image2.gif) | 6262_142.JPG | 2025-05-19 11:03 | 4.0M | |
![[IMG]](/icons/image2.gif) | 5401_3.JPG | 2025-05-19 11:05 | 4.0M | |
![[IMG]](/icons/image2.gif) | 6262_095.JPG | 2025-05-19 11:05 | 4.0M | |
![[IMG]](/icons/image2.gif) | 6291_IMG_6625.JPG | 2025-05-19 11:05 | 4.0M | |
![[IMG]](/icons/image2.gif) | 2570_P3220759.JPG | 2025-05-19 11:07 | 4.0M | |
![[IMG]](/icons/image2.gif) | 2589_guardhouse blessing 10.JPG | 2025-05-19 11:04 | 4.0M | |
![[IMG]](/icons/image2.gif) | 6262_099.JPG | 2025-05-19 11:07 | 4.0M | |
![[IMG]](/icons/image2.gif) | 2589_Guardhouse Stilt.JPG | 2025-05-19 11:05 | 4.0M | |
![[IMG]](/icons/image2.gif) | 2589_GOPR3420.JPG | 2025-05-19 11:04 | 4.0M | |
![[IMG]](/icons/image2.gif) | 2589_guardhouse blessing 4.JPG | 2025-05-19 11:05 | 4.0M | |
![[IMG]](/icons/image2.gif) | 2589_guardhouse blessing 9.JPG | 2025-05-19 11:05 | 4.0M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_4691.jpg | 2025-05-19 11:03 | 4.0M | |
![[IMG]](/icons/image2.gif) | 7000_Collective1.jpg | 2025-05-19 11:03 | 4.0M | |
![[IMG]](/icons/image2.gif) | 2589_DSC_0507.JPG | 2025-05-19 11:05 | 4.0M | |
![[IMG]](/icons/image2.gif) | 7102_IMG_6407.jpg | 2025-05-19 11:07 | 4.0M | |
![[IMG]](/icons/image2.gif) | 6787_IMG_20231129_122044_386.jpg | 2025-05-19 11:03 | 4.0M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190308_153550.jpg | 2025-05-19 11:05 | 4.0M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_174254.jpg | 2025-05-19 11:04 | 4.0M | |
![[IMG]](/icons/image2.gif) | 1447_p2 (2).jpg | 2025-05-19 11:05 | 4.0M | |
![[IMG]](/icons/image2.gif) | 2858_IMG_20180904_101040.jpg | 2025-05-19 11:05 | 4.0M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3942.JPG | 2025-05-19 11:07 | 4.0M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3936.JPG | 2025-05-19 11:05 | 4.0M | |
![[IMG]](/icons/image2.gif) | 1436_GOPR2183.JPG | 2025-05-19 11:05 | 4.0M | |
![[IMG]](/icons/image2.gif) | 2836_IMG_20180815_082512.jpg | 2025-05-19 11:05 | 4.0M | |
![[IMG]](/icons/image2.gif) | 6713_Chibanja school 2.jpg | 2025-05-19 11:04 | 4.0M | |
![[IMG]](/icons/image2.gif) | 2110_Hearth Feeding Scheme.jpg | 2025-05-19 11:07 | 4.0M | |
![[IMG]](/icons/image2.gif) | 6671_IMG_0336.jpg | 2025-05-19 11:05 | 4.0M | |
![[IMG]](/icons/image2.gif) | 3594_20200216_192003.jpg | 2025-05-19 11:04 | 4.0M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1105.JPG | 2025-05-19 11:05 | 4.0M | |
![[ ]](/icons/compressed.gif) | Final Report_22-046 (Kaundama, Jolex) - Budget Files.zip | 2025-05-19 11:04 | 4.0M | |
![[IMG]](/icons/image2.gif) | 6262_110.JPG | 2025-05-19 11:03 | 4.0M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190306_113118.jpg | 2025-05-19 11:03 | 4.0M | |
![[IMG]](/icons/image2.gif) | 5436_StorageX-11.jpg | 2025-05-19 11:04 | 4.0M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_193702.jpg | 2025-05-19 11:04 | 4.0M | |
![[IMG]](/icons/image2.gif) | 6262_071.JPG | 2025-05-19 11:05 | 4.0M | |
![[IMG]](/icons/image2.gif) | 3137_IMG_20190820_160600_5.jpg | 2025-05-19 11:05 | 4.0M | |
![[IMG]](/icons/image2.gif) | 2671_IMG_0046.jpg | 2025-05-19 11:03 | 4.0M | |
![[IMG]](/icons/image2.gif) | 2329_IMG_20180109_171342.jpg | 2025-05-19 11:05 | 4.0M | |
![[IMG]](/icons/image2.gif) | 1021_KW_ZADS_4.jpg | 2025-05-19 11:04 | 4.0M | |
![[IMG]](/icons/image2.gif) | 1100_The wall before metal rebar supports and the facade was added .jpg | 2025-05-19 11:05 | 4.0M | |
![[IMG]](/icons/image2.gif) | 1013_IMG_3331.JPG | 2025-05-19 11:03 | 4.0M | |
![[IMG]](/icons/image2.gif) | 2858_IMG_20180823_101333.jpg | 2025-05-19 11:03 | 4.0M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1180.JPG | 2025-05-19 11:04 | 4.1M | |
![[VID]](/icons/movie.gif) | 5792_VID-20221203-WA0004.mp4 | 2025-05-19 11:03 | 4.1M | |
![[IMG]](/icons/image2.gif) | 7000_SS1.jpg | 2025-05-19 11:05 | 4.1M | |
![[IMG]](/icons/image2.gif) | 2589_guardhouse blessing 14.JPG | 2025-05-19 11:03 | 4.1M | |
![[IMG]](/icons/image2.gif) | 7000_SS2.jpg | 2025-05-19 11:03 | 4.1M | |
![[IMG]](/icons/image2.gif) | 2329_IMG_20171018_170247_1.jpg | 2025-05-19 11:05 | 4.1M | |
![[IMG]](/icons/image2.gif) | 2589_DSC_0503.JPG | 2025-05-19 11:03 | 4.1M | |
![[IMG]](/icons/image2.gif) | 2658_20180519_185702.jpg | 2025-05-19 11:03 | 4.1M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1164.JPG | 2025-05-19 11:04 | 4.1M | |
![[IMG]](/icons/image2.gif) | 6288_688A8945.JPG | 2025-05-19 11:05 | 4.1M | |
![[IMG]](/icons/image2.gif) | 3137_IMG_20190820_163024_6.jpg | 2025-05-19 11:03 | 4.1M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191106_133409.jpg | 2025-05-19 11:05 | 4.1M | |
![[IMG]](/icons/image2.gif) | 2589_Sir Henry Golingan 2.JPG | 2025-05-19 11:04 | 4.1M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190306_172608.jpg | 2025-05-19 11:03 | 4.1M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1107.jpg | 2025-05-19 11:04 | 4.1M | |
![[IMG]](/icons/image2.gif) | 1447_p3.jpg | 2025-05-19 11:05 | 4.1M | |
![[IMG]](/icons/image2.gif) | 6787_IMG_20240516_105150_037.jpg | 2025-05-19 11:04 | 4.1M | |
![[IMG]](/icons/image2.gif) | 2329_IMG_20180105_145057.jpg | 2025-05-19 11:07 | 4.1M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1069.JPG | 2025-05-19 11:03 | 4.1M | |
![[IMG]](/icons/image2.gif) | 3933_20191023_153205.jpg | 2025-05-19 11:05 | 4.1M | |
![[IMG]](/icons/image2.gif) | 2658_20180519_185705.jpg | 2025-05-19 11:05 | 4.1M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_163109.jpg | 2025-05-19 11:03 | 4.1M | |
![[IMG]](/icons/image2.gif) | 739_Leadershipgroup.JPG | 2025-05-19 11:04 | 4.1M | |
![[IMG]](/icons/image2.gif) | 2589_guardhouse blessing 12.JPG | 2025-05-19 11:05 | 4.1M | |
![[IMG]](/icons/image2.gif) | 3933_20191119_125524.jpg | 2025-05-19 11:05 | 4.1M | |
![[IMG]](/icons/image2.gif) | 6291_IMG_6699.JPG | 2025-05-19 11:04 | 4.1M | |
![[IMG]](/icons/image2.gif) | 6713_Chibanja school 3.jpg | 2025-05-19 11:06 | 4.1M | |
![[IMG]](/icons/image2.gif) | 816_IMG_9491.JPG | 2025-05-19 11:07 | 4.1M | |
![[IMG]](/icons/image2.gif) | 3594_20200224_114144.jpg | 2025-05-19 11:04 | 4.1M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190307_161436.jpg | 2025-05-19 11:07 | 4.1M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1160.JPG | 2025-05-19 11:07 | 4.1M | |
![[IMG]](/icons/image2.gif) | 5660_20220722_150019.jpg | 2025-05-19 11:03 | 4.1M | |
![[IMG]](/icons/image2.gif) | 6262_121 - Copy.JPG | 2025-05-19 11:05 | 4.1M | |
![[IMG]](/icons/image2.gif) | 739_reopeningparty.JPG | 2025-05-19 11:05 | 4.2M | |
![[IMG]](/icons/image2.gif) | 6531_AYO director handing over relief items to an elderly.jpg | 2025-05-19 11:04 | 4.2M | |
![[IMG]](/icons/image2.gif) | 2658_20180519_185715.jpg | 2025-05-19 11:03 | 4.2M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190225_165609.jpg | 2025-05-19 11:05 | 4.2M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190307_160317.jpg | 2025-05-19 11:05 | 4.2M | |
![[IMG]](/icons/image2.gif) | 2589_DSC_0497.JPG | 2025-05-19 11:05 | 4.2M | |
![[ ]](/icons/compressed.gif) | Final Report_18-135 (Mbalamula, Espeth) - Budget Files.zip | 2025-05-19 11:06 | 4.2M | |
![[IMG]](/icons/image2.gif) | 6141_20221007_172052.jpg | 2025-05-19 11:05 | 4.2M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190307_160208.jpg | 2025-05-19 11:03 | 4.2M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190307_160200.jpg | 2025-05-19 11:05 | 4.2M | |
![[ ]](/icons/layout.gif) | 2966_CFLC ordinances.pdf | 2025-05-19 11:05 | 4.2M | |
![[IMG]](/icons/image2.gif) | 6266__MG_9588.JPG | 2025-05-19 11:04 | 4.2M | |
![[IMG]](/icons/image2.gif) | 2589_Tabugon MSO.JPG | 2025-05-19 11:03 | 4.2M | |
![[IMG]](/icons/image2.gif) | 3180_Learning visit on Greenhouse moringa drying.jpg | 2025-05-19 11:05 | 4.2M | |
![[IMG]](/icons/image2.gif) | 1436_GOPR2520.JPG | 2025-05-19 11:04 | 4.2M | |
![[IMG]](/icons/image2.gif) | 6787_IMG_20231129_122700_209.jpg | 2025-05-19 11:05 | 4.2M | |
![[IMG]](/icons/image2.gif) | 6713_Chibanja Primary 10.jpg | 2025-05-19 11:04 | 4.2M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190226_111250.jpg | 2025-05-19 11:05 | 4.2M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3943.JPG | 2025-05-19 11:05 | 4.2M | |
![[IMG]](/icons/image2.gif) | 1436_GOPR2169.JPG | 2025-05-19 11:05 | 4.2M | |
![[IMG]](/icons/image2.gif) | 5454_IMG_20211221_102555_748.jpg | 2025-05-19 11:03 | 4.2M | |
![[IMG]](/icons/image2.gif) | 5571_IMG_20221104_130813_329.jpg | 2025-05-19 11:03 | 4.2M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_164825.jpg | 2025-05-19 11:03 | 4.3M | |
![[IMG]](/icons/image2.gif) | 2589_guardhouse blessing 17.JPG | 2025-05-19 11:04 | 4.3M | |
![[IMG]](/icons/image2.gif) | 6524_IMG_20230627_122840_899.jpg | 2025-05-19 11:05 | 4.3M | |
![[IMG]](/icons/image2.gif) | 1026_child measurement on new bench.jpg | 2025-05-19 11:04 | 4.3M | |
![[IMG]](/icons/image2.gif) | 2342_IMG_0337.jpg | 2025-05-19 11:03 | 4.3M | |
![[IMG]](/icons/image2.gif) | 6141_20221010_154553.jpg | 2025-05-19 11:03 | 4.3M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190307_160420.jpg | 2025-05-19 11:07 | 4.3M | |
![[IMG]](/icons/image2.gif) | 2671_IMG_0076 (1).jpg | 2025-05-19 11:05 | 4.3M | |
![[IMG]](/icons/image2.gif) | 5454_IMG_20211221_102559_788.jpg | 2025-05-19 11:04 | 4.3M | |
![[IMG]](/icons/image2.gif) | 3180_Moringa dded to childs porridge.jpg | 2025-05-19 11:04 | 4.3M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190225_165550.jpg | 2025-05-19 11:04 | 4.3M | |
![[IMG]](/icons/image2.gif) | 5454_IMG_20211221_102554_380.jpg | 2025-05-19 11:05 | 4.3M | |
![[IMG]](/icons/image2.gif) | 714_IMG_4840.JPG | 2025-05-19 11:03 | 4.3M | |
![[IMG]](/icons/image2.gif) | 5648_DSC_4736.JPG | 2025-05-19 11:07 | 4.3M | |
![[IMG]](/icons/image2.gif) | 5454_IMG_20211221_102601_348.jpg | 2025-05-19 11:03 | 4.3M | |
![[IMG]](/icons/image2.gif) | 5454_IMG_20211221_102606_078.jpg | 2025-05-19 11:05 | 4.3M | |
![[IMG]](/icons/image2.gif) | 2414_DSC_8413.JPG | 2025-05-19 11:05 | 4.3M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_193655.jpg | 2025-05-19 11:03 | 4.3M | |
![[ ]](/icons/compressed.gif) | Final Report_18-052 (Joy, Tony) - Budget Files.zip | 2025-05-19 11:06 | 4.3M | |
![[IMG]](/icons/image2.gif) | 3774_20200717_171421.jpg | 2025-05-19 11:05 | 4.3M | |
![[IMG]](/icons/image2.gif) | 2112_IMG_3889.JPG | 2025-05-19 11:03 | 4.3M | |
![[IMG]](/icons/image2.gif) | 4756_GiST 05-06-2.jpg | 2025-05-19 11:03 | 4.3M | |
![[IMG]](/icons/image2.gif) | 5660_20220705_140359.jpg | 2025-05-19 11:06 | 4.3M | |
![[IMG]](/icons/image2.gif) | 6429_IMG_8522.JPG | 2025-05-19 11:05 | 4.3M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1057.JPG | 2025-05-19 11:05 | 4.3M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1084.JPG | 2025-05-19 11:05 | 4.3M | |
![[IMG]](/icons/image2.gif) | 1447_p4 (2).jpg | 2025-05-19 11:05 | 4.3M | |
![[IMG]](/icons/image2.gif) | 2148_DSC04476.JPG | 2025-05-19 11:04 | 4.3M | |
![[IMG]](/icons/image2.gif) | 1447_p1 (2).jpg | 2025-05-19 11:05 | 4.4M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1186.JPG | 2025-05-19 11:04 | 4.4M | |
![[ ]](/icons/compressed.gif) | Community Coffee Conquest-final_report-files.zip | 2025-05-19 11:05 | 4.4M | |
![[VID]](/icons/movie.gif) | 6087_WhatsApp Video 2024-06-03 at 8.43.10 AM.mp4 | 2025-05-19 11:06 | 4.4M | |
![[IMG]](/icons/image2.gif) | 1363_20170220_102731.jpg | 2025-05-19 11:03 | 4.4M | |
![[IMG]](/icons/image2.gif) | 1105_IMG_4533.JPG | 2025-05-19 11:05 | 4.4M | |
![[IMG]](/icons/image2.gif) | 1447_p3 (2).jpg | 2025-05-19 11:05 | 4.4M | |
![[IMG]](/icons/image2.gif) | 2671_IMG_0086.jpg | 2025-05-19 11:05 | 4.4M | |
![[IMG]](/icons/image2.gif) | 6797_IMG_20240822_191607.jpg | 2025-05-19 11:04 | 4.4M | |
![[IMG]](/icons/image2.gif) | 5660_20220923_113139.jpg | 2025-05-19 11:04 | 4.4M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_164536.jpg | 2025-05-19 11:05 | 4.4M | |
![[IMG]](/icons/image2.gif) | 2858_IMG_7131.JPG | 2025-05-19 11:05 | 4.4M | |
![[IMG]](/icons/image2.gif) | 820_Belize-Samantha, Johanna-Sarah Park.JPG | 2025-05-19 11:03 | 4.4M | |
![[IMG]](/icons/image2.gif) | 2589_GOPR3403.JPG | 2025-05-19 11:05 | 4.4M | |
![[IMG]](/icons/image2.gif) | 6262_097.JPG | 2025-05-19 11:05 | 4.4M | |
![[VID]](/icons/movie.gif) | 1668_Ramp_Project__Kukes__Albania.mp4 | 2025-05-19 11:03 | 4.4M | |
![[IMG]](/icons/image2.gif) | 7000_MV3.jpg | 2025-05-19 11:03 | 4.4M | |
![[IMG]](/icons/image2.gif) | 2110_Health Center Nursery.jpg | 2025-05-19 11:05 | 4.4M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190225_165607.jpg | 2025-05-19 11:03 | 4.4M | |
![[IMG]](/icons/image2.gif) | 7100_PXL_20231104_132903977.MP.jpg | 2025-05-19 11:03 | 4.4M | |
![[IMG]](/icons/image2.gif) | 6713_Chibanja School 4.jpg | 2025-05-19 11:04 | 4.4M | |
![[IMG]](/icons/image2.gif) | 2589_guardhouse blessing 1.JPG | 2025-05-19 11:05 | 4.4M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20221118_172724.jpg | 2025-05-19 11:04 | 4.5M | |
![[IMG]](/icons/image2.gif) | 6291_IMG_6827.JPG | 2025-05-19 11:04 | 4.5M | |
![[IMG]](/icons/image2.gif) | 6787_IMG_20240516_125921_676.jpg | 2025-05-19 11:04 | 4.5M | |
![[IMG]](/icons/image2.gif) | 3193_IMG_20190710_145213_2.jpg | 2025-05-19 11:03 | 4.5M | |
![[IMG]](/icons/image2.gif) | 6713_Chibanja School 5.jpg | 2025-05-19 11:06 | 4.5M | |
![[IMG]](/icons/image2.gif) | 6713_Chibanja School 6.jpg | 2025-05-19 11:05 | 4.5M | |
![[IMG]](/icons/image2.gif) | 6531_photo activty.jpg | 2025-05-19 11:05 | 4.5M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1171.jpg | 2025-05-19 11:05 | 4.5M | |
![[IMG]](/icons/image2.gif) | 2671_IMG_0032.jpg | 2025-05-19 11:04 | 4.5M | |
![[IMG]](/icons/image2.gif) | 6113_IMG_20230213_153902.jpg | 2025-05-19 11:03 | 4.5M | |
![[IMG]](/icons/image2.gif) | 2858_IMG_7143.JPG | 2025-05-19 11:05 | 4.5M | |
![[IMG]](/icons/image2.gif) | 1242_IMG_4215.jpg | 2025-05-19 11:06 | 4.5M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191224_090514.jpg | 2025-05-19 11:05 | 4.5M | |
![[IMG]](/icons/image2.gif) | 6113_IMG_20230213_142523.jpg | 2025-05-19 11:04 | 4.5M | |
![[ ]](/icons/compressed.gif) | Final Report_18-189 (Kankuzi, Alfred) - Budget Files.zip | 2025-05-19 11:05 | 4.5M | |
![[IMG]](/icons/image2.gif) | 6113_IMG_20230213_142503.jpg | 2025-05-19 11:05 | 4.5M | |
![[IMG]](/icons/image2.gif) | 5447_FAMILUSI HEALTH CENTER.jpg | 2025-05-19 11:05 | 4.5M | |
![[IMG]](/icons/image2.gif) | 2671_IMG_0041.jpg | 2025-05-19 11:06 | 4.5M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_191202.jpg | 2025-05-19 11:04 | 4.5M | |
![[IMG]](/icons/image2.gif) | 2858_IMG_7116.JPG | 2025-05-19 11:05 | 4.5M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1083.JPG | 2025-05-19 11:04 | 4.5M | |
![[IMG]](/icons/image2.gif) | 6787_IMG_20231129_122208_846.jpg | 2025-05-19 11:04 | 4.5M | |
![[IMG]](/icons/image2.gif) | 2414_DSC_8434.JPG | 2025-05-19 11:05 | 4.5M | |
![[IMG]](/icons/image2.gif) | 3643_IMG_6979.jpg | 2025-05-19 11:05 | 4.5M | |
![[IMG]](/icons/image2.gif) | 3193_IMG_20190910_115708_1 (1).jpg | 2025-05-19 11:05 | 4.5M | |
![[IMG]](/icons/image2.gif) | 3193_IMG_20190910_115708_1.jpg | 2025-05-19 11:05 | 4.5M | |
![[IMG]](/icons/image2.gif) | 3933_20191119_125447.jpg | 2025-05-19 11:05 | 4.5M | |
![[IMG]](/icons/image2.gif) | 5660_20220729_141623.jpg | 2025-05-19 11:06 | 4.5M | |
![[IMG]](/icons/image2.gif) | 1265_DSC_0994.jpg | 2025-05-19 11:05 | 4.6M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20221118_172736.jpg | 2025-05-19 11:03 | 4.6M | |
![[IMG]](/icons/image2.gif) | 6141_20221007_121355.jpg | 2025-05-19 11:04 | 4.6M | |
![[IMG]](/icons/image2.gif) | 3193_IMG_20190910_115731_7.jpg | 2025-05-19 11:03 | 4.6M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1117.JPG | 2025-05-19 11:05 | 4.6M | |
![[ ]](/icons/compressed.gif) | A Mill of Their OwnRemodeling a Space for Corazons Women-final_report-files.zip | 2025-05-19 11:04 | 4.6M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175159.jpg | 2025-05-19 11:05 | 4.6M | |
![[IMG]](/icons/image2.gif) | 5660_20220721_142050.jpg | 2025-05-19 11:03 | 4.6M | |
![[IMG]](/icons/image2.gif) | 2128_20170525_091400.jpg | 2025-05-19 11:05 | 4.6M | |
![[IMG]](/icons/image2.gif) | 714_IMG_4847.JPG | 2025-05-19 11:03 | 4.6M | |
![[IMG]](/icons/image2.gif) | 2673_IMG_20190123_082102_1.jpg | 2025-05-19 11:05 | 4.6M | |
![[IMG]](/icons/image2.gif) | 2671_IMG_0053.jpg | 2025-05-19 11:05 | 4.6M | |
![[ ]](/icons/layout.gif) | 5284_Trainees-manual-poultry-course.pdf | 2025-05-19 11:04 | 4.6M | |
![[IMG]](/icons/image2.gif) | 2858_IMG_20180823_112044.jpg | 2025-05-19 11:04 | 4.6M | |
![[IMG]](/icons/image2.gif) | 2589_Fish Caught in Bancal Bay.JPG | 2025-05-19 11:06 | 4.6M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_164527.jpg | 2025-05-19 11:05 | 4.6M | |
![[IMG]](/icons/image2.gif) | 3180_Moringa bottle packaging.jpg | 2025-05-19 11:04 | 4.6M | |
![[IMG]](/icons/image2.gif) | 2128_20170525_091425.jpg | 2025-05-19 11:04 | 4.6M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190305_172638.jpg | 2025-05-19 11:03 | 4.6M | |
![[IMG]](/icons/image2.gif) | 3058_IMG_20190517_101851_8.jpg | 2025-05-19 11:05 | 4.6M | |
![[IMG]](/icons/image2.gif) | 816_IMG_9246.JPG | 2025-05-19 11:04 | 4.6M | |
![[IMG]](/icons/image2.gif) | 2342_IMG_0346.jpg | 2025-05-19 11:04 | 4.6M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1075.JPG | 2025-05-19 11:05 | 4.6M | |
![[IMG]](/icons/image2.gif) | 1692_IMG_3919.jpg | 2025-05-19 11:04 | 4.6M | |
![[IMG]](/icons/image2.gif) | 7000_MC2.jpg | 2025-05-19 11:03 | 4.7M | |
![[VID]](/icons/movie.gif) | 4678_VID-20200502-WA0069.mp4 | 2025-05-19 11:05 | 4.7M | |
![[IMG]](/icons/image2.gif) | 3594_20191121_111104.jpg | 2025-05-19 11:07 | 4.7M | |
![[IMG]](/icons/image2.gif) | 2329_20180108_162429.jpg | 2025-05-19 11:06 | 4.7M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_174209.jpg | 2025-05-19 11:04 | 4.7M | |
![[IMG]](/icons/image2.gif) | 7100_PXL_20231104_133056747.MP.jpg | 2025-05-19 11:03 | 4.7M | |
![[IMG]](/icons/image2.gif) | 3193_IMG_20190710_120844_0.jpg | 2025-05-19 11:04 | 4.7M | |
![[IMG]](/icons/image2.gif) | 1436_GOPR2536.JPG | 2025-05-19 11:05 | 4.7M | |
![[IMG]](/icons/image2.gif) | 3594_20191106_174543.jpg | 2025-05-19 11:05 | 4.7M | |
![[IMG]](/icons/image2.gif) | 6829_IMG_20240201_143055_625.jpg | 2025-05-19 11:04 | 4.7M | |
![[IMG]](/icons/image2.gif) | 1013_IMG_3333.JPG | 2025-05-19 11:05 | 4.7M | |
![[IMG]](/icons/image2.gif) | 6291_IMG_6674.JPG | 2025-05-19 11:05 | 4.7M | |
![[IMG]](/icons/image2.gif) | 2673_IMG_20180802_151204.jpg | 2025-05-19 11:06 | 4.7M | |
![[IMG]](/icons/image2.gif) | 6291_IMG_6830.JPG | 2025-05-19 11:05 | 4.7M | |
![[IMG]](/icons/image2.gif) | 1242_IMG_4627.JPG | 2025-05-19 11:05 | 4.7M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_163001.jpg | 2025-05-19 11:06 | 4.7M | |
![[IMG]](/icons/image2.gif) | 773_DSC05897.JPG | 2025-05-19 11:05 | 4.7M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_191234.jpg | 2025-05-19 11:03 | 4.7M | |
![[IMG]](/icons/image2.gif) | 2589_guardhouse blessing 2.JPG | 2025-05-19 11:04 | 4.8M | |
![[IMG]](/icons/image2.gif) | 4713_20200428_121949.jpg | 2025-05-19 11:05 | 4.8M | |
![[ ]](/icons/compressed.gif) | Reducing HIV Rates and Increasing HIV Education Through Chicken Rearing-final_report-files.zip | 2025-05-19 11:05 | 4.8M | |
![[IMG]](/icons/image2.gif) | 773_DSC06579.JPG | 2025-05-19 11:04 | 4.8M | |
![[IMG]](/icons/image2.gif) | 6113_IMG_20230213_145657.jpg | 2025-05-19 11:05 | 4.8M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191224_090532.jpg | 2025-05-19 11:05 | 4.8M | |
![[IMG]](/icons/image2.gif) | 2993_IMG-20190831-WA0021.jpg | 2025-05-19 11:05 | 4.8M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1133.JPG | 2025-05-19 11:05 | 4.8M | |
![[IMG]](/icons/image2.gif) | 5660_20220726_173559.jpg | 2025-05-19 11:03 | 4.8M | |
![[IMG]](/icons/image2.gif) | 832_IMG_1060.JPG | 2025-05-19 11:05 | 4.8M | |
![[IMG]](/icons/image2.gif) | 739_ZoridaLaurenAdam.JPG | 2025-05-19 11:07 | 4.8M | |
![[IMG]](/icons/image2.gif) | 5809_Formulated Neem Pesticide.jpg | 2025-05-19 11:04 | 4.8M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190305_172748.jpg | 2025-05-19 11:03 | 4.8M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190305_172641.jpg | 2025-05-19 11:03 | 4.8M | |
![[IMG]](/icons/image2.gif) | 2472_pic one .JPG | 2025-05-19 11:03 | 4.8M | |
![[IMG]](/icons/image2.gif) | 5660_20220720_173710.jpg | 2025-05-19 11:04 | 4.8M | |
![[IMG]](/icons/image2.gif) | 3137_IMG_20190820_163049_7.jpg | 2025-05-19 11:04 | 4.8M | |
![[IMG]](/icons/image2.gif) | 6524_IMG_20230520_144212.jpg | 2025-05-19 11:04 | 4.8M | |
![[IMG]](/icons/image2.gif) | 2329_Blarito.jpg | 2025-05-19 11:05 | 4.8M | |
![[IMG]](/icons/image2.gif) | 2329_IMG_20180226_162757.jpg | 2025-05-19 11:03 | 4.8M | |
![[ ]](/icons/compressed.gif) | Final Report_22-075 (Melance, NIYONIZIGIYE) - Files.zip | 2025-05-19 11:04 | 4.8M | |
![[IMG]](/icons/image2.gif) | 2110_CHW training on handwashing.jpg | 2025-05-19 11:04 | 4.8M | |
![[IMG]](/icons/image2.gif) | 5034_drilling borehole.jpg | 2025-05-19 11:03 | 4.8M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_164257.jpg | 2025-05-19 11:03 | 4.8M | |
![[IMG]](/icons/image2.gif) | 7370_IMG_1454.jpg | 2025-07-24 16:47 | 4.8M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_144002.jpg | 2025-05-19 11:03 | 4.8M | |
![[ ]](/icons/compressed.gif) | Community Recycling Center-final_report-files.zip | 2025-05-19 11:04 | 4.8M | |
![[IMG]](/icons/image2.gif) | 3389_Isaac Phiri Support the installation during the launch_.JPG | 2025-05-19 11:07 | 4.8M | |
![[IMG]](/icons/image2.gif) | 5660_20220718_132350.jpg | 2025-05-19 11:04 | 4.8M | |
![[IMG]](/icons/image2.gif) | 5401_munuge.jpg | 2025-05-19 11:04 | 4.8M | |
![[IMG]](/icons/image2.gif) | 3933_20191119_125626.jpg | 2025-05-19 11:05 | 4.9M | |
![[IMG]](/icons/image2.gif) | 2110_Health Center Nursery 2.jpg | 2025-05-19 11:05 | 4.9M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_164924.jpg | 2025-05-19 11:05 | 4.9M | |
![[ ]](/icons/compressed.gif) | Final Report_19-090 (Gondwe, Chancy ) - Budget Files.zip | 2025-05-19 11:07 | 4.9M | |
![[IMG]](/icons/image2.gif) | 1436_GOPR2759.JPG | 2025-05-19 11:05 | 4.9M | |
![[IMG]](/icons/image2.gif) | 2329_20180108_162646.jpg | 2025-05-19 11:06 | 4.9M | |
![[IMG]](/icons/image2.gif) | 4713_20200428_122035.jpg | 2025-05-19 11:03 | 4.9M | |
![[IMG]](/icons/image2.gif) | 5034_water for community.jpg | 2025-05-19 11:04 | 4.9M | |
![[IMG]](/icons/image2.gif) | 5648_20221207164753_IMG_9310.jpg | 2025-05-19 11:03 | 4.9M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_191229.jpg | 2025-05-19 11:07 | 4.9M | |
![[ ]](/icons/compressed.gif) | Final Report_19-024 (Nyirenda, Elias) - Budget Files.zip | 2025-05-19 11:03 | 4.9M | |
![[IMG]](/icons/image2.gif) | 4713_20200428_121258.jpg | 2025-05-19 11:03 | 4.9M | |
![[IMG]](/icons/image2.gif) | 2589_GOPR3422.JPG | 2025-05-19 11:03 | 4.9M | |
![[IMG]](/icons/image2.gif) | 2107_IMG_8161[1].JPG | 2025-05-19 11:05 | 4.9M | |
![[IMG]](/icons/image2.gif) | 5401_DSC_6227.JPG | 2025-05-19 11:05 | 4.9M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_164837.jpg | 2025-05-19 11:04 | 4.9M | |
![[ ]](/icons/compressed.gif) | Dominican Republic Provincial Health Promotion Network-final_report-files.zip | 2025-05-19 11:07 | 4.9M | |
![[IMG]](/icons/image2.gif) | 1021_DSC_0487.JPG | 2025-05-19 11:07 | 4.9M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190306_112604.jpg | 2025-05-19 11:05 | 4.9M | |
![[IMG]](/icons/image2.gif) | 6141_20221007_170130.jpg | 2025-05-19 11:04 | 4.9M | |
![[IMG]](/icons/image2.gif) | 2671_IMG_0034.jpg | 2025-05-19 11:03 | 4.9M | |
![[IMG]](/icons/image2.gif) | 2110_Health Center Nursery 3.jpg | 2025-05-19 11:06 | 4.9M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_164844.jpg | 2025-05-19 11:07 | 4.9M | |
![[IMG]](/icons/image2.gif) | 3058_IMG_20190517_102041_0.jpg | 2025-05-19 11:03 | 4.9M | |
![[IMG]](/icons/image2.gif) | 1436_GOPR2476.JPG | 2025-05-19 11:06 | 5.0M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20221118_123500.jpg | 2025-05-19 11:04 | 5.0M | |
![[IMG]](/icons/image2.gif) | 6633_IMG_20231027_125629.jpg | 2025-05-19 11:04 | 5.0M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191224_090613.jpg | 2025-05-19 11:04 | 5.0M | |
![[IMG]](/icons/image2.gif) | 2472_pic 2 .JPG | 2025-05-19 11:05 | 5.0M | |
![[IMG]](/icons/image2.gif) | 5660_20220722_145003.jpg | 2025-05-19 11:05 | 5.0M | |
![[IMG]](/icons/image2.gif) | 2329_20180108_163742.jpg | 2025-05-19 11:04 | 5.0M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_193644.jpg | 2025-05-19 11:05 | 5.0M | |
![[IMG]](/icons/image2.gif) | 1100_The head mason, Mortalla Diop, constructing the wall.jpg | 2025-05-19 11:05 | 5.0M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_164529.jpg | 2025-05-19 11:03 | 5.0M | |
![[IMG]](/icons/image2.gif) | 3137_Public session on Hygiene in Mburamazi Center.jpg | 2025-05-19 11:04 | 5.0M | |
![[IMG]](/icons/image2.gif) | 2858_IMG_5196.JPG | 2025-05-19 11:05 | 5.0M | |
![[IMG]](/icons/image2.gif) | 2107_IMG_8025[1].JPG | 2025-05-19 11:05 | 5.0M | |
![[IMG]](/icons/image2.gif) | 6291_IMG_6817.JPG | 2025-05-19 11:05 | 5.0M | |
![[IMG]](/icons/image2.gif) | 6633_IMG_20231027_125213.jpg | 2025-05-19 11:05 | 5.0M | |
![[ ]](/icons/layout.gif) | 1103_ANAM Manual de La Estufa Ecologica 2014.pdf | 2025-05-19 11:04 | 5.0M | |
![[IMG]](/icons/image2.gif) | 773_DSC06600.JPG | 2025-05-19 11:04 | 5.0M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191224_092027.jpg | 2025-05-19 11:05 | 5.0M | |
![[IMG]](/icons/image2.gif) | 773_DSC06601.JPG | 2025-05-19 11:04 | 5.0M | |
![[IMG]](/icons/image2.gif) | 6291_IMG_6529.JPG | 2025-05-19 11:03 | 5.0M | |
![[IMG]](/icons/image2.gif) | 2107_IMG_7990[1].JPG | 2025-05-19 11:03 | 5.0M | |
![[IMG]](/icons/image2.gif) | 3933_20191023_141555.jpg | 2025-05-19 11:06 | 5.0M | |
![[IMG]](/icons/image2.gif) | 4756_GiST 1st-06-70.jpg | 2025-05-19 11:04 | 5.1M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_174218.jpg | 2025-05-19 11:05 | 5.1M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20230127_125407.jpg | 2025-05-19 11:03 | 5.1M | |
![[IMG]](/icons/image2.gif) | 773_DSC05861.JPG | 2025-05-19 11:03 | 5.1M | |
![[IMG]](/icons/image2.gif) | 3025_Elin and Ida from the Norwegian Embassy visit the RRC..jpg | 2025-05-19 11:05 | 5.1M | |
![[IMG]](/icons/image2.gif) | 1436_GOPR2740.JPG | 2025-05-19 11:07 | 5.1M | |
![[IMG]](/icons/image2.gif) | 773_DSC05695.JPG | 2025-05-19 11:05 | 5.1M | |
![[IMG]](/icons/image2.gif) | 6524_IMG_20230627_123436_636.jpg | 2025-05-19 11:05 | 5.1M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_164301.jpg | 2025-05-19 11:05 | 5.1M | |
![[IMG]](/icons/image2.gif) | 821_Belize-Zac, David 2-Molly.jpg | 2025-05-19 11:05 | 5.1M | |
![[IMG]](/icons/image2.gif) | 2658_20180503_131726 (1).jpg | 2025-05-19 11:07 | 5.1M | |
![[IMG]](/icons/image2.gif) | 2658_20180503_131726.jpg | 2025-05-19 11:03 | 5.1M | |
![[IMG]](/icons/image2.gif) | 1100_One of the people instrumental to the project's success, Mordou Sathie, overlooks construction.jpg | 2025-05-19 11:06 | 5.1M | |
![[IMG]](/icons/image2.gif) | 6291_IMG_6673.JPG | 2025-05-19 11:05 | 5.1M | |
![[IMG]](/icons/image2.gif) | 6291_IMG_6721.JPG | 2025-05-19 11:05 | 5.1M | |
![[IMG]](/icons/image2.gif) | 773_DSC05764.JPG | 2025-05-19 11:05 | 5.1M | |
![[IMG]](/icons/image2.gif) | 6291_IMG_6821.JPG | 2025-05-19 11:03 | 5.1M | |
![[IMG]](/icons/image2.gif) | 4713_20200428_122031.jpg | 2025-05-19 11:03 | 5.1M | |
![[IMG]](/icons/image2.gif) | 3933_20191119_125545.jpg | 2025-05-19 11:05 | 5.1M | |
![[IMG]](/icons/image2.gif) | 6292_IMG_20230109_121547_264.jpg | 2025-05-19 11:04 | 5.1M | |
![[IMG]](/icons/image2.gif) | 6291_IMG_6755.JPG | 2025-05-19 11:05 | 5.1M | |
![[IMG]](/icons/image2.gif) | 5571_IMG_20220202_153434_183.jpg | 2025-05-19 11:04 | 5.1M | |
![[IMG]](/icons/image2.gif) | 773_DSC06562.JPG | 2025-05-19 11:04 | 5.2M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190305_172800.jpg | 2025-05-19 11:06 | 5.2M | |
![[IMG]](/icons/image2.gif) | 4713_20200428_122038.jpg | 2025-05-19 11:05 | 5.2M | |
![[IMG]](/icons/image2.gif) | 2107_IMG_8243[1].JPG | 2025-05-19 11:03 | 5.2M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_164520.jpg | 2025-05-19 11:04 | 5.2M | |
![[IMG]](/icons/image2.gif) | 773_DSC06511.JPG | 2025-05-19 11:05 | 5.2M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190306_152039.jpg | 2025-05-19 11:03 | 5.2M | |
![[IMG]](/icons/image2.gif) | 6524_IMG_20230520_153502.jpg | 2025-05-19 11:04 | 5.2M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20230127_122542.jpg | 2025-05-19 11:05 | 5.2M | |
![[IMG]](/icons/image2.gif) | 6531_Activity photo.jpg | 2025-05-19 11:04 | 5.2M | |
![[IMG]](/icons/image2.gif) | 773_DSC05736.JPG | 2025-05-19 11:03 | 5.2M | |
![[ ]](/icons/unknown.gif) | 2841_ECO-FRIENDLY FARM PROJECT REPORT.docx | 2025-05-19 11:05 | 5.2M | |
![[IMG]](/icons/image2.gif) | 2110_3 women who work in garden with chickens purchased from cooperative-Jakrine on right with blue headdress.jpg | 2025-05-19 11:05 | 5.2M | |
![[IMG]](/icons/image2.gif) | 1436_GOPR2739.JPG | 2025-05-19 11:06 | 5.2M | |
![[IMG]](/icons/image2.gif) | 1013_IMG_3736.JPG | 2025-05-19 11:03 | 5.2M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_162801.jpg | 2025-05-19 11:05 | 5.2M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_144012.jpg | 2025-05-19 11:05 | 5.2M | |
![[ ]](/icons/layout.gif) | 6530_Project Pictures.pdf | 2025-05-19 11:05 | 5.2M | |
![[IMG]](/icons/image2.gif) | 773_DSC05815.JPG | 2025-05-19 11:03 | 5.2M | |
![[IMG]](/icons/image2.gif) | 773_DSC06198.JPG | 2025-05-19 11:04 | 5.2M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190306_112332.jpg | 2025-05-19 11:03 | 5.2M | |
![[IMG]](/icons/image2.gif) | 6787_IMG_20240515_152935_073.jpg | 2025-05-19 11:04 | 5.2M | |
![[ ]](/icons/compressed.gif) | Ndoro Memorial School Garden Growing More With Less-final_report-files.zip | 2025-05-19 11:06 | 5.2M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190306_160149.jpg | 2025-05-19 11:04 | 5.3M | |
![[IMG]](/icons/image2.gif) | 2110_Training for women with children 2 years old and younger.jpg | 2025-05-19 11:05 | 5.3M | |
![[ ]](/icons/unknown.gif) | 3971_Allyson Figeroa testimonial.docx | 2025-05-19 11:03 | 5.3M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_193716.jpg | 2025-05-19 11:03 | 5.3M | |
![[IMG]](/icons/image2.gif) | 773_DSC05698.JPG | 2025-05-19 11:05 | 5.3M | |
![[IMG]](/icons/image2.gif) | 4713_20200428_122029.jpg | 2025-05-19 11:03 | 5.3M | |
![[IMG]](/icons/image2.gif) | 5034_water tank taps for community.jpg | 2025-05-19 11:05 | 5.3M | |
![[IMG]](/icons/image2.gif) | 773_DSC05774.JPG | 2025-05-19 11:04 | 5.3M | |
![[IMG]](/icons/image2.gif) | 6633_IMG_20231027_124750.jpg | 2025-05-19 11:04 | 5.3M | |
![[IMG]](/icons/image2.gif) | 2850_IMG_20190222_152020_0 - Copy.jpg | 2025-05-19 11:05 | 5.3M | |
![[IMG]](/icons/image2.gif) | 912_P1050709.JPG | 2025-05-19 11:06 | 5.3M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190306_170439.jpg | 2025-05-19 11:03 | 5.3M | |
![[IMG]](/icons/image2.gif) | 5034_septic tank.jpg | 2025-05-19 11:07 | 5.3M | |
![[ ]](/icons/compressed.gif) | 1060_Interviews - Photos.zip | 2025-05-19 11:03 | 5.3M | |
![[IMG]](/icons/image2.gif) | 3193_IMG_20190711_114920_1.jpg | 2025-05-19 11:04 | 5.3M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_164926.jpg | 2025-05-19 11:05 | 5.3M | |
![[IMG]](/icons/image2.gif) | 4358_Shelter after.jpg | 2025-05-19 11:07 | 5.3M | |
![[IMG]](/icons/image2.gif) | 2794_Training Session- Organizing team.JPG | 2025-05-19 11:04 | 5.3M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_191257.jpg | 2025-05-19 11:04 | 5.3M | |
![[IMG]](/icons/image2.gif) | 912_P1050708.JPG | 2025-05-19 11:05 | 5.3M | |
![[VID]](/icons/movie.gif) | 3025_Explaining the Reading and Resource Centre Model to the Minister of Education using the recently purchased gadgets.mp4 | 2025-05-19 11:05 | 5.3M | |
![[IMG]](/icons/image2.gif) | 3193_IMG_20190711_141339_5.jpg | 2025-05-19 11:05 | 5.3M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190306_170525.jpg | 2025-05-19 11:04 | 5.3M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191224_090617.jpg | 2025-05-19 11:03 | 5.3M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_164524.jpg | 2025-05-19 11:03 | 5.3M | |
![[IMG]](/icons/image2.gif) | 6291_IMG_6719.JPG | 2025-05-19 11:04 | 5.4M | |
![[IMG]](/icons/image2.gif) | 2329_IMG_20180103_152655.jpg | 2025-05-19 11:03 | 5.4M | |
![[IMG]](/icons/image2.gif) | 3193_IMG_20190710_122722_8.jpg | 2025-05-19 11:03 | 5.4M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175101.jpg | 2025-05-19 11:04 | 5.4M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20230127_122538.jpg | 2025-05-19 11:04 | 5.4M | |
![[IMG]](/icons/image2.gif) | 4713_20200428_121323.jpg | 2025-05-19 11:03 | 5.4M | |
![[IMG]](/icons/image2.gif) | 7000_MV2.jpg | 2025-05-19 11:05 | 5.4M | |
![[IMG]](/icons/image2.gif) | 5571_IMG_20220202_153438_399.jpg | 2025-05-19 11:07 | 5.4M | |
![[IMG]](/icons/image2.gif) | 6787_IMG_20240515_152619_427.jpg | 2025-05-19 11:05 | 5.4M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20230127_122558.jpg | 2025-05-19 11:06 | 5.4M | |
![[IMG]](/icons/image2.gif) | 5034_drilling.jpg | 2025-05-19 11:03 | 5.4M | |
![[ ]](/icons/compressed.gif) | Final Report_19-187 (Chikhosi Kafotokoza, Mercy) - Files.zip | 2025-05-19 11:03 | 5.4M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190306_112335.jpg | 2025-05-19 11:04 | 5.4M | |
![[IMG]](/icons/image2.gif) | 6141_20221005_133626.jpg | 2025-05-19 11:05 | 5.4M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191128_133154.jpg | 2025-05-19 11:03 | 5.4M | |
![[IMG]](/icons/image2.gif) | 6141_20221004_155603.jpg | 2025-05-19 11:07 | 5.4M | |
![[IMG]](/icons/image2.gif) | 2850_IMG_20190610_103832_9 - Copy.jpg | 2025-05-19 11:05 | 5.4M | |
![[IMG]](/icons/image2.gif) | 5034_water tank3.jpg | 2025-05-19 11:05 | 5.4M | |
![[IMG]](/icons/image2.gif) | 1436_GOPR2375.JPG | 2025-05-19 11:03 | 5.4M | |
![[IMG]](/icons/image2.gif) | 5571_IMG_20220202_153422_915.jpg | 2025-05-19 11:04 | 5.4M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190306_160325.jpg | 2025-05-19 11:05 | 5.5M | |
![[ ]](/icons/compressed.gif) | Safe Delivery Secure Future-final_report-files.zip | 2025-05-19 11:05 | 5.5M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_193711.jpg | 2025-05-19 11:03 | 5.5M | |
![[IMG]](/icons/image2.gif) | 2110_Weekly distribution of vegetables.jpg | 2025-05-19 11:04 | 5.5M | |
![[IMG]](/icons/image2.gif) | 6515_20230521_101455.jpg | 2025-05-19 11:05 | 5.5M | |
![[IMG]](/icons/image2.gif) | 3193_IMG_20190710_160958_3.jpg | 2025-05-19 11:04 | 5.5M | |
![[IMG]](/icons/image2.gif) | 5714_COMMUNITY MEETING.jpg | 2025-05-19 11:05 | 5.5M | |
![[IMG]](/icons/image2.gif) | 1021_KW_ZADS_3.jpg | 2025-05-19 11:05 | 5.5M | |
![[IMG]](/icons/image2.gif) | 6288_688A1290.jpg | 2025-05-19 11:03 | 5.5M | |
![[IMG]](/icons/image2.gif) | 6787_IMG_20240515_152634_539.jpg | 2025-05-19 11:03 | 5.5M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191031_102603.jpg | 2025-05-19 11:05 | 5.5M | |
![[IMG]](/icons/image2.gif) | 2850_IMG_20190610_103618_9.jpg | 2025-05-19 11:03 | 5.5M | |
![[VID]](/icons/movie.gif) | 5792_VID-20221203-WA0005.mp4 | 2025-05-19 11:07 | 5.5M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_191259.jpg | 2025-05-19 11:06 | 5.5M | |
![[IMG]](/icons/image2.gif) | 1658_Ecuador Education Hepting community center art.jpg | 2025-05-19 11:03 | 5.5M | |
![[IMG]](/icons/image2.gif) | 3294_DSC_3424.JPG | 2025-05-19 11:03 | 5.5M | |
![[IMG]](/icons/image2.gif) | 6524_IMG_20230627_112909_856.jpg | 2025-05-19 11:03 | 5.5M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191224_090907.jpg | 2025-05-19 11:03 | 5.5M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_164921.jpg | 2025-05-19 11:05 | 5.6M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20200130_151736.jpg | 2025-05-19 11:04 | 5.6M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175122.jpg | 2025-05-19 11:03 | 5.6M | |
![[IMG]](/icons/image2.gif) | 2850_IMG_20190218_164743_3.jpg | 2025-05-19 11:06 | 5.6M | |
![[VID]](/icons/movie.gif) | 2507_Naika Sampeur Testimony- WC.MP4 | 2025-05-19 11:06 | 5.6M | |
![[ ]](/icons/compressed.gif) | Final Report_23-137 (Olafemiwa, Adesola ) - Files.zip | 2025-05-19 11:04 | 5.6M | |
![[IMG]](/icons/image2.gif) | 2956_20190605_103618.jpg | 2025-05-19 11:05 | 5.6M | |
![[IMG]](/icons/image2.gif) | 2514_IMG_0088.JPG | 2025-05-19 11:05 | 5.6M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175126.jpg | 2025-05-19 11:04 | 5.6M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_164937.jpg | 2025-05-19 11:05 | 5.6M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_164303.jpg | 2025-05-19 11:04 | 5.6M | |
![[ ]](/icons/compressed.gif) | Final Report_ (banda, Smart) - Budget Files.zip | 2025-05-19 11:05 | 5.6M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20230126_125828.jpg | 2025-05-19 11:05 | 5.6M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_164931.jpg | 2025-05-19 11:05 | 5.6M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191224_090708.jpg | 2025-05-19 11:04 | 5.6M | |
![[ ]](/icons/compressed.gif) | Final Report_21-119 (Nkorerimana, Eric) - Files.zip | 2025-05-19 11:05 | 5.6M | |
![[IMG]](/icons/image2.gif) | 6113_IMG_20230213_150400.jpg | 2025-05-19 11:04 | 5.6M | |
![[ ]](/icons/compressed.gif) | Final Report_21-136 (Mhango, Denis) - Files.zip | 2025-05-19 11:05 | 5.6M | |
![[IMG]](/icons/image2.gif) | 3389_Nation Nkhoma.JPG | 2025-05-19 11:04 | 5.6M | |
![[IMG]](/icons/image2.gif) | 2850_IMG_20190610_103940_7.jpg | 2025-05-19 11:04 | 5.6M | |
![[IMG]](/icons/image2.gif) | 6291_IMG_6520.JPG | 2025-05-19 11:03 | 5.6M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_163033.jpg | 2025-05-19 11:04 | 5.6M | |
![[IMG]](/icons/image2.gif) | 820_Belize-Glow girls sack race-Sarah Park.JPG | 2025-05-19 11:05 | 5.6M | |
![[IMG]](/icons/image2.gif) | 2858_IMG_5192.JPG | 2025-05-19 11:03 | 5.7M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20230125_142653.jpg | 2025-05-19 11:05 | 5.7M | |
![[ ]](/icons/compressed.gif) | Final Report_21-167 (Kaponda, Francis) - Budget Files.zip | 2025-05-19 11:05 | 5.7M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191112_113928.jpg | 2025-05-19 11:04 | 5.7M | |
![[IMG]](/icons/image2.gif) | 6524_IMG_20230520_145848.jpg | 2025-05-19 11:05 | 5.7M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191128_133211.jpg | 2025-05-19 11:03 | 5.7M | |
![[IMG]](/icons/image2.gif) | 2658_20180519_185718.jpg | 2025-05-19 11:04 | 5.7M | |
![[IMG]](/icons/image2.gif) | 6531_AYO CYCLONE FREEDY TEAM MEMBER.jpg | 2025-05-19 11:05 | 5.7M | |
![[IMG]](/icons/image2.gif) | 6291_IMG_6523.JPG | 2025-05-19 11:04 | 5.7M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191224_090447.jpg | 2025-05-19 11:06 | 5.7M | |
![[IMG]](/icons/image2.gif) | 3643_IMG_2923.jpg | 2025-05-19 11:04 | 5.7M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_162101.jpg | 2025-05-19 11:03 | 5.7M | |
![[IMG]](/icons/image2.gif) | 1242_IMG_4586.JPG | 2025-05-19 11:04 | 5.7M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_162843.jpg | 2025-05-19 11:04 | 5.7M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_162853.jpg | 2025-05-19 11:03 | 5.7M | |
![[IMG]](/icons/image2.gif) | 2107_IMG_8154[1].JPG | 2025-05-19 11:04 | 5.7M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191028_120211.jpg | 2025-05-19 11:07 | 5.7M | |
![[IMG]](/icons/image2.gif) | 3389_Nation Nkhoma and another community Member discuss the repyment scheduling.JPG | 2025-05-19 11:04 | 5.7M | |
![[ ]](/icons/compressed.gif) | Light Leads to Healthier Safer Lives and Education-final_report-files.zip | 2025-05-19 11:03 | 5.7M | |
![[IMG]](/icons/image2.gif) | 5660_20220929_125810.jpg | 2025-05-19 11:04 | 5.7M | |
![[IMG]](/icons/image2.gif) | 2107_IMG_7968[1].JPG | 2025-05-19 11:04 | 5.7M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191106_133808.jpg | 2025-05-19 11:06 | 5.7M | |
![[IMG]](/icons/image2.gif) | 2858_IMG_5197.JPG | 2025-05-19 11:03 | 5.7M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_123217.jpg | 2025-05-19 11:05 | 5.7M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175309.jpg | 2025-05-19 11:06 | 5.8M | |
![[IMG]](/icons/image2.gif) | 6524_IMG_20230821_111550_728.jpg | 2025-05-19 11:05 | 5.8M | |
![[IMG]](/icons/image2.gif) | 7100_PXL_20231104_153424745.MP.jpg | 2025-05-19 11:03 | 5.8M | |
![[IMG]](/icons/image2.gif) | 7000_MV1.jpg | 2025-05-19 11:05 | 5.8M | |
![[ ]](/icons/compressed.gif) | Primary School Mini Library in the Box-final_report-files.zip | 2025-05-19 11:05 | 5.8M | |
![[IMG]](/icons/image2.gif) | 6515_20230521_102045.jpg | 2025-05-19 11:05 | 5.8M | |
![[IMG]](/icons/image2.gif) | 5815_IMG_20220202_080048_1.jpg | 2025-05-19 11:03 | 5.8M | |
![[IMG]](/icons/image2.gif) | 2671_IMG_0064.jpg | 2025-05-19 11:04 | 5.8M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191128_133359.jpg | 2025-05-19 11:03 | 5.8M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20230126_125119.jpg | 2025-05-19 11:05 | 5.8M | |
![[IMG]](/icons/image2.gif) | 6291_IMG_6746.JPG | 2025-05-19 11:03 | 5.8M | |
![[IMG]](/icons/image2.gif) | 2691_P1060818.JPG | 2025-05-19 11:03 | 5.8M | |
![[IMG]](/icons/image2.gif) | 3193_IMG_20190827_121521_1.jpg | 2025-05-19 11:06 | 5.8M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191031_102555.jpg | 2025-05-19 11:06 | 5.8M | |
![[IMG]](/icons/image2.gif) | 3193_IMG_20190323_140551_6.jpg | 2025-05-19 11:04 | 5.8M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_164929.jpg | 2025-05-19 11:05 | 5.8M | |
![[IMG]](/icons/image2.gif) | 2658_20180404_134319.jpg | 2025-05-19 11:03 | 5.8M | |
![[IMG]](/icons/image2.gif) | 2850_IMG_20190610_103802_3.jpg | 2025-05-19 11:05 | 5.8M | |
![[IMG]](/icons/image2.gif) | 2107_IMG_8160[1].JPG | 2025-05-19 11:03 | 5.8M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_162105.jpg | 2025-05-19 11:03 | 5.8M | |
![[IMG]](/icons/image2.gif) | 3193_IMG_20190710_105929_7.jpg | 2025-05-19 11:04 | 5.8M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175335.jpg | 2025-05-19 11:05 | 5.8M | |
![[IMG]](/icons/image2.gif) | 1100_Digging the foundation.jpg | 2025-05-19 11:05 | 5.8M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20221118_173113.jpg | 2025-05-19 11:06 | 5.9M | |
![[IMG]](/icons/image2.gif) | 3548_vegetable garden.jpg | 2025-05-19 11:03 | 5.9M | |
![[IMG]](/icons/image2.gif) | 1021_DSC_0038.JPG | 2025-05-19 11:05 | 5.9M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20230126_130825.jpg | 2025-05-19 11:05 | 5.9M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175520.jpg | 2025-05-19 11:05 | 5.9M | |
![[IMG]](/icons/image2.gif) | 6291_IMG_6747.JPG | 2025-05-19 11:05 | 5.9M | |
![[IMG]](/icons/image2.gif) | 2691_P1060468.JPG | 2025-05-19 11:05 | 5.9M | |
![[IMG]](/icons/image2.gif) | 5815_IMG_20220126_080348.jpg | 2025-05-19 11:04 | 5.9M | |
![[IMG]](/icons/image2.gif) | 6113_IMG_20230213_150335.jpg | 2025-05-19 11:03 | 5.9M | |
![[IMG]](/icons/image2.gif) | 2870__MG_004g6.jpg | 2025-05-19 11:06 | 5.9M | |
![[IMG]](/icons/image2.gif) | 2850_IMG_20190219_095829_8.jpg | 2025-05-19 11:05 | 5.9M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_164820.jpg | 2025-05-19 11:06 | 5.9M | |
![[VID]](/icons/movie.gif) | 6710_2024-07-21 at 19.04.21_75bb036b.mp4 | 2025-05-19 11:03 | 5.9M | |
![[IMG]](/icons/image2.gif) | 3137_Latrine and Compost bin.jpg | 2025-05-19 11:03 | 5.9M | |
![[IMG]](/icons/image2.gif) | 1242_IMG_4798.JPG | 2025-05-19 11:04 | 5.9M | |
![[IMG]](/icons/image2.gif) | 5454_IMG_20211221_084825_653.jpg | 2025-05-19 11:07 | 6.0M | |
![[IMG]](/icons/image2.gif) | 6787_IMG_0014.JPG | 2025-05-19 11:03 | 6.0M | |
![[IMG]](/icons/image2.gif) | 6671_IMG_9634.jpg | 2025-05-19 11:05 | 6.0M | |
![[IMG]](/icons/image2.gif) | 6829_IMG_20231217_101907_338.jpg | 2025-05-19 11:05 | 6.0M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_174230.jpg | 2025-05-19 11:03 | 6.0M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_174131.jpg | 2025-05-19 11:05 | 6.0M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_164938.jpg | 2025-05-19 11:06 | 6.0M | |
![[ ]](/icons/compressed.gif) | 6299_Photos (2).zip | 2025-05-19 11:05 | 6.0M | |
![[IMG]](/icons/image2.gif) | 2691_P1060445.JPG | 2025-05-19 11:04 | 6.0M | |
![[IMG]](/icons/image2.gif) | 1103_Panama_AlbertoGil&EuriviadesPimentel_KarenRitland.JPG | 2025-05-19 11:05 | 6.0M | |
![[IMG]](/icons/image2.gif) | 1026_Bench Kasiya outreach.jpg | 2025-05-19 11:03 | 6.0M | |
![[IMG]](/icons/image2.gif) | 1100_Local children walk across bricks made for the construction of the wall .jpg | 2025-05-19 11:05 | 6.0M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20230127_125505.jpg | 2025-05-19 11:06 | 6.0M | |
![[VID]](/icons/movie.gif) | 2129_video-1493416447.mp4 | 2025-05-19 11:05 | 6.0M | |
![[IMG]](/icons/image2.gif) | 5648_20221207130719_IMG_9088.jpg | 2025-05-19 11:05 | 6.0M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_164449.jpg | 2025-05-19 11:06 | 6.1M | |
![[IMG]](/icons/image2.gif) | 2858_IMG_5195.JPG | 2025-05-19 11:04 | 6.1M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_162935.jpg | 2025-05-19 11:04 | 6.1M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_174139.jpg | 2025-05-19 11:05 | 6.1M | |
![[IMG]](/icons/image2.gif) | 2691_P1060746.JPG | 2025-05-19 11:07 | 6.1M | |
![[IMG]](/icons/image2.gif) | 3193_IMG_20190710_105923_0.jpg | 2025-05-19 11:03 | 6.1M | |
![[IMG]](/icons/image2.gif) | 5648_20221207165710_IMG_9321.jpg | 2025-05-19 11:05 | 6.1M | |
![[IMG]](/icons/image2.gif) | 2850_IMG_20190219_121250_6 - Copy (2).jpg | 2025-05-19 11:03 | 6.1M | |
![[IMG]](/icons/image2.gif) | 3594_20191212_120446.jpg | 2025-05-19 11:03 | 6.1M | |
![[ ]](/icons/compressed.gif) | Final Report_20-062 (Kalima, Rex) - Budget Files.zip | 2025-05-19 11:05 | 6.1M | |
![[IMG]](/icons/image2.gif) | 3548_mixing of the organic fertilizer ingredients.jpg | 2025-05-19 11:05 | 6.1M | |
![[ ]](/icons/compressed.gif) | Creative Arts Health and Wellbeing for OVC On and Off the Streets of Bamenda-final_report-files.zip | 2025-05-19 11:05 | 6.1M | |
![[ ]](/icons/compressed.gif) | Final Report_18-192 (Kathako, Abraham) - Budget Files.zip | 2025-05-19 11:05 | 6.1M | |
![[ ]](/icons/compressed.gif) | Information Communication Learning Center-final_report-files.zip | 2025-05-19 11:03 | 6.1M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_191236.jpg | 2025-05-19 11:05 | 6.1M | |
![[IMG]](/icons/image2.gif) | 2691_P1060440.JPG | 2025-05-19 11:04 | 6.1M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_163039.jpg | 2025-05-19 11:05 | 6.2M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191112_113904.jpg | 2025-05-19 11:05 | 6.2M | |
![[IMG]](/icons/image2.gif) | 5603_IMG-20230428-WA0006.jpg | 2025-05-19 11:03 | 6.2M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20230126_132123.jpg | 2025-05-19 11:05 | 6.2M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_164452.jpg | 2025-05-19 11:05 | 6.2M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20221118_145620.jpg | 2025-05-19 11:05 | 6.2M | |
![[IMG]](/icons/image2.gif) | 3193_IMG_20190827_121428_5.jpg | 2025-05-19 11:03 | 6.2M | |
![[IMG]](/icons/image2.gif) | 1103_Panama_ArtisanGroup_KarenRitland.JPG | 2025-05-19 11:03 | 6.2M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20230127_125449.jpg | 2025-05-19 11:03 | 6.2M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_164243.jpg | 2025-05-19 11:05 | 6.2M | |
![[IMG]](/icons/image2.gif) | 1693_DSCN0743.JPG | 2025-05-19 11:06 | 6.2M | |
![[IMG]](/icons/image2.gif) | 3193_IMG_20190710_160858_0.jpg | 2025-05-19 11:03 | 6.2M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175401.jpg | 2025-05-19 11:03 | 6.3M | |
![[IMG]](/icons/image2.gif) | 3294_DSC_0125.jpg | 2025-05-19 11:05 | 6.3M | |
![[IMG]](/icons/image2.gif) | 5815_IMG_20220202_075325.jpg | 2025-05-19 11:04 | 6.3M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_164238.jpg | 2025-05-19 11:05 | 6.3M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175115.jpg | 2025-05-19 11:04 | 6.3M | |
![[IMG]](/icons/image2.gif) | 5648_20221207161103_IMG_9264.jpg | 2025-05-19 11:05 | 6.3M | |
![[IMG]](/icons/image2.gif) | 3548_beneficiaries. members of mtimaumoza group.jpg | 2025-05-19 11:07 | 6.3M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_165053.jpg | 2025-05-19 11:03 | 6.3M | |
![[IMG]](/icons/image2.gif) | 2991_20181027_161325.jpg | 2025-05-19 11:05 | 6.3M | |
![[VID]](/icons/movie.gif) | 3730_WhatsApp Video 2019-09-16 at 10.12.23 PM.mp4 | 2025-05-19 11:05 | 6.3M | |
![[IMG]](/icons/image2.gif) | 1436_GOPR2277.JPG | 2025-05-19 11:03 | 6.3M | |
![[IMG]](/icons/image2.gif) | 3193_IMG_20190710_160855_6.jpg | 2025-05-19 11:04 | 6.3M | |
![[IMG]](/icons/image2.gif) | 3643_IMG_3041.jpg | 2025-05-19 11:04 | 6.3M | |
![[IMG]](/icons/image2.gif) | 5447_IMG_8547.JPG | 2025-05-19 11:03 | 6.4M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_154436.jpg | 2025-05-19 11:06 | 6.4M | |
![[IMG]](/icons/image2.gif) | 4756_GiST 3rd-06-54.jpg | 2025-05-19 11:03 | 6.4M | |
![[IMG]](/icons/image2.gif) | 2691_P1040035.JPG | 2025-05-19 11:03 | 6.4M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (32).jpg | 2025-05-19 11:04 | 6.4M | |
![[IMG]](/icons/image2.gif) | 1436_GOPR2269.JPG | 2025-05-19 11:05 | 6.4M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191112_113854.jpg | 2025-05-19 11:03 | 6.4M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_165048.jpg | 2025-05-19 11:03 | 6.4M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191112_114005.jpg | 2025-05-19 11:03 | 6.4M | |
![[IMG]](/icons/image2.gif) | 2850_IMG_20190130_144732_2.jpg | 2025-05-19 11:05 | 6.4M | |
![[IMG]](/icons/image2.gif) | 2658_20180519_190111.jpg | 2025-05-19 11:04 | 6.4M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20230126_115558.jpg | 2025-05-19 11:03 | 6.4M | |
![[ ]](/icons/compressed.gif) | Final Report_18-178 (Katemba, Mweta) - Files.zip | 2025-05-19 11:03 | 6.4M | |
![[IMG]](/icons/image2.gif) | 1430_DSC_0795.JPG | 2025-05-19 11:05 | 6.4M | |
![[ ]](/icons/layout.gif) | 3608_3608_RECEIPTS APICULTURE(1) (1).pdf | 2025-05-19 11:05 | 6.4M | |
![[ ]](/icons/layout.gif) | 3608_RECEIPTS APICULTURE(1).pdf | 2025-05-19 11:05 | 6.4M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_180240.jpg | 2025-05-19 11:03 | 6.4M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_180242.jpg | 2025-05-19 11:04 | 6.4M | |
![[IMG]](/icons/image2.gif) | 3294_DSC_0139.jpg | 2025-05-19 11:03 | 6.4M | |
![[IMG]](/icons/image2.gif) | 6787_IMG_20240515_153156_910.jpg | 2025-05-19 11:05 | 6.4M | |
![[IMG]](/icons/image2.gif) | 1021_DSC_0049.JPG | 2025-05-19 11:03 | 6.5M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20230126_131914.jpg | 2025-05-19 11:03 | 6.5M | |
![[IMG]](/icons/image2.gif) | 2691_P1040036.JPG | 2025-05-19 11:06 | 6.5M | |
![[IMG]](/icons/image2.gif) | 3971_IMG_1222.JPG | 2025-05-19 11:04 | 6.5M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20230127_123506.jpg | 2025-05-19 11:06 | 6.5M | |
![[IMG]](/icons/image2.gif) | 820_Belize- Jennifer, Elisha, Johanna- Sarah Park.JPG | 2025-05-19 11:04 | 6.5M | |
![[IMG]](/icons/image2.gif) | 2993_20190809_121925.jpg | 2025-05-19 11:05 | 6.5M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175509.jpg | 2025-05-19 11:05 | 6.5M | |
![[VID]](/icons/movie.gif) | 5585_Ngwenya Literacy Hub Project (1).mp4 | 2025-05-19 11:05 | 6.5M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175358.jpg | 2025-05-19 11:06 | 6.5M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175341.jpg | 2025-05-19 11:05 | 6.5M | |
![[IMG]](/icons/image2.gif) | 3294_DSC_2970.JPG | 2025-05-19 11:04 | 6.5M | |
![[IMG]](/icons/image2.gif) | 6291_IMG_6524.JPG | 2025-05-19 11:04 | 6.5M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191106_133844.jpg | 2025-05-19 11:03 | 6.6M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_125318.jpg | 2025-05-19 11:03 | 6.6M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_162947.jpg | 2025-05-19 11:05 | 6.6M | |
![[IMG]](/icons/image2.gif) | 2691_P1060442.JPG | 2025-05-19 11:04 | 6.6M | |
![[IMG]](/icons/image2.gif) | 1430_DSC_0793.JPG | 2025-05-19 11:03 | 6.6M | |
![[IMG]](/icons/image2.gif) | 2658_20180503_131718 (1).jpg | 2025-05-19 11:04 | 6.6M | |
![[IMG]](/icons/image2.gif) | 2658_20180503_131718.jpg | 2025-05-19 11:05 | 6.6M | |
![[IMG]](/icons/image2.gif) | 2671_IMG_0084.jpg | 2025-05-19 11:06 | 6.6M | |
![[IMG]](/icons/image2.gif) | 5648_20221207162207_IMG_9278.jpg | 2025-05-19 11:03 | 6.6M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175318.jpg | 2025-05-19 11:04 | 6.6M | |
![[IMG]](/icons/image2.gif) | 1693_DSCN0777.JPG | 2025-05-19 11:05 | 6.6M | |
![[IMG]](/icons/image2.gif) | 6381_DSC_0477.JPG | 2025-05-19 11:05 | 6.6M | |
![[IMG]](/icons/image2.gif) | 6381_DSC_0221.JPG | 2025-05-19 11:05 | 6.6M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_125151.jpg | 2025-05-19 11:05 | 6.7M | |
![[IMG]](/icons/image2.gif) | 3709_20200208_123910.jpg | 2025-05-19 11:05 | 6.7M | |
![[IMG]](/icons/image2.gif) | 2691_P1050906.JPG | 2025-05-19 11:05 | 6.7M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_162806.jpg | 2025-05-19 11:06 | 6.7M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175504.jpg | 2025-05-19 11:03 | 6.7M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_174125.jpg | 2025-05-19 11:03 | 6.7M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191112_113918.jpg | 2025-05-19 11:03 | 6.7M | |
![[IMG]](/icons/image2.gif) | 820_Belize-GLOW Camp girls, Lauren Schilperoort-Sarah Park.JPG | 2025-05-19 11:07 | 6.7M | |
![[IMG]](/icons/image2.gif) | 2850_IMG_20190219_100542_2 - Copy (2).jpg | 2025-05-19 11:07 | 6.7M | |
![[IMG]](/icons/image2.gif) | 1038_P1010934.JPG | 2025-05-19 11:04 | 6.7M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_165102.jpg | 2025-05-19 11:03 | 6.7M | |
![[ ]](/icons/compressed.gif) | Final Report_17-091 (Sullivan, Tara) - Files.zip | 2025-05-19 11:05 | 6.7M | |
![[IMG]](/icons/image2.gif) | 3933_20191023_141533.jpg | 2025-05-19 11:05 | 6.7M | |
![[ ]](/icons/compressed.gif) | Final Report_19-036 (Nzima, Chimwemwe ) - Budget Files.zip | 2025-05-19 11:05 | 6.7M | |
![[IMG]](/icons/image2.gif) | 6524_IMG_20230821_112152_589.jpg | 2025-05-19 11:05 | 6.7M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_125315.jpg | 2025-05-19 11:07 | 6.7M | |
![[ ]](/icons/compressed.gif) | Final Report_18-037 (Black, Michael) - Files.zip | 2025-05-19 11:04 | 6.7M | |
![[IMG]](/icons/image2.gif) | 1038_P1010900.JPG | 2025-05-19 11:03 | 6.7M | |
![[IMG]](/icons/image2.gif) | 6381_DSC_0193.JPG | 2025-05-19 11:03 | 6.8M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_125149.jpg | 2025-05-19 11:06 | 6.8M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175645.jpg | 2025-05-19 11:05 | 6.8M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_180253.jpg | 2025-05-19 11:05 | 6.8M | |
![[IMG]](/icons/image2.gif) | 5660_20220929_125511.jpg | 2025-05-19 11:05 | 6.8M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (37).jpg | 2025-05-19 11:03 | 6.8M | |
![[IMG]](/icons/image2.gif) | 6381_IMG_20230422_121646.jpg | 2025-05-19 11:04 | 6.8M | |
![[IMG]](/icons/image2.gif) | 6381_DSC_0388.JPG | 2025-05-19 11:06 | 6.8M | |
![[IMG]](/icons/image2.gif) | 2658_20180327_135109.jpg | 2025-05-19 11:06 | 6.8M | |
![[IMG]](/icons/image2.gif) | 1436_GOPR2295.JPG | 2025-05-19 11:05 | 6.8M | |
![[IMG]](/icons/image2.gif) | 6296_20230211_142226.jpg | 2025-05-19 11:07 | 6.8M | |
![[VID]](/icons/movie.gif) | 6104_VID-20210920-WA0037.mp4 | 2025-05-19 11:07 | 6.8M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_165046.jpg | 2025-05-19 11:07 | 6.8M | |
![[IMG]](/icons/image2.gif) | 3294_DSC_0130.jpg | 2025-05-19 11:04 | 6.8M | |
![[IMG]](/icons/image2.gif) | 2658_20180503_131722 (1).jpg | 2025-05-19 11:06 | 6.8M | |
![[IMG]](/icons/image2.gif) | 2658_20180503_131722.jpg | 2025-05-19 11:05 | 6.8M | |
![[ ]](/icons/compressed.gif) | Final Report_18-106 (Banda, Tendai) - Files.zip | 2025-05-19 11:03 | 6.8M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_164502.jpg | 2025-05-19 11:04 | 6.8M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_174159.jpg | 2025-05-19 11:05 | 6.8M | |
![[IMG]](/icons/image2.gif) | 820_Belize-GLOW Camp participants-Sarah Park.JPG | 2025-05-19 11:06 | 6.8M | |
![[IMG]](/icons/image2.gif) | 6381_DSC_0437.JPG | 2025-05-19 11:05 | 6.9M | |
![[IMG]](/icons/image2.gif) | 5809_Farmers formulating their own Neem extract.jpg | 2025-05-19 11:03 | 6.9M | |
![[ ]](/icons/compressed.gif) | Final Report_18-166 (Katungwe, Noriah) - Budget Files.zip | 2025-05-19 11:05 | 6.9M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_125316.jpg | 2025-05-19 11:05 | 6.9M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (29).jpg | 2025-05-19 11:05 | 6.9M | |
![[ ]](/icons/compressed.gif) | Final Report_18-028 (Mwafulirwa, Zizwa) - Files.zip | 2025-05-19 11:03 | 6.9M | |
![[IMG]](/icons/image2.gif) | 2691_P1070059.JPG | 2025-05-19 11:03 | 6.9M | |
![[IMG]](/icons/image2.gif) | 2658_20180313_125142.jpg | 2025-05-19 11:05 | 6.9M | |
![[IMG]](/icons/image2.gif) | 5454_IMG_20211221_085625_749.jpg | 2025-05-19 11:05 | 6.9M | |
![[VID]](/icons/movie.gif) | 4524_Student-1.mp4 | 2025-05-19 11:03 | 6.9M | |
![[IMG]](/icons/image2.gif) | 2993_20190809_122047.jpg | 2025-05-19 11:04 | 6.9M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20230126_171453.jpg | 2025-05-19 11:03 | 6.9M | |
![[IMG]](/icons/image2.gif) | 2658_20180519_190101.jpg | 2025-05-19 11:03 | 6.9M | |
![[IMG]](/icons/image2.gif) | 2658_20180503_131734 (1).jpg | 2025-05-19 11:06 | 6.9M | |
![[IMG]](/icons/image2.gif) | 2658_20180503_131734.jpg | 2025-05-19 11:05 | 6.9M | |
![[IMG]](/icons/image2.gif) | 2850_IMG_20190129_110958_8.jpg | 2025-05-19 11:03 | 6.9M | |
![[IMG]](/icons/image2.gif) | 2956_20190605_112821.jpg | 2025-05-19 11:03 | 6.9M | |
![[IMG]](/icons/image2.gif) | 6381_DSC_0258.JPG | 2025-05-19 11:04 | 6.9M | |
![[IMG]](/icons/image2.gif) | 6381_DSC_0337.JPG | 2025-05-19 11:03 | 6.9M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_174202.jpg | 2025-05-19 11:05 | 7.0M | |
![[IMG]](/icons/image2.gif) | 2691_P1070945.JPG | 2025-05-19 11:05 | 7.0M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (30).jpg | 2025-05-19 11:05 | 7.0M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_124141.jpg | 2025-05-19 11:03 | 7.0M | |
![[IMG]](/icons/image2.gif) | 3620_IMG_20191128_133227.jpg | 2025-05-19 11:06 | 7.0M | |
![[IMG]](/icons/image2.gif) | 6381_DSC_0215.JPG | 2025-05-19 11:05 | 7.0M | |
![[IMG]](/icons/image2.gif) | 5809_Women preparing ash and neem extracts.jpg | 2025-05-19 11:03 | 7.0M | |
![[IMG]](/icons/image2.gif) | 3594_20191216_101426.jpg | 2025-05-19 11:04 | 7.0M | |
![[IMG]](/icons/image2.gif) | 6524_IMG_20230821_113905_315.jpg | 2025-05-19 11:03 | 7.0M | |
![[IMG]](/icons/image2.gif) | 2234_DSC00923.JPG | 2025-05-19 11:07 | 7.0M | |
![[IMG]](/icons/image2.gif) | 2691_P1070953.JPG | 2025-05-19 11:03 | 7.0M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_154418.jpg | 2025-05-19 11:05 | 7.0M | |
![[IMG]](/icons/image2.gif) | 2691_P1060441.JPG | 2025-05-19 11:03 | 7.0M | |
![[IMG]](/icons/image2.gif) | 6515_20230521_102117.jpg | 2025-05-19 11:05 | 7.0M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190305_172503.jpg | 2025-05-19 11:04 | 7.0M | |
![[IMG]](/icons/image2.gif) | 6381_DSC_0079.JPG | 2025-05-19 11:05 | 7.0M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190305_172500.jpg | 2025-05-19 11:04 | 7.1M | |
![[IMG]](/icons/image2.gif) | 4666_mpamba incinerator 5.jpg | 2025-05-19 11:03 | 7.1M | |
![[IMG]](/icons/image2.gif) | 2658_20180327_135106.jpg | 2025-05-19 11:03 | 7.1M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_164459.jpg | 2025-05-19 11:06 | 7.1M | |
![[ ]](/icons/compressed.gif) | Final Report_18-181 (Kalima, Rex) - Budget Files.zip | 2025-05-19 11:03 | 7.1M | |
![[IMG]](/icons/image2.gif) | 5829_20220115124741_IMG_3985.JPG | 2025-05-19 11:06 | 7.1M | |
![[IMG]](/icons/image2.gif) | 2858_IMG_6774.JPG | 2025-05-19 11:05 | 7.1M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190305_172527.jpg | 2025-05-19 11:03 | 7.1M | |
![[IMG]](/icons/image2.gif) | 1038_P1010931.JPG | 2025-05-19 11:05 | 7.1M | |
![[IMG]](/icons/image2.gif) | 2691_P1060294.JPG | 2025-05-19 11:05 | 7.1M | |
![[IMG]](/icons/image2.gif) | 1450_Screenshot (2).png | 2025-05-19 11:06 | 7.1M | |
![[IMG]](/icons/image2.gif) | 5648_20221207125312_IMG_9082.jpg | 2025-05-19 11:06 | 7.2M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20230127_123559.jpg | 2025-05-19 11:07 | 7.2M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175346.jpg | 2025-05-19 11:05 | 7.2M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_154431.jpg | 2025-05-19 11:03 | 7.2M | |
![[IMG]](/icons/image2.gif) | 2691_P1060276.JPG | 2025-05-19 11:05 | 7.2M | |
![[IMG]](/icons/image2.gif) | 5284_feedmaking in process.JPG | 2025-05-19 11:05 | 7.3M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_124129.jpg | 2025-05-19 11:05 | 7.3M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (26).jpg | 2025-05-19 11:05 | 7.3M | |
![[IMG]](/icons/image2.gif) | 6381_DSC_0145.JPG | 2025-05-19 11:05 | 7.3M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190305_172457.jpg | 2025-05-19 11:05 | 7.3M | |
![[IMG]](/icons/image2.gif) | 2850_IMG_20190409_105200_2.jpg | 2025-05-19 11:03 | 7.3M | |
![[VID]](/icons/movie.gif) | 2373_Greens Project.mp4 | 2025-05-19 11:05 | 7.3M | |
![[IMG]](/icons/image2.gif) | 2658_20180519_114858.jpg | 2025-05-19 11:05 | 7.3M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175352.jpg | 2025-05-19 11:04 | 7.3M | |
![[IMG]](/icons/image2.gif) | 2658_20180602_180211.jpg | 2025-05-19 11:05 | 7.3M | |
![[IMG]](/icons/image2.gif) | 2691_P1060455.JPG | 2025-05-19 11:04 | 7.4M | |
![[IMG]](/icons/image2.gif) | 6515_20230521_102120.jpg | 2025-05-19 11:05 | 7.4M | |
![[IMG]](/icons/image2.gif) | 1103_Panama_EuriviadesPimentel_KarenRitland.JPG | 2025-05-19 11:03 | 7.4M | |
![[IMG]](/icons/image2.gif) | 7103_Rise Peer Support Group Session #2.JPG | 2025-05-19 11:04 | 7.4M | |
![[IMG]](/icons/image2.gif) | 2691_P1040031.JPG | 2025-05-19 11:04 | 7.4M | |
![[IMG]](/icons/image2.gif) | 2691_P1060112.JPG | 2025-05-19 11:03 | 7.4M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175213.jpg | 2025-05-19 11:04 | 7.4M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175224.jpg | 2025-05-19 11:03 | 7.4M | |
![[IMG]](/icons/image2.gif) | 5454_IMG_20211221_085538_097.jpg | 2025-05-19 11:05 | 7.4M | |
![[IMG]](/icons/image2.gif) | 3389_Nation Nkhoma Leads a session during products launch day.JPG | 2025-05-19 11:04 | 7.4M | |
![[VID]](/icons/movie.gif) | 4713_Chaseta Protected Well Celebration.mp4 | 2025-05-19 11:05 | 7.5M | |
![[IMG]](/icons/image2.gif) | 2148_DSC04396.JPG | 2025-05-19 11:04 | 7.5M | |
![[IMG]](/icons/image2.gif) | 3971_IMG_1592.JPG | 2025-05-19 11:05 | 7.5M | |
![[IMG]](/icons/image2.gif) | 2691_P1070020.JPG | 2025-05-19 11:03 | 7.5M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (27).jpg | 2025-05-19 11:06 | 7.5M | |
![[IMG]](/icons/image2.gif) | 5648_20221207151913_IMG_9205.jpg | 2025-05-19 11:04 | 7.5M | |
![[IMG]](/icons/image2.gif) | 2530_IMG_6236.JPG | 2025-05-19 11:05 | 7.5M | |
![[IMG]](/icons/image2.gif) | 1436_GOPR2818.JPG | 2025-05-19 11:03 | 7.6M | |
![[ ]](/icons/compressed.gif) | Chairs and tables for classroom-final_report-files.zip | 2025-05-19 11:03 | 7.6M | |
![[IMG]](/icons/image2.gif) | 3594_20200308_160435.jpg | 2025-05-19 11:05 | 7.6M | |
![[IMG]](/icons/image2.gif) | 1103_Panama_EbangelistaJil_KarenRitland.JPG | 2025-05-19 11:05 | 7.6M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (28).jpg | 2025-05-19 11:05 | 7.6M | |
![[IMG]](/icons/image2.gif) | 2691_P1060111.JPG | 2025-05-19 11:04 | 7.6M | |
![[IMG]](/icons/image2.gif) | 3594_20200214_154203.jpg | 2025-05-19 11:04 | 7.6M | |
![[IMG]](/icons/image2.gif) | 2658_20180315_113243.jpg | 2025-05-19 11:07 | 7.7M | |
![[IMG]](/icons/image2.gif) | 2658_20180315_113243(0).jpg | 2025-05-19 11:05 | 7.7M | |
![[IMG]](/icons/image2.gif) | 5648_20221207134051_IMG_9108.jpg | 2025-05-19 11:05 | 7.7M | |
![[IMG]](/icons/image2.gif) | 2658_20180519_114912.jpg | 2025-05-19 11:03 | 7.7M | |
![[IMG]](/icons/image2.gif) | 2691_P1060721.JPG | 2025-05-19 11:04 | 7.7M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175619.jpg | 2025-05-19 11:05 | 7.7M | |
![[IMG]](/icons/image2.gif) | 6138_IMG_20230127_123431.jpg | 2025-05-19 11:04 | 7.7M | |
![[IMG]](/icons/image2.gif) | 3074_IMG_20190306_154203.jpg | 2025-05-19 11:05 | 7.7M | |
![[IMG]](/icons/image2.gif) | 3294_DSC_0118.JPG | 2025-05-19 11:04 | 7.7M | |
![[IMG]](/icons/image2.gif) | 2658_20180519_114903.jpg | 2025-05-19 11:05 | 7.7M | |
![[IMG]](/icons/image2.gif) | 1103_Panama_DamarisRodriguez&AbdielRodriguez_KarenRitland.JPG | 2025-05-19 11:06 | 7.7M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_123221.jpg | 2025-05-19 11:04 | 7.7M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_154422.jpg | 2025-05-19 11:05 | 7.7M | |
![[IMG]](/icons/image2.gif) | 1103_Panama_IsmaelGilandChildren_KarenRitland.JPG | 2025-05-19 11:03 | 7.8M | |
![[IMG]](/icons/image2.gif) | 6829_IMG_20240201_150742_809.jpg | 2025-05-19 11:05 | 7.8M | |
![[IMG]](/icons/image2.gif) | 2658_20180519_114438.jpg | 2025-05-19 11:03 | 7.8M | |
![[IMG]](/icons/image2.gif) | 5829_20220115123156_IMG_3974.JPG | 2025-05-19 11:06 | 7.8M | |
![[ ]](/icons/compressed.gif) | 6299_Photos (1).zip | 2025-05-19 11:05 | 7.8M | |
![[IMG]](/icons/image2.gif) | 5648_20221207151633_IMG_9194.jpg | 2025-05-19 11:05 | 7.8M | |
![[IMG]](/icons/image2.gif) | 6281_PXL_20230313_095822363.MP_093247.jpg | 2025-05-19 11:05 | 7.9M | |
![[IMG]](/icons/image2.gif) | 2658_20180327_135103.jpg | 2025-05-19 11:05 | 7.9M | |
![[IMG]](/icons/image2.gif) | 2691_P1060245.JPG | 2025-05-19 11:03 | 7.9M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175239.jpg | 2025-05-19 11:04 | 7.9M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175622.jpg | 2025-05-19 11:05 | 7.9M | |
![[IMG]](/icons/image2.gif) | 6381_DSC_0755.JPG | 2025-05-19 11:05 | 7.9M | |
![[IMG]](/icons/image2.gif) | 2397_Next Gen Female CEO 13.JPG | 2025-05-19 11:05 | 7.9M | |
![[IMG]](/icons/image2.gif) | 6381_DSC_0151.JPG | 2025-05-19 11:07 | 7.9M | |
![[IMG]](/icons/image2.gif) | 1436_GOPR2854.JPG | 2025-05-19 11:04 | 7.9M | |
![[IMG]](/icons/image2.gif) | 5648_20221207170026_IMG_9333.jpg | 2025-05-19 11:03 | 7.9M | |
![[ ]](/icons/compressed.gif) | Save the children from the rain-final_report-files.zip | 2025-05-19 11:07 | 7.9M | |
![[IMG]](/icons/image2.gif) | 5648_20221207150437_IMG_9186.jpg | 2025-05-19 11:05 | 7.9M | |
![[IMG]](/icons/image2.gif) | 2691_P1060466.JPG | 2025-05-19 11:05 | 7.9M | |
![[IMG]](/icons/image2.gif) | 2658_20180327_120426.jpg | 2025-05-19 11:03 | 8.0M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175205.jpg | 2025-05-19 11:05 | 8.0M | |
![[IMG]](/icons/image2.gif) | 2658_20180313_125150.jpg | 2025-05-19 11:05 | 8.0M | |
![[VID]](/icons/movie.gif) | 2507_Dieuvela Bien Aime testimony WC.MP4 | 2025-05-19 11:05 | 8.0M | |
![[IMG]](/icons/image2.gif) | 2850_IMG_20190409_105106_8.jpg | 2025-05-19 11:04 | 8.0M | |
![[IMG]](/icons/image2.gif) | 5809_New emerging suckers from one of the planting chambers.jpg | 2025-05-19 11:04 | 8.0M | |
![[VID]](/icons/movie.gif) | 5640_Testimonial of a beneficiary.mp4 | 2025-05-19 11:05 | 8.0M | |
![[IMG]](/icons/image2.gif) | 2850_IMG_20190409_103016_2 - Copy.jpg | 2025-05-19 11:03 | 8.0M | |
![[IMG]](/icons/image2.gif) | 7103_Rise Peer Support Group Session #1.JPG | 2025-05-19 11:07 | 8.1M | |
![[IMG]](/icons/image2.gif) | 6381_20230726_181659.jpg | 2025-05-19 11:03 | 8.1M | |
![[ ]](/icons/compressed.gif) | The Greens Go To School Campaign-final_report-files.zip | 2025-05-19 11:05 | 8.1M | |
![[IMG]](/icons/image2.gif) | 5648_20221207134401_IMG_9121.jpg | 2025-05-19 11:05 | 8.1M | |
![[ ]](/icons/compressed.gif) | Final Report_19-039 (Kachiguma, Alinafe) - Files.zip | 2025-05-19 11:05 | 8.1M | |
![[ ]](/icons/compressed.gif) | Final Report_18-169 (Phiri, Enelless) - Budget Files.zip | 2025-05-19 11:03 | 8.2M | |
![[IMG]](/icons/image2.gif) | 5648_20221207165627_IMG_9319.jpg | 2025-05-19 11:03 | 8.2M | |
![[IMG]](/icons/image2.gif) | 2658_20180605_175243.jpg | 2025-05-19 11:03 | 8.2M | |
![[VID]](/icons/movie.gif) | 6138_VID_20230127_130331.mp4 | 2025-05-19 11:03 | 8.2M | |
![[IMG]](/icons/image2.gif) | 2658_20180327_120421.jpg | 2025-05-19 11:06 | 8.2M | |
![[IMG]](/icons/image2.gif) | 5648_20221207151015_IMG_9190.jpg | 2025-05-19 11:03 | 8.2M | |
![[ ]](/icons/compressed.gif) | Final Report_19-004 (Chipala, Hussein) - Budget Files.zip | 2025-05-19 11:05 | 8.2M | |
![[VID]](/icons/movie.gif) | 2127_VID-20170324-WA0000.mp4 | 2025-05-19 11:05 | 8.2M | |
![[IMG]](/icons/image2.gif) | 6524_IMG_20230821_112109_803.jpg | 2025-05-19 11:07 | 8.2M | |
![[IMG]](/icons/image2.gif) | 6524_IMG_20230821_111933_457.jpg | 2025-05-19 11:03 | 8.2M | |
![[IMG]](/icons/image2.gif) | 2850_IMG_20190401_143233_8.jpg | 2025-05-19 11:03 | 8.3M | |
![[IMG]](/icons/image2.gif) | 5829_20220115124752_IMG_3987.JPG | 2025-05-19 11:03 | 8.3M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_123546.jpg | 2025-05-19 11:06 | 8.3M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_123600.jpg | 2025-05-19 11:03 | 8.3M | |
![[IMG]](/icons/image2.gif) | 1103_Panama_Juana&JasbierMartinez_KarenRitland.JPG | 2025-05-19 11:05 | 8.3M | |
![[IMG]](/icons/image2.gif) | 2397_Next Gen Female CEO 12.JPG | 2025-05-19 11:05 | 8.3M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_123603.jpg | 2025-05-19 11:03 | 8.3M | |
![[ ]](/icons/compressed.gif) | 5284_WhatsApp Unknown 2022-10-12 at 10.48.44.zip | 2025-05-19 11:03 | 8.3M | |
![[IMG]](/icons/image2.gif) | 2691_P1060457.JPG | 2025-05-19 11:04 | 8.3M | |
![[IMG]](/icons/image2.gif) | 6288_688A1026.jpg | 2025-05-19 11:07 | 8.3M | |
![[IMG]](/icons/image2.gif) | 5829_20220115123142_IMG_3970.JPG | 2025-05-19 11:05 | 8.3M | |
![[IMG]](/icons/image2.gif) | 2658_20180604_123551.jpg | 2025-05-19 11:05 | 8.4M | |
![[IMG]](/icons/image2.gif) | 5648_20221207145119_IMG_9178.jpg | 2025-05-19 11:07 | 8.4M | |
![[IMG]](/icons/image2.gif) | 3643_IMG_3138.jpg | 2025-05-19 11:04 | 8.4M | |
![[VID]](/icons/movie.gif) | 2507_Lamia Makkar Testimonies WC.MP4 | 2025-05-19 11:04 | 8.4M | |
![[IMG]](/icons/image2.gif) | 3643_IMG_3231.jpg | 2025-05-19 11:05 | 8.4M | |
![[IMG]](/icons/image2.gif) | 5648_20221207143640_IMG_9170.jpg | 2025-05-19 11:06 | 8.4M | |
![[IMG]](/icons/image2.gif) | 2691_P1060733.JPG | 2025-05-19 11:05 | 8.4M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_4960.JPG | 2025-05-19 11:04 | 8.5M | |
![[IMG]](/icons/image2.gif) | 2658_20180519_114457.jpg | 2025-05-19 11:04 | 8.5M | |
![[IMG]](/icons/image2.gif) | 3643_IMG_3109.jpg | 2025-05-19 11:03 | 8.5M | |
![[ ]](/icons/compressed.gif) | Homoine Girls sewing school -final_report-files.zip | 2025-05-19 11:03 | 8.5M | |
![[IMG]](/icons/image2.gif) | 7370_IMG_1724.PNG | 2025-07-24 16:47 | 8.5M | |
![[IMG]](/icons/image2.gif) | 2658_20180519_114527.jpg | 2025-05-19 11:04 | 8.5M | |
![[ ]](/icons/compressed.gif) | 1452_Cyabayaga Health Center Rwanda Maternity Ward Photos.zip | 2025-05-19 11:03 | 8.5M | |
![[IMG]](/icons/image2.gif) | 5648_20221207142509_IMG_9168.jpg | 2025-05-19 11:05 | 8.6M | |
![[IMG]](/icons/image2.gif) | 5648_20221207134456_IMG_9126.jpg | 2025-05-19 11:07 | 8.6M | |
![[IMG]](/icons/image2.gif) | 2397_Next Gen Female CEO 7.JPG | 2025-05-19 11:06 | 8.6M | |
![[ ]](/icons/compressed.gif) | Final Report_23-057 (Likambale, Anita) - Budget Files.zip | 2025-05-19 11:05 | 8.6M | |
![[IMG]](/icons/image2.gif) | 2397_EBUN186-19.JPG | 2025-05-19 11:03 | 8.6M | |
![[IMG]](/icons/image2.gif) | 3643_IMG_3107.jpg | 2025-05-19 11:05 | 8.6M | |
![[ ]](/icons/compressed.gif) | GS St Bonaventure Classroom Libraries-final_report-files.zip | 2025-05-19 11:07 | 8.6M | |
![[IMG]](/icons/image2.gif) | 3643_IMG_3030.jpg | 2025-05-19 11:03 | 8.6M | |
![[ ]](/icons/compressed.gif) | Final Report_18-041 (Ba, Amadou) - Budget Files.zip | 2025-05-19 11:04 | 8.7M | |
![[IMG]](/icons/image2.gif) | 5648_20221207141734_IMG_9160.jpg | 2025-05-19 11:03 | 8.7M | |
![[IMG]](/icons/image2.gif) | 2234_IMG_0096.JPG | 2025-05-19 11:04 | 8.8M | |
![[IMG]](/icons/image2.gif) | 2691_P1060763.JPG | 2025-05-19 11:05 | 8.8M | |
![[ ]](/icons/compressed.gif) | 1060_Participants Weekly Meetings - Photos.zip | 2025-05-19 11:03 | 8.8M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_5009.JPG | 2025-05-19 11:05 | 8.9M | |
![[IMG]](/icons/image2.gif) | 2397_Next Gen Female CEO 17.JPG | 2025-05-19 11:03 | 8.9M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_5004.JPG | 2025-05-19 11:05 | 9.0M | |
![[ ]](/icons/compressed.gif) | Final Report_20-131 (Olaosebikan, Kabir ) - Budget Files.zip | 2025-05-19 11:04 | 9.0M | |
![[IMG]](/icons/image2.gif) | 5648_20221207170222_IMG_9339.jpg | 2025-05-19 11:05 | 9.0M | |
![[IMG]](/icons/image2.gif) | 2691_P1050911.JPG | 2025-05-19 11:03 | 9.0M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_5042.JPG | 2025-05-19 11:05 | 9.0M | |
![[ ]](/icons/compressed.gif) | Final Report_18-074 (Sipasi, Olalekan) - Files.zip | 2025-05-19 11:04 | 9.1M | |
![[ ]](/icons/layout.gif) | 3608_0_RECEIPTS KADYALUNDA.pdf | 2025-05-19 11:05 | 9.2M | |
![[ ]](/icons/compressed.gif) | Final Report_18-184 (Nasasara, Benson) - Files.zip | 2025-05-19 11:05 | 9.2M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (36).jpg | 2025-05-19 11:05 | 9.2M | |
![[IMG]](/icons/image2.gif) | 2251_DSC_0234.jpg | 2025-05-19 11:04 | 9.2M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_5000.JPG | 2025-05-19 11:07 | 9.3M | |
![[IMG]](/icons/image2.gif) | 5829_20220115140800_IMG_4018.JPG | 2025-05-19 11:05 | 9.3M | |
![[IMG]](/icons/image2.gif) | 2691_P1040032.JPG | 2025-05-19 11:05 | 9.3M | |
![[IMG]](/icons/image2.gif) | 2251_DSC_0323.jpg | 2025-05-19 11:04 | 9.3M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (35).jpg | 2025-05-19 11:04 | 9.3M | |
![[VID]](/icons/movie.gif) | 6138_VID_20230127_114944.mp4 | 2025-05-19 11:04 | 9.3M | |
![[IMG]](/icons/image2.gif) | 3643_IMG_3096.jpg | 2025-05-19 11:05 | 9.4M | |
![[ ]](/icons/compressed.gif) | Final Report_23-090 (Mathews , Harrison ) - Files.zip | 2025-05-19 11:05 | 9.4M | |
![[ ]](/icons/compressed.gif) | Recycling in Prmet-final_report-files.zip | 2025-05-19 11:03 | 9.4M | |
![[IMG]](/icons/image2.gif) | 2397_Next Gen Female CEO 10.JPG | 2025-05-19 11:05 | 9.4M | |
![[ ]](/icons/compressed.gif) | Final Report_22-091 (Elyse , Irikumwenatwe ) - Files.zip | 2025-05-19 11:07 | 9.4M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_5006.JPG | 2025-05-19 11:07 | 9.4M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_5016.JPG | 2025-05-19 11:05 | 9.4M | |
![[IMG]](/icons/image2.gif) | 2397_Next Gen Female CEO 19.JPG | 2025-05-19 11:05 | 9.4M | |
![[ ]](/icons/compressed.gif) | Final Report_20-020 (Ngwira, Towera) - Files.zip | 2025-05-19 11:06 | 9.5M | |
![[VID]](/icons/movie.gif) | 3730_8af7b903-c791-4dba-bfa3-77c90ca794f2.mp4 | 2025-05-19 11:04 | 9.5M | |
![[VID]](/icons/movie.gif) | 4678_VID-20200502-WA0073.mp4 | 2025-05-19 11:04 | 9.5M | |
![[ ]](/icons/compressed.gif) | Final Report_18-214 (Chilimani, Hector ) - Budget Files.zip | 2025-05-19 11:05 | 9.5M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (34).jpg | 2025-05-19 11:05 | 9.5M | |
![[IMG]](/icons/image2.gif) | 6303_IMG_9167.JPG | 2025-05-19 11:07 | 9.6M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_4914.JPG | 2025-05-19 11:05 | 9.6M | |
![[IMG]](/icons/image2.gif) | 3643_IMG_3086.jpg | 2025-05-19 11:06 | 9.6M | |
![[IMG]](/icons/image2.gif) | 5829_89 (1).jpg | 2025-05-19 11:05 | 9.7M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_4984.JPG | 2025-05-19 11:04 | 9.7M | |
![[VID]](/icons/movie.gif) | 6113_VID-20240820-WA0039.mp4 | 2025-05-19 11:05 | 9.8M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_5026.JPG | 2025-05-19 11:03 | 9.8M | |
![[IMG]](/icons/image2.gif) | 6303_IMG_9211.JPG | 2025-05-19 11:05 | 9.8M | |
![[IMG]](/icons/image2.gif) | 2251_DSC_0107.jpg | 2025-05-19 11:06 | 9.8M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (33).jpg | 2025-05-19 11:04 | 9.8M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_4998.JPG | 2025-05-19 11:03 | 9.9M | |
![[IMG]](/icons/image2.gif) | 2397_Next Gen Female CEO 1.JPG | 2025-05-19 11:03 | 9.9M | |
![[IMG]](/icons/image2.gif) | 5829_89.jpg | 2025-05-19 11:05 | 9.9M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_5041.JPG | 2025-05-19 11:04 | 9.9M | |
![[IMG]](/icons/image2.gif) | 2397_Next Gen Female CEO 20.JPG | 2025-05-19 11:06 | 10M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_4956.JPG | 2025-05-19 11:03 | 10M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_5038.JPG | 2025-05-19 11:04 | 10M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_5034.JPG | 2025-05-19 11:03 | 10M | |
![[IMG]](/icons/image2.gif) | 1021_KW_ZADS_9.jpg | 2025-05-19 11:05 | 10M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_5031.JPG | 2025-05-19 11:07 | 10M | |
![[IMG]](/icons/image2.gif) | 2251_DSC_0176.jpg | 2025-05-19 11:05 | 10M | |
![[ ]](/icons/compressed.gif) | Final Report_19-054 (Ngombo, Caleb ) - Files.zip | 2025-05-19 11:04 | 10M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_5046.JPG | 2025-05-19 11:04 | 10M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_5002.JPG | 2025-05-19 11:03 | 10M | |
![[IMG]](/icons/image2.gif) | 2397_Next Gen Female CEO 3.JPG | 2025-05-19 11:06 | 10M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_5045.JPG | 2025-05-19 11:06 | 10M | |
![[ ]](/icons/unknown.gif) | 5667_Rabbit farming to support teenager mothers at Banda Village.docx | 2025-05-19 11:05 | 10M | |
![[ ]](/icons/compressed.gif) | 7106_SVEAP October meeting .zip | 2025-05-19 11:03 | 10M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_4997.JPG | 2025-05-19 11:04 | 10M | |
![[IMG]](/icons/image2.gif) | 2397_Next Gen Female CEO 11.JPG | 2025-05-19 11:03 | 10M | |
![[IMG]](/icons/image2.gif) | 3971_IMG_1599.JPG | 2025-05-19 11:06 | 10M | |
![[IMG]](/icons/image2.gif) | 2397_Next Gen Female CEO 6.JPG | 2025-05-19 11:03 | 11M | |
![[IMG]](/icons/image2.gif) | 5585_Ngwenya Literacy Hub Project (31).jpg | 2025-05-19 11:03 | 11M | |
![[IMG]](/icons/image2.gif) | 2251_DSC_0268.jpg | 2025-05-19 11:05 | 11M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_5023.JPG | 2025-05-19 11:05 | 11M | |
![[ ]](/icons/compressed.gif) | Final Report_18-070 (Gondwe, Chrissy) - Files.zip | 2025-05-19 11:03 | 11M | |
![[ ]](/icons/compressed.gif) | 7106_SVEAP - July Meeting.zip | 2025-05-19 11:05 | 11M | |
![[VID]](/icons/movie.gif) | 2414_VID-20180601-WA0008.mp4 | 2025-05-19 11:03 | 11M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_4950.JPG | 2025-05-19 11:06 | 11M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_4996.JPG | 2025-05-19 11:03 | 11M | |
![[IMG]](/icons/image2.gif) | 2397_Next Gen Female CEO 4.JPG | 2025-05-19 11:04 | 11M | |
![[ ]](/icons/compressed.gif) | Final Report_17-070 (Francois, Ralph) - Files.zip | 2025-05-19 11:03 | 11M | |
![[IMG]](/icons/image2.gif) | 3643_IMG_3076.jpg | 2025-05-19 11:04 | 11M | |
![[ ]](/icons/compressed.gif) | Final Report_23-117 (Njoka, Tamandani ) - Budget Files.zip | 2025-05-19 11:07 | 11M | |
![[ ]](/icons/compressed.gif) | 7106_SVEAP - June Meeting.zip | 2025-05-19 11:07 | 11M | |
![[IMG]](/icons/image2.gif) | 5829_72.jpg | 2025-05-19 11:03 | 11M | |
![[ ]](/icons/compressed.gif) | Widows Sustainable Vegetable Gardening Project-final_report-files.zip | 2025-05-19 11:05 | 11M | |
![[VID]](/icons/movie.gif) | 7097_IMG_5283.MOV | 2025-05-19 11:05 | 11M | |
![[ ]](/icons/layout.gif) | 2624_fINAL WORLD CONNET NARATIVE REPORT.pdf | 2025-05-19 11:06 | 11M | |
![[ ]](/icons/compressed.gif) | GS Kizibere Library and Resource Center-final_report-files.zip | 2025-05-19 11:05 | 11M | |
![[ ]](/icons/layout.gif) | 7105_TBP Case for Support-2.pdf | 2025-05-19 11:07 | 12M | |
![[ ]](/icons/compressed.gif) | Final Report_19-037 (Mndala, Dalitso) - Budget Files.zip | 2025-05-19 11:03 | 12M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_5036.JPG | 2025-05-19 11:03 | 12M | |
![[IMG]](/icons/image2.gif) | 6825_DSC_5028.JPG | 2025-05-19 11:03 | 12M | |
![[IMG]](/icons/image2.gif) | 3971_IMG_1453.JPG | 2025-05-19 11:05 | 12M | |
![[VID]](/icons/movie.gif) | 6087_WhatsApp Video 2024-06-03 at 8.42.16 AM.mp4 | 2025-05-19 11:03 | 12M | |
![[IMG]](/icons/image2.gif) | 5829_71.jpg | 2025-05-19 11:04 | 12M | |
![[ ]](/icons/compressed.gif) | Women of Business-final_report-files.zip | 2025-05-19 11:03 | 12M | |
![[ ]](/icons/compressed.gif) | RISE Diversity Camp Respecting Individuality and Striving for Equality-final_report-files.zip | 2025-05-19 11:05 | 12M | |
![[VID]](/icons/movie.gif) | 5603_VID-20230409-WA0064.mp4 | 2025-05-19 11:04 | 12M | |
![[IMG]](/icons/image2.gif) | 5829_78.jpg | 2025-05-19 11:05 | 12M | |
![[IMG]](/icons/image2.gif) | 5829_88 (2).jpg | 2025-05-19 11:03 | 12M | |
![[IMG]](/icons/image2.gif) | 5829_88.jpg | 2025-05-19 11:03 | 12M | |
![[IMG]](/icons/image2.gif) | 2251_DSC_0284.jpg | 2025-05-19 11:04 | 12M | |
![[VID]](/icons/movie.gif) | 6104_VID-20210920-WA0038.mp4 | 2025-05-19 11:04 | 12M | |
![[IMG]](/icons/image2.gif) | 5829_82.jpg | 2025-05-19 11:05 | 12M | |
![[ ]](/icons/compressed.gif) | 7106_SVEAP September meeting .zip | 2025-05-19 11:03 | 12M | |
![[IMG]](/icons/image2.gif) | 1401_IMG_4687.jpg | 2025-05-19 11:04 | 12M | |
![[ ]](/icons/compressed.gif) | Healthy Households-final_report-files.zip | 2025-05-19 11:05 | 12M | |
![[IMG]](/icons/image2.gif) | 5829_77.jpg | 2025-05-19 11:05 | 12M | |
![[ ]](/icons/compressed.gif) | Final Report_20-109 (Chibaka, Chifundo ) - Budget Files.zip | 2025-05-19 11:07 | 12M | |
![[VID]](/icons/movie.gif) | 4787_Carmen Carcelen Video.mp4 | 2025-05-19 11:03 | 12M | |
![[IMG]](/icons/image2.gif) | 5829_79.jpg | 2025-05-19 11:06 | 13M | |
![[ ]](/icons/compressed.gif) | Final Report_18-001 (Ebai Enow, Oben) - Files.zip | 2025-05-19 11:05 | 13M | |
![[ ]](/icons/compressed.gif) | Final Report_22-044 (Majomeka, Boyson ) - Files.zip | 2025-05-19 11:05 | 13M | |
![[ ]](/icons/compressed.gif) | Doctor Housing-final_report-files.zip | 2025-05-19 11:05 | 13M | |
![[IMG]](/icons/image2.gif) | 3971_IMG_1235.JPG | 2025-05-19 11:05 | 13M | |
![[IMG]](/icons/image2.gif) | 5829_79 (1).jpg | 2025-05-19 11:03 | 13M | |
![[ ]](/icons/compressed.gif) | 7106_SVEAP - Day 4.zip | 2025-05-19 11:03 | 13M | |
![[VID]](/icons/movie.gif) | 2614_SoapVid.mp4 | 2025-05-19 11:05 | 13M | |
![[ ]](/icons/compressed.gif) | 7106_SVEAP - August Meeting- English .zip | 2025-05-19 11:03 | 13M | |
![[ ]](/icons/layout.gif) | 2115_World Connect Accerelatpor Grants Report.pdf | 2025-05-19 11:03 | 13M | |
![[VID]](/icons/movie.gif) | 3208_VID-20200204-WA0010.mp4 | 2025-05-19 11:04 | 13M | |
![[IMG]](/icons/image2.gif) | 3971_IMG_1558.JPG | 2025-05-19 11:07 | 13M | |
![[IMG]](/icons/image2.gif) | 3971_IMG_1584.JPG | 2025-05-19 11:06 | 13M | |
![[ ]](/icons/compressed.gif) | Final Report_19-002 (Aazco, Alcira) - Budget Files.zip | 2025-05-19 11:06 | 13M | |
![[ ]](/icons/compressed.gif) | World Connect Grant Literacy Outreach Through Childrens Stories and Supplementary Materials-final_report-files.zip | 2025-05-19 11:03 | 13M | |
![[ ]](/icons/compressed.gif) | Protecting Women and Children from Illness through Community Education and Construction of Latrines-final_report-files.zip | 2025-05-19 11:04 | 14M | |
![[ ]](/icons/layout.gif) | 5667_ubworozi_bw_inkwavu.pdf | 2025-05-19 11:03 | 14M | |
![[ ]](/icons/compressed.gif) | Final Report_20-033 (KANYESIGYE, Rhoda) - Budget Files.zip | 2025-05-19 11:05 | 14M | |
![[ ]](/icons/compressed.gif) | Dada Ventures -final_report-files.zip | 2025-05-19 11:06 | 14M | |
![[IMG]](/icons/image2.gif) | 3971_IMG_0983.JPG | 2025-05-19 11:03 | 14M | |
![[ ]](/icons/compressed.gif) | Final Report_20-084 (Kaliati, Dumisani) - Budget Files.zip | 2025-05-19 11:05 | 14M | |
![[ ]](/icons/compressed.gif) | Early Childhood Education Center and Adult Literacy-final_report-files.zip | 2025-05-19 11:03 | 14M | |
![[VID]](/icons/movie.gif) | 5792_VID-20221203-WA0007.mp4 | 2025-05-19 11:04 | 14M | |
![[ ]](/icons/compressed.gif) | 1060_December Training - Photos.zip | 2025-05-19 11:05 | 14M | |
![[IMG]](/icons/image2.gif) | 3971_IMG_1573.JPG | 2025-05-19 11:05 | 14M | |
![[ ]](/icons/compressed.gif) | Families Growing Positively-final_report-files.zip | 2025-05-19 11:05 | 14M | |
![[VID]](/icons/movie.gif) | 3730_3a63855b-8950-4b07-a3ea-6ff00b94c608.mp4 | 2025-05-19 11:05 | 14M | |
![[IMG]](/icons/image2.gif) | 3971_IMG_1577.JPG | 2025-05-19 11:03 | 14M | |
![[IMG]](/icons/image2.gif) | 3643_IMG_3018.jpg | 2025-05-19 11:05 | 14M | |
![[IMG]](/icons/image2.gif) | 3643_IMG_3177.jpg | 2025-05-19 11:05 | 14M | |
![[IMG]](/icons/image2.gif) | 822_frequenciesgroup.png | 2025-05-19 11:04 | 15M | |
![[IMG]](/icons/image2.gif) | 3971_IMG_0932.JPG | 2025-05-19 11:03 | 15M | |
![[IMG]](/icons/image2.gif) | 3971_IMG_1536.JPG | 2025-05-19 11:07 | 15M | |
![[VID]](/icons/movie.gif) | 3730_4b4e55fd-06ee-4413-a854-f4be6fcb369b.mp4 | 2025-05-19 11:06 | 15M | |
![[IMG]](/icons/image2.gif) | 3971_IMG_1029.JPG | 2025-05-19 11:05 | 15M | |
![[ ]](/icons/compressed.gif) | Final Report_19-060 (Salijeni, Geoffrey) - Budget Files.zip | 2025-05-19 11:03 | 15M | |
![[ ]](/icons/compressed.gif) | Final Report_19-113 (Mwambila, Fransisco) - Budget Files.zip | 2025-05-19 11:04 | 15M | |
![[ ]](/icons/compressed.gif) | Final Report_22-084 (UWIMANA, Claude) - Files.zip | 2025-05-19 11:04 | 16M | |
![[ ]](/icons/compressed.gif) | The Durres Media Project-final_report-files.zip | 2025-05-19 11:04 | 16M | |
![[VID]](/icons/movie.gif) | 2397_The Next Generation Female CEO Video.mp4 | 2025-05-19 11:03 | 16M | |
![[VID]](/icons/movie.gif) | 6710_2024-07-21 at 19.02.09_6551aa75.mp4 | 2025-05-19 11:05 | 16M | |
![[ ]](/icons/compressed.gif) | Inclusive Learning Environments for Marginalized Girls-final_report-files.zip | 2025-05-19 11:04 | 16M | |
![[ ]](/icons/compressed.gif) | Creating Jobs and Cleaning up Birkelane-final_report-files.zip | 2025-05-19 11:03 | 16M | |
![[IMG]](/icons/image2.gif) | 3971_IMG_0999.JPG | 2025-05-19 11:03 | 16M | |
![[ ]](/icons/compressed.gif) | Final Report_18-156 (Gerson, Jacqueline) - Files.zip | 2025-05-19 11:04 | 16M | |
![[ ]](/icons/unknown.gif) | 3262_Mercury project pictures.docx | 2025-05-19 11:03 | 17M | |
![[ ]](/icons/compressed.gif) | Final Report_23-042 (CHIMOSOLA, REUEL ) - Files.zip | 2025-05-19 11:03 | 17M | |
![[VID]](/icons/movie.gif) | 1026_20160802_121107_106635343478517.mp4 | 2025-05-19 11:07 | 17M | |
![[ ]](/icons/compressed.gif) | Recycling Education for Kids in Monterrey de San Carlos Costa Rica-final_report-files.zip | 2025-05-19 11:06 | 17M | |
![[ ]](/icons/layout.gif) | 1312_Yaeger_Mnyigumba_SuccessStory_June2017.pdf | 2025-05-19 11:05 | 17M | |
![[ ]](/icons/compressed.gif) | Eco Bank of Jordan National High school-final_report-files.zip | 2025-05-19 11:06 | 17M | |
![[ ]](/icons/compressed.gif) | Health Hut Additions-final_report-files.zip | 2025-05-19 11:05 | 17M | |
![[ ]](/icons/compressed.gif) | Mboula Womens Group Garden-final_report-files.zip | 2025-05-19 11:05 | 17M | |
![[ ]](/icons/compressed.gif) | Final Report_19-170 (Kyamilhando, Kunegonda) - Budget Files.zip | 2025-05-19 11:03 | 17M | |
![[ ]](/icons/compressed.gif) | Final Report_19-251 (Bekui, Benedict) - Budget Files.zip | 2025-05-19 11:03 | 17M | |
![[ ]](/icons/layout.gif) | 7106_SVEAP - Day 1.pdf | 2025-05-19 11:03 | 18M | |
![[IMG]](/icons/image2.gif) | 3971_IMG_1003.JPG | 2025-05-19 11:05 | 18M | |
![[ ]](/icons/compressed.gif) | Final Report_17-099 (Kalinga, Brighton) - Files.zip | 2025-05-19 11:03 | 18M | |
![[ ]](/icons/compressed.gif) | Mushroom Growing in Ubungo-final_report-files.zip | 2025-05-19 11:04 | 18M | |
![[ ]](/icons/compressed.gif) | 7106_SVEAP - Day 2.zip | 2025-05-19 11:04 | 18M | |
![[IMG]](/icons/image2.gif) | 3971_IMG_1640.JPG | 2025-05-19 11:05 | 18M | |
![[ ]](/icons/compressed.gif) | Final Report_18-089 (Mvula, January) - Files.zip | 2025-05-19 11:07 | 19M | |
![[ ]](/icons/compressed.gif) | Final Report_18-033 (Truong, Tammy) - Budget Files.zip | 2025-05-19 11:05 | 19M | |
![[ ]](/icons/compressed.gif) | Final Report_20-097 (Chabuka, Sylvester ) - Budget Files.zip | 2025-05-19 11:03 | 19M | |
![[ ]](/icons/compressed.gif) | Ramping Up Youth Engagement in Kuks-final_report-files.zip | 2025-05-19 11:05 | 19M | |
![[ ]](/icons/compressed.gif) | Final Report_18-090 (Kondowe, Ulala) - Files.zip | 2025-05-19 11:03 | 19M | |
![[ ]](/icons/compressed.gif) | Final Report_19-044 (Choi, Jane) - Files.zip | 2025-05-19 11:05 | 19M | |
![[ ]](/icons/compressed.gif) | Final Report_23-017 (, ) - Files.zip | 2025-05-19 11:03 | 19M | |
![[ ]](/icons/compressed.gif) | Final Report_18-108 (Kunkeyani, Silvester) - Budget Files.zip | 2025-05-19 11:04 | 19M | |
![[IMG]](/icons/image2.gif) | 1277_tarp.jpg | 2025-05-19 11:07 | 19M | |
![[IMG]](/icons/image2.gif) | 3971_IMG_1468.JPG | 2025-05-19 11:03 | 20M | |
![[ ]](/icons/compressed.gif) | Final Report_21-021 (Kyamilhando, Kunegonda) - Files.zip | 2025-05-19 11:03 | 20M | |
![[VID]](/icons/movie.gif) | 4678_VID-20200501-WA0048.mp4 | 2025-05-19 11:03 | 20M | |
![[VID]](/icons/movie.gif) | 1303_IMG_0277.MOV | 2025-05-19 11:03 | 20M | |
![[ ]](/icons/compressed.gif) | 1060_Award Ceremony Photos .zip | 2025-05-19 11:04 | 20M | |
![[ ]](/icons/compressed.gif) | Final Report_18-051 (Olaosebikan, Abdul Lateef) - Files.zip | 2025-05-19 11:03 | 20M | |
![[ ]](/icons/compressed.gif) | 7106_SVEAP - Day 3.zip | 2025-05-19 11:05 | 20M | |
![[VID]](/icons/movie.gif) | 7286_VID-20250510-WA0003.mp4 | 2025-06-27 09:21 | 20M | |
![[ ]](/icons/compressed.gif) | 865_Morocco-Sidi Slimane CLIMB World Connect-Marc Galloway.bak.zip | 2025-05-19 11:03 | 20M | |
![[ ]](/icons/compressed.gif) | 865_Morocco-Sidi Slimane CLIMB World Connect-Marc Galloway.zip | 2025-05-19 11:05 | 20M | |
![[ ]](/icons/compressed.gif) | Final Report_18-166 (Katungwe, Noriah) - Files.zip | 2025-05-19 11:05 | 21M | |
![[ ]](/icons/compressed.gif) | Final Report_18-029 (Dwyer, Bryan) - Files.zip | 2025-05-19 11:03 | 21M | |
![[VID]](/icons/movie.gif) | 3685_Justin Women Singing During Borehole Drilling.mp4 | 2025-05-19 11:03 | 21M | |
![[ ]](/icons/compressed.gif) | San Vicente Youth Disaster Risk Reduction Training-final_report-files.zip | 2025-05-19 11:07 | 22M | |
![[ ]](/icons/compressed.gif) | Final Report_19-035 (Kamlopa , Chisomo) - Files.zip | 2025-05-19 11:06 | 22M | |
![[ ]](/icons/compressed.gif) | Final Report_20-142 (NDAYAMBAJE, Jerome) - Budget Files.zip | 2025-05-19 11:04 | 22M | |
![[ ]](/icons/compressed.gif) | Womens Soap Collective -final_report-files.zip | 2025-05-19 11:05 | 22M | |
![[ ]](/icons/compressed.gif) | Final Report_23-057 (Likambale, Anita) - Files.zip | 2025-05-19 11:03 | 22M | |
![[VID]](/icons/movie.gif) | 2870_MVI_4572.mp4 | 2025-05-19 11:05 | 23M | |
![[ ]](/icons/compressed.gif) | Final Report_18-214 (Chilimani, Hector ) - Files.zip | 2025-05-19 11:03 | 24M | |
![[ ]](/icons/compressed.gif) | Final Report_18-062 (Jean, Johnny) - Budget Files.zip | 2025-05-19 11:04 | 24M | |
![[ ]](/icons/compressed.gif) | Light Up Vista Alegre-final_report-files.zip | 2025-05-19 11:05 | 24M | |
![[VID]](/icons/movie.gif) | 4678_VID-20200502-WA0074.mp4 | 2025-05-19 11:05 | 24M | |
![[ ]](/icons/compressed.gif) | Get a Pap Campaign-final_report-files.zip | 2025-05-19 11:05 | 25M | |
![[ ]](/icons/compressed.gif) | Final Report_19-004 (Chipala, Hussein) - Files.zip | 2025-05-19 11:03 | 25M | |
![[VID]](/icons/movie.gif) | 7097_IMG_5363.MOV | 2025-05-19 11:03 | 25M | |
![[ ]](/icons/compressed.gif) | Mnyamata Tree Initiative -final_report-files.zip | 2025-05-19 11:04 | 25M | |
![[ ]](/icons/compressed.gif) | Caticugan Fisherfolk Ecotourism-final_report-files.zip | 2025-05-19 11:05 | 26M | |
![[ ]](/icons/compressed.gif) | Final Report_22-077 (Nsanzamahoro, Polycarpe) - Files.zip | 2025-05-19 11:03 | 26M | |
![[VID]](/icons/movie.gif) | 4524_Hm-1.mp4 | 2025-05-19 11:04 | 26M | |
![[ ]](/icons/compressed.gif) | VICCAFIN Project-final_report-files.zip | 2025-05-19 11:04 | 26M | |
![[ ]](/icons/compressed.gif) | 100 FoutaSourced Thille Boubacar Chicken Coop-final_report-files.zip | 2025-05-19 11:04 | 27M | |
![[ ]](/icons/compressed.gif) | Improved Cookstoves For the Cure of Respiratory Illnesses and Care for the Community Environment-final_report-files.zip | 2025-05-19 11:03 | 27M | |
![[VID]](/icons/movie.gif) | 6948_WhatsApp Video 2025-01-07 at 19.11.43.mp4 | 2025-05-19 11:05 | 27M | |
![[ ]](/icons/compressed.gif) | Final Report_19-215 (Ijadunola, Elizabeth) - Budget Files.zip | 2025-05-19 11:03 | 27M | |
![[VID]](/icons/movie.gif) | 6299_Mzee Serwimo testifying how pig manure helped increase in yield.mp4 | 2025-05-19 11:05 | 28M | |
![[ ]](/icons/compressed.gif) | Final Report_19-024 (Nyirenda, Elias) - Files.zip | 2025-05-19 11:06 | 28M | |
![[ ]](/icons/compressed.gif) | Final Report_17-069 (Charles, Daphnee) - Files.zip | 2025-05-19 11:04 | 28M | |
![[ ]](/icons/compressed.gif) | Final Report_19-200 (Kambuzi, Wangiwe) - Budget Files.zip | 2025-05-19 11:06 | 28M | |
![[VID]](/icons/movie.gif) | 1658_Ecuador Education Hepting ARP Education Program Report Aug 2017.mp4 | 2025-05-19 11:05 | 29M | |
![[VID]](/icons/movie.gif) | 3774_WhatsApp Video 2020-07-28 at 14.51.05.mp4 | 2025-05-19 11:06 | 29M | |
![[ ]](/icons/compressed.gif) | Final Report_18-104 (Khunguni, Virginia) - Files.zip | 2025-05-19 11:07 | 29M | |
![[ ]](/icons/compressed.gif) | Final Report_23-064 (AMEKUDI, ANGELA) - Files.zip | 2025-05-19 11:06 | 30M | |
![[ ]](/icons/compressed.gif) | Final Report_21-072 (Kambuzi, Wangiwe ) - Files.zip | 2025-05-19 11:03 | 31M | |
![[ ]](/icons/compressed.gif) | Community Mobilization to Improving Sanitation and Installations of Latrines-final_report-files.zip | 2025-05-19 11:05 | 31M | |
![[VID]](/icons/movie.gif) | 7286_VID-20250509-WA0013.mp4 | 2025-06-27 10:11 | 32M | |
![[VID]](/icons/movie.gif) | 2329_VID_20171006_094550.mp4 | 2025-05-19 11:03 | 32M | |
![[ ]](/icons/compressed.gif) | Creating safe spaces Improving the learning environment in Senegal-final_report-files.zip | 2025-05-19 11:04 | 32M | |
![[ ]](/icons/compressed.gif) | Final Report_22-078 (Mutatsineza, Jean Paulin) - Files.zip | 2025-05-19 11:06 | 32M | |
![[ ]](/icons/compressed.gif) | Revitalizing the Community Center of Sabana Larga-final_report-files.zip | 2025-05-19 11:05 | 33M | |
![[VID]](/icons/movie.gif) | 3730_d68d18c7-606c-4444-8fd9-94daaa07637d.mp4 | 2025-05-19 11:06 | 33M | |
![[ ]](/icons/compressed.gif) | Final Report_18-189 (Kankuzi, Alfred) - Files.zip | 2025-05-19 11:04 | 33M | |
![[ ]](/icons/compressed.gif) | Final Report_20-048 (Agunloye, Jennifer) - Files.zip | 2025-05-19 11:03 | 33M | |
![[ ]](/icons/compressed.gif) | The Girls Room-final_report-files.zip | 2025-05-19 11:04 | 33M | |
![[ ]](/icons/compressed.gif) | Reproductive Health Outreach in Librazhd Villages-final_report-files.zip | 2025-05-19 11:05 | 33M | |
![[VID]](/icons/movie.gif) | 1303_IMG_0368.MOV | 2025-05-19 11:04 | 34M | |
![[ ]](/icons/compressed.gif) | People Helping People Latrine Project-final_report-files.zip | 2025-05-19 11:05 | 34M | |
![[ ]](/icons/compressed.gif) | Final Report_19-247 (Abdulai, Fati) - Budget Files.zip | 2025-05-19 11:05 | 34M | |
![[ ]](/icons/compressed.gif) | Final Report_20-136 (Ayodele, Wuraoluwa) - Budget Files.zip | 2025-05-19 11:03 | 35M | |
![[ ]](/icons/compressed.gif) | Nursery School Renovations-final_report-files.zip | 2025-05-19 11:03 | 35M | |
![[ ]](/icons/layout.gif) | 2134_Catalog_Final_Export.pdf | 2025-05-19 11:05 | 35M | |
![[VID]](/icons/movie.gif) | 1006_IMG_1621.MOV | 2025-05-19 11:05 | 37M | |
![[ ]](/icons/compressed.gif) | Velingara Koto Health Post Maternity Ward-final_report-files.zip | 2025-05-19 11:05 | 38M | |
![[VID]](/icons/movie.gif) | 3208_VID-20200206-WA0009.mp4 | 2025-05-19 11:05 | 38M | |
![[VID]](/icons/movie.gif) | 1013_IMG_3826.MOV | 2025-05-19 11:03 | 38M | |
![[ ]](/icons/unknown.gif) | 3291_benard @testmonials.docx | 2025-05-19 11:06 | 38M | |
![[VID]](/icons/movie.gif) | 5663_Teachers soap.mp4 | 2025-05-19 11:04 | 38M | |
![[ ]](/icons/compressed.gif) | Final Report_18-177 (Mwasinga, Elina) - Files.zip | 2025-05-19 11:04 | 39M | |
![[ ]](/icons/compressed.gif) | Artisanal Fabric-final_report-files.zip | 2025-05-19 11:03 | 39M | |
![[ ]](/icons/compressed.gif) | Final Report_18-101 (Silungwe, Patience) - Files.zip | 2025-05-19 11:03 | 39M | |
![[ ]](/icons/layout.gif) | 7106_SVEAP-November meeting.pdf | 2025-05-19 11:05 | 40M | |
![[ ]](/icons/compressed.gif) | Final Report_18-041 (Ba, Amadou) - Files.zip | 2025-05-19 11:05 | 40M | |
![[VID]](/icons/movie.gif) | 3979_SESEWA FEMALE CEOs 2020.mp4 | 2025-05-19 11:06 | 40M | |
![[VID]](/icons/movie.gif) | 6138_VID_20230125_182622.mp4 | 2025-05-19 11:03 | 40M | |
![[ ]](/icons/compressed.gif) | Final Report_23-058 (Chisale, Gibson ) - Files.zip | 2025-05-19 11:05 | 41M | |
![[ ]](/icons/compressed.gif) | Final Report_19-123 (Ngambi, Gomezgan) - Files.zip | 2025-05-19 11:04 | 41M | |
![[VID]](/icons/movie.gif) | 4524_Parent-1.mp4 | 2025-05-19 11:04 | 41M | |
![[VID]](/icons/movie.gif) | 6138_VID_20230126_130741.mp4 | 2025-05-19 11:04 | 42M | |
![[ ]](/icons/compressed.gif) | Water For Sukamahela-final_report-files.zip | 2025-05-19 11:04 | 42M | |
![[VID]](/icons/movie.gif) | 3594_20200303_134839.mp4 | 2025-05-19 11:07 | 42M | |
![[ ]](/icons/compressed.gif) | Final Report_22-047 (Katsala, Joseph) - Files.zip | 2025-05-19 11:03 | 43M | |
![[ ]](/icons/compressed.gif) | Katumba Songwe Secondary School Dormitory Project-final_report-files.zip | 2025-05-19 11:03 | 43M | |
![[ ]](/icons/unknown.gif) | 3292_All testimonials.docx | 2025-05-19 11:05 | 43M | |
![[VID]](/icons/movie.gif) | 2097_IMG_0670.MOV | 2025-05-19 11:05 | 44M | |
![[ ]](/icons/compressed.gif) | Final Report_22-058 (ChimphoyoBanda, Eunice) - Files.zip | 2025-05-19 11:04 | 44M | |
![[VID]](/icons/movie.gif) | 6531_Activity video.mp4 | 2025-05-19 11:04 | 47M | |
![[ ]](/icons/layout.gif) | 7106__SVEAP-December meeting.pdf | 2025-05-19 11:04 | 48M | |
![[ ]](/icons/compressed.gif) | Keur Mandoumbe School Wall -final_report-files.zip | 2025-05-19 11:03 | 50M | |
![[ ]](/icons/compressed.gif) | Diakhaba Elementary School Solar Panel Project-final_report-files.zip | 2025-05-19 11:05 | 50M | |
![[ ]](/icons/compressed.gif) | Bumba Womens Bakery-final_report-files.zip | 2025-05-19 11:03 | 52M | |
![[ ]](/icons/compressed.gif) | Advancing Educational Opportunities in the Ecuadorian Amazon-final_report-files.zip | 2025-05-19 11:07 | 54M | |
![[ ]](/icons/compressed.gif) | Final Report_15-157 (Moser, Bonnie) - Files.zip | 2025-05-19 11:03 | 55M | |
![[ ]](/icons/compressed.gif) | Final Report_21-016 (Bekui, Benedict) - Files.zip | 2025-05-19 11:04 | 55M | |
![[VID]](/icons/movie.gif) | 3208_VID-20200205-WA0002.mp4 | 2025-05-19 11:03 | 55M | |
![[ ]](/icons/compressed.gif) | Bisongo Wall-final_report-files.zip | 2025-05-19 11:03 | 55M | |
![[ ]](/icons/compressed.gif) | ELECTRICITY INSTALLATION PROJECT WORLD CONNECT MNAZI RURAL HEALTH CENTER AND MNAZI SECONDARY SCHOOL-final_report-files.zip | 2025-05-19 11:04 | 55M | |
![[ ]](/icons/compressed.gif) | SOS Low Ropes Course-final_report-files.zip | 2025-05-19 11:06 | 56M | |
![[ ]](/icons/compressed.gif) | The ENews Citizen Lab-final_report-files.zip | 2025-05-19 11:05 | 57M | |
![[ ]](/icons/compressed.gif) | Final Report_19-103 (chenjezi, cannon) - Files.zip | 2025-05-19 11:03 | 60M | |
![[ ]](/icons/compressed.gif) | Community EcoStoves Promoting Healthier Households and a Healthier Environment World Connect-final_report-files.zip | 2025-05-19 11:03 | 61M | |
![[ ]](/icons/compressed.gif) | RISE Camp Respecting Individuality and Striving for Equality-final_report-files.zip | 2025-05-19 11:03 | 61M | |
![[ ]](/icons/compressed.gif) | Final Report_23-113 (Mhone, Sytone) - Files.zip | 2025-05-19 11:03 | 63M | |
![[ ]](/icons/compressed.gif) | Creating a Space for Learning-final_report-files.zip | 2025-05-19 11:05 | 64M | |
![[ ]](/icons/compressed.gif) | Lighting Up Teria Nacimiento-final_report-files.zip | 2025-05-19 11:03 | 64M | |
![[ ]](/icons/compressed.gif) | RentToOwn Solar Devices for Farmer and Fisherfolk Organization-final_report-files.zip | 2025-05-19 11:04 | 64M | |
![[ ]](/icons/compressed.gif) | Final Report_23-112 (Mwabanga, Rev Rockin) - Files.zip | 2025-05-19 11:07 | 65M | |
![[ ]](/icons/compressed.gif) | Digital Summer Academy DSA-final_report-files.zip | 2025-05-19 11:04 | 65M | |
![[ ]](/icons/compressed.gif) | Final Report_18-033 (Truong, Tammy) - Files.zip | 2025-05-19 11:03 | 65M | |
![[VID]](/icons/movie.gif) | 912_MVI_0016.MP4 | 2025-05-19 11:05 | 71M | |
![[ ]](/icons/compressed.gif) | Bathroom Construction and Hygiene Education in Peru Phase 1-final_report-files.zip | 2025-05-19 11:05 | 71M | |
![[VID]](/icons/movie.gif) | 3552_Milling at Kandulu Maize Mill Project.mp4 | 2025-05-19 11:04 | 71M | |
![[VID]](/icons/movie.gif) | 6531_Testimony video.mp4 | 2025-05-19 11:03 | 73M | |
![[VID]](/icons/movie.gif) | 2589_Fish Game.MOV | 2025-05-19 11:04 | 73M | |
![[ ]](/icons/compressed.gif) | Final Report_19-090 (Gondwe, Chancy ) - Files.zip | 2025-05-19 11:04 | 75M | |
![[ ]](/icons/compressed.gif) | A Likely Story Library-final_report-files.zip | 2025-05-19 11:03 | 75M | |
![[VID]](/icons/movie.gif) | 3643_The road to Wuring Kunda.MP4 | 2025-05-19 11:03 | 85M | |
![[ ]](/icons/compressed.gif) | Final Report_19-036 (Nzima, Chimwemwe ) - Files.zip | 2025-05-19 11:03 | 87M | |
![[ ]](/icons/compressed.gif) | Khmer Arts Revival Program-final_report-files.zip | 2025-05-19 11:06 | 88M | |
![[ ]](/icons/compressed.gif) | Final Report_18-064 (Mutiu, Damilola) - Files.zip | 2025-05-19 11:07 | 88M | |
![[VID]](/icons/movie.gif) | 5582_MVI_2831.MP4 | 2025-05-19 11:03 | 88M | |
![[ ]](/icons/compressed.gif) | Final Report_21-074 (Chipekwe, Madalitso) - Files.zip | 2025-05-19 11:03 | 91M | |
![[ ]](/icons/compressed.gif) | 3730_Photos.zip | 2025-05-19 11:04 | 92M | |
![[VID]](/icons/movie.gif) | 4713_Mwayiwawo Tchete appreciating a Well at Chaseta.mp4 | 2025-05-19 11:04 | 97M | |
![[VID]](/icons/movie.gif) | 2589_Fish Game 1.MOV | 2025-05-19 11:04 | 98M | |
![[ ]](/icons/compressed.gif) | Final Report_22-117 (Knott, Alexandra) - Files.zip | 2025-05-19 11:05 | 98M | |
![[VID]](/icons/movie.gif) | 3193_VID_20190711_110615.mp4 | 2025-05-19 11:06 | 101M | |
![[VID]](/icons/movie.gif) | 2589_BD Fish Game R2.MOV | 2025-05-19 11:05 | 101M | |
![[VID]](/icons/movie.gif) | 2589_BD Fish Game R3.MOV | 2025-05-19 11:05 | 101M | |
![[ ]](/icons/compressed.gif) | Final Report_23-186 (Gallegos, Norma) - Files.zip | 2025-05-19 11:05 | 106M | |
![[ ]](/icons/compressed.gif) | Final Report_18-180 (Kasanga, Gift) - Files.zip | 2025-05-19 11:04 | 106M | |
![[VID]](/icons/movie.gif) | 2589_BD Fish Game R4.MOV | 2025-05-19 11:05 | 111M | |
![[ ]](/icons/compressed.gif) | Final Report_20-028 (MTHULULA, HAPPY) - Files.zip | 2025-05-19 11:05 | 113M | |
![[VID]](/icons/movie.gif) | 2589_Fish Game MPA.MOV | 2025-05-19 11:04 | 114M | |
![[ ]](/icons/compressed.gif) | Final Report_19-188 (Kamoto, Arthur) - Budget Files.zip | 2025-05-19 11:03 | 114M | |
![[VID]](/icons/movie.gif) | 2850_World Connect_Durian.mp4 | 2025-05-19 11:04 | 119M | |
![[ ]](/icons/compressed.gif) | Final Report_18-177 (Mwasinga, Elina) - Budget Files.zip | 2025-05-19 11:04 | 120M | |
![[VID]](/icons/movie.gif) | 3193_VID_20190710_110921.mp4 | 2025-05-19 11:04 | 121M | |
![[ ]](/icons/compressed.gif) | 2798_StopPneumonia Pictures (2).zip | 2025-05-19 11:04 | 121M | |
![[VID]](/icons/movie.gif) | 6948_EMPOWERHER MPACT .mp4 | 2025-05-19 11:03 | 132M | |
![[ ]](/icons/compressed.gif) | Final Report_18-167 (Adeoye, Adekunbi) - Files.zip | 2025-05-19 11:06 | 139M | |
![[ ]](/icons/compressed.gif) | Final Report_19-088 (Silungwe Khembo, Patience) - Budget Files.zip | 2025-05-19 11:05 | 141M | |
![[ ]](/icons/compressed.gif) | 100 Family Latrines and Hand Washing Stations in Kazaboua-final_report-files.zip | 2025-05-19 11:04 | 146M | |
![[ ]](/icons/compressed.gif) | Ticos on Blades-final_report-files.zip | 2025-05-19 11:05 | 146M | |
![[ ]](/icons/compressed.gif) | Final Report_19-058 (Makunganya, Siyaphera) - Files.zip | 2025-05-19 11:03 | 147M | |
![[VID]](/icons/movie.gif) | 6625_VID_20231111_121625.mp4 | 2025-05-19 11:04 | 158M | |
![[ ]](/icons/compressed.gif) | Final Report_20-043 (Kaponda, Francis) - Files.zip | 2025-05-19 11:04 | 161M | |
![[ ]](/icons/compressed.gif) | Final Report_23-043 (MHANGO, JAILOS) - Files.zip | 2025-05-19 11:05 | 173M | |
![[ ]](/icons/compressed.gif) | 6976_IZERE Home visits-20250106T144659Z-001.zip | 2025-05-19 11:07 | 192M | |
![[ ]](/icons/compressed.gif) | Final Report_19-070 (Holubecki, Matt) - Files.zip | 2025-05-19 11:05 | 192M | |
![[VID]](/icons/movie.gif) | 6843_ASHAKE FOUNDATION .MP4 | 2025-05-19 11:03 | 196M | |
![[ ]](/icons/compressed.gif) | ES Bisesero Sportsground-final_report-files.zip | 2025-05-19 11:03 | 203M | |
![[ ]](/icons/compressed.gif) | Final Report_19-072 (McConnell, Michael) - Files.zip | 2025-05-19 11:04 | 208M | |
![[ ]](/icons/compressed.gif) | Final Report_18-052 (Tony, Joy) - Files.zip | 2025-05-19 11:05 | 213M | |
![[ ]](/icons/compressed.gif) | Poverty Alleviation 20 Getting Out and Staying Out-final_report-files.zip | 2025-05-19 11:04 | 216M | |
![[ ]](/icons/compressed.gif) | Final Report_18-139 (Luteli, Damian) - Files.zip | 2025-05-19 11:06 | 225M | |
![[ ]](/icons/compressed.gif) | Final Report_22-046 (Kaundama, Jolex) - Files.zip | 2025-05-19 11:06 | 246M | |
![[ ]](/icons/compressed.gif) | Final Report_23-128 (Bello, Aisha) - Files.zip | 2025-05-19 11:05 | 247M | |
![[ ]](/icons/compressed.gif) | Final Report_18-188 (Maliro, Dorcas) - Files.zip | 2025-05-19 11:04 | 319M | |
![[ ]](/icons/compressed.gif) | Strengthening a Marine Sanctuary to Revitalize a Fisherfolk Community-final_report-files.zip | 2025-05-19 11:03 | 323M | |
![[ ]](/icons/compressed.gif) | Final Report_18-195 (Nsona, Vanessa) - Budget Files.zip | 2025-05-19 11:06 | 363M | |
![[ ]](/icons/compressed.gif) | EcoFriendly Schoolyards-final_report-files.zip | 2025-05-19 11:03 | 501M | |
![[VID]](/icons/movie.gif) | 6825_FINANCE FOR SAFETY PROJECT, 2024.mp4 | 2025-05-19 11:04 | 675M | |
|